summaryrefslogtreecommitdiffstats
path: root/libvo
Commit message (Expand)AuthorAgeFilesLines
* Add new VDPAU feature high-quality-scaling (and require newer library).cehoyos2009-11-041-1/+9
* Remove unneeded initializationreynaldo2009-11-031-1/+0
* Slightly change behavior of "none" if fstype specification.corey2009-10-301-1/+1
* Move teletext specific code from stream into libmpcodecs.cehoyos2009-10-291-1/+1
* Cosmetics: Reindent after last commit.cehoyos2009-10-271-1/+1
* Allow image format BGRA when using vo vdpau.cehoyos2009-10-271-0/+38
* Move some variable initializations to the beginning of vo_x11_fullscreen().diego2009-10-241-9/+4
* Implement VFCAP_FLIP for vo_vdpau.cehoyos2009-10-231-3/+5
* Free memory allocated in ff_vdpau_add_data_chunk() on uninit.cehoyos2009-10-221-0/+8
* Fix aspect test program linking.diego2009-10-191-0/+4
* Try to recover from VDPAU display pre-emptions.cehoyos2009-10-171-0/+76
* Support SMPTE-240M colourspace in vo_vdpau.cehoyos2009-10-121-3/+4
* Add colorspace option to vo_vdpau.cehoyos2009-10-101-12/+39
* cosmetics: Remove some pointless parentheses from return calls.diego2009-10-081-2/+2
* cosmetics: Break two more lines.diego2009-10-081-2/+4
* K&R coding style and whitespace cosmeticsdiego2009-10-061-162/+170
* Add keycode definitions for older versions of OSX. Fixes compilation on 10.4.adrian2009-10-061-0/+51
* Fix definition of KEY_PAGE_DOWN.cehoyos2009-10-041-1/+1
* Set sensible write frequency/priority values for AllocateMemoryMESAreimar2009-09-271-1/+1
* Print error instead of crashing when mesa-buffer is used on systemsreimar2009-09-271-0/+4
* Also check GLX client and server strings for extensionsreimar2009-09-271-2/+27
* Fix teletext font autoscaling.cehoyos2009-09-221-2/+2
* Fix vo_corevideo with shared buffer after r29606: Only do GUI dependent displ...adrian2009-09-201-4/+5
* Re-add some ifdefs, partially reverting r29688, since mDisplay andreimar2009-09-181-0/+4
* Use vo_w32_window directly instead of via the vo_window macro in Windows-only...reimar2009-09-181-2/+2
* Get rid of several (probably) pointless ifdefsreimar2009-09-181-6/+0
* Use ecx instead of ebx to avoid unnecessary issues with PIC.reimar2009-09-171-9/+9
* Add standard license header and move a misplaced comment.reimar2009-09-051-1/+18
* Factor out duplicated code to set play video scaled by a certain factor.reimar2009-09-041-39/+21
* Subopt parser subopts should now be const.reimar2009-09-041-1/+1
* Consistently use sizeof(variable) instead of sizeof(type) where easily possible.reimar2009-09-021-7/+7
* Cosmetics: get rid of many pointless ()reimar2009-09-021-17/+17
* Reduce code duplication for half/normal/double video size handling.reimar2009-09-021-31/+19
* Remove unused variable.reimar2009-09-021-1/+0
* vo_quartz: change deallocation/uninit to more reliably free allocated data.reimar2009-09-021-29/+20
* Make glContext a local variable, it is not needed outside the functionreimar2009-09-012-3/+2
* Add a dealloc function to corevideo to reduce the memleaks fromreimar2009-09-011-0/+11
* Fix some of the major memleaks of vo_corevideo with -fixed-voreimar2009-09-011-24/+27
* Do not do a unmap/map cycle on Windows given with -wid, with some windowreimar2009-09-011-2/+1
* Check setGlWindow return value to fail properly instead of crashing if e.g.reimar2009-09-012-2/+4
* Make shm_fd a local variable and close it when we need it no longer, thusreimar2009-09-011-1/+3
* Reduce vo_corevideo memleaks by initializing static context etc. only oncereimar2009-09-011-14/+26
* Fix memleak when using fontconfig without a font name.reimar2009-09-011-3/+1
