summaryrefslogtreecommitdiffstats
Commit message (Collapse)AuthorAgeFilesLines
* whitespace cosmetics: Break some overly long lines.diego2009-04-141-10/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29180 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use abgrToA for both luma and alpha channel in hyscale.sdrik2009-04-142-10/+11
| | | | | | This fixes RGB32 (et al.) scaling. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29179 b3059339-0415-0410-9bf9-f77b7e298cf2
* follow renaming of pbBufPtr() to put_bits_ptr() by stefanorik2009-04-132-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29178 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix a memory leak leading to ~80 bytes being leaked at each call to flip_page.gpoirier2009-04-131-0/+1
| | | | | | | | | Patch by Alexander Strange %astrange A ithinksw.com% Original thread: date: Thu, Apr 9, 2009 at 4:47 AM git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29177 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest FFmpeg changes.diego2009-04-132-49/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29176 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move addition of MMX-OBJS to OBJS into common.mak instead of duplicating it.diego2009-04-121-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29175 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmetics: Reindent a few lines and break a few excessively long ↵diego2009-04-121-12/+15
| | | | | | lines. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29174 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix E-AC-3 channel ordering. E-AC-3 needs to use the same ordering as AC-3,diego2009-04-121-1/+2
| | | | | | | | not the standard ordering. patch by Andrew de Quincey, adq_dvb lidskialf net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29173 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce subtitle parsing verbosity.diego2009-04-121-5/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29172 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use extra_cflags variable instead of CFLAGS to add system-specific CFLAGS.diego2009-04-121-2/+2
| | | | | | | Otherwise the CFLAGS warning gets triggered and necessary CFLAGS are not set. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29171 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reemit the ID_AID_x_LANG for the track. This allows the identification of thediego2009-04-111-3/+10
| | | | | | | | audio track by language code (en or es) rather than by ID (128 or 129). patch by Kevin DeKorte, kdekorte gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29170 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move all CFLAGS checks together at the beginning of configure.diego2009-04-101-15/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29169 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move thread-related CFLAGS settings into pthread test.diego2009-04-101-8/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29168 b3059339-0415-0410-9bf9-f77b7e298cf2
* some updates about translation maintenancediego2009-04-101-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29167 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify: use av_fifo_spacereimar2009-04-102-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29166 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary Darwin default CFLAGS and LDFLAGS.diego2009-04-101-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29165 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move darwin CFLAG settings to darwin section at the beginning of configure.diego2009-04-101-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29164 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move amigaos CFLAG settings to amigaos section at the beginning of configure.diego2009-04-101-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29163 b3059339-0415-0410-9bf9-f77b7e298cf2
* gcc <3.1 is unsupported on Darwin, no need to check for this.diego2009-04-101-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29162 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make tvi_v4l2 print -1 as "Current input" if the ioctl to read it failed.reimar2009-04-101-0/+1
| | | | | | | Previously it printed (number of inputs + 1) which is needlessly confusing. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29161 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable pause-hack from PulseAudio 0.9.15 on, it should be fixed.reimar2009-04-091-3/+3
| | | | | | | | Patch Lennart Poettering [lennart poettering net] with documentation update by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29160 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split oversized of "argument" onto a separate line.reimar2009-04-091-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29159 b3059339-0415-0410-9bf9-f77b7e298cf2
* Also lock the mainloop when doing adjusting the volume for PulseAudio.reimar2009-04-091-0/+3
| | | | | | | Patch by Lennart Poettering [lennart poettering net] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29158 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure waitop always unlocks the mainloop even if the operation could notreimar2009-04-091-1/+4
| | | | | | | | be created. Patch by Lennart Poettering [lennart poettering net] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29157 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a -indentify message that indicates if the current DVDNAV title isreimar2009-04-091-2/+5
| | | | | | | | a menu or a video. Patch by Kevin DeKorte [kdekorte gmail com], approved by Nico. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29156 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change type of first argument of the print_int_array function from int todiego2009-04-091-1/+1
| | | | | | | | unsigned int, fixes warnings of the type: codec-cfg.c:1031: warning: pointer targets in passing argument 1 of 'print_int_array' differ in signedness git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29155 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename RUNTIME_CPUDETECT to CONFIG_RUNTIME_CPUDETECT and always define it.ramiro2009-04-089-50/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29154 b3059339-0415-0410-9bf9-f77b7e298cf2
* Specify precise dependencies for generated header file codecs.conf.h.diego2009-04-081-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29153 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce compilation time after version.h was updated.cehoyos2009-04-081-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29152 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix wrong syntax in test example, noticed by Jason Holt, jholt google com.diego2009-04-081-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29151 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add rules to install gmplayer manual pages.diego2009-04-061-0/+10
| | | | | | | based on a patch by Reinhard Tartler, siretart tauware de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29150 b3059339-0415-0410-9bf9-f77b7e298cf2
* swscale: Remove X86 commented out code.ramiro2009-04-051-11/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29149 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r29147Gabrov2009-04-051-3/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29148 b3059339-0415-0410-9bf9-f77b7e298cf2
* eliminate a trailing whitespaceGabrov2009-04-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29147 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with en/mplayer.1 r29133jrash2009-04-051-8/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29146 b3059339-0415-0410-9bf9-f77b7e298cf2
* swscale: Use function pointers for swScale functions.ramiro2009-04-043-205/+186
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29145 b3059339-0415-0410-9bf9-f77b7e298cf2
* swscale: {}-related cosmetics.ramiro2009-04-041-7/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29144 b3059339-0415-0410-9bf9-f77b7e298cf2
* swscale: Add const to some swScale functions' parameters.ramiro2009-04-042-70/+72
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29143 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove startup -volume wish, option was added a while agocompn2009-04-041-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29142 b3059339-0415-0410-9bf9-f77b7e298cf2
* add tivo (ty) and rm (rmvb) to file chooser, fixes bug 663compn2009-04-041-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29141 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid spurious rebuilds on svn up. The check to find out if the header filecehoyos2009-04-041-1/+1
| | | | | | | changed compared two lines to one, which would result in false positive updates. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29140 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix passing CFLAGS and LDFLAGS with = in them as configure parameters.diego2009-04-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29138 b3059339-0415-0410-9bf9-f77b7e298cf2
* make = and + both adjust audio delay, useful for keyboards without keypadscompn2009-04-041-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29137 b3059339-0415-0410-9bf9-f77b7e298cf2
* add fourccs: dvp and dvs1, from vlc dv video fourcc listcompn2009-04-031-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29136 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation for newly added VAAPI_HWACCEL's.cehoyos2009-04-031-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29135 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use native endian float filter provided by libbs2b instead ofbircoph2009-04-021-5/+2
| | | | | | | selection based on WORDS_ENDIAN. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29134 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add documentation for libbs2b audio filter.bircoph2009-04-021-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29133 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add libbs2b audio filter itself.bircoph2009-04-023-0/+220
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29132 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for libbs2b audio filter.bircoph2009-04-021-0/+43
| | | | | | | Add auto detection and selection routines to configure. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29131 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation with libavcodec's HWACCEL.cehoyos2009-04-021-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29130 b3059339-0415-0410-9bf9-f77b7e298cf2
* swscale: Remove mmx2 params from h[yc]scale().ramiro2009-04-021-29/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29129 b3059339-0415-0410-9bf9-f77b7e298cf2
* swscale: Split h[yc]scale_fast() into their own functions.ramiro2009-04-021-23/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29128 b3059339-0415-0410-9bf9-f77b7e298cf2
* swscale: Execute sfence and emms depending on runtime flags.ramiro2009-04-021-17/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29127 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary malloc.h #includes and related #ifdeffery.diego2009-04-0226-123/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29126 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add recently added FFmpeg subdirs to DIRS variable.diego2009-04-021-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29125 b3059339-0415-0410-9bf9-f77b7e298cf2
* override codec tag for pcm s32le and s32be, used in movbcoudurier2009-04-021-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29124 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add config.h #include, necessary for HAVE_MALLOC_H check.diego2009-04-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29123 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable along with the related warning.diego2009-04-011-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29122 b3059339-0415-0410-9bf9-f77b7e298cf2
* Increase probe buffer size to 32kB, this makes ac3 auto-detection far more ↵reimar2009-04-011-1/+1
| | | | | | reliable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29121 b3059339-0415-0410-9bf9-f77b7e298cf2
* At least direct3d vo supports -xineramascreen, tooreimar2009-04-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29120 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make examples and test progs depend on librariesmru2009-04-011-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29119 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prefer vo vdpau over vo xv where available.cehoyos2009-03-311-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29118 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, add forgotten BGR15 format to fmt-conversion.c tablereimar2009-03-311-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29117 b3059339-0415-0410-9bf9-f77b7e298cf2
* cdvh decodes with ffdvcompn2009-03-311-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29116 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add forgotten escapes for -reimar2009-03-311-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29115 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing $(EXESUF) to example/test program dependency declaration.diego2009-03-311-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29114 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain relationship between -geometry and -xineramascreen.reimar2009-03-311-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29113 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of nonsensical limits on -geometry x, y,w and h values, they onlyreimar2009-03-311-15/+8
| | | | | | | cause confusion on multi-monitor setups. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29112 b3059339-0415-0410-9bf9-f77b7e298cf2
* More flags; sync with Linux kernel.zuxy2009-03-311-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29111 b3059339-0415-0410-9bf9-f77b7e298cf2
* override lavf tag for pcm s24le, mov uses the same for s24bebcoudurier2009-03-301-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29110 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support IMGFMT_NV12 for vo vdpau.cehoyos2009-03-301-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29109 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set the forced_subs_only value correctly whenever a new spudec is created.reimar2009-03-302-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29108 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use correct PRId64 instead of "lld" in printf string, fixes compiler warnings.reimar2009-03-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29107 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure we do not accidentally use the vdp_get_error_string from thereimar2009-03-301-0/+1
| | | | | | | previous initialization. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29106 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for IMGFMT_YUY2 and IMGFMT_UYVY to vo vdpau.cehoyos2009-03-291-2/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29105 b3059339-0415-0410-9bf9-f77b7e298cf2
* VDPAU supports IMGFMT_I420 and IMGFMT_IYUV.cehoyos2009-03-291-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29104 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use MP_MAX_PLANES as size for plane pointer/stride arrays in ↵reimar2009-03-294-22/+18
| | | | | | | | | | libmpcodecs. This might avoid some issues since sws_scale in some cases assumes these have at least 4 valid entries. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29103 b3059339-0415-0410-9bf9-f77b7e298cf2
* Globally ignore all example binaries.diego2009-03-290-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29102 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use MP_MAX_PLANES as size for plane pointer/stride arrays in libvo.reimar2009-03-294-19/+17
| | | | | | | | This might avoid some issues since sws_scale in some cases assumes these have at least 4 valid entries. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29101 b3059339-0415-0410-9bf9-f77b7e298cf2
* Generalize example target rule in common.mak so that it sets a -example$(EXESUF)diego2009-03-291-1/+1
| | | | | | | suffix for all example files instead of doing this in individual Makefiles. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29100 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move swscale AltiVec template code to ppc subdirectory.diego2009-03-292-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29099 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use MP_MAX_PLANES as size of arrays passed to mpcodecs_draw_slice.reimar2009-03-292-6/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29098 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense file to LGPL with the permission of Romain Dolbeau, the author.diego2009-03-291-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29097 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with en/mplayer.1 r29059jrash2009-03-291-6/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29096 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update demuxer->sub->id and demuxer->sub->sh if a new subtitle stream isreimar2009-03-291-0/+4
| | | | | | | | created that matches the user-requested one. Fixes -slang and -sid with DVDs (anything that uses demux_mpg actually). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29095 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: Reindent after last commit.cehoyos2009-03-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29094 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Don't use MP_IMGFIELD_TOP_FIRST if MP_IMGFIELD_ORDERED is not set.cehoyos2009-03-291-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29093 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r29059Gabrov2009-03-281-6/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29092 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move config.h include directive up as a precaution measure.bircoph2009-03-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29091 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reorder includes alphabetically.bircoph2009-03-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29090 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove af_mp.h and add its content to af.hbircoph2009-03-282-34/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29089 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove af_msg special-casing API in libaf.bircoph2009-03-2820-180/+141
| | | | | | | Replace it by standard mp_msg message system. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29088 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document the ass_render_event event_images parameter.reimar2009-03-281-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29087 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialize all structs to 0 before using them.reimar2009-03-281-0/+3
| | | | | | | | | | This is consistent with the remaining code (which uses e.g. calloc) and makes it easier to extend the structs in the future. As a side effect it fixes several valgrind errors in hashmap_hash/hashmap_key_compare caused by padding in the structures, but it is not a correct fix for that issue. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29086 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for ddk/ntddcdrm.h header before enabling VCD on mingw.reimar2009-03-281-3/+11
| | | | | | | Fixes a compilation issue on mingw-w64 which does not have that header. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29085 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, revert r29082, I missed that the vts comparison should be ↵reimar2009-03-281-1/+5
| | | | | | case-insensitive. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29084 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindentreimar2009-03-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29083 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify extracting title number from ifo namereimar2009-03-281-5/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29082 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move bfin specific code to its subdir.ramiro2009-03-274-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29079 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify detection of .ifo extension.reimar2009-03-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29078 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use x86_reg instead of long in several video filters to fix compilation on ↵reimar2009-03-274-11/+11
| | | | | | MinGW64. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29077 b3059339-0415-0410-9bf9-f77b7e298cf2
* Directly include libavutil/x86_cpu.h in cpudetect.h instead of duplicating itreimar2009-03-271-27/+1
| | | | | | | incompletely. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29076 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of gettimeofday reimplementation for MinGW, all remotely recentreimar2009-03-271-9/+0
| | | | | | | versions of MinGW already provide it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29075 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling fixes, add release namediego2009-03-271-16/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29072 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for _WINGDI_ instead of _WINGDI_H before defining BITMAPINFOHEADERreimar2009-03-271-1/+1
| | | | | | since former works on both 32 and 64 bit MinGW git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29071 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc updatesdiego2009-03-271-8/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29070 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync cpuid detection code with libavcodec: assume it is always available on ↵reimar2009-03-271-13/+7
| | | | | | x86_64 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29069 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename local TMP variable to TMPRES to avoid a clash with thereimar2009-03-271-4/+4
| | | | | | | | variable holding the path used for temporary files - this is used by mingw-w64 and this change avoids crashes with it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29068 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename cs_test.c --> colorspace-test.c. This is more consistent with the namesdiego2009-03-262-2/+2
| | | | | | | of other test programs and more descriptive of what the program does. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29067 b3059339-0415-0410-9bf9-f77b7e298cf2
* change close to closesocket, unifies close streaming codecompn2009-03-261-1/+1
| | | | | | | patch by Francesco Cosoleto , cosoleto gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29066 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make svn:ignore properties globally consistent. Ignore all .d, .ho, .exe, -testdiego2009-03-260-0/+0
| | | | | | | files, all generated libraries and headers and example programs. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29065 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for mmsh:// as alias for mmshttp://reimar2009-03-261-2/+3
| | | | | | | Patch by Francesco Cosoleto [cosoleto gmail com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29064 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move yuv2rgb code to subdirs.ramiro2009-03-269-65/+113
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29063 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable vp6 codec to read/write .fpf (passlogfile)compn2009-03-251-3/+5
| | | | | | | fixes 2pass vp6 encoding on linux git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29062 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify vdpau deinterlacing code and fix timing for deint=2.cehoyos2009-03-251-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29061 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fixesdiego2009-03-251-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29060 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update date in manual page.diego2009-03-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29059 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename 'default-binds' input option to 'default-bindings'.diego2009-03-256-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29058 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Drop leading underscore from extra_ variables.diego2009-03-251-194/+194
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29057 b3059339-0415-0410-9bf9-f77b7e298cf2
