summaryrefslogtreecommitdiffstats
path: root/libvo
Commit message (Expand)AuthorAgeFilesLines
* fix missing event on move that breaks xmga window movementattila2009-06-191-1/+2
* enable fontconfig support by default. This change takes only in effect,siretart2009-06-171-1/+1
* When used with shared_buffer, there's no need for a NSApp object, which cause...adrian2009-05-181-4/+6
* When used with shared_buffer, autorelease in each flip_page so objects don't ...adrian2009-05-181-2/+4
* whitespace cosmetics: Remove all trailing whitespace.diego2009-05-1358-1288/+1288
* Do not use flag CWBackPixel when calling vo_x11_create_vo_window():cehoyos2009-05-081-1/+3
* Add missing 'void' to parameterless function declarations.diego2009-05-046-18/+18
* Rename macosx video output driver to corevideo.diego2009-05-043-21/+21
* Replace QuickTime.h #include with Carbon.h, which is really needed.diego2009-05-041-1/+1
* Change getdladdr to always use dlopen, dlsym and then dlclose.reimar2009-04-231-11/+6
* Fix a signedness issue that caused a warning to be wrongfully printed at runt...gpoirier2009-04-211-1/+1
* Unify error message output and update error messages.diego2009-04-201-13/+13
* follow renaming of pbBufPtr() to put_bits_ptr() by stefanorik2009-04-131-1/+1
* fix a memory leak leading to ~80 bytes being leaked at each call to flip_page.gpoirier2009-04-131-0/+1
* Rename RUNTIME_CPUDETECT to CONFIG_RUNTIME_CPUDETECT and always define it.ramiro2009-04-082-31/+31
* Remove unnecessary malloc.h #includes and related #ifdeffery.diego2009-04-021-3/+0
* Prefer vo vdpau over vo xv where available.cehoyos2009-03-311-3/+3
* Get rid of nonsensical limits on -geometry x, y,w and h values, they onlyreimar2009-03-311-15/+8
* Support IMGFMT_NV12 for vo vdpau.cehoyos2009-03-301-0/+6
* Make sure we do not accidentally use the vdp_get_error_string from thereimar2009-03-301-0/+1
* Add support for IMGFMT_YUY2 and IMGFMT_UYVY to vo vdpau.cehoyos2009-03-291-2/+20
* VDPAU supports IMGFMT_I420 and IMGFMT_IYUV.cehoyos2009-03-291-0/+2
* Consistently use MP_MAX_PLANES as size for plane pointer/stride arrays in libvo.reimar2009-03-294-19/+17
* Cosmetics: Reindent after last commit.cehoyos2009-03-291-1/+1
* 10l: Don't use MP_IMGFIELD_TOP_FIRST if MP_IMGFIELD_ORDERED is not set.cehoyos2009-03-291-0/+3
* Simplify vdpau deinterlacing code and fix timing for deint=2.cehoyos2009-03-251-7/+7
* New VDPAU deinterlacing code needs one reference surface less for software de...cehoyos2009-03-241-1/+1
* New vdpau deinterlacing code needs one reference surface less.cehoyos2009-03-241-6/+5
* Stephen Warren reported that VDPAU deinterlacing did not work correctly.cehoyos2009-03-241-4/+10
* Change function call order in config().cehoyos2009-03-221-10/+5
* 10l: Only try to create vdpau decoder if hardware decoding is intended.cehoyos2009-03-211-1/+1
* Test if create_vdp_decoder() might succeed by calling it from config()cehoyos2009-03-211-0/+3
* Change return value for create_vdp_decoder().cehoyos2009-03-211-3/+3
* Factorize create_vdp_decoder().cehoyos2009-03-211-32/+40
* Allow to use vdpau temporal deinterlacers with hardware accelerated decoding.cehoyos2009-03-181-4/+24
* Add chroma-deint option to vo vdpau (nochroma-deint speeds up deinterlacing).cehoyos2009-03-161-0/+11
* Check mpi type before returning an DR buffer in get_image, fixes jerkinessreimar2009-03-161-0/+3
* Move initialisation of deint_surfaces[] to free_video_specific().cehoyos2009-03-151-4/+4
* Update -vo vdpau command line help.cehoyos2009-03-151-4/+4
* Cosmetics: Fix whitespace.cehoyos2009-03-151-1/+1