* Use MPlayer's standard aspect handling functions in corevideoreimar2009-09-012-100/+30
* Port feature from corevideo: remember half/double size settings and reapplyreimar2009-08-281-0/+6
* Make aspect switching work again (used the wrong variable and alwaysreimar2009-08-281-1/+1
* Fix implicit declaration of mp_input_.. functions.reimar2009-08-281-0/+1
* 1l, use sizeof for snprintf size instead of hard-coding the current value.reimar2009-08-281-1/+1
* Reuse the osx_common convert_key function to convert OSX keycodes to MPlayerreimar2009-08-281-52/+3
* Move aspect change handling from vo_quartz to osx_common.reimar2009-08-283-12/+34
* Add osx_common.c and move the keycode conversion (OSX to MPlayer) there.reimar2009-08-284-190/+47
* Use the standard MPlayer aspect handling instead of reimplementing our own in...reimar2009-08-281-80/+42
* Remove unused movie_aspect extern declaration.reimar2009-08-271-1/+0
* Use lookup_keymap_table function with data structure instead of huge switch-casereimar2009-08-271-50/+33
* Enable calc_src_dst_rects for windowed aspect and panscan.reimar2009-08-271-3/+3
* Remove panscan related conditions and code that only breaks future windowedreimar2009-08-271-14/+0
* Make gl2 code capable of windowed aspect and panscan (no user option to enabl...reimar2009-08-271-4/+4
* Add infrastructure and test code to enable aspect scaling and panscan in wind...reimar2009-08-274-9/+28
* Fix video placement with -vo gl2 -fs -wid.reimar2009-08-271-1/+1
* -vo gl2 resize does not need to modify its arguments, so pass int instead of ...reimar2009-08-271-12/+12
* Simplify -vo gl ass border etc. dimension calculation one bit more.reimar2009-08-271-3/+1
* Remove useless code that has no effect.reimar2009-08-271-3/+0
* Simplify and fix ass border calculations for -vo gl and -wid -fs mode.reimar2009-08-271-6/+3
* Make panscan cover the same range in -wid -fs mode as in normal mode.reimar2009-08-271-8/+17
* Disable -keepaspect with -wid in w32_common code.reimar2009-08-271-1/+1
* Fix aspect_fit to work correctly when borders need to be added on top andreimar2009-08-271-2/+2
* Forgotten changes to aspect code to handle -wid with -fs.reimar2009-08-272-0/+6
* First attempts at supporting -fs with -wid, -vo gl on X11 only so farreimar2009-08-272-1/+9
* Replace WORDS_BIGENDIAN by HAVE_BIGENDIAN in all internal code.diego2009-07-264-5/+5
* Use memcpy_pic2 instead of reimplementing it.reimar2009-06-261-8/+2
* Close /dev/tty again on uninit.reimar2009-06-261-0/+2
* Fix indentation broken in last patchreimar2009-06-261-2/+2
* Get rid of completely pointless vt_doit variablereimar2009-06-261-5/+1
* 10l, use fopen directly instead of open + fdopenreimar2009-06-261-7/+2
* Use a single err_out in fb_preinit, also fixes a leak when vo_dbpp has anreimar2009-06-261-6/+8
* Use FFALIGN and FFMAX3reimar2009-06-261-3/+3
* Remove useless castsreimar2009-06-261-4/+4
* fbdev: remove pointless ()reimar2009-06-261-9/+9
* Use the RESET_GEOMETRY macro in one more place instead of duplicating its code.reimar2009-06-261-1/+1
* 100l, RESET_GEOMETRY must reset values to INT_MIN, not -1, -1 is areimar2009-06-261-1/+1
* fix missing event on move that breaks xmga window movementattila2009-06-191-1/+2
* enable fontconfig support by default. This change takes only in effect,siretart2009-06-171-1/+1
* When used with shared_buffer, there's no need for a NSApp object, which cause...adrian2009-05-181-4/+6
* When used with shared_buffer, autorelease in each flip_page so objects don't ...adrian2009-05-181-2/+4
* whitespace cosmetics: Remove all trailing whitespace.diego2009-05-1358-1288/+1288