* swscale-example is an API example, not a test program.diego2009-03-251-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29056 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l: There is no more delay since r29051.cehoyos2009-03-251-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29055 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify vdpau deinterlacers.cehoyos2009-03-251-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29054 b3059339-0415-0410-9bf9-f77b7e298cf2
* New VDPAU deinterlacing code needs one reference surface less for software ↵cehoyos2009-03-241-1/+1
| | | | | | decoding. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29053 b3059339-0415-0410-9bf9-f77b7e298cf2
* New vdpau deinterlacing code needs one reference surface less.cehoyos2009-03-241-6/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29052 b3059339-0415-0410-9bf9-f77b7e298cf2
* Stephen Warren reported that VDPAU deinterlacing did not work correctly.cehoyos2009-03-241-4/+10
| | | | | | | New static function push_deint_surface() by Reimar. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29051 b3059339-0415-0410-9bf9-f77b7e298cf2
* sqcp plays with ffqclp in ffmpegcompn2009-03-241-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29050 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update help output with previous --extra-ldflags change.diego2009-03-241-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29049 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds "YUYV422 to YUVA420P" and "UYVY422 to YUVA420P" unscaled convertionsdrik2009-03-241-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29048 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some places where "non-alpha to YUVA420P" do not fill the alpha planesdrik2009-03-241-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29047 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simpler and more elegant fix to the x86_32/OSX+PIC build failuresdrik2009-03-242-10/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29046 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace --with-extralibdir option by --extra-ldflags, which accepts arbitrarydiego2009-03-241-98/+98
| | | | | | | LDFLAGS. Also rename the corresponding variable for consistency. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29045 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fix: Remove stray '-' from --extra-cflags option evaluation.diego2009-03-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29044 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace --with-extraincdir option by --extra-cflags, which accepts arbitrarydiego2009-03-231-48/+48
| | | | | | | CFLAGS. Also rename the corresponding variables for consistency. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29043 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of pointless EXTRA_INC and EXTRAXX_INC config.mak variable indirection.diego2009-03-231-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29042 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use full CFLAGS to build codec-cfg, they are unnecessary.diego2009-03-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29041 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change function call order in config().cehoyos2009-03-221-10/+5
| | | | | | | | This stops creating a window even if hardware decoding is certainly going to fail. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29040 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename 'tests' target to 'testprogs'. It is too easily confused with thediego2009-03-221-1/+1
| | | | | | | 'test' target and a directory named tests exists. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29039 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary CLEANFILES declaration. Test programs do not require it.diego2009-03-221-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29038 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add forgotten "static" to new data_length variable in ao_pcmreimar2009-03-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29037 b3059339-0415-0410-9bf9-f77b7e298cf2
* Whitespace-only cosmetics: use consistent indentation in ao_pcm.creimar2009-03-221-137/+137
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29036 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print a warning if ao_pcm wrote more data than what can be specified in thereimar2009-03-221-5/+11
| | | | | | | WAV header (ca. 2GB currently) or if it can not update the header at all. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29035 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with r28984: 17% done.bircoph2009-03-221-508/+504
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29034 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28991.bircoph2009-03-221-7/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29033 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with en/mplayer.1 r28991jrash2009-03-221-12/+57
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29032 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable unscaled packed422 -> planar 420 converters by default as themichael2009-03-211-5/+4
| | | | | | | imgconvert inherited quality issues should be fixed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29031 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l (C code was buggy and untested)michael2009-03-211-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29030 b3059339-0415-0410-9bf9-f77b7e298cf2
* Average chroma of 2 lines in packed 422 -> planar 420.michael2009-03-211-4/+110
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29029 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Only try to create vdpau decoder if hardware decoding is intended.cehoyos2009-03-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29028 b3059339-0415-0410-9bf9-f77b7e298cf2
* Test if create_vdp_decoder() might succeed by calling it from config()cehoyos2009-03-211-0/+3
| | | | | | | | | | | | | | | with a small value for max_reference_frames. This does not make automatic recovery by using software decoder possible, but lets MPlayer fail more graciously on - actually existing - buggy hardware that does not support certain H264 widths when using hardware accelerated decoding (784, 864, 944, 1024, 1808, 1888 pixels on NVIDIA G98) and if the user tries to hardware-decode more samples at the same time than supported. Might break playback of H264 Intra-Only samples on hardware with very little video memory. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29027 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change return value for create_vdp_decoder().cehoyos2009-03-211-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29026 b3059339-0415-0410-9bf9-f77b7e298cf2
* map jls (jpeg-ls), thm and db (thumbnails) files to jpgcompn2009-03-211-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29025 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize create_vdp_decoder().cehoyos2009-03-211-32/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29024 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialize HAVE_FAST_UNALIGNED definition to 0 so that it is never undefined.diego2009-03-211-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29023 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix build failure on x86_32 Mac OS X with PIC enabledsdrik2009-03-212-2/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29022 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix planarCopy to ignore the GRAY8 "pseudo"-palette, fixes libavtest ↵reimar2009-03-211-1/+3
| | | | | | regression test. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29021 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove postinst script that asks for a TrueType font to use as default.diego2009-03-212-59/+1
| | | | | | | | | | This also gets rid of the libconfhelper-perl dependency; a package that no longer exists in current Debian versions, rendering the generated Debian package uninstallable. patch by Vladislav Naumov, vladislav.naumov gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29020 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add CONFIG_SWSCALE_ALPHA and HAVE_VIRTUALALLOC config.h #defines for FFmpeg.diego2009-03-211-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29019 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid crash on planarCopy to a destination without alpha.reimar2009-03-201-1/+2
| | | | | | | Makes regression tests run again, though the results are still wrong. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29018 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialize pointer arrays which may be freed before being initialized.benoit2009-03-201-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29017 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do _not_ use rbx on x86_64, it will fail to compile with PIC, besides itreimar2009-03-201-4/+3
| | | | | | | added completely pointless code. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29016 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix swscale compilation with Altivec enabled.reimar2009-03-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29015 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindent after last commitsdrik2009-03-201-66/+66
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29014 b3059339-0415-0410-9bf9-f77b7e298cf2
* Also test the alpha channel in swscale-examplesdrik2009-03-201-19/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29013 b3059339-0415-0410-9bf9-f77b7e298cf2
* YUVA420P is now supported as output formatsdrik2009-03-202-8/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29012 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add alpha channel scalingsdrik2009-03-203-88/+411
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29011 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add YUVA420P -> RGBA/BGRA/ARGB/ABGR unscaled converterssdrik2009-03-202-10/+115
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29010 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a simpler and more general check for the gray case in the planarCopy ↵sdrik2009-03-201-4/+1
| | | | | | function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29009 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialize *srcContext, *dstContext, *outContext to NULL, avoids the warnings:diego2009-03-191-2/+2
| | | | | | | | | libswscale/swscale-example.c:60: warning: 'outContext' may be used uninitialized in this function libswscale/swscale-example.c:60: warning: 'dstContext' may be used uninitialized in this function libswscale/swscale-example.c:60: warning: 'srcContext' may be used uninitialized in this function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29008 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless casting in asm "m" operand.cehoyos2009-03-191-2/+2
| | | | | | | Patch by Matthieu Castet, castet D matthieu A free D fr git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29007 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allocate executable memory with VirtualAlloc() in Windows.ramiro2009-03-191-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29006 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop unnecessary cast and cosmetically align.ramiro2009-03-191-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29005 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix HTML docs generation, broken in r28980.rathann2009-03-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29004 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revertmichael2009-03-191-28/+18
| | | | | | | | | | | | | | | Date: Wed Mar 18 23:11:50 2009 New Revision: 28996 Log: Fix libswscale compilation on non-x86, hopefully without breaking MinGW64 again. This change was non optimal, correct would have been to revert the offending commits if no time was available to find a clean fix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29003 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 10l typo.michael2009-03-191-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29002 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove trailing whitespacesGabrov2009-03-194-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29001 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove trailing whitespacesGabrov2009-03-191-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29000 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove trailing whitespaces all over the placeGabrov2009-03-197-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28999 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28991Gabrov2009-03-192-23/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28998 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unscaled converters formichael2009-03-194-1/+324
| | | | | | | | | | YUYV->YUV420P YUYV->YUV422P UYVY->YUV420P UYVY->YUV422P git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28997 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix libswscale compilation on non-x86, hopefully without breaking MinGW64 again.reimar2009-03-181-18/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28996 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support icc 11.1.cehoyos2009-03-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28995 b3059339-0415-0410-9bf9-f77b7e298cf2
* drop obsolete guidelinesrathann2009-03-181-6/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28994 b3059339-0415-0410-9bf9-f77b7e298cf2
* swscale-example: use LFG instead of random()ramiro2009-03-181-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28993 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not assume long is same width as x86 register.ramiro2009-03-185-36/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28992 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow to use vdpau temporal deinterlacers with hardware accelerated decoding.cehoyos2009-03-185-15/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28991 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support FFmpeg codecs that decode to other formats than S16.reimar2009-03-181-1/+10
| | | | | | | Double format is currently not supported. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28990 b3059339-0415-0410-9bf9-f77b7e298cf2
* Older versions of <vdpau/vdpau.h> will fail during compilation.cehoyos2009-03-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28989 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use ff_ prefixes for internal symbols.diego2009-03-188-25/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28988 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Fix indentation.cehoyos2009-03-181-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28987 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a fillPlane function to fill a plane with one constant valuesdrik2009-03-171-8/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28986 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't write outside of the picture buffer in planarCopy in the gray casesdrik2009-03-171-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28985 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of trailing whitespaces.bircoph2009-03-171-24/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28984 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28979.bircoph2009-03-171-4/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28983 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix ff_bfin_yuv2rgb_get_func_ptr() vs. sws_ff_bfin_yuv2rgb_get_func_ptr() namediego2009-03-172-2/+2
| | | | | | | mismatch. The function is now called sws_yuv2rgb_get_func_ptr_bfin(). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28982 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmetics: Consistently format function calls without spacediego2009-03-172-65/+67
| | | | | | | between name and parentheses; shorten some overly long lines. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28981 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid an error at the end of chunked HTML doc generation.reimar2009-03-171-2/+4
| | | | | | | Since doctype was added, xsltproc always needs a target _file_. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28980 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add chroma-deint option to vo vdpau (nochroma-deint speeds up deinterlacing).cehoyos2009-03-162-0/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28979 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an alpha parameter to the YUV2RGBFUNC macro to ease the upcoming ↵sdrik2009-03-161-12/+12
| | | | | | yuva2rgb patch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28978 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: reindent.eugeni2009-03-161-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28977 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix uninitialized memory access in ass_fontconfig.eugeni2009-03-161-0/+2
| | | | | | | This fixes hangups with plaintext subtitles happening when the first subtitle is about to be displayed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28976 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add TVI_CONTROL_VID_SET_WIDTH_HEIGHT to set width and height together for v4l2,reimar2009-03-163-0/+15
| | | | | | | otherwise some drivers will always stay stuck in the lowest resolution. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28975 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check mpi type before returning an DR buffer in get_image, fixes jerkinessreimar2009-03-161-0/+3
| | | | | | | with MPEG1/2 and -dr -slices git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28974 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28968 with some extra roff markup fixesGabrov2009-03-161-36/+59
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28973 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split YUV2RGB operands declaration into a separate macrosdrik2009-03-161-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28972 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move initialisation of deint_surfaces[] to free_video_specific().cehoyos2009-03-151-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28971 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update -vo vdpau command line help.cehoyos2009-03-151-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28970 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: Fix whitespace.cehoyos2009-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28969 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initial support for advanced VDPAU deinterlacers (software-decoded videocehoyos2009-03-152-12/+39
| | | | | | | | | only). With a lot of help from Reimar git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28968 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore generated files 'tags' and 'cpuinfo'.diego2009-03-150-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28967 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some parentheses to silence the warnings:diego2009-03-151-2/+2
| | | | | | | | cpuinfo.c:293: warning: suggest parentheses around && within || cpuinfo.c:297: warning: suggest parentheses around && within || git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28966 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning: Add forgotten 'int' to variable declaration.iive2009-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28965 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28958gpoirier2009-03-151-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28964 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid ridiculously small decode_buffer_size (e.g. 4 with acodec=pcm_s16le)reimar2009-03-151-0/+1
| | | | | | | that can make -oac lavc unusable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28963 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l fix calculation of dropped frames, number of frames is time * fps, not ↵reimar2009-03-151-1/+1
| | | | | | time / fps. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28962 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28958.bircoph2009-03-151-5/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28961 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update sync tag.bircoph2009-03-151-1/+1
| | | | | | | All *.h files were actually changed in r28860. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28960 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove file names from file header, it only causes trouble.diego2009-03-159-13/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28959 b3059339-0415-0410-9bf9-f77b7e298cf2
* roff markup: Place \& after abbreviations like i.e. and e.g.diego2009-03-151-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28958 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete extra elements from opt_t struct initialization.diego2009-03-158-37/+37
| | | | | | | Fixes a bunch of 'excess elements in struct initializer' warnings. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28957 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of pointless preprocessor condition indirection and use ARCH_X86diego2009-03-152-23/+17
| | | | | | | directly instead of CAN_COMPILE_X86_ASM. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28956 b3059339-0415-0410-9bf9-f77b7e298cf2
* "MPlayer - The Movie Player" should be used as the player name.diego2009-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28955 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: typo fixdiego2009-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28954 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prefer ffdv over qdv, it seems qdv can not play some FFmpeg-encoded samples.reimar2009-03-151-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28953 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_THREADS should be initialized to 0, it is a 0/1 #define in FFmpeg.diego2009-03-151-1/+1
| | | | | | | patch by Dave Yeo, dave.r.yeo gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28952 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28950gpoirier2009-03-141-1/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28951 b3059339-0415-0410-9bf9-f77b7e298cf2
* KVA vo driver for OS/2, patch by KO Myung-Hun, komh chollian netdiego2009-03-146-0/+1139
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28950 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move page heading and table of contents out of the codec support table.diego2009-03-141-12/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28949 b3059339-0415-0410-9bf9-f77b7e298cf2
* Give table headings more meaningful names.diego2009-03-141-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28948 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify that -vo vdpau:deint=n delays video output for n>2 by one frame.cehoyos2009-03-141-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28947 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add /usr/X11R7 to the list of directories in which to search for X11 includesdiego2009-03-141-3/+5
| | | | | | | and libraries. patch by Bernd Ernesti, mplayer-dev-eng lists veego.de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28946 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only compile fastmemcpybench on x86.diego2009-03-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28945 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set DOCTYPE in xsl-generated HTML documentation.reimar2009-03-141-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28944 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the source buffer operands parametrized in the YSCALEYUV2RGB_YA macrosdrik2009-03-141-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28943 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for HAVE_EBX_AVAILABLE before enabling MMX code that needs the EBX ↵reimar2009-03-132-4/+4
| | | | | | | | | register. Makes things a bit simpler for everyone who insists on compiling MPlayer as PIE-code. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28942 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the same code as in vf_decimate to select diff_MMXreimar2009-03-131-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28941 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing ecx clobber in diff_MMX code (yes, that function is duplicated).reimar2009-03-132-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28940 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation with --charset=noconvreimar2009-03-131-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28939 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace duplicated code by a macro.diego2009-03-121-45/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28938 b3059339-0415-0410-9bf9-f77b7e298cf2