* Initial support for advanced VDPAU deinterlacers (software-decoded videocehoyos2009-03-151-9/+34
* Fix warning: Add forgotten 'int' to variable declaration.iive2009-03-151-1/+1
* cosmetics: Remove file names from file header, it only causes trouble.diego2009-03-152-2/+2
* Remove obsolete extra elements from opt_t struct initialization.diego2009-03-158-37/+37
* Get rid of pointless preprocessor condition indirection and use ARCH_X86diego2009-03-152-23/+17
* "MPlayer - The Movie Player" should be used as the player name.diego2009-03-151-1/+1
* cosmetics: typo fixdiego2009-03-151-1/+1
* KVA vo driver for OS/2, patch by KO Myung-Hun, komh chollian netdiego2009-03-142-0/+1091
* Output number of reference frames before creating H264 vdpau decoder.cehoyos2009-03-091-0/+1
* Merge two preprocessor conditions in order to drop one duplicated #else case.diego2009-03-091-9/+2
* Change default OSD/subtitle font sizes.greg2009-03-091-2/+2
* cosmetics: spelling fixesdiego2009-03-071-7/+7
* cosmetics: Reformat file header.diego2009-03-071-8/+3
* Setting vo_fs is handled by x11_common.c, so remove that code from vo_xv/vo_x...reimar2009-03-072-4/+0
* Make data related to suboption parsing const in libvoreimar2009-03-0717-20/+20
* Refactor smalltex/tinytex EOSD optimization in vo_glreimar2009-03-061-18/+39
* Simplify EOSD code by rendering it in VOCTRL_DRAW_EOSD instead of genEOSD,reimar2009-03-061-3/+2
* Remove duplicate OSD drawing introduced due to a conflict between r28840 and ...reimar2009-03-061-3/+1
* As for vo_gl, do not rely on draw_osd to render EOSD.reimar2009-03-061-1/+6
* Draw EOSD with VOCTRL_DRAW_EOSD instead of along with OSD.greg2009-03-061-1/+1
* Do not rely on draw_osd to render the EOSD, instead draw it already at thereimar2009-03-061-10/+15
* Make sure all output_surfaces are initialized in preinit.reimar2009-03-041-1/+1
* Make sure vo_x11_create_vo_window sets vo_dwidth and vo_dheight rightreimar2009-03-041-0/+6
* Make WinID a 64 bit integer, this should avoid issues with valid Windowreimar2009-03-022-2/+2
* Use M_PI for pi.cehoyos2009-02-281-2/+3
* Make VdpVideoMixerAttribute attributes[] static const.cehoyos2009-02-281-1/+1
* Support brightness, contrast, hue and saturation adjustments viacehoyos2009-02-281-2/+54
* Fix OSD for vo vdpau:deint>1.cehoyos2009-02-281-1/+3
* Handle vdp_decoder_create failures better, in particular avoid unrelatedreimar2009-02-281-0/+5
* Do not forget the chosen deinterlacer for -vo vdpau.cehoyos2009-02-271-0/+6
* Add one-field-only output for -vo vdpau.cehoyos2009-02-271-6/+7
* Document that all vdpau deinterlacers respect -field-dominance.cehoyos2009-02-271-1/+1
* 10l: Remove debug printf() from last commit.cehoyos2009-02-261-1/+0
* Support "D" to (de-)activate deinterlacing when using vo vdpau.cehoyos2009-02-261-0/+7
* 10l: Add missing braces for VOCTRL_GET_EOSD_RES.cehoyos2009-02-251-2/+4
* Use memset to make sure all parts of struct sockaddr_in are always initialized.reimar2009-02-251-0/+1
* Change code to actually work when NUM_OUTPUT_SURFACES is changed.reimar2009-02-251-9/+10
* Cosmetics: Fix indentation and line length.cehoyos2009-02-241-6/+7
* Enable Bob de-interlacing for VDPAU.cehoyos2009-02-241-13/+26
* Calculate border size in aspect keeping code by using AdjustWindowRectreimar2009-02-231-5/+6
* Only check for vdp_video_mixer_destroy failure when we actually executed that...reimar2009-02-231-2/+3
* EOSD/ASS support for vo_vdpau.creimar2009-02-231-1/+187
* Add forgotten type to variable declaration.reimar2009-02-211-2/+2
