summaryrefslogtreecommitdiffstats
path: root/libvo
Commit message (Expand)AuthorAgeFilesLines
* Merge branch 'vdpau' into buildUoti Urpala2009-09-196-872/+1263
|\
| * VO: Prefer vo_vdpau over vo_xv againUoti Urpala2009-09-191-3/+3
| * vo_vdpau: Fix X event handling bugsUoti Urpala2009-09-191-8/+10
| * core/VO: Allow VO drivers to add/modify framesUoti Urpala2009-09-183-72/+178
| * video_out.h: CosmeticsUoti Urpala2009-09-171-73/+73
| * VO interface: Remove obsolete draw_frame() from new interfaceUoti Urpala2009-09-175-21/+4
| * vo_vdpau: Support recovering from VDPAU display preemptionUoti Urpala2009-09-072-61/+166
| * vo_vdpau: Support updating OSD while pausedUoti Urpala2009-09-051-0/+6
| * vo_vdpau.c: Reindent control() switch statementUoti Urpala2009-09-051-77/+76
| * vo_vdpau: Allocate one large surface for EOSD contentUoti Urpala2009-09-052-78/+158
| * Merge branch 'vdpau_old' into vdpauUoti Urpala2009-08-312-684/+794
| |\
| | * vo_vdpau.c: cosmeticsUoti Urpala2009-08-291-198/+258
| | * vo_vdpau: reindent after GUI code removalUoti Urpala2009-08-291-30/+28
| | * vo_vpdau: Clean up uninit logicUoti Urpala2009-08-291-52/+54
| | * vo_vdpau: Make CHECK_ST macro saferUoti Urpala2009-08-291-41/+51
| | * vo_vdpau: Move all remaining static/global variables to contextUoti Urpala2009-08-291-103/+103
| | * vo_vdpau: Move things to context structUoti Urpala2009-08-291-254/+257
| | * vo_vdpau: Make info struct constUoti Urpala2009-08-291-1/+1
| | * vo_vdpau: Replace global function table with context variableUoti Urpala2009-08-291-91/+148
| | * vo_vdpau: Move VDPAU interface pointers into one structUoti Urpala2009-08-291-53/+55
| | * vo_vdpau: Add template file for VDPAU functionsUoti Urpala2009-08-292-86/+44
| | * vo_vdpau: Make compile as new-style VOUoti Urpala2009-08-291-78/+97
| | * vo_vdpau: Delete GUI stuff, include font_load.h for force_load_fontUoti Urpala2009-08-291-8/+1
* | | Merge svn changes up to r29684Uoti Urpala2009-09-162-41/+40
|\ \ \
| * | | Add standard license header and move a misplaced comment.reimar2009-09-051-1/+18
| * | | Factor out duplicated code to set play video scaled by a certain factor.reimar2009-09-041-39/+21
| * | | Subopt parser subopts should now be const.reimar2009-09-041-1/+1
* | | | Merge svn changes up to r29644Uoti Urpala2009-09-0416-618/+363
|\| | | | |/ / |/| |
| * | Consistently use sizeof(variable) instead of sizeof(type) where easily possible.reimar2009-09-021-7/+7
| * | Cosmetics: get rid of many pointless ()reimar2009-09-021-17/+17
| * | Reduce code duplication for half/normal/double video size handling.reimar2009-09-021-31/+19
| * | Remove unused variable.reimar2009-09-021-1/+0
| * | vo_quartz: change deallocation/uninit to more reliably free allocated data.reimar2009-09-021-29/+20
| * | Make glContext a local variable, it is not needed outside the functionreimar2009-09-012-3/+2
| * | Add a dealloc function to corevideo to reduce the memleaks fromreimar2009-09-011-0/+11
| * | Fix some of the major memleaks of vo_corevideo with -fixed-voreimar2009-09-011-24/+27
| * | Do not do a unmap/map cycle on Windows given with -wid, with some windowreimar2009-09-011-2/+1
| * | Check setGlWindow return value to fail properly instead of crashing if e.g.reimar2009-09-012-2/+4
| * | Make shm_fd a local variable and close it when we need it no longer, thusreimar2009-09-011-1/+3
| * | Reduce vo_corevideo memleaks by initializing static context etc. only oncereimar2009-09-011-14/+26
| * | Fix memleak when using fontconfig without a font name.reimar2009-09-011-3/+1
| * | Use MPlayer's standard aspect handling functions in corevideoreimar2009-09-012-100/+30
| * | Port feature from corevideo: remember half/double size settings and reapplyreimar2009-08-281-0/+6
| * | Make aspect switching work again (used the wrong variable and alwaysreimar2009-08-281-1/+1
| * | Fix implicit declaration of mp_input_.. functions.reimar2009-08-281-0/+1
| * | 1l, use sizeof for snprintf size instead of hard-coding the current value.reimar2009-08-281-1/+1
| * | Reuse the osx_common convert_key function to convert OSX keycodes to MPlayerreimar2009-08-281-52/+3