* add some info for acm and tips for searchingcompn2009-03-121-5/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28937 b3059339-0415-0410-9bf9-f77b7e298cf2
* SSE3 support patch by Zhou Zongyi, zhouzongyi pset.suntec netdiego2009-03-122-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28936 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use ScaledBorderAndShadow: yes by default.greg2009-03-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28935 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make MMX registers parametrized in the YSCALEYUV2PACKEDX_YA macrosdrik2009-03-111-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28934 b3059339-0415-0410-9bf9-f77b7e298cf2
* In initMMX2HScaler, when chrDstW is not divisible by 4, the last filterPos ↵sdrik2009-03-111-1/+1
| | | | | | element is initialized on the wrong index (not evenly aligned). This fixes it git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28933 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update email address for Vajna, Miklós.diego2009-03-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28932 b3059339-0415-0410-9bf9-f77b7e298cf2
* add sn40 binary codeccompn2009-03-101-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28931 b3059339-0415-0410-9bf9-f77b7e298cf2
* sn40 decodes with ffodivxcompn2009-03-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28930 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix and restructure fastmemcpybench. It is now one binary that runs alldiego2009-03-103-45/+140
| | | | | | | available memcpy variants and prints benchmark results about them. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28929 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo nuppelvideo spotted by kostyacompn2009-03-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28928 b3059339-0415-0410-9bf9-f77b7e298cf2
* Output number of reference frames before creating H264 vdpau decoder.cehoyos2009-03-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28927 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update entry for libdvdread; add entry for libdvdnav.diego2009-03-091-6/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28926 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Add newlines for better readability, rename Homepage entry to URL.diego2009-03-091-18/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28925 b3059339-0415-0410-9bf9-f77b7e298cf2
* GraphEdit is also available in the Microsoft SDK nowadays.diego2009-03-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28924 b3059339-0415-0410-9bf9-f77b7e298cf2
* typokraymer2009-03-091-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28923 b3059339-0415-0410-9bf9-f77b7e298cf2
* libmpdemux/nuppelvideo.h was removed.diego2009-03-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28922 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial further sync by patch by sevenfourk, sevenfourk gmail comdiego2009-03-091-0/+122
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28921 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ensure the string we're trying to compare is actually not NULL.ben2009-03-091-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28920 b3059339-0415-0410-9bf9-f77b7e298cf2
* The first valid index is total count - 1 (usually 0)ben2009-03-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28919 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not call waveOutReset in uninit if you should wait till playing finishes,reimar2009-03-091-1/+2
| | | | | | | and retry waveOutClose if it fails due to still playing. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28918 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reuse libavutil fifo code instead of reimplementing it over and over.reimar2009-03-092-133/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28917 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mask all unused bits for packed pixel format instead of green and alpha mask ↵kostya2009-03-091-1/+1
| | | | | | | | | | | only. That fixes the case when converting 15-bit RGB/BGR to YUV and high bit is set for input value(s). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28916 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of DEMUXER_TYPE_NUV define, it is no longer used.reimar2009-03-091-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28915 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of nuppelvideo.h and its ugly packed struct and instead write thereimar2009-03-092-98/+17
| | | | | | | frame header directly in nuv encoder. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28914 b3059339-0415-0410-9bf9-f77b7e298cf2
* people are forgetting to update the changelogcompn2009-03-091-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28913 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix type of zlen, fixes crashes on 64 bit systems.reimar2009-03-091-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28912 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not calculate the same value twicereimar2009-03-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28911 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allocate buffer for lzo compression correctly also for large frame sizes.reimar2009-03-091-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28910 b3059339-0415-0410-9bf9-f77b7e298cf2
* nuv encoder 64 bit fix: avoid using long/sizeof(long)reimar2009-03-091-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28909 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove now unused parts of nuppelvideo.hreimar2009-03-091-99/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28908 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove native nuv demuxer, it only needs more code to achieve the same thingreimar2009-03-094-465/+0
| | | | | | | as the libavformat demuxer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28907 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make fastmemcpybench almost working - only thing missing is a way toreimar2009-03-092-3/+4
| | | | | | | override HAVE_MMX etc. from config.h. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28906 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28895Gabrov2009-03-092-8/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28905 b3059339-0415-0410-9bf9-f77b7e298cf2
* comment/output cosmeticsdiego2009-03-091-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28904 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmetics:diego2009-03-091-74/+75
| | | | | | | | | - Remove all tabs and trailing whitespace. - Indent with 4 spaces. - K&R-ify and prettyprint some parts. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28903 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge two preprocessor conditions in order to drop one duplicated #else case.diego2009-03-091-9/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28902 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore all fastmem-* binaries.diego2009-03-090-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28901 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change default OSD/subtitle font sizes.greg2009-03-091-2/+2
| | | | | | | | | | This was discussed on -dev-eng and IRC. The consensus seems to be that 3-4% of the diagonal is a good default, and most people use something along these lines. The subtitle font size is set to 3.5% and the OSD is kept a little bigger with 4%. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28900 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix fastmemcpybench tools build:diego2009-03-091-11/+15
| | | | | | | | - HAVE_MMX and friends now have 0/1 values and are always defined. - Use proper file dependencies instead of a phony target. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28899 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28895gpoirier2009-03-081-6/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28898 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28895.bircoph2009-03-081-8/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28897 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: reindent.eugeni2009-03-081-25/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28896 b3059339-0415-0410-9bf9-f77b7e298cf2
* Treat -font/-subfont as Fontconfig pattern in libass.eugeni2009-03-089-17/+37
| | | | | | Patch by Adrian Stutz (adrian sttz ch). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28895 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add test for C memcpy()michael2009-03-082-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28894 b3059339-0415-0410-9bf9-f77b7e298cf2
* Resurrect script needed for easy use of fastmemcpybench.c.michael2009-03-081-0/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28893 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove extraneous braces.greg2009-03-081-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28892 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't assume width == stride for bitmap composition.greg2009-03-081-6/+8
| | | | | | Fixes http://bugzilla.mplayerhq.hu/show_bug.cgi?id=1421 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28891 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert michael2009-03-081-2/+2
| | | | | | | | | r3082 | michael | 2001-11-23 13:00:40 +0100 (Fri, 23 Nov 2001) | 2 lines missaligned arrays, as nick requested Reason: idiotic idea git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28890 b3059339-0415-0410-9bf9-f77b7e298cf2
* rtjpegn.c is only needed by the NuppelVideo encoder, change Makefile accordinglyreimar2009-03-081-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28889 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove internal NuppelVideo decoder, the code in libavcodec can decodereimar2009-03-087-1562/+0
| | | | | | | those files and some more and is far more maintainable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28888 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of pointless debugging codereimar2009-03-081-18/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28887 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove the grayscale and 4:2:2 RTjpeg code, it is neither used nor is therereimar2009-03-081-257/+0
| | | | | | | anything special about to to justify preserving it for documentation purposes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28886 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove colourspace-conversion stuff from rtjpeg, we have functions to do thatreimar2009-03-081-384/+0
| | | | | | | better and it doesn't belong in that file anyway. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28885 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark everything not used outside the file as "static"reimar2009-03-081-36/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28884 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove functions not used by MPlayer from headerreimar2009-03-081-15/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28883 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless "extern" in function declarations.reimar2009-03-081-22/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28882 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a small howto explaining how to cross-compile for MinGWreimar2009-03-081-0/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28881 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain that disabling other input methods is not the purpose of -slavereimar2009-03-081-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28880 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable from demux_mov.reimar2009-03-081-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28879 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an option to disable the default key binding that MPlayer includesreimar2009-03-082-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28878 b3059339-0415-0410-9bf9-f77b7e298cf2
* Bump etc/codecs.conf version to eliminate one possible cause when debugging ↵reimar2009-03-081-1/+1
| | | | | | VDPAU issues. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28877 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix clipping for pan-and-scan.greg2009-03-081-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28876 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a proper color check to the overlap compositing.greg2009-03-081-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28875 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace rotation functions with a simplified version adapted fromgreg2009-03-081-79/+40
| | | | | | | | vsfilter. This (mostly) fixes http://bugzilla.mplayerhq.hu/show_bug.cgi?id=1394#c7 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28874 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only use first \org in a line.greg2009-03-071-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28873 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: spelling fixesdiego2009-03-071-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28872 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Reformat file header.diego2009-03-071-8/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28871 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make pausing_keep_force the default for the set_mouse_pos and key_down_event -reimar2009-03-073-3/+13
| | | | | | | | | different behaviour is unlikely to make sense but it is better to handle this in input.c instead of adding special cases to mplayer.c and being able to override the default behaviour at least should not hurt. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28870 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update x264 version check for version required by lavc.reimar2009-03-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28869 b3059339-0415-0410-9bf9-f77b7e298cf2
* Let the 4th plane reach the swScale functionsdrik2009-03-071-6/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28868 b3059339-0415-0410-9bf9-f77b7e298cf2
* YUVA420P is a planar YUV formatsdrik2009-03-071-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28867 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce size of needlessly large mp3lib bandInfoStructreimar2009-03-071-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28866 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make several constant mp3lib tables constreimar2009-03-072-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28865 b3059339-0415-0410-9bf9-f77b7e298cf2
* Setting vo_fs is handled by x11_common.c, so remove that code from ↵reimar2009-03-072-4/+0
| | | | | | vo_xv/vo_xvmc. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28864 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make data related to suboption parsing const in libvoreimar2009-03-0717-20/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28863 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of the "set" member of the subopt-parser struct, it madereimar2009-03-062-14/+4
| | | | | | | | it impossible to make the those struct variables const. Also it is not really useful, and wastes space. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28862 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some "const" to mpcodecs_vd_driversreimar2009-03-062-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28861 b3059339-0415-0410-9bf9-f77b7e298cf2
* The large -help help_text should be const so it goes into .rodatareimar2009-03-0625-25/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28860 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make audio_out_* structs const so they end up in .rodatareimar2009-03-062-24/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28859 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make ao_info_t structs const.reimar2009-03-0623-23/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28858 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use code that is actually thread-safe to calculate delay, free space etc. in ↵reimar2009-03-061-10/+13
| | | | | | ao_win32 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28857 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: get rid of trailing whitespace.reimar2009-03-061-23/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28856 b3059339-0415-0410-9bf9-f77b7e298cf2
* get rid of full_buffers variable, if the check it is used for is triggeredreimar2009-03-061-9/+0
| | | | | | | something is seriously wrong and the ao will not work right anyway. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28855 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove now unused buf_write_pos variable from ao_win32reimar2009-03-061-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28854 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always write full buffers in ao_win32, except for the last block.reimar2009-03-061-8/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28853 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use calloc instead of malloc+memsetreimar2009-03-061-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28852 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28807gpoirier2009-03-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28851 b3059339-0415-0410-9bf9-f77b7e298cf2
* The 8 bit per sample formats are unsigned on Windows, fixes playback withreimar2009-03-062-2/+2
| | | | | | | | -af format=s8 for -ao dsound and -ao win32. Patch by Zhou Zongyi [zhouzongyi (at) pset suntec net] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28850 b3059339-0415-0410-9bf9-f77b7e298cf2
* Refactor smalltex/tinytex EOSD optimization in vo_glreimar2009-03-061-18/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28849 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove several useless casts from af_resamplereimar2009-03-061-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28848 b3059339-0415-0410-9bf9-f77b7e298cf2
* Free af->setup and contents in af_resample uninit function.reimar2009-03-061-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28847 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use calloc to allocate the af_resample ring buffers, reportedly usingreimar2009-03-061-1/+1
| | | | | | | | | non-zeroed buffers can cause initial noise, see -dev-eng: [PATCH]: Add missing memset after malloc in libaf/af_resample.c Wed, 4 Mar 2009 15:29:30 +0800 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28846 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a single malloc to allocate space for the circular buffers.reimar2009-03-061-5/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28845 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment typo fixes for af_resamplereimar2009-03-061-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28844 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify EOSD code by rendering it in VOCTRL_DRAW_EOSD instead of genEOSD,reimar2009-03-061-3/+2
| | | | | | | just like vo_vdpau. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28843 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicate OSD drawing introduced due to a conflict between r28840 and ↵reimar2009-03-061-3/+1
| | | | | | r28839. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28842 b3059339-0415-0410-9bf9-f77b7e298cf2
* Swap order of VFCTRL_DRAW_EOSD and VFCTRL_DRAW_OSD so that the EOSD is drawnreimar2009-03-061-1/+4
| | | | | | | | below the OSD and document possible issues when this is changed. Patch by Uoti (though originally intended for a different issue) with extra comment by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28841 b3059339-0415-0410-9bf9-f77b7e298cf2
* As for vo_gl, do not rely on draw_osd to render EOSD.reimar2009-03-061-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28840 b3059339-0415-0410-9bf9-f77b7e298cf2
* Draw EOSD with VOCTRL_DRAW_EOSD instead of along with OSD.greg2009-03-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28839 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not rely on draw_osd to render the EOSD, instead draw it already at thereimar2009-03-061-10/+15
| | | | | | | | end of genOSD. Fixes that the EOSD was drawn one frame too late. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28838 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix \be blur start position.greg2009-03-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28837 b3059339-0415-0410-9bf9-f77b7e298cf2
* Raise max. number of \be applications to 100, introduce #define for it.greg2009-03-061-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28836 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace magic numbers (for subpixel accuracy masking) with a define.greg2009-03-061-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28835 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use blur with kernel [[1,2,1], [2,4,2], [1,2,1]] for \be.greg2009-03-063-14/+34
| | | | | | This is faster than gaussian blur and similar to vsfilter. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28834 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync latest set of changes.diego2009-03-061-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28833 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync local changes file with #ifdef --> #if conversion.diego2009-03-062-45/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28832 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync local changes file with #ifdef --> #if conversion.diego2009-03-061-12/+219
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28831 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for extracting the release version number from a VERSION file.diego2009-03-051-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28830 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only add -Ilibdvdnav to the CFLAGS of the files that require it.diego2009-03-052-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28829 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sleep based on get_delay in ao_win32 uninit instead of a loop.reimar2009-03-051-1/+2
| | | | | | | The loop for an unknown reason could rarely cause an endless loop. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28828 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify CFLAGS generation for individual targets.diego2009-03-051-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28827 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update libass changelog.greg2009-03-051-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28826 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix bug introduced by me in r28756sdrik2009-03-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28825 b3059339-0415-0410-9bf9-f77b7e298cf2
* Combine adjacent overlapping, translucent glyph borders and shadows togreg2009-03-053-1/+177
| | | | | | | | avoid luminance build-up, which looks ugly. The resulting, modified bitmaps are stored in separate bitmap cache. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28824 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix positioned events' y-position when pan-and-scan is used.greg2009-03-051-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28823 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for subpixel accuracy of 3 bits for \pos and \move.greg2009-03-051-15/+20
| | | | | | | Also, restrict advance subpixel accuracy to 3 bits to reduce cache bloat. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28822 b3059339-0415-0410-9bf9-f77b7e298cf2
* Style override for ScaledBorderAndShadow.greg2009-03-051-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28821 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support ScaledBorderAndShadow property.greg2009-03-055-1/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28820 b3059339-0415-0410-9bf9-f77b7e298cf2
* Scale shadow displacement and blur size like border size.greg2009-03-051-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28819 b3059339-0415-0410-9bf9-f77b7e298cf2
* Round shadow displacement to nearest int.greg2009-03-051-4/+5