* 100l, place vdpau below xv, it should not normally be preferred for auto-sele...reimar2009-02-211-3/+3
* Cosmetics. Reindent to 4 spaces.iive2009-02-211-473/+473
* Cleanup.iive2009-02-211-20/+2
* Cosmetics. Remove all trailing whitespacesiive2009-02-211-61/+61
* Turn all remaining printf() into mp_msg().iive2009-02-201-84/+85
* Cleanup.iive2009-02-201-53/+29
* Cosmetics part2. Indent local variable definitions like the rest of the code.iive2009-02-201-55/+62
* Cosmetics part 1. Reindent to 4 spaces.iive2009-02-201-916/+916
* Comment out "else" statement without following block.iive2009-02-201-1/+1
* Move libavcodec includes together.iive2009-02-201-1/+1
* Document that and why deinterlacing is not workingreimar2009-02-201-3/+6
* Add support for VDPAU deinterlacing, pullup, denoise and sharpening.reimar2009-02-201-5/+71
* Use the same code to convert fps in float to fraction as used in mencoder,reimar2009-02-181-1/+1
* Add VOCAP_NOSLICES and use it to allow vo_vdpau to not support slices forreimar2009-02-181-1/+3
* Extend calc_src_dst_rects to also calculate the border values needed forreimar2009-02-176-8/+30
* Convert HAVE_MALLOC_H into a 0/1 definition, fixes the warning:diego2009-02-173-3/+3
* Fix compilation after last commit.cehoyos2009-02-171-1/+1
* Cropping parameter to calc_src_dst_rects is constreimar2009-02-171-1/+1
* 100l, reset ass_border when switching out of fullscreen mode.reimar2009-02-171-0/+1
* The CONFIG_TV_TELETEXT preprocessor directive is defined/undefined,diego2009-02-171-1/+1
* Fix compilation without VDPAUuau2009-02-171-1/+1
* Add support for VDPAU video out, including hardware decoding.reimar2009-02-162-0/+813
* Replace double semicolon by single semicolon.diego2009-02-161-1/+1
* Sync renaming of xvmc struct members in FFmpeg.diego2009-02-161-2/+2
* The AV_XVMC_RENDER_MAGIC constant was renamed to AV_XVMC_ID in FFmpeg.diego2009-02-151-4/+4
* Reflect ffmpeg change of xvmc struct field to xvmc_id.iive2009-02-151-4/+4
* whitespace cosmetics: Remove all tabs and trailing whitespace.diego2009-02-151-75/+75
* The xvmc_pixfmt_render structure was renamed to xvmc_pix_fmt in FFmpeg.diego2009-02-151-19/+19
* Remove unnecessary #ifdef around internal #include.diego2009-02-151-3/+0
* The xmvc structure member magic_id was renamed to unique_id.diego2009-02-151-4/+4
* Reflect the change of xvmc struct name.iive2009-02-151-19/+19
* Move direct-rendering hack from vo_xvmc to vf_vo, so it does not need toreimar2009-02-151-1/+0
* Now xvmc struct uses magic_id fieldiive2009-02-151-4/+4
* Remove display_flag remains as the member has been removed from the xvmc struct.iive2009-02-151-2/+0
* Remove some xvmc field initializations. They are not used byiive2009-02-141-2/+0
* Remove local copy of xvmc_render.h, it is now an installed header in FFmpeg.diego2009-02-141-15/+15
* Remove now unused vo_calc_drwXY function.reimar2009-02-122-18/+0
* Add a calc_src_dst_rects that calculates from window size, panscan etc.reimar2009-02-125-93/+99
* Only set VO_EVENT_RESIZE if size actually changed, not if e.g. the window wasreimar2009-02-121-2/+6
* Conditionally compile aclib.c instead of placing #ifdef around its content.diego2009-02-081-4/+0
* Add standard license headers, unify header formatting.diego2009-02-0851-147/+976
* Avoid message spam during video adapter uncooperative state.gogothebee2009-02-051-1/+1
* Unify info/error messages to a common style:gogothebee2009-02-051-43/+43
* Add [gl] in front of vo_gl messagereimar2009-02-031-1/+1
* Latest 9.1 ATI drivers finally fixed PBOs, thus do not need ati-hack and are ...reimar2009-02-031-1/+10