| * | Move aspect change handling from vo_quartz to osx_common.reimar2009-08-283-12/+34
| * | Add osx_common.c and move the keycode conversion (OSX to MPlayer) there.reimar2009-08-284-190/+47
| * | Use the standard MPlayer aspect handling instead of reimplementing our own in...reimar2009-08-281-80/+42
| * | Remove unused movie_aspect extern declaration.reimar2009-08-271-1/+0
| * | Use lookup_keymap_table function with data structure instead of huge switch-casereimar2009-08-271-50/+33
| * | Enable calc_src_dst_rects for windowed aspect and panscan.reimar2009-08-271-3/+3
| * | Remove panscan related conditions and code that only breaks future windowedreimar2009-08-271-14/+0
| * | Make gl2 code capable of windowed aspect and panscan (no user option to enabl...reimar2009-08-271-4/+4
| * | Add infrastructure and test code to enable aspect scaling and panscan in wind...reimar2009-08-274-9/+28
| * | Fix video placement with -vo gl2 -fs -wid.reimar2009-08-271-1/+1
| * | -vo gl2 resize does not need to modify its arguments, so pass int instead of ...reimar2009-08-271-12/+12
| * | Simplify -vo gl ass border etc. dimension calculation one bit more.reimar2009-08-271-3/+1
| * | Remove useless code that has no effect.reimar2009-08-271-3/+0
| * | Simplify and fix ass border calculations for -vo gl and -wid -fs mode.reimar2009-08-271-6/+3
| * | Make panscan cover the same range in -wid -fs mode as in normal mode.reimar2009-08-271-8/+17
| * | Disable -keepaspect with -wid in w32_common code.reimar2009-08-271-1/+1
| * | Fix aspect_fit to work correctly when borders need to be added on top andreimar2009-08-271-2/+2
| * | Forgotten changes to aspect code to handle -wid with -fs.reimar2009-08-272-0/+6
| * | First attempts at supporting -fs with -wid, -vo gl on X11 only so farreimar2009-08-272-1/+9
* | | Change type names to match upstream libassGrigori Goronzy2009-08-072-6/+6
* | | Merge svn changes up to r29455Uoti Urpala2009-07-294-5/+5
|\| |
| * | Replace WORDS_BIGENDIAN by HAVE_BIGENDIAN in all internal code.diego2009-07-264-5/+5
* | | Remove internal libass treeUoti Urpala2009-07-262-4/+2
* | | Disable functionality requiring libswscale internalsUoti Urpala2009-07-261-4/+16
* | | Remove the internal GUIAnton Khirnov2009-07-0716-215/+2
* | | Merge svn changes up to r29412Uoti Urpala2009-07-074-50/+43
|\ \ \
| * | | Revert "fix missing event on move that breaks xmga window movement"Uoti Urpala2009-07-071-2/+1
| |/ /
| * | Use memcpy_pic2 instead of reimplementing it.reimar2009-06-261-8/+2
| * | Close /dev/tty again on uninit.reimar2009-06-261-0/+2
| * | Fix indentation broken in last patchreimar2009-06-261-2/+2
| * | Get rid of completely pointless vt_doit variablereimar2009-06-261-5/+1
| * | 10l, use fopen directly instead of open + fdopenreimar2009-06-261-7/+2
| * | Use a single err_out in fb_preinit, also fixes a leak when vo_dbpp has anreimar2009-06-261-6/+8
| * | Use FFALIGN and FFMAX3reimar2009-06-261-3/+3
| * | Remove useless castsreimar2009-06-261-4/+4
| * | fbdev: remove pointless ()reimar2009-06-261-9/+9
| * | Use the RESET_GEOMETRY macro in one more place instead of duplicating its code.reimar2009-06-261-1/+1
| * | 100l, RESET_GEOMETRY must reset values to INT_MIN, not -1, -1 is areimar2009-06-261-1/+1
| * | fix missing event on move that breaks xmga window movementattila2009-06-191-1/+2
| * | enable fontconfig support by default. This change takes only in effect,siretart2009-06-171-1/+1
| * | When used with shared_buffer, there's no need for a NSApp object, which cause...adrian2009-05-181-4/+6
| * | When used with shared_buffer, autorelease in each flip_page so objects don't ...adrian2009-05-181-2/+4
| * | whitespace cosmetics: Remove all trailing whitespace.diego2009-05-1358-1288/+1288
* | | Remove trailing whitespace from most filesUoti Urpala2009-07-0761-1279/+1265
* | | Translation system changes part 2: replace macros by stringsAmar Takhar2009-07-0725-297/+314
* | | Translation system changes part 1: wrap translated stringsAmar Takhar2009-07-0725-294/+294
| |/ |/|
* | video_out.c: Fix a minor memory leakUoti Urpala2009-05-091-0/+2