* Do not use flag CWBackPixel when calling vo_x11_create_vo_window():cehoyos2009-05-081-1/+3
* Add missing 'void' to parameterless function declarations.diego2009-05-046-18/+18
* Rename macosx video output driver to corevideo.diego2009-05-043-21/+21
* Replace QuickTime.h #include with Carbon.h, which is really needed.diego2009-05-041-1/+1
* Change getdladdr to always use dlopen, dlsym and then dlclose.reimar2009-04-231-11/+6
* Fix a signedness issue that caused a warning to be wrongfully printed at runt...gpoirier2009-04-211-1/+1
* Unify error message output and update error messages.diego2009-04-201-13/+13
* follow renaming of pbBufPtr() to put_bits_ptr() by stefanorik2009-04-131-1/+1
* fix a memory leak leading to ~80 bytes being leaked at each call to flip_page.gpoirier2009-04-131-0/+1
* Rename RUNTIME_CPUDETECT to CONFIG_RUNTIME_CPUDETECT and always define it.ramiro2009-04-082-31/+31
* Remove unnecessary malloc.h #includes and related #ifdeffery.diego2009-04-021-3/+0
* Prefer vo vdpau over vo xv where available.cehoyos2009-03-311-3/+3
* Get rid of nonsensical limits on -geometry x, y,w and h values, they onlyreimar2009-03-311-15/+8
* Support IMGFMT_NV12 for vo vdpau.cehoyos2009-03-301-0/+6
* Make sure we do not accidentally use the vdp_get_error_string from thereimar2009-03-301-0/+1
* Add support for IMGFMT_YUY2 and IMGFMT_UYVY to vo vdpau.cehoyos2009-03-291-2/+20
* VDPAU supports IMGFMT_I420 and IMGFMT_IYUV.cehoyos2009-03-291-0/+2
* Consistently use MP_MAX_PLANES as size for plane pointer/stride arrays in libvo.reimar2009-03-294-19/+17
* Cosmetics: Reindent after last commit.cehoyos2009-03-291-1/+1
* 10l: Don't use MP_IMGFIELD_TOP_FIRST if MP_IMGFIELD_ORDERED is not set.cehoyos2009-03-291-0/+3
* Simplify vdpau deinterlacing code and fix timing for deint=2.cehoyos2009-03-251-7/+7
* New VDPAU deinterlacing code needs one reference surface less for software de...cehoyos2009-03-241-1/+1
* New vdpau deinterlacing code needs one reference surface less.cehoyos2009-03-241-6/+5
* Stephen Warren reported that VDPAU deinterlacing did not work correctly.cehoyos2009-03-241-4/+10
* Change function call order in config().cehoyos2009-03-221-10/+5
* 10l: Only try to create vdpau decoder if hardware decoding is intended.cehoyos2009-03-211-1/+1
* Test if create_vdp_decoder() might succeed by calling it from config()cehoyos2009-03-211-0/+3
* Change return value for create_vdp_decoder().cehoyos2009-03-211-3/+3
* Factorize create_vdp_decoder().cehoyos2009-03-211-32/+40
* Allow to use vdpau temporal deinterlacers with hardware accelerated decoding.cehoyos2009-03-181-4/+24
* Add chroma-deint option to vo vdpau (nochroma-deint speeds up deinterlacing).cehoyos2009-03-161-0/+11
* Check mpi type before returning an DR buffer in get_image, fixes jerkinessreimar2009-03-161-0/+3
* Move initialisation of deint_surfaces[] to free_video_specific().cehoyos2009-03-151-4/+4
* Update -vo vdpau command line help.cehoyos2009-03-151-4/+4
* Cosmetics: Fix whitespace.cehoyos2009-03-151-1/+1
* Initial support for advanced VDPAU deinterlacers (software-decoded videocehoyos2009-03-151-9/+34
* Fix warning: Add forgotten 'int' to variable declaration.iive2009-03-151-1/+1
* cosmetics: Remove file names from file header, it only causes trouble.diego2009-03-152-2/+2
* Remove obsolete extra elements from opt_t struct initialization.diego2009-03-158-37/+37
* Get rid of pointless preprocessor condition indirection and use ARCH_X86diego2009-03-152-23/+17
* "MPlayer - The Movie Player" should be used as the player name.diego2009-03-151-1/+1