| | | | | | Use double for shadow displacement parameter. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28818 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support a vsfilter special case:greg2009-03-051-1/+7
| | | | | | | If PlayResX or Y is 1280/1024 respectively and the other PlayRes attribute isn't provided, use 1280/1024 for it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28817 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hack: half-merge glyph border with outline to avoid ugly anti-aliasinggreg2009-03-051-1/+1
| | | | | | in certain situations. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28816 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify some vidix dhahelper build commands with automatic make variables.diego2009-03-051-5/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28815 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore PlayResX/Y aspect ratio for font aspect ratio.greg2009-03-051-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28814 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28807Gabrov2009-03-051-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28813 b3059339-0415-0410-9bf9-f77b7e298cf2
* mphq now runs Subversion 1.5.diego2009-03-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28812 b3059339-0415-0410-9bf9-f77b7e298cf2
* full_buffers and buffered_bytes must be volatile because they are used fromreimar2009-03-051-2/+2
| | | | | | | | different threads, hopefully this fixes an uninit hang. The code still relies on luck for thread-safety though. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28811 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28807.bircoph2009-03-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28810 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure all output_surfaces are initialized in preinit.reimar2009-03-041-1/+1
| | | | | | | Patch by Dan Oscarsson [Dan Oscarsson (at) tietoenator com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28809 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rewrite of rgb15to32 and rgb16to32 using fewer asm instructions and setting ↵sdrik2009-03-041-38/+23
| | | | | | alpha channel to 0xFF git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28808 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Fix max value for -vo vdpau:deint.cehoyos2009-03-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28807 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure vo_x11_create_vo_window sets vo_dwidth and vo_dheight rightreimar2009-03-041-0/+6
| | | | | | | when we were in fullscreen mode and stay there. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28806 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mp_msg call with too few arguments.reimar2009-03-041-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28805 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove the rest of x86 asm from LGPL buildhenry2009-03-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28804 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, remove a pointless opt = NULL assignment that made print_int crash ↵reimar2009-03-031-1/+0
| | | | | | since r28794 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28803 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add back mistakenly removed copyright notice.diego2009-03-031-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28802 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add another hack to work-around the currently completely inconsistent way inreimar2009-03-031-1/+5
| | | | | | | which libavcodec sets AVCodecContext::pix_fmt. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28801 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28788Gabrov2009-03-031-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28800 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/ r28788gpoirier2009-03-021-7/+64
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28799 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28707gpoirier2009-03-021-172/+190
| | | | | | | Patch by %Cedric P Dumez-Viou A obs-nancay P fr% git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28798 b3059339-0415-0410-9bf9-f77b7e298cf2
* french punctuation cosmeticsgpoirier2009-03-021-50/+49
| | | | | | | Patch by %Cedric P Dumez-Viou A obs-nancay P fr% git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28797 b3059339-0415-0410-9bf9-f77b7e298cf2
* - french punctuation cosmetics that was done weeks before.gpoirier2009-03-021-14/+22
| | | | | | | | - sync with r23520 Patch by %Cedric P Dumez-Viou A obs-nancay P fr% git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28796 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make WinID a 64 bit integer, this should avoid issues with valid Windowreimar2009-03-023-3/+3
| | | | | | | handles on windows being interpreted as "no wid set". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28795 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a 64 bit integer type to the suboption parser.reimar2009-03-022-1/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28794 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use strtoll in parse_int to avoid discrepancies between 32 and 64 bit systems.reimar2009-03-021-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28793 b3059339-0415-0410-9bf9-f77b7e298cf2
* Minor cosmetics: fix indentationreimar2009-03-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28792 b3059339-0415-0410-9bf9-f77b7e298cf2
* import ffmpeg changelogcompn2009-03-021-13/+58
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28791 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28788.bircoph2009-03-021-3/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28790 b3059339-0415-0410-9bf9-f77b7e298cf2
* changescompn2009-03-021-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28789 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improve vdpau deinterlacing documentation.cehoyos2009-03-011-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28788 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a memory leak.eugeni2009-03-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28787 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document that -heartbeat-cmd is only for video, not audio-onlyreimar2009-03-011-0/+1
| | | | | | | (should this be changed?) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28786 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use UTF-8 as character set.diego2009-03-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28785 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove trailing whitespace.diego2009-03-011-25/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28784 b3059339-0415-0410-9bf9-f77b7e298cf2
* With pan-and-scan, keep positioned events in their original positionseugeni2009-03-011-1/+5
| | | | | | | | relative to video. Patch by Grigori Goronzy (greg chown ath cx). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28783 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary linking hack, compilation works fine without.diego2009-03-011-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28782 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove now unnecessary linking hacks.diego2009-03-011-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28781 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention VDPAU in Changelog.cehoyos2009-03-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28780 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add standard license headers to files.diego2009-03-0120-20/+381
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28779 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28775Gabrov2009-03-011-2/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28778 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in comments.rathann2009-03-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28777 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add warnings to yuv2rgb_vis.c because alpha is set wrong (0 instead of 255).reimar2009-03-011-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28776 b3059339-0415-0410-9bf9-f77b7e298cf2
* DART audio output driver for OS/2 by KO Myung-Hun, komh chollian netdiego2009-03-016-0/+381
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28775 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make AltiVec code write alpha as 255 instead of 0 when converting to RGBAreimar2009-03-011-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28774 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix braindead and broken way to calculate abase, fixes regression tests onreimar2009-03-011-1/+1
| | | | | | | big-endian systems. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28773 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 10l typo in ADD_ALL_EXESUFS function name.diego2009-03-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28772 b3059339-0415-0410-9bf9-f77b7e298cf2
* codec-cfg does not depend on codecs.conf.h, it is used to generate it.diego2009-03-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28771 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make all object files depend on generated header files.diego2009-03-011-4/+2
| | | | | | | | This solution does not record precise dependencies but is robust against header dependency changes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28770 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add explicit dependencies on generated header files for the object files alongdiego2009-03-011-1/+2
| | | | | | | | with the dependency information files. This fixes a straight build without generating dependency information. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28769 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix dependencies on generated header files for the codec* binaries.diego2009-03-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28768 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, replace a tab that slipped in.reimar2009-03-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28767 b3059339-0415-0410-9bf9-f77b7e298cf2
* Create a set_format_params function that sets all the special options neededreimar2009-03-011-19/+23
| | | | | | | | | for XvMC/VDPAU acceleration in a single place. This should get closer to working with selecting acceleration via pix_fmt instead of via a special codec for each method. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28766 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with en/mplayer.1 r28745jrash2009-03-011-39/+77
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28765 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use M_PI for pi.cehoyos2009-02-281-2/+3
| | | | | | | Suggested by Reimar. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28764 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make VdpVideoMixerAttribute attributes[] static const.cehoyos2009-02-281-1/+1
| | | | | | | Suggested by Reimar. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28763 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28745Gabrov2009-02-281-5/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28762 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Ivan (sevenfourk, sevenfourk gmail com)diego2009-02-281-189/+451
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28761 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support brightness, contrast, hue and saturation adjustments viacehoyos2009-02-281-2/+54
| | | | | | | | | custom color space conversion matrices in VDPAU. Patch by Grigori Goronzy, greg A chown D ath D cx git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28760 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix OSD for vo vdpau:deint>1.cehoyos2009-02-281-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28759 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle vdp_decoder_create failures better, in particular avoid unrelatedreimar2009-02-281-0/+5
| | | | | | | error messages and retry creating a decoder. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28758 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a possible NULL-pointer crash introduced by local changes to libfaad2reimar2009-02-282-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28757 b3059339-0415-0410-9bf9-f77b7e298cf2
* When converting from a non alpha format to an alpha format, defaults to all ↵sdrik2009-02-286-37/+40
| | | | | | ones rather than all zeroes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28756 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28745.bircoph2009-02-281-3/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28755 b3059339-0415-0410-9bf9-f77b7e298cf2
* Zero-fill glyph_info_t before use.eugeni2009-02-271-1/+1
| | | | | | Patch by Grigori G (greg chown ath cx). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28754 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused function argument.eugeni2009-02-273-44/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28753 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support fractional arguments for some override tags.eugeni2009-02-273-22/+40
| | | | | | | Done by parsing all integers as doubles first and then converting them to the nearest integer. Patch by Grigori G (greg chown ath cx). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28752 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix two gcc warnings.eugeni2009-02-271-2/+2
| | | | | | Patch by Grigori G (greg chown ath cx). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28751 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix memory leak produced by the \blur patch.eugeni2009-02-271-2/+2
| | | | | | Patch by Grigori G (greg chown ath cx). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28750 b3059339-0415-0410-9bf9-f77b7e298cf2
* Stronger blur.eugeni2009-02-271-0/+1
| | | | | | Patch by Grigori G (greg chown ath cx). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28749 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow shadow without border.eugeni2009-02-271-6/+3
| | | | | | Patch by Grigori G (greg chown ath cx). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28748 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an isALPHA macro to check if pixel format has alpha channelsdrik2009-02-271-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28747 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use YUV420P code path for YUVA420P where appropriatesdrik2009-02-271-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28746 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update vdpau:deint documentation.cehoyos2009-02-271-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28745 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not forget the chosen deinterlacer for -vo vdpau.cehoyos2009-02-271-0/+6
| | | | | | | | Make temporal deinterlacing standard when pressing "D" to activate deinterlacer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28744 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add one-field-only output for -vo vdpau.cehoyos2009-02-271-6/+7
| | | | | | | Change syntax of -vo vdpau:deint for the last time. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28743 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document that all vdpau deinterlacers respect -field-dominance.cehoyos2009-02-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28742 b3059339-0415-0410-9bf9-f77b7e298cf2
* Refactor code for upcoming alpha patches.cehoyos2009-02-271-40/+42
| | | | | | | Patch by Cédric Schieli, cschieli A gmail git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28741 b3059339-0415-0410-9bf9-f77b7e298cf2
* vdpau:pullup only works with temporal and temporal-spatial deinterlacing.cehoyos2009-02-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28740 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28736Gabrov2009-02-271-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28739 b3059339-0415-0410-9bf9-f77b7e298cf2
* r27801 Clarify screenw/screenh options, patch by Christian Ohm, chr.ohm gmx net.kraymer2009-02-261-18/+50
| | | | | | | | | | | | | | | r27872 Add a few more supported URL protocols r27895 Fix typo in psy-rd x264 option description. r27906 document x264's option subq=0, plus a bit of factoring and added details r27973 add direct3d docs, ok'd by Guillaume r27979 Make description of the option more clear r28056 Add a note about some known issues with -vo sdl r28095 Document missing vo_gl suboptions r28096 Using rectangle=2 for vo_gl is probably a good idea nowadays. r28126 Add support for writing PNG files with alpha channel in -vo png git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28738 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Remove debug printf() from last commit.cehoyos2009-02-261-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28737 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support "D" to (de-)activate deinterlacing when using vo vdpau.cehoyos2009-02-262-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28736 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document that -field-dominance also works for vdpau.cehoyos2009-02-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28735 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Add missing braces for VOCTRL_GET_EOSD_RES.cehoyos2009-02-251-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28734 b3059339-0415-0410-9bf9-f77b7e298cf2
* r27390 Fix a misleading section in the libavcodec options manualkraymer2009-02-251-52/+115
| | | | | | | | | | | | | | | | | | | r27407 Add video driver for Nintendo Wii/GameCube. r27454 Mention IVTV, S3 and SH_VEU drivers within VIDIX section of manpage. r27466 Document -lavcopts o, aka libavcodec AVOption. r27542 'mp3lame' audio output codec was wrongly listed as 'lame'. r27606 Make -heartbeat-cmd and -stop-xscreensaver sections reference each other. r27638 add lavfopts matroska suboption r27639 document lavc/lavf avoption o suboption r27650 add outdir sub-option to vo png r27690 whitespace cosmetics r27691 vo_fbdev now supports -geometry. r27768 update x264's section with r999 of x264 r27800 improve documentation of latest x264's options r27801 Clarify screenw/screenh options git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28733 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use memset to make sure all parts of struct sockaddr_in are always initialized.reimar2009-02-253-0/+4
| | | | | | | Problem reported by [kmkaplan+mplayer-dev-eng (at) kim kim-minh com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28732 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change code to actually work when NUM_OUTPUT_SURFACES is changed.reimar2009-02-251-9/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28731 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28727Gabrov2009-02-253-8/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28730 b3059339-0415-0410-9bf9-f77b7e298cf2
* copyright year update in man pagesGabrov2009-02-256-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28729 b3059339-0415-0410-9bf9-f77b7e298cf2
* Read revision string from the file snapshot_version if available.diego2009-02-241-1/+4
| | | | | | | This will be used by daily snapshots without Subversion metadata. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28728 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document -vo vdpau:pullup.cehoyos2009-02-241-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28727 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Use $() instead of ``, the former can be nested more easily.diego2009-02-241-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28726 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document -vo vdpau:deint.cehoyos2009-02-241-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28725 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: Fix indentation and line length.cehoyos2009-02-241-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28724 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename yuv2rgb2.c --> yuv2rgb.c.diego2009-02-242-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28723 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify -vo vdpau:sharpen.cehoyos2009-02-241-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28722 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document -vo vdpau:denoise.cehoyos2009-02-241-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28721 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document -vo vdpau:sharpen.cehoyos2009-02-241-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28720 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable Bob de-interlacing for VDPAU.cehoyos2009-02-241-13/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28719 b3059339-0415-0410-9bf9-f77b7e298cf2
* version bumpkraymer2009-02-241-9/+10
| | | | | | | contains some cosmetics from several in-between revisions git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28718 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense AltiVec optimizations as LGPL with the permission of Marc Hoffmandiego2009-02-241-8/+8
| | | | | | | and Reza Jelveh, the original authors. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28717 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove GPL version of yuv2rgb.c that has been replaced by an LGPL substitute.diego2009-02-241-780/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28716 b3059339-0415-0410-9bf9-f77b7e298cf2
* add Zhu Tian (JRaSH) as Chinese document translatorjrash2009-02-231-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28715 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with en/mplayer.1 r28576jrash2009-02-231-69/+173
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28714 b3059339-0415-0410-9bf9-f77b7e298cf2
* Calculate border size in aspect keeping code by using AdjustWindowRectreimar2009-02-231-5/+6
| | | | | | | | instead of GetClientRect and GetWindowRect since GetClientRect returns nonsensical values if Window is still minimized. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28713 b3059339-0415-0410-9bf9-f77b7e298cf2
* ffvc1vdpau and ffwmv3vdpau should be marked as buggy in the samereimar2009-02-231-2/+2
| | | | | | | | way as the software decoders, otherwise they will be preferred over the software decoders which just breaks things when using e.g. xv vo. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28712 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only check for vdp_video_mixer_destroy failure when we actually executed ↵reimar2009-02-231-2/+3
| | | | | | that function. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28711 b3059339-0415-0410-9bf9-f77b7e298cf2
* EOSD/ASS support for vo_vdpau.creimar2009-02-231-1/+187
| | | | | | | Patch by Grigori G (greg <at> chown ath cx) with minor cosmetic changes by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28710 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28707.bircoph2009-02-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28709 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28706.bircoph2009-02-231-5/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28708 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update faq about power management effect taking into account thatbircoph2009-02-231-1/+1
| | | | | | | -rtc is default no longer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28707 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update some statements:bircoph2009-02-231-3/+11
| | | | | | | | 1) Suggest larger read ahead buffer. 2) Note how sdparm may be used to adjust scsi device speed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28706 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28704.bircoph2009-02-231-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28705 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of the outdated and unmaintained CPU codename table.zuxy2009-02-232-589/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28704 b3059339-0415-0410-9bf9-f77b7e298cf2
* configure: Make the special dvdnav test the last one againuau2009-02-231-43/+47
| | | | | | | | | | | | | | The libdvdnav linker flag handling is hacky and can add flags that make any compile attempt using them fail unless MPlayer's internal dvdread has been compiled and is linked as a part of the resulting binary. For this reason no more tests using the common flags can be performed after the flags from the dvdnav test have been added. However the dvdnav test was no longer the last one despite some warning comments. Move it back to the last position and make the warnings a bit more explicit. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28703 b3059339-0415-0410-9bf9-f77b7e298cf2
