summaryrefslogtreecommitdiffstats
path: root/libmpdemux/dvbin.c
Commit message (Expand)AuthorAgeFilesLines
* Fix:rathann2006-05-141-2/+2
* prevent memleaknicodvb2006-05-131-3/+4
* unconditionally stop allocating memory for dvb_channel_t after 1 MB: it's unr...nicodvb2006-05-131-0/+5
* close channels file before exiting dvb_get_channels() if malloc(dvb_channels_...nicodvb2006-03-121-0/+1
* DVB channels cycling; patch by Ben Zores ben p geekbox d orgnicodvb2006-02-241-6/+6
* Patch by Stefan Huehner / stefan % huehner ! org \rathann2006-02-091-1/+1
* Unify include path handling, -I.. is in CFLAGS.diego2005-11-181-2/+2
* removed dependency on glibc's %a in sscanf()nicodvb2005-09-181-22/+37
* check the result of poll() before read()ing; 100lnicodvb2005-04-181-8/+8
* Mark modified imported files as such to comply more closely with GPL ยง2a.diego2005-04-161-0/+4
* added support for ATSC tuner and conf.filenicodvb2005-01-061-3/+32
* added forgotten dvb-t params lp_coderate and hierarchynicodvb2004-08-261-2/+38
* added multi-pid parsing code (up to 15), pid 0 is always added (for the PAT)nicodvb2004-07-121-62/+99
* new configuration structure, dvb_set_channel takes 2 parameters, 1000l memle...nicodvb2004-04-261-192/+175
* fixed broken diseqc fetch from channels filenicodvb2004-04-041-2/+3
* disallow non-sense type parameter; added support for absolute file path; pref...nicodvb2004-04-031-26/+32
* added missing tuning parameters (inversion and coderate) and changed debug le...nicodvb2004-03-191-2/+7
* Compliance with the DVB power management specification (doesn't closeattila2004-01-291-22/+21
* Patch by Nico <nsabbi@libero.it>attila2003-11-011-14/+22
* This patch fixes:alex2003-08-271-4/+19
* this patch fixesarpi2003-08-111-421/+478
* this is a combo patch that:arpi2003-03-161-0/+684