* | Merge svn changes up to r29277Uoti Urpala2009-05-0812-55/+53
|\|
| * Do not use flag CWBackPixel when calling vo_x11_create_vo_window():cehoyos2009-05-081-1/+3
| * Add missing 'void' to parameterless function declarations.diego2009-05-046-18/+18
| * Rename macosx video output driver to corevideo.diego2009-05-043-21/+21
| * Replace QuickTime.h #include with Carbon.h, which is really needed.diego2009-05-041-1/+1
| * Change getdladdr to always use dlopen, dlsym and then dlclose.reimar2009-04-231-11/+6
| * Fix a signedness issue that caused a warning to be wrongfully printed at runt...gpoirier2009-04-211-1/+1
| * Unify error message output and update error messages.diego2009-04-201-13/+13
| * follow renaming of pbBufPtr() to put_bits_ptr() by stefanorik2009-04-131-1/+1
| * fix a memory leak leading to ~80 bytes being leaked at each call to flip_page.gpoirier2009-04-131-0/+1
* | x11_common.h: Remove declarations of some nonexistent variablesUoti Urpala2009-05-041-3/+0
* | Merge svn changes up to r29154Uoti Urpala2009-04-092-31/+31
|\|
| * Rename RUNTIME_CPUDETECT to CONFIG_RUNTIME_CPUDETECT and always define it.ramiro2009-04-082-31/+31
* | Merge branch 'ordered_chapters'Uoti Urpala2009-04-086-7/+5
|\ \
| * | VO: Don't reset pause status in VO config() functionsUoti Urpala2009-04-025-6/+0
| * | VO: Don't force window position in X11 VOsUoti Urpala2009-03-311-1/+5
* | | vo_xv: Fix context Shminfo table sizeUoti Urpala2009-04-051-1/+1
* | | Make VO xv preferred over vdpau againUoti Urpala2009-04-021-3/+3
* | | Merge svn changes up to r29134Uoti Urpala2009-04-022-6/+3
|\ \ \ | | |/ | |/|
| * | Remove unnecessary malloc.h #includes and related #ifdeffery.diego2009-04-021-3/+0
| * | Prefer vo vdpau over vo xv where available.cehoyos2009-03-311-3/+3
* | | Merge svn changes up to r29117Uoti Urpala2009-04-0120-153/+238
|\| |
| * | Get rid of nonsensical limits on -geometry x, y,w and h values, they onlyreimar2009-03-311-15/+8
| * | Support IMGFMT_NV12 for vo vdpau.cehoyos2009-03-301-0/+6
| * | Make sure we do not accidentally use the vdp_get_error_string from thereimar2009-03-301-0/+1
| * | Add support for IMGFMT_YUY2 and IMGFMT_UYVY to vo vdpau.cehoyos2009-03-291-2/+20
| * | VDPAU supports IMGFMT_I420 and IMGFMT_IYUV.cehoyos2009-03-291-0/+2
| * | Consistently use MP_MAX_PLANES as size for plane pointer/stride arrays in libvo.reimar2009-03-294-19/+17
| * | Cosmetics: Reindent after last commit.cehoyos2009-03-291-1/+1
| * | 10l: Don't use MP_IMGFIELD_TOP_FIRST if MP_IMGFIELD_ORDERED is not set.cehoyos2009-03-291-0/+3
| * | Simplify vdpau deinterlacing code and fix timing for deint=2.cehoyos2009-03-251-7/+7
| * | New VDPAU deinterlacing code needs one reference surface less for software de...cehoyos2009-03-241-1/+1
| * | New vdpau deinterlacing code needs one reference surface less.cehoyos2009-03-241-6/+5
| * | Stephen Warren reported that VDPAU deinterlacing did not work correctly.cehoyos2009-03-241-4/+10
| * | Change function call order in config().cehoyos2009-03-221-10/+5
| * | 10l: Only try to create vdpau decoder if hardware decoding is intended.cehoyos2009-03-211-1/+1
| * | Test if create_vdp_decoder() might succeed by calling it from config()cehoyos2009-03-211-0/+3
| * | Change return value for create_vdp_decoder().cehoyos2009-03-211-3/+3
| * | Factorize create_vdp_decoder().cehoyos2009-03-211-32/+40
| * | Allow to use vdpau temporal deinterlacers with hardware accelerated decoding.cehoyos2009-03-181-4/+24
| * | Add chroma-deint option to vo vdpau (nochroma-deint speeds up deinterlacing).cehoyos2009-03-161-0/+11
| * | Check mpi type before returning an DR buffer in get_image, fixes jerkinessreimar2009-03-161-0/+3
| * | Move initialisation of deint_surfaces[] to free_video_specific().cehoyos2009-03-151-4/+4
| * | Update -vo vdpau command line help.cehoyos2009-03-151-4/+4
| * | Cosmetics: Fix whitespace.cehoyos2009-03-151-1/+1
| * | Initial support for advanced VDPAU deinterlacers (software-decoded videocehoyos2009-03-151-9/+34
| * | Fix warning: Add forgotten 'int' to variable declaration.iive2009-03-151-1