* Accept DVB API 5, patch by Steven Brudenell, steven.brudenell gmail com.diego2009-02-221-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28702 b3059339-0415-0410-9bf9-f77b7e298cf2
* SwScaler now has new YUV2RGB table generatorkostya2009-02-221-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28701 b3059339-0415-0410-9bf9-f77b7e298cf2
* New LGPLed YUV2RGB table generator for SwScalerkostya2009-02-224-5/+685
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28700 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make alpha arch detection more lenient. Taken from the Debian patchset.diego2009-02-211-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28699 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_stats: Some fixes to the new filteruau2009-02-211-13/+14
| | | | | | | | The just committed af_stats was an older version of the patch with broken max volume calculation. Fix that and do some cleanup. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28698 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include "config.h", fixes the warning:diego2009-02-211-0/+1
| | | | | | | libaf/af.c:23:5: warning: "HAVE_MALLOC_H" is not defined git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28697 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add statistics audio filter that prints information about the audio stream.diego2009-02-215-0/+169
| | | | | | | patch by Nicolas George, nicolas.george normalesup org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28696 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set time_base to 1/samplerate, like FFmpeg does, instead of leaving it at thediego2009-02-211-0/+2
| | | | | | | | default 0/1. This is not required by a lot of codecs, but at least by libvorbis. patch by Nicolas George, nicolas.george normalesup org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28695 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add -ffast-math to LDFLAGS as well as to CFLAGS.diego2009-02-211-0/+1
| | | | | | | patch by Piotr Kaczuba, pepe attika.ath cx git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28694 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add forgotten type to variable declaration.reimar2009-02-211-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28693 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add HAVE_GETHRTIME and HAVE_INLINE_ASM definitions for FFmpeg.diego2009-02-211-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28692 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print the version string after the command line has been parsed.diego2009-02-211-1/+2
| | | | | | | | This allows printing the CPU information when verbose mode is triggered on the command line. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28691 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize some code in yuv2rgb_template.c to ease further yuva2rgb patch.cehoyos2009-02-211-158/+73
| | | | | | | Patch by Cédric Schieli, cschieli gmail git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28690 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move resetting audio_info_t samples, eof and error in ao_sun.c to reset(), ↵reimar2009-02-211-8/+9
| | | | | | | | | avoids duplication code from init() and fixes hangs after seeking. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28689 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, place vdpau below xv, it should not normally be preferred for ↵reimar2009-02-211-3/+3
| | | | | | auto-selection (yet). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28688 b3059339-0415-0410-9bf9-f77b7e298cf2
* move zeroing of alpha channel register out of YSCALEYUV2xxx macros,stefang2009-02-211-4/+23
| | | | | | | patch by Cédric Schieli (cschieli at gmail youknowwhat) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28687 b3059339-0415-0410-9bf9-f77b7e298cf2
* splits various YSCALEYUV2xxx macros into YSCALEYUV2xxx_UV,stefang2009-02-211-8/+27
| | | | | | | | YSCALEYUV2xxx_YA and YSCALEYUV2xxx_COEFF, patch by Cédric Schieli (cschieli at gmail youknowwhat) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28686 b3059339-0415-0410-9bf9-f77b7e298cf2
* make MMX registers parametrized in the WRITEBGR32 macro,stefang2009-02-211-24/+23
| | | | | | | patch by Cédric Schieli (cschieli at gmail youknowwhat) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28685 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics. Reindent to 4 spaces.iive2009-02-211-473/+473
| | | | | | | | Checked for equality with diff -w. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28684 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cleanup.iive2009-02-211-20/+2
| | | | | | | | Turn a number of if(mp_msg_test()) mp_msg(); into single mp_msg() git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28683 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28266.bircoph2009-02-211-51/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28682 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics. Remove all trailing whitespacesiive2009-02-211-61/+61
| | | | | | | and convert the few tabs into spaces. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28681 b3059339-0415-0410-9bf9-f77b7e298cf2
* Turn all remaining printf() into mp_msg().iive2009-02-201-84/+85
| | | | | | | Try to set appropriate levels for them. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28680 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cleanup.iive2009-02-201-53/+29
| | | | | | | Turn a number of if(mp_msg_test()) printf(); into normal mp_msg() git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28679 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics part2. Indent local variable definitions like the rest of the code.iive2009-02-201-55/+62
| | | | | | | Checked for equality by diff -wB . git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28678 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics part 1. Reindent to 4 spaces.iive2009-02-201-916/+916
| | | | | | | Checked for equality with diff -b. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28677 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment out "else" statement without following block.iive2009-02-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28676 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move libavcodec includes together.iive2009-02-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28675 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document that and why deinterlacing is not workingreimar2009-02-201-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28674 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for VDPAU deinterlacing, pullup, denoise and sharpening.reimar2009-02-201-5/+71
| | | | | | | | Deinterlacing can not yet be toggled at runtime, and actually it does not seem to work at all... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28673 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28670. (Copyright year update.)bircoph2009-02-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28672 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28670Gabrov2009-02-193-12/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28671 b3059339-0415-0410-9bf9-f77b7e298cf2
* update copyright year at the end of the man pageGabrov2009-02-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28670 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop official maintainership of ao_pulse since libpulseaudio still hasreimar2009-02-191-1/+1
| | | | | | | | no proper (i.e. complete) API documentation and too many bugs I am no longer willing to take responsibility for the ao. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28669 b3059339-0415-0410-9bf9-f77b7e298cf2
* Work around a PulseAudio bug that causes MPlayer to hang after unpausing.reimar2009-02-191-0/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28668 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try to update libvo.txtreimar2009-02-191-13/+64
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28667 b3059339-0415-0410-9bf9-f77b7e298cf2
* Re-add accidentally discarded comment about YUVJ format.reimar2009-02-191-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28666 b3059339-0415-0410-9bf9-f77b7e298cf2
* Be more robust against corrupted RM files that contain invalid packet lengthzuxy2009-02-191-1/+9
| | | | | | | by seeking to a known good place when index table is available. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28665 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add necessary header for ARCH_X86_64 preprocessor check.diego2009-02-191-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28664 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused and unreachable code hunk that was surrounded by a misspelleddiego2009-02-191-4/+0
| | | | | | | preprocessor condition. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28663 b3059339-0415-0410-9bf9-f77b7e298cf2
* Return PIX_FMT_NONE if the video system refuses all other formats.iive2009-02-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28662 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28660.bircoph2009-02-191-202/+162
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28661 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another outdated text in <screen> example.bircoph2009-02-191-1/+1
| | | | | | | Synced with currrent MSGTR_TooManyVideoInBuffer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28660 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove exclamation marks to make output similar to English version.bircoph2009-02-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28659 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix capitalization to be similar to English master file.bircoph2009-02-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28658 b3059339-0415-0410-9bf9-f77b7e298cf2
* Screen example for no audio problem is outdated:bircoph2009-02-191-4/+4
| | | | | | | | | | | | | The following MSGTR_* messages changed since then: MSGTR_AO_OSS_CantOpenDev MSGTR_CannotInitAO MSGTR_NoSound MSGTR_StartPlaying Expamle is updated as appropriate. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28657 b3059339-0415-0410-9bf9-f77b7e298cf2
* Spelling: capitalize pronouns.bircoph2009-02-191-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28656 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename the "src" parameter in the sws_scale() declaration tostefano2009-02-181-3/+3
| | | | | | | | "srcSlice" to stress the fact that it references a slice rather than an image. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28655 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document sws_scale().stefano2009-02-181-0/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28654 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace the dash sign by &mdash; tag.bircoph2009-02-181-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28653 b3059339-0415-0410-9bf9-f77b7e298cf2
* Exterminate one more trailing whitespace.bircoph2009-02-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28652 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with r26990.bircoph2009-02-181-21/+22
| | | | | | | Remove trailing whitespaces. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28651 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the same code to convert fps in float to fraction as used in mencoder,reimar2009-02-181-1/+1
| | | | | | | | it ensures all the common frame rates work right. If this causes issues, it should be changed in the same way in mencoder.c git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28650 b3059339-0415-0410-9bf9-f77b7e298cf2
* Current revision is in sync with r28645, because r28644 and r28645bircoph2009-02-181-1/+1
| | | | | | | doesn't affect Russian translation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28649 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore synchronization with r28618.bircoph2009-02-181-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28648 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert r28597 as requested by Diego in order to be cautious beforebircoph2009-02-181-5937/+5932
| | | | | | | relese. (Do not convert to UTF-8 for now.) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28647 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add VOCAP_NOSLICES and use it to allow vo_vdpau to not support slices forreimar2009-02-183-1/+7
| | | | | | | | YV12 - since VDPAU only has functions to upload the full frame at once there is no sense in supporting draw_slice for that. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28646 b3059339-0415-0410-9bf9-f77b7e298cf2
* Also shorten <channel> to <chan> in the description, not just in the example.diego2009-02-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28645 b3059339-0415-0410-9bf9-f77b7e298cf2
* Shorten one example line to avoid the groff warning:diego2009-02-181-1/+1
| | | | | | | | DOCS/man/en/mplayer.1:1905: warning [p 20, 5.7i, div `an-div', 0.0i]: cannot adjust line DOCS/man/en/mplayer.1:1905: warning [p 20, 5.7i]: cannot adjust line git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28644 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle mpcodecs_get_image returning NULL, FFmpeg most of the time handlesreimar2009-02-181-0/+1
| | | | | | | it correctly (VDPAU and probably H.264 currently don't, MPEG1/2 does etc.). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28643 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with r28618.bircoph2009-02-181-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28642 b3059339-0415-0410-9bf9-f77b7e298cf2
* AVR32 apparently supports fast unaligned accesses.diego2009-02-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28641 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set samplerate in reset also for AC3, and set it before the format in thatreimar2009-02-171-0/+2
| | | | | | | case (no idea why, but it is done this way in init, so it is consistent). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28640 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark all Linux RealVideo decoders as buggy, they all seem to have some problemreimar2009-02-171-3/+3
| | | | | | | on some systems. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28639 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make it possible for mpcodecs_get_image to return NULL as thereimar2009-02-171-1/+1
| | | | | | | documentation says it should instead of crashing. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28638 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print an error and return NULL in vf_get_image if we try to allocatereimar2009-02-171-1/+6
| | | | | | | | a format with bpp == 0, since this can not work. This way at least we crash earlier and print an error message. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28637 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set avctx->opaque already at init instead of decode so it can be used inreimar2009-02-171-1/+1
| | | | | | | | get_format and get_buffer would not crash if called during avcodec_open. Patch by Gwenole Beauchesne [gbeauchesne splitted-desktop com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28636 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo fixGabrov2009-02-171-2/+2
| | | | | | | Patch submitted directly to me by Rezso Pader (rezso at rezso dot net) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28635 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Replace unused 'argc/argv' in main declarations by 'void'.diego2009-02-173-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28634 b3059339-0415-0410-9bf9-f77b7e298cf2
* Extend calc_src_dst_rects to also calculate the border values needed forreimar2009-02-176-8/+30
| | | | | | | correctly placed dvdnav highlights, and fix direct3d and vdpau accordingly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28633 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: const static --> static const, avoids the debug mode warning:diego2009-02-171-1/+1
| | | | | | | cpuinfo.c:80: warning: 'static' is not at beginning of declaration git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28632 b3059339-0415-0410-9bf9-f77b7e298cf2
* Also set HAVE_EBP_AVAILABLE in debug mode.diego2009-02-171-0/+2
| | | | | | | patch by Gwenole Beauchesne, gbeauchesne splitted-desktop com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28631 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove stray empty lines.diego2009-02-171-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28630 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert HAVE_MALLOC_H into a 0/1 definition, fixes the warning:diego2009-02-1739-40/+40
| | | | | | | mem.c:32:5: warning: "HAVE_MALLOC_H" is not defined git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28629 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert HAVE_MEMALIGN into a 0/1 definition, fixes the warning:diego2009-02-173-3/+4
| | | | | | | mem.c:67:7: warning: "HAVE_MEMALIGN" is not defined git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28628 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after last commit.cehoyos2009-02-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28627 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cropping parameter to calc_src_dst_rects is constreimar2009-02-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28626 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, reset ass_border when switching out of fullscreen mode.reimar2009-02-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28625 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use FFmpeg instead of MPlayer MANGLE macro, they are equivalent in thisdiego2009-02-171-1/+0
| | | | | | | | | | | particular case. Avoids the warning: In file included from libmpcodecs/vf_fspp.c:693: ./mangle.h:34:1: warning: "MANGLE" redefined In file included from libmpcodecs/vf_fspp.c:46: ./libavutil/internal.h:113:1: warning: this is the location of the previous definition git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28624 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move FFmpeg #includes below all others so that they do not overridediego2009-02-171-6/+6
| | | | | | | | | | | | system functions and cause the warning: In file included from libmpcodecs/vf_fspp.c:57: libmpcodecs/mp_image.h: In function 'new_mp_image': libmpcodecs/mp_image.h:214: warning: implicit declaration of function 'please_use_av_malloc' libmpcodecs/mp_image.h: In function 'free_mp_image': libmpcodecs/mp_image.h:226: warning: implicit declaration of function 'please_use_av_free' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28623 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move libavutil #includes below all others so that they do not overridediego2009-02-171-2/+3
| | | | | | | | | system functions and cause the warning: In file included from mp3lib/sr1.c:27: /mp_msg.h:115: warning: 'please_use_av_log_instead_of_printf' is an unrecognized format function type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28622 b3059339-0415-0410-9bf9-f77b7e298cf2
* The CONFIG_TV_TELETEXT preprocessor directive is defined/undefined,diego2009-02-171-1/+1
| | | | | | | | so use it with #ifdef instead of #if; fixes the warning: libvo/sub.c:1233:5: warning: "CONFIG_TV_TELETEXT" is not defined git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28621 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation without VDPAUuau2009-02-172-2/+2
| | | | | | | | | | | | The commit adding vo_vdpau had two bugs that broke compilation when VDPAU was not enabled. - video_out.c used "#ifdef CONFIG_VDPAU", but it's always set to 0 or 1 - In configure, MPEG1_VDPAU_DECODER was dropped from the list of libavcodec codecs to disable when moving VDPAU-related ones from the always-disabled list to a conditinal one. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28620 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix #endif comment.cehoyos2009-02-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28619 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add note about ffwmv3vdpau.cehoyos2009-02-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28618 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for VDPAU video out, including hardware decoding.reimar2009-02-166-6/+866
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28617 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28615.bircoph2009-02-161-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28616 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add ccache usage suggestion to speed up compilation.bircoph2009-02-161-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28615 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, do 0-filling on resume (to avoid desync after pause) in ao_oss only whenreimar2009-02-161-1/+1
| | | | | | | the we output a PCM format, not for e.g. AC3. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28614 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use fixed-point implementation on avr32.diego2009-02-162-2/+2
| | | | | | | patch by Hans-Christian Egtvedt, hans-christian.egtvedt atmel com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28613 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make configure recognize avr32.diego2009-02-161-1/+7
| | | | | | | patch by Hans-Christian Egtvedt, hans-christian.egtvedt atmel com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28612 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace double semicolon by single semicolon.diego2009-02-168-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28611 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync renaming of xvmc struct members in FFmpeg.diego2009-02-161-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28610 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28593Gabrov2009-02-162-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28609 b3059339-0415-0410-9bf9-f77b7e298cf2
* The AV_XVMC_RENDER_MAGIC constant was renamed to AV_XVMC_ID in FFmpeg.diego2009-02-152-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28608 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reflect ffmpeg change of xvmc struct field to xvmc_id.iive2009-02-152-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28607 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix spelling: "whom" should be used instead of "which" when we'rebircoph2009-02-151-1/+1
| | | | | | | | talking about people. Mistake noticed by Paul Arthur flowerysong00 yahoo com. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28606 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove the reference to history.html because history.xml was purgedbircoph2009-02-151-4/+3
| | | | | | | from xml documentation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28605 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmetics: Remove all tabs and trailing whitespace.diego2009-02-151-75/+75
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28604 b3059339-0415-0410-9bf9-f77b7e298cf2
* The xvmc_pixfmt_render structure was renamed to xvmc_pix_fmt in FFmpeg.diego2009-02-152-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28603 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary #ifdef around internal #include.diego2009-02-151-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28602 b3059339-0415-0410-9bf9-f77b7e298cf2
* The xmvc structure member magic_id was renamed to unique_id.diego2009-02-152-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28601 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary #if around forward declaration.reimar2009-02-151-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28600 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restructure get_format so it can easily be extended to handle VDPAUreimar2009-02-151-7/+14
| | | | | | | and hardware-acceleration selected via get_format. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28599 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reuse the code for the general do_dr1 case to set get_buffer/release_buffer ↵reimar2009-02-151-3/+1
| | | | | | for XvMC. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28598 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change man page encoding from KOI8-R to UTF-8.bircoph2009-02-151-5932/+5932