* Add checks that a D3D device is available before attempting rendering.reimar2009-02-031-1/+16
* Remove the Present call after adapter reinitialization, it can not work anywayreimar2009-02-031-4/+0
* Cosmetics: remove empty line, improve some messages.reimar2009-02-031-5/+3
* Whitespace/comment typo cosmetics.reimar2009-02-031-5/+5
* Check for change_d3d_backbuffer failure.reimar2009-02-031-1/+2
* Fix several return valuesreimar2009-02-031-3/+3
* Remove pointless #ifdef around internal header includes.diego2009-02-011-4/+0
* Make CONFIG_XVMC a proper FFmpeg-style 0/1 definition.diego2009-01-301-1/+1
* Allocate a larger backbuffer to allow resizing without reinit.reimar2009-01-271-43/+113
* HAVE_3DNOW --> HAVE_AMD3DNOWdiego2009-01-265-47/+47
* cosmetics: Remove pointless period after copyright statement non-sentences.diego2009-01-192-2/+2
* fix device_id option after r28165gpoirier2009-01-181-7/+6
* 100l, forgot to delete two defines left over from old HAVE_MMX handling code.reimar2009-01-161-2/+0
* More #ifdef HAVE_MMX etc. missed by earlier search.reimar2009-01-161-1/+1
* More #ifdef -> #if fixesreimar2009-01-161-2/+2
* Lots and lots of #ifdef ARCH_... -> #if ARCH_...reimar2009-01-164-90/+142
* Change vo_draw_text to a vo_draw_text_ext function which draws DVD navigationreimar2009-01-103-11/+45
* Fix build: calc_drwXY was factorized into vo_calc_drwXY.diego2009-01-091-1/+1
* Factor calc_drwXY out of vo_xv and vo_xvmc.cehoyos2009-01-094-35/+22
* Support loading font faces other then the first one in a font file.eugeni2009-01-062-7/+9
* Add missing 'void' keyword to parameterless function declarations.diego2009-01-056-19/+19
* Fix deinit problem due to r28215gpoirier2009-01-031-2/+4
* Sync with latest round of xvmc changes in FFmpeg.diego2009-01-021-19/+20
* Conditionally define render_one_glyph and kerning dummy functions indiego2009-01-022-9/+5
* Remove unused debug code.diego2009-01-021-9/+0
* Add an option to vo_macosx to set a custom buffer_name.gpoirier2008-12-301-6/+23
* Support F- and numpad keys for w32_common based vos.reimar2008-12-301-0/+10
* Fix ugly borders problem with ati-hackreimar2008-12-271-0/+19
* Remove unused variable.diego2008-12-241-1/+0
* Warn when using features that are broken due to ATI driver bugs.reimar2008-12-231-0/+3
* Do not default to rectangle=2, it is at least for ATI HD4850 cards with 8.12 ...reimar2008-12-231-1/+1
* Remove pointless forward declaration.diego2008-12-231-1/+0
* 100l, forgot an assignment, broke special keys handling for X11-based vos.reimar2008-12-211-1/+1
* Add and use a special lookup function to do table-based translation to MPlaye...reimar2008-12-204-55/+49
* Cosmetics: get rid of some tabs and trailing whitespace.reimar2008-12-201-32/+32
* Use a table to translate X11 to MPlayer keycodes.reimar2008-12-201-145/+46
* Get rid of pointless and now unused defines.reimar2008-12-201-88/+0
* Simplify handling of X11 key events that are just passed through.reimar2008-12-201-97/+7
* Replace vo_macosx's custom options parsing with a subopt_parse()-based onegpoirier2008-12-191-22/+24
* Do not use full relative #include path for headers in the same directory.diego2008-12-171-1/+1
* #include sub.h instead of locally declaring vo_draw_text().diego2008-12-171-1/+1
* xvmc is now a CONFIG_ option in FFmpeg.diego2008-12-151-1/+1
* Add support for writing PNG files with alpha channel in -vo pngreimar2008-12-101-2/+9
* Try to auto-detect several vo_gl settings (ati-hack, force-pbo and rectangle).reimar2008-12-101-3/+13
* Fix MGSTR vs. MSGTR typo.diego2008-12-091-3/