* cosmetics: typo fixdiego2009-03-151-1/+1
* KVA vo driver for OS/2, patch by KO Myung-Hun, komh chollian netdiego2009-03-142-0/+1091
* Output number of reference frames before creating H264 vdpau decoder.cehoyos2009-03-091-0/+1
* Merge two preprocessor conditions in order to drop one duplicated #else case.diego2009-03-091-9/+2
* Change default OSD/subtitle font sizes.greg2009-03-091-2/+2
* cosmetics: spelling fixesdiego2009-03-071-7/+7
* cosmetics: Reformat file header.diego2009-03-071-8/+3
* Setting vo_fs is handled by x11_common.c, so remove that code from vo_xv/vo_x...reimar2009-03-072-4/+0
* Make data related to suboption parsing const in libvoreimar2009-03-0717-20/+20
* Refactor smalltex/tinytex EOSD optimization in vo_glreimar2009-03-061-18/+39
* Simplify EOSD code by rendering it in VOCTRL_DRAW_EOSD instead of genEOSD,reimar2009-03-061-3/+2
* Remove duplicate OSD drawing introduced due to a conflict between r28840 and ...reimar2009-03-061-3/+1
* As for vo_gl, do not rely on draw_osd to render EOSD.reimar2009-03-061-1/+6
* Draw EOSD with VOCTRL_DRAW_EOSD instead of along with OSD.greg2009-03-061-1/+1
* Do not rely on draw_osd to render the EOSD, instead draw it already at thereimar2009-03-061-10/+15
* Make sure all output_surfaces are initialized in preinit.reimar2009-03-041-1/+1
* Make sure vo_x11_create_vo_window sets vo_dwidth and vo_dheight rightreimar2009-03-041-0/+6
* Make WinID a 64 bit integer, this should avoid issues with valid Windowreimar2009-03-022-2/+2
* Use M_PI for pi.cehoyos2009-02-281-2/+3
* Make VdpVideoMixerAttribute attributes[] static const.cehoyos2009-02-281-1/+1
* Support brightness, contrast, hue and saturation adjustments viacehoyos2009-02-281-2/+54
* Fix OSD for vo vdpau:deint>1.cehoyos2009-02-281-1/+3
* Handle vdp_decoder_create failures better, in particular avoid unrelatedreimar2009-02-281-0/+5
* Do not forget the chosen deinterlacer for -vo vdpau.cehoyos2009-02-271-0/+6
* Add one-field-only output for -vo vdpau.cehoyos2009-02-271-6/+7
* Document that all vdpau deinterlacers respect -field-dominance.cehoyos2009-02-271-1/+1
* 10l: Remove debug printf() from last commit.cehoyos2009-02-261-1/+0
* Support "D" to (de-)activate deinterlacing when using vo vdpau.cehoyos2009-02-261-0/+7
* 10l: Add missing braces for VOCTRL_GET_EOSD_RES.cehoyos2009-02-251-2/+4
* Use memset to make sure all parts of struct sockaddr_in are always initialized.reimar2009-02-251-0/+1
* Change code to actually work when NUM_OUTPUT_SURFACES is changed.reimar2009-02-251-9/+10
* Cosmetics: Fix indentation and line length.cehoyos2009-02-241-6/+7
* Enable Bob de-interlacing for VDPAU.cehoyos2009-02-241-13/+26
* Calculate border size in aspect keeping code by using AdjustWindowRectreimar2009-02-231-5/+6
* Only check for vdp_video_mixer_destroy failure when we actually executed that...reimar2009-02-231-2/+3
* EOSD/ASS support for vo_vdpau.creimar2009-02-231-1/+187
* Add forgotten type to variable declaration.reimar2009-02-211-2/+2
* 100l, place vdpau below xv, it should not normally be preferred for auto-sele...reimar2009-02-211-3/+3
* Cosmetics. Reindent to 4 spaces.iive2009-02-211-473/+473
* Cleanup.iive2009-02-211-20/+2
* Cosmetics. Remove all trailing whitespacesiive2009-02-211-61/+61
* Turn all remaining printf() into mp_msg().iive2009-02-201-84/+85
* Cleanup.iive2009-02-201-53/+29
* Cosmetics part2. Indent local variable definitions like the rest of the code.iive2009-02-201-55/+62
* Cosmetics part 1. Reindent to 4 spaces.iive2009-02-201-916/+916
* Comment out "else" statement without following block.iive2009-02-201-1/+1
* Move libavcodec includes togeth