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28597 b3059339-0415-0410-9bf9-f77b7e298cf2
* I hope this one is clearer and understandable.bircoph2009-02-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28596 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use PIX_FMT_NONE instead of -1reimar2009-02-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28595 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove apparently unneeded CODEC_FLAG_EMU_EDGE for XvMCreimar2009-02-151-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28594 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove trailing whitespaces.bircoph2009-02-152-20/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28593 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28201.bircoph2009-02-151-32/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28592 b3059339-0415-0410-9bf9-f77b7e298cf2
* Extend get_buffer to handle the XvMC case and remove mc_get_bufferreimar2009-02-151-93/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28591 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unset MP_IMGFLAG_IN_USE in release_buffer.reimar2009-02-151-0/+2
| | | | | | | | This is only needed for MPI_IMGTYPE_NUMBERED support and will probably first be used for VDPAU, but it is still "the right thing to do". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28590 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge two checks for mpi != NULLreimar2009-02-151-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28589 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the default release_buffer work for XvMC, use it and remove ↵reimar2009-02-151-33/+14
| | | | | | mc_release_buffer git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28588 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of mc_render_slice and use the generic draw_slice instead.reimar2009-02-151-20/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28587 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update info about contributions.bircoph2009-02-151-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28586 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a regression caused by r17933; RealMedia index tables could never be ↵zuxy2009-02-151-1/+1
| | | | | | printed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28585 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support seek in multirate RealMedia files.zuxy2009-02-151-32/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28584 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reflect the change of xvmc struct name.iive2009-02-152-23/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28583 b3059339-0415-0410-9bf9-f77b7e298cf2
* WMVA works with VDPAU, tooreimar2009-02-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28582 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move direct-rendering hack from vo_xvmc to vf_vo, so it does not need toreimar2009-02-152-2/+4
| | | | | | | be duplicated for other systems like VDPAU or VAAPI. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28581 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync fourccs for ffvc1vdpaureimar2009-02-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28580 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync fourcc list for ffmpeg12vdpaureimar2009-02-151-3/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28579 b3059339-0415-0410-9bf9-f77b7e298cf2
* Now xvmc struct uses magic_id fieldiive2009-02-152-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28578 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove display_flag remains as the member has been removed from the xvmc struct.iive2009-02-151-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28577 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of the trailing whitespaces.bircoph2009-02-151-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28576 b3059339-0415-0410-9bf9-f77b7e298cf2
* 'Capitalize' mplayer -> MPlayer when used as a project name.bircoph2009-02-151-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28575 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some more trailing whitespaces.bircoph2009-02-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28574 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of trailing whitespaces.bircoph2009-02-151-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28573 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix r28506.bircoph2009-02-151-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28572 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with r28520, 100% done.bircoph2009-02-151-21/+70
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28571 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some xvmc field initializations. They are not used byiive2009-02-141-2/+0
| | | | | | | | the libavcodec decoder. They are a copy of the queried surface and are meaningful only for pixel format selection, not during decoding. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28570 b3059339-0415-0410-9bf9-f77b7e298cf2
* timebomb made some swscale AltiVec fixescompn2009-02-141-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28569 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with r27979.bircoph2009-02-141-48/+69
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28568 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use sws_printVec2() instead of the deprecated sws_printVec(). stefano2009-02-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28567 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement sws_printVec2() and deprecate sws_printVec().stefano2009-02-142-7/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28566 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document sws_normalizeVec().stefano2009-02-141-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28565 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with r27639.bircoph2009-02-141-587/+725
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28564 b3059339-0415-0410-9bf9-f77b7e298cf2
* Actually it is in sync with SVN HEAD. bircoph2009-02-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28563 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use fmt-conversion.h in vd_ffmpeg.creimar2009-02-141-27/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28562 b3059339-0415-0410-9bf9-f77b7e298cf2
* Create a fmt-conversion.c file so fmt-conversion.h can be included by ↵reimar2009-02-143-66/+98
| | | | | | | | | multiple files. Also restructure the code so it provides a pixfmt2imgfmt function, too. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28561 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently place whitespace around * ( ) and ,reimar2009-02-141-70/+70
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28560 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless breakreimar2009-02-141-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28559 b3059339-0415-0410-9bf9-f77b7e298cf2
* Indentation and other whitespace fixesreimar2009-02-141-90/+90
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28558 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove local copy of xvmc_render.h, it is now an installed header in FFmpeg.diego2009-02-143-95/+20
| | | | | | | Also adapt MPlayer to definition name changes in libavcodec/xvmc.h. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28557 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make hScale_altivec_real() trim its output like other implementations dokostya2009-02-141-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28556 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some AltiVec functions in SwScaler produce different output than theirkostya2009-02-142-2/+4
| | | | | | | | counterparts in pure C, so don't invoke them in bitexact mode. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28555 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial update, patch by sevenfourk, sevenfourk gmail comdiego2009-02-141-31/+282
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28554 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace fprintf call by mp_msg, fixes the warning:diego2009-02-141-1/+2
| | | | | | | | | In file included from libmpcodecs/vf_fspp.c:58: libmpcodecs/mp_image.h: In function 'mp_image_setfmt': libmpcodecs/mp_image.h:207: warning: implicit declaration of function 'please_use_av_log_instead_of_fprintf' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28553 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: handle all special/compressed formats in a single if in ↵reimar2009-02-141-15/+4
| | | | | | mp_image_setfmt git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28552 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for image formats and codecs used by VDPAUreimar2009-02-145-0/+80
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28551 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add MP_IMGTYPE_NUMBERED which gives access to the kind of mp_image_t thatreimar2009-02-143-2/+25
| | | | | | | | | are numbered and have a "in use" flag which is necessary for proper buffer management as e.g. H.264 direct-rendering needs and is already used successfully for the -vo vdpau work-in-progress. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28550 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in German message.reimar2009-02-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28549 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28532Gabrov2009-02-125-98/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28548 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove now unused vo_calc_drwXY function.reimar2009-02-122-18/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28547 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a calc_src_dst_rects that calculates from window size, panscan etc.reimar2009-02-125-93/+99
| | | | | | | | | which part of the video source must be scaled onto which part of the window. Direct3D and (future) VDPAU need this, for XvMC it makes it easier to add cropping support and Xv is changed to keep the diff to XvMC small. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28546 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, removed a #ifdef the wrong way, CODEC_FLAG_NOT_TRUNCATED no longer exists,reimar2009-02-121-1/+0
| | | | | | | so remove reference to it to fix compilation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28545 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove trailing whitespace from vd_ffmpeg.reimar2009-02-121-34/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28544 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace tabs in vd_ffmpeg by 8 spaces to better match FFmpeg's coding style.reimar2009-02-121-179/+179
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28543 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove several #ifdefs that check for libavcodec features from vd_ffmpeg.reimar2009-02-121-14/+0
| | | | | | They make no sense since only recent libavcodec versions are supported anyway. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28542 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only set VO_EVENT_RESIZE if size actually changed, not if e.g. the window wasreimar2009-02-121-2/+6
| | | | | | | only moved to the foreground. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28541 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore errors from all rm commands in clean targets.diego2009-02-121-12/+12
| | | | | | | This way make will not stop on failure and remove as much as possible. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28540 b3059339-0415-0410-9bf9-f77b7e298cf2
* On clean/distclean, remove binaries with all types of executable suffixes.diego2009-02-122-17/+18
| | | | | | | This helps clean a tree completely before and after crosscompiling. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28539 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use addprefix and addsuffix functions to generate TOOLS variable.diego2009-02-121-10/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28538 b3059339-0415-0410-9bf9-f77b7e298cf2
* Apply misc fixes for sws_getCachedContext() documentation.stefano2009-02-121-7/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28537 b3059339-0415-0410-9bf9-f77b7e298cf2
* Bump micro version, related to r28491.stefano2009-02-121-1/+1
| | | | | | | | See the thread: "[FFmpeg-devel] [PATCH] Explicitely declare {dst, src}Format sws_get*Context() params as enum PixelFormat". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28536 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document sws_getContext().stefano2009-02-111-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28535 b3059339-0415-0410-9bf9-f77b7e298cf2
* Port check for 10 assembler operands support from FFmpeg.diego2009-02-111-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28534 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document sws_getIdentityVec().stefano2009-02-111-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28533 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert "advanced audio usage" into from a subsection to a chapter.diego2009-02-111-28/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28532 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace a mention of MPlayer by MEncoder in the MEncoder section.diego2009-02-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28531 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove outdated FAQ entries.diego2009-02-111-60/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28530 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary _UWIN #define.diego2009-02-111-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28529 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move sws_getGaussianVec() documentation from swscale.c to swscale.h.stefano2009-02-102-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28528 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document sws_cloneVec().stefano2009-02-101-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28527 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo: lenght -> length.stefano2009-02-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28526 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document sws_scaleVec().stefano2009-02-101-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28525 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document sws_getConstVec().stefano2009-02-101-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28524 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move documentation of sws_getCachedContext() from swscale.c tostefano2009-02-102-10/+10
| | | | | | | swscale.h. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28523 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless comment regarding sws_scale_ordered().stefano2009-02-101-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28522 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a @deprecated notice to swscale_get_ordered().stefano2009-02-101-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28521 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add priority support for OS/2 and factorize the Windows priority support.diego2009-02-109-49/+146
| | | | | | | patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28520 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add proper check for posix_memalign(), needed for FFmpeg.diego2009-02-101-1/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28519 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary emms Assembler instructions.diego2009-02-101-9/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28518 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removaldiego2009-02-106-726/+163
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28517 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removaldiego2009-02-106-692/+144
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28516 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removaldiego2009-02-106-710/+148
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28515 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removaldiego2009-02-093-272/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28514 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removaldiego2009-02-096-704/+144
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28513 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document coeff and length fields in SwsVector.stefano2009-02-091-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28512 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync x264 section renaming.diego2009-02-093-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28511 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use consistent names for codec installation sections.diego2009-02-092-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28510 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removaldiego2009-02-093-215/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28509 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removaldiego2009-02-095-839/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28508 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removaldiego2009-02-095-858/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28507 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removaldiego2009-02-095-829/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28506 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removaldiego2009-02-093-625/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28505 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with obsolete section removalsdiego2009-02-098-1316/+172
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28504 b3059339-0415-0410-9bf9-f77b7e298cf2
* change internal real video packetizing format to the more straight forward oneaurel2009-02-094-171/+62
| | | | | | | | see [MPlayer-dev-eng] [PATCH] cleanup/uniformize real video packetizing patch blessed by Roberto git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28503 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert #undefining system functions, it is not necessary.diego2009-02-091-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28502 b3059339-0415-0410-9bf9-f77b7e298cf2
* bruteforce partial sync with obsolete documentation removaldiego2009-02-0911-1935/+222
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28501 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add config.h #include for ARCH_X86 definition.diego2009-02-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28500 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add #undefs to reenable system functions that are normally forbidden in otherdiego2009-02-091-0/+7
| | | | | | | parts of FFmpeg but OK in this test program. Fixes the build. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28499 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop DECLARE_ALIGNED from extern declarations. It creates trouble whendiego2009-02-091-2/+2
| | | | | | | swscale_internal.h is #included without HAVE_AV_CONFIG_H defined. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28498 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use SetErrorMode so Windows will not show all kinds of error dialogsreimar2009-02-091-0/+2
| | | | | | we do not want. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28497 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prefix visible YUV2RGB functions with sws_kostya2009-02-096-16/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28496 b3059339-0415-0410-9bf9-f77b7e298cf2
* Give better name to Inverse_Table_6_9kostya2009-02-092-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28495 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove file name from file headers.diego2009-02-091-1/+1
| | | | | | | It provides no useful information and breaks on renames. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28494 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print information about detected CPU in verbose mode only.diego2009-02-091-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28493 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop the deprecated sws_scale_ordered() at the next major versionstefano2009-02-082-0/+4
| | | | | | | bump. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28492 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace int type with enum PixelFormat for the dstFormat/srcFormatstefano2009-02-081-3/+3
| | | | | | | | params of the sws_getContext() and sws_getCachedContext() declarations, consistent with the implementation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28491 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a typo: lumaSarpen -> lumaSharpen.stefano2009-02-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28490 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove leading underscore from all def_ variables.diego2009-02-081-797/+797
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28489 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add CONFIG_LIBAMR_NB_FIXED #define for FFmpeg to config.h.diego2009-02-081-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28488 b3059339-0415-0410-9bf9-f77b7e298cf2
* CONFIG_LIBAMR_NB/WB should be 0/1 #defines.diego2009-02-081-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28487 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix FFmpeg decoder info fields to be consistent.diego2009-02-081-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28486 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Drop redundant "decoder" from codec info fields.diego2009-02-081-91/+91
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28485 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28432Gabrov2009-02-083-165/+59
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28484 b3059339-0415-0410-9bf9-f77b7e298cf2
* Conditionally compile aclib.c instead of placing #ifdef around its content.diego2009-02-083-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28483 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add CONFIG_LIBVORBIS #define for FFmpeg to config.h.diego2009-02-081-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28482 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add standard license headers, unify header formatting.diego2009-02-0851-147/+976
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28481 b3059339-0415-0410-9bf9-f77b7e298cf2
* Give _XOPEN_SOURCE #define an explicit 600 value. Fixes build on Open Solaris.diego2009-02-073-3/+3
| | | | | | | patch by Imran Syed, freakabcd gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28480 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest FFmpeg changes.diego2009-02-071-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28479 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add config.h/config.mak bzlib variables missed in last commit.diego2009-02-071-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28478 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add bzlib check for FFmpeg.diego2009-02-071-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28477 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a couple of unused variable warnings through the av_unused attribute.diego2009-02-071-10/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28476 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert CONFIG_ZLIB into a 0/1 option.diego2009-02-073-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28475 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add READ_CACHE_TRACE #define for libdvdnav.diego2009-02-071-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28474 b3059339-0415-0410-9bf9-f77b7e298cf2
* In case of several \move or \pos in one line, prefer the first one.eugeni2009-02-071-8/+12
| | | | | | Patch by Grigori G, greg at chown ath cx. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28473 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add stubs for a few unimplemented tags.eugeni2009-02-071-1/+39
| | | | | | Patch by Grigori G, greg at chown ath cx. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28472 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow \be with arguments other than 0 or 1. Implement \blur.eugeni2009-02-074-20/+63
| | | | | | Patch by Grigori G, greg at chown ath cx. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28471 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28415gpoirier2009-02-051-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28470 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid message spam during video adapter uncooperative state.gogothebee2009-02-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28469 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify info/error messages to a common style:gogothebee2009-02-051-43/+43
| | | | | | | <vo_direct3d> in the beginning, "." at the end. Shorter/more descriptive sentences. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28468 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print an error message when given insufficient parameters.diego2009-02-041-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28467 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Regroup some FFmpeg config.h options.diego2009-02-041-8/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28466 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add proper check for arpa/inet.h.diego2009-02-041-5/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28465 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove stray tab.diego2009-02-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28464 b3059339-0415-0410-9bf9-f77b7e298cf2
* We use libdvdcss 1.2.10, not 1.2.9.diego2009-02-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28463 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not hardcode HAVE_DOS_PATHS, set it by OS instead.diego2009-02-041-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28462 b3059339-0415-0410-9bf9-f77b7e298cf2
* add automatic hw acceleration for vo gl entrycompn2009-02-031-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28461 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hack: fix MINGW compilation by hard-coding HAVE_ARPA_INET_Hreimar2009-02-031-0/+4
| | | | | | to 0 if __MINGW32__ is defined. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28460 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add [gl] in front of vo_gl messagereimar2009-02-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28459 b3059339-0415-0410-9bf9-f77b7e298cf2
* Latest 9.1 ATI drivers finally fixed PBOs, thus do not need ati-hack and are ↵reimar2009-02-031-1/+10
| | | | | | | | | much faster without it. Change autodetection accordingly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28458 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add checks that a D3D device is available before attempting rendering.reimar2009-02-031-1/+16
| | | | | | | | | We may have lost the device e.g. because it became uncooperative e.g. when using remote desktop or Vista's UAC is activated. Patch by Georgi Petrov [gogothebee gmail com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28457 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove the Present call after adapter reinitialization, it can not work anywayreimar2009-02-031-4/+0
| | | | | | | since no video frame is uploaded to the new context yet. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28456 b3059339-0415-0410-9bf9-f77b7e298cf2
* swab() needs _XOPEN_SOURCE to be defined.reimar2009-02-033-0/+3
| | | | | | | Fixes two implicit declaration warnings. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28455 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: remove empty line, improve some messages.reimar2009-02-031-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28454 b3059339-0415-0410-9bf9-f77b7e298cf2
* Whitespace/comment typo cosmetics.reimar2009-02-031-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28453 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for change_d3d_backbuffer failure.reimar2009-02-031-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28452 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix several return valuesreimar2009-02-031-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28451 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename lzo1x_decode -> av_lzo1x_decode, this was missed in the previous patch.reimar2009-02-031-2/+2
| | | | | | | | It currently works (though badly with missing prototype) but will break on libavutil version bump. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28450 b3059339-0415-0410-9bf9-f77b7e298cf2
* FFmpeg sync: LZO_OUTPUT_PADDING --> AV_LZO_OUTPUT_PADDINGdiego2009-02-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28449 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adapt to lzo changes in libavutilreimar2009-02-022-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28448 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert CONFIG_XVMC into a 0/1 definition.zuxy2009-02-021-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28447 b3059339-0415-0410-9bf9-f77b7e298cf2
* Chinese manpage is actually simplified Chinese (zh_CN), so rename the manpagerathann2009-02-012-1/+1
| | | | | | | | directory to reflect that. Also update configure to handle two-part lang codes for manpages. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28446 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not print a warning if current pts is equal to previous pts.diego2009-02-011-2/+2
| | | | | | | patch by Dennis Vshivkov, jaimor orcon net nz git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28445 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove period after copyright statement non-sentence.diego2009-02-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28444 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_WINSOCK2_H is now a 0/1 definition.diego2009-02-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28443 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify inet_pton/inet_aton checks.diego2009-02-011-18/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28442 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some more definitions for FFmpeg to config.h.diego2009-02-011-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28441 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix indentation after last commit.diego2009-02-011-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28440 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restructure network tests: Always check for both inet_aton and inet_pton.diego2009-02-014-53/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28439 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_DCBZL should be a 0/1 definition.diego2009-02-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28438 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert HAVE_WINSOCK2_H into a 0/1 definition.diego2009-02-0120-41/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28437 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless #ifdef around internal header includes.diego2009-02-011-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28436 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_ATON --> HAVE_INET_ATON to match FFmpeg and give it a 0/1 value.diego2009-02-014-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28435 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert HAVE_CLOSESOCKET and HAVE_SOCKLEN_T into 0/1 definitions.diego2009-02-012-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28434 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a few more #defines for FFmpeg to config.h.diego2009-02-011-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28433 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reminder for Dominik to update the RPM packaging section.diego2009-02-011-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28432 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename "ARM" section to "ARM Linux".diego2009-02-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28431 b3059339-0415-0410-9bf9-f77b7e298cf2
* CONFIG_LIB* are defined as 0/1 in FFmpeg.diego2009-02-011-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28430 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move QNX subsection to commercial Unix section.diego2009-02-011-32/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28429 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move note about binary packages to the top section.diego2009-02-011-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28428 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reword beginning of MinGW section.diego2009-02-011-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28427 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove Amiga/MorphOS section, it only contained outdated information.diego2009-02-011-35/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28426 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove hints about specific binary packages, add a link to the listdiego2009-02-011-19/+3
| | | | | | | of unofficial packages on our homepage instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28425 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove IRIX section, the advice it contained is now obsolete.diego2009-02-011-28/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28424 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove -c option from install commands. It is ignored by GNU install anddiego2009-02-011-2/+2
| | | | | | | incompatible with some other install commands. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28423 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a note about POSIX system requirements.diego2009-02-012-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28422 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert Solaris PATH modification workaround.diego2009-02-011-3/+0
| | | | | | | It is incomplete anyway and configure should not fiddle with user configuration. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28421 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a note about adding /usr/xpg4/bin to your PATH on Solaris.diego2009-02-011-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28420 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove remarks about GNU Make being required on some systems.diego2009-02-011-24/+1
| | | | | | | GNU Make 3.81 or later is required everywhere. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28419 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move GNU Make entry to the top of the list.diego2009-02-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28418 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update binutils and compiler sections.diego2009-02-011-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28417 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add CONFIG_FASTDIV and CONFIG_POWERPC_PERF to config.h for FFmpeg compilation.diego2009-02-011-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28416 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for libavcodec GMC flag, patch by Dave Baker, dbkr mxtelecom com.diego2009-02-012-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28415 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use full internal pathname in doxygen @file directives.diego2009-02-011-1/+1
| | | | | | | | Otherwise doxygen complains about ambiguous filenames when files exist under the same name in different subdirectories. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28414 b3059339-0415-0410-9bf9-f77b7e298cf2
* increase max OSD message size limitcompn2009-02-011-6/+6
| | | | | | | patch by Scaevolus on irc git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28413 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set a sane default path on Solaris.diego2009-01-311-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28412 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move memalign_hack define next to other FFmpeg defines in config.h.diego2009-01-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28411 b3059339-0415-0410-9bf9-f77b7e298cf2
* Slightly simplify VIDIX_PCI_FILES command.diego2009-01-311-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28410 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure CONFIG_MEMALIGN_HACK is always #defined.diego2009-01-311-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28409 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure HAVE_ALTIVEC_H is always #defined.diego2009-01-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28408 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure HAVE_FAST_64BIT is always #defined.diego2009-01-311-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28407 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add bswap check, needed for FFmpeg.diego2009-01-311-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28406 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add #define HAVE_DLFCN_H to config.h, libdvdread4 needs it.diego2009-01-311-1/+1
| | | | | | | Fixes Bugzilla #1399. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28405 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_LRINT and friends should be defined to 0/1.diego2009-01-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28404 b3059339-0415-0410-9bf9-f77b7e298cf2
* command.c: Fix some commands crashing during audio-only playbackuau2009-01-311-0/+4
| | | | | | | | | | The SWITCH_RATIO and VF_CHANGE_RECTANGLE cases crashed if the user gave those commands when there was no video stream. Make them no-op instead. Patch by ShadowJK git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28403 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make CONFIG_XVMC a proper FFmpeg-style 0/1 definition.diego2009-01-302-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28402 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add CONFIG_SWSCALE to config.h, we always enable the software scaler.diego2009-01-301-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28401 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add 4 more config.h #defines for libfaad2.diego2009-01-301-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28400 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use OS preprocessor checks with '#if defined()' consistently.diego2009-01-302-20/+10
| | | | | | | Avoids undefined preprocessor directives warnings. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28399 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings about undefined preprocessor directives.diego2009-01-301-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28398 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1) HAVE_SYS_ASOUNDLIB_H/HAVE_ALSA_ASOUNDLIB_H are defined to 0/1,diego2009-01-302-3/+4
| | | | | | | | not defined/undefined, use them accordingly. 2) Add ESD definitions to avoid undefined preprocessor directives warnings. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28397 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert mistaken #ifdef --> #if change.diego2009-01-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28396 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update libavcodec 'aic' flag define to match current FFmpeg.diego2009-01-301-2/+2
| | | | | | | patch by Dave Baker, dbkr mxtelecom com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28395 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_ARMV6 is defined to 0/1, use the preprocessor directive accordingly.diego2009-01-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28394 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add -Wundef to CFLAGS.diego2009-01-301-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28393 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable RDFT in FFmpeg, some codecs depend on it.diego2009-01-301-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28392 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable internal dvdread support on OS/2.diego2009-01-301-1/+1
| | | | | | | patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28391 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move setting of O_NONBLOCK before lirc_readconfig, this avoids a memleakreimar2009-01-301-7/+7
| | | | | | | due to not freeing the lirc config on error. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28390 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix an MSGT_INPUT to MSGT_LIRC in lirc.creimar2009-01-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28389 b3059339-0415-0410-9bf9-f77b7e298cf2
* add pvez to truemotion 1compn2009-01-291-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28388 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove sys/timeb.h includecompn2009-01-291-1/+0
| | | | | | | | | fixes compilation on uClibc based i386 system patch by Markus Heidelberg markus(x.x)heidelberg(x@x)web(x.x)de ok'd by diego git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28387 b3059339-0415-0410-9bf9-f77b7e298cf2
* increase max glyph and lines limitcompn2009-01-291-2/+2
| | | | | | | | patch by Scaevolus on irc fixes http://samples.mplayerhq.hu/Matroska/subtitles/090128_gszs02.mkv git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28386 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use single quotes to avoid escaping double quotes in a string.diego2009-01-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28385 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use cat instead of echo to generate version.h.diego2009-01-291-2/+4
| | | | | | | Portably echoing backslashes is near impossible. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28384 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove superfluous backslash escapes that caused unintended escapes.diego2009-01-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28383 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid a division by 0 when using -oac mp3lame but no audio data actually is ↵reimar2009-01-281-0/+1
| | | | | | encoded. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28382 b3059339-0415-0410-9bf9-f77b7e298cf2
* increase max subtitle stream limitcompn2009-01-281-1/+1
| | | | | | | patch by henryk (irc) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28381 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use select n lirc code, instead set the fd non-blocking.reimar2009-01-271-18/+10
| | | | | | | | | select can not work because lirc_nextcode buffers data internally, causing events to be delayed until the next keypress in some cases. Patch by Dennis Vshivkov [jaimor (at) orcon net nz] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28380 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allocate a larger backbuffer to allow resizing without reinit.reimar2009-01-271-43/+113
| | | | | | | Patch by Georgi Petrov [gogothebee gmail com] and Jim Hauxwell [james (at) dattrax co uk] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28379 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add standard license headers.diego2009-01-2613-29/+265
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28378 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace another bunch of '#if HAVE_FOO' preprocessor checks by 'if (HAVE_FOO)'.diego2009-01-261-22/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28377 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not duplicate VERSION string.diego2009-01-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28376 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace a bunch of '#if HAVE_FOO' preprocessor checks by 'if (HAVE_FOO)'.diego2009-01-261-16/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28375 b3059339-0415-0410-9bf9-f77b7e298cf2
* WORDS_BIGENDIAN is defined/undefined, not 0/1.diego2009-01-265-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28374 b3059339-0415-0410-9bf9-f77b7e298cf2
* some more HAVE_3DNOW --> HAVE_AMD3DNOWdiego2009-01-261-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28373 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop HAVE_LRINTF check, lrintf is used without checking in other places.diego2009-01-261-8/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28372 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_LRINTF is now always defined to either 0 or 1, not defined/undefined.diego2009-01-262-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28371 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_3DNOW --> HAVE_AMD3DNOWdiego2009-01-2618-100/+100
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28370 b3059339-0415-0410-9bf9-f77b7e298cf2
* version.h depends on version.sh.diego2009-01-261-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28369 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix build: Add required header and adjust preprocessor check.diego2009-01-251-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28368 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop dev- prefix from printed version number, just SVN-rXXXXX is enough.diego2009-01-251-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28367 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add SSSE3 and CMOV to CPU information printed on startup.diego2009-01-251-2/+8
| | | | | | | Fixes Bugzilla #1378. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28366 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Consistently name 3DNow! extensions.diego2009-01-251-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28365 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after DECLARE_ASM_CONST/DECLARE_ALIGNED moving within FFmpeg.diego2009-01-252-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28364 b3059339-0415-0410-9bf9-f77b7e298cf2
* DECLARE_ALIGNED was moved in FFmpeg.diego2009-01-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28363 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after DECLARE_ASM_CONST/DECLARE_ALIGNED moving within FFmpeg.diego2009-01-253-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28362 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_3DNOWEX --> HAVE_3DNOWEXTdiego2009-01-259-33/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28361 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize print_version().diego2009-01-256-82/+51
| | | | | | | Print CPU information in verbose mode instead of by default. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28360 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing multiple inclusion guards.diego2009-01-251-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28359 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_3DNOW --> HAVE_AMD3DNOW to sync with latest configure changes.diego2009-01-256-31/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28358 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header for av_gcd, fixes the warning:diego2009-01-251-0/+1
| | | | | | | libaf/af_resample.c:204: warning: implicit declaration of function 'av_gcd' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28357 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo: pool -> pollreimar2009-01-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28356 b3059339-0415-0410-9bf9-f77b7e298cf2
* Actually abort (return NULL) in the alloc-failure check in play_tree_newreimar2009-01-251-1/+3
| | | | | | | | instead of going right ahead and crashing. Patch by Luis Felipe Strano Moraes (luis strano gmail com). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28355 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a NULL-check that used && instead of || and thus could not avoid crashes.reimar2009-01-251-1/+1
| | | | | | | Patch by Luis Felipe Strano Moraes (luis strano gmail com). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28354 b3059339-0415-0410-9bf9-f77b7e298cf2
* Declare struct SwsContext before using it, fixes the checkheaders warning:diego2009-01-251-0/+2
| | | | | | | | libswscale/swscale_internal.h:58: warning: `struct SwsContext' declared inside parameter list libswscale/swscale_internal.h:58: warning: its scope is only this definition or declaration, which is probably not what you want git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28353 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable C code when compiling AltiVec code, fixes the warning:diego2009-01-251-0/+1
| | | | | | | swscale_template.c:2623: warning: `swScale_C' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28352 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/grammar cosmeticsdiego2009-01-251-48/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28351 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix #endif comments.diego2009-01-251-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28350 b3059339-0415-0410-9bf9-f77b7e298cf2
* add "<!DOCTYPE smil" to smil playlistcompn2009-01-241-0/+2
| | | | | | | patch by Gavin McCullagh gmccullagh!gmail!com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28349 b3059339-0415-0410-9bf9-f77b7e298cf2
* in parse_pat() IDENTIFY program number and pmt_pidnicodvb2009-01-221-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28348 b3059339-0415-0410-9bf9-f77b7e298cf2
* The homepage/ subdirectory should no longer be redirected on web mirrors.diego2009-01-201-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28347 b3059339-0415-0410-9bf9-f77b7e298cf2
* add EPHV to ffodivx,xvidcompn2009-01-201-0/+12
| | | | | | | | add T263 to ffh263 add MFZ0 binary codec Moyea Flash to Video Converter git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28346 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28341gpoirier2009-01-201-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28345 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add PIX_FMT_VDPAU_WMV3 and PIX_FMT_VDPAU_VC1.cehoyos2009-01-201-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28344 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable upcoming VC1/WMV3 VDPAU decoder.cehoyos2009-01-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28343 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove pointless period after copyright statement non-sentences.diego2009-01-197-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28342 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix device_id option after r28165gpoirier2009-01-182-8/+8
| | | | | | | | | | patch by Adrian Stutz %adrian A sttz P ch% Original thread: date Fri, Jan 9, 2009 at 4:03 PM subject [MPlayer-dev-eng] [PATCH] vo_macosx: fix device_id option after r28165 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28341 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce QuickTime binary decoder verbosity.diego2009-01-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28340 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPlayer only supports latest libavutil.cehoyos2009-01-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28339 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation: s/ff_gcd/av_gcd.cehoyos2009-01-172-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28338 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, forgot to delete two defines left over from old HAVE_MMX handling code.reimar2009-01-161-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28337 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compilation without VDPAU decodersgpoirier2009-01-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28336 b3059339-0415-0410-9bf9-f77b7e298cf2
* add mimic in avi fourcc LM20 to ffmimiccompn2009-01-161-0/+17
| | | | | | | | MidiVid3 binary decoder for MV30 Telegeny binary decoder for VDTZ git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28335 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert #ifdef WORDS_BIGENDIAN => #if WORDS_BIGENDIAN changes from r28331gpoirier2009-01-164-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28334 b3059339-0415-0410-9bf9-f77b7e298cf2
* Completely get rid of MMX define, use HAVE_MMX define instead.gpoirier2009-01-161-28/+25
| | | | | | | Patch by Guillaume LECERF % foxcore A gmail P com % git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28333 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix wrong #ifdef/#ifndef -> #if conversion in r28323gpoirier2009-01-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28332 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compilation on non x86 machines (PPC here)gpoirier2009-01-165-27/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28331 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a wrongly converted !defined(ARCH_X86_64)reimar2009-01-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28330 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, mixed up ao_data.samplerate and ao_data.bps when calculating sleep time.reimar2009-01-161-1/+1
| | | | | | | Fixes stuttering audio when playing audio-only files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28329 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another missed #ifdef HAVE_MMXreimar2009-01-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28328 b3059339-0415-0410-9bf9-f77b7e298cf2
* More #ifdef HAVE_MMX etc. missed by earlier search.reimar2009-01-164-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28327 b3059339-0415-0410-9bf9-f77b7e298cf2
* More #ifdef -> #if fixesreimar2009-01-164-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28326 b3059339-0415-0410-9bf9-f77b7e298cf2
* Lots and lots of #ifdef ARCH_... -> #if ARCH_...reimar2009-01-1646-215/+271
| | | | | | | | and #ifdef HAVE_MMX etc -> #if HAVE_MMX. There might be still more that need to be fixed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28325 b3059339-0415-0410-9bf9-f77b7e298cf2
* More #ifdef -> #ifreimar2009-01-162-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28324 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix first handful of #if vs. #ifdef for ARCH_, HAVE_SSE etc.reimar2009-01-162-23/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28323 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add VDPAU hardware accelerated decoding for MPEG1 and MPEG2 which willcehoyos2009-01-161-0/+4
| | | | | | | | | be used by MPlayer. Original patch by NVIDIA corporation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28322 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable upcoming MPEG_VDPAU_DECODER.cehoyos2009-01-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28321 b3059339-0415-0410-9bf9-f77b7e298cf2
* one more ARCH_ARMV4L --> ARCH_ARM, patch by Guillaume Lecerf, foxcore gmail comdiego2009-01-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28320 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28279gpoirier2009-01-151-9/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28319 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of now unused FFmpeg ENABLE_ preprocessor directives.diego2009-01-151-17/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28318 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest FFmpeg changes: #define disabled preprocessor directivesdiego2009-01-151-1/+2
| | | | | | | used by FFmpeg to 0 instead of leaving them undefined. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28317 b3059339-0415-0410-9bf9-f77b7e298cf2
* Treat mlib as a normal FFmpeg option, not a CPU extension.diego2009-01-151-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28316 b3059339-0415-0410-9bf9-f77b7e298cf2
* Treat SH architecture like SH4 like in FFmpeg, the only place it is used.diego2009-01-151-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28315 b3059339-0415-0410-9bf9-f77b7e298cf2
* SH4 is not a CPU extension mechanism.diego2009-01-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28314 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark internal libraries as such in the configure summary, fixes Bugzilla #1378.diego2009-01-151-7/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28313 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update copyright year, patch by Zhou Zongyi, zhouzongyi pset.suntec net.diego2009-01-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28312 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change semantic of CONFIG_*, HAVE_* and ARCH_*.aurel2009-01-148-186/+195
| | | | | | | They are now always defined to either 0 or 1. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28311 b3059339-0415-0410-9bf9-f77b7e298cf2
* add SLMJ fourcc to ffmjpegcompn2009-01-131-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28310 b3059339-0415-0410-9bf9-f77b7e298cf2
* add binary codecs:compn2009-01-131-0/+32
| | | | | | | | | | Forward JPEG Video Codec (FRWD) Forward JPEG+Alpha Video Codec (FRWT) Forward Uncompressed Video Codec (FRWU) DideoNET SMV2 Codec (SMV2) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28309 b3059339-0415-0410-9bf9-f77b7e298cf2
* add nsvideo (NSVI) binary codec. works on uncommon samples listcompn2009-01-131-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28308 b3059339-0415-0410-9bf9-f77b7e298cf2
* add yamaha adpcm ffmpeg codec, works on samplecompn2009-01-131-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28307 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update copyright year.diego2009-01-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28306 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest FFmpeg changes: Check for the availability of truncf().diego2009-01-111-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28305 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/grammar/wording/whitespacediego2009-01-111-77/+79
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28304 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix d_width vs. d_height typo.diego2009-01-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28303 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix decvideo vs. dec_video typo noticed by Vineeth N, nvineeth gmail com.diego2009-01-111-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28302 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove outdated comment.diego2009-01-111-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28301 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move CPU byte order check to a more sensible place.diego2009-01-111-26/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28300 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only check for YASM support on x86 systems.diego2009-01-111-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28299 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move some checks to more logical places.diego2009-01-111-83/+87
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28298 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed remaining english wordptt2009-01-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28297 b3059339-0415-0410-9bf9-f77b7e298cf2
* console output cosmeticsdiego2009-01-111-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28296 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only print "using XYZ" comment if XYZ has been set.diego2009-01-111-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28295 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing const qualifier to mpctx_get_audio_out function declaration.diego2009-01-101-1/+1
| | | | | | | | This fixes the warning: mplayer.c:381: warning: return discards qualifiers from pointer target type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28294 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28279Gabrov2009-01-101-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28293 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindent for "if" added in internal dvdnav patchreimar2009-01-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28292 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support an "internal" dvdnav version to make it easier to compile with,reimar2009-01-102-2/+23
| | | | | | | test and debug dvdnav SVN. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28291 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change vo_draw_text to a vo_draw_text_ext function which draws DVD navigationreimar2009-01-103-11/+45
| | | | | | | highlights at the correct position with the high-resolution OSD of -vo gl. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28290 b3059339-0415-0410-9bf9-f77b7e298cf2
* add vdowave acm codec for format 0xFFFCcompn2009-01-101-0/+7
| | | | | | | works on http://videorenditions.com/media/babyfaceVDO.avi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28289 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correct a few mistakes in the spanish translation.reynaldo2009-01-101-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28288 b3059339-0415-0410-9bf9-f77b7e298cf2
* TRIVIAL, Extend the copyright line to 2009. Patch by andrew .david .45 AT gmail.reynaldo2009-01-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28287 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix build: calc_drwXY was factorized into vo_calc_drwXY.diego2009-01-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28286 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factor calc_drwXY out of vo_xv and vo_xvmc.cehoyos2009-01-094-35/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28285 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use tabs in svn:externalsreimar2009-01-090-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28284 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rearrange genres between numbers 53 and 63 into the correct order.diego2009-01-091-11/+11
| | | | | | | patch by Gil Kloepfer, mpldev09 kloepfer org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28283 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace reference to LICENSE file with GPL notice from said file.diego2009-01-091-1/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28282 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add PIX_FMT_VDPAU_H264.cehoyos2009-01-081-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28281 b3059339-0415-0410-9bf9-f77b7e298cf2
* Switch internal dvdread to libdvdread SVN external.reimar2009-01-0828-11037/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28280 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify relationship between -ass and -fontconfig in the man page.eugeni2009-01-071-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28279 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28122, patch by JRaSH % jrash06 A 163 P com %gpoirier2009-01-061-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28278 b3059339-0415-0410-9bf9-f77b7e298cf2
* looks like I missed r27542...gpoirier2009-01-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28277 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support loading font faces other then the first one in a font file.eugeni2009-01-062-7/+9
| | | | | | | | | | | With -fontconfig, it is possible to select a face with index higher than 0 in a multi-face font file. Currently, with the old rendering code, this information is lost and the first face is loaded. With this change, index supplied by fontconfig is used for font loading. Patch by Adrian Stutz, adrian sttz ch. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28276 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix r28222, including alloca.h directly might break compilation.reimar2009-01-052-2/+1
| | | | | | | Instead make sure os.h is included which includes alloca.h if possible. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28275 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some typos, add flv and trp to the list of video formatsdiego2009-01-051-42/+47
| | | | | | | | and rearrange file type lists alphabetically. patch by Konrad 'd3viCe' Pióro, konrad.pioro zask pl git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28274 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename libaf/af_format_alaw.c --> libaf/af_format_alaw.h anddiego2009-01-053-8/+8
| | | | | | | | | libaf/af_format_ulaw.c --> libaf/af_format_ulaw.h. Both files are not compiled but used as standard headers, so there is no reason for them not be named like any other header file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28273 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard multiple inclusion guards.diego2009-01-052-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28272 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary local definition of _ISOC9X_SOURCE.diego2009-01-051-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28271 b3059339-0415-0410-9bf9-f77b7e298cf2
* small Turkish translation fixes, patch by Onur Küçük, onur delipenguen netdiego2009-01-051-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28270 b3059339-0415-0410-9bf9-f77b7e298cf2
* timer-win2.c: Fix "voi" (void) typo breaking Windows compilationuau2009-01-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28269 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include the appropriate header instead of using local declarations.diego2009-01-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28268 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing 'void' keyword to parameterless function declarations.diego2009-01-0527-84/+94
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28267 b3059339-0415-0410-9bf9-f77b7e298cf2
* update copyright yearGabrov2009-01-0520-11/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28266 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete and misleading comment.diego2009-01-051-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28265 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace informal license notices by standard license headerdiego2009-01-0535-245/+705
| | | | | | | and add standard license header where missing. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28264 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix nonstandard license headers in the documentation.diego2009-01-052-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28263 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix two more instances of nonstandard license headers.diego2009-01-052-36/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28262 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28247Gabrov2009-01-052-3/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28261 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync removal of bugs.xml.diego2009-01-0512-845/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28260 b3059339-0415-0410-9bf9-f77b7e298cf2
* add binary codec Philips Speech Processing CELP acm for format 0x120compn2009-01-051-0/+8
| | | | | | | | works on /A-codecs/format-0x120-phillips-celp-T_CELP.WAV add DIVF fourcc to ffodivx git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28259 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not run mkdir in a subshell.diego2009-01-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28258 b3059339-0415-0410-9bf9-f77b7e298cf2
* Skip pointless ignoring return value of 'rm -f'.diego2009-01-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28257 b3059339-0415-0410-9bf9-f77b7e298cf2
* nonrecursive releaseclean targetdiego2009-01-052-10/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28256 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move clean targets to the bottom.diego2009-01-051-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28255 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless language-specific clean and distclean targets.diego2009-01-041-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28254 b3059339-0415-0410-9bf9-f77b7e298cf2
* Subsume clean-html-chunked and clean-html-single targets into clean target.diego2009-01-041-9/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28253 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after upcoming H264_VDPAU patch for FFmpeg.cehoyos2009-01-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28252 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of pointless chunked-dir and single-dir targets.diego2009-01-041-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28251 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify phony target declaration.diego2009-01-041-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28250 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync audio.xml removal.diego2009-01-0424-1673/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28249 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync history chapter removal.diego2009-01-0417-1504/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28248 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove history chapter; it is outdated and of little practical value.diego2009-01-042-188/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28247 b3059339-0415-0410-9bf9-f77b7e298cf2
* EXTERN_PREFIX is not only used in FFmpeg code.diego2009-01-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28246 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for manual audio substream selection out of 0xFD PES streams ↵nicodvb2009-01-044-0/+81
| | | | | | (Blueray, multistream in the same pid) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28245 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add ARMv6t2 CPU extension additions missed in previous commit.diego2009-01-041-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28244 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync ARMv6t2 optimization support from FFmpeg.diego2009-01-041-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28243 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update JACK configure test to match r28241reimar2009-01-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28242 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace deprecated jack_client_new with jack_client_open.reimar2009-01-042-2/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28241 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28215Gabrov2009-01-041-4/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28240 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix deinit problem due to r28215gpoirier2009-01-031-2/+4
| | | | | | | | | original thread: date: Fri, Jan 2, 2009 at 10:00 PM subject: [PATCH] Fix deinit problem due to r28215 (was Re: [MPlayer-cvslog] r28215 - in trunk: DOCS/man/en/mplayer.1 libvo/vo_macosx.m) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28239 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r28122jheryan2009-01-031-704/+782
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28238 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest round of xvmc changes in FFmpeg.diego2009-01-023-62/+83
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28237 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename libaf/af_resample.h to libaf/af_resample_template.c, it is used asdiego2009-01-022-5/+5
| | | | | | | a macro, not as a header file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28236 b3059339-0415-0410-9bf9-f77b7e298cf2
* Conditionally define render_one_glyph and kerning dummy functions indiego2009-01-022-9/+5
| | | | | | | | | font_load.c when FreeType is not enabled instead of conditionally defining them in font_load.h. This moves the workaround closer to where the actual problem is. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28235 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused debug code.diego2009-01-021-9/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28234 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid unused variable warning.diego2009-01-021-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28233 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reorder #includes and #ifdefs to avoid excessive #ifdeffery.diego2009-01-021-10/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28232 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reorder #includes and #ifdefs to avoid warnings and excessive #ifdeffery.diego2009-01-021-20/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28231 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense to GPLv2 or later with the author's permission.diego2009-01-029-45/+171
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28230 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix reference to wrong DLL filename in header comment.diego2009-01-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28229 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix confused references to DLL filenames.diego2009-01-018-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28228 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move several of the ao_nas int-to-string maps into .rodatareimar2009-01-011-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28227 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix DVD seek_to_chapter: the title number must be converted to a per-VTSreimar2009-01-011-0/+9
| | | | | | | title number first. Also add a few out-of-bounds checks just in case. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28226 b3059339-0415-0410-9bf9-f77b7e298cf2
* Code simplificationreimar2009-01-011-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28225 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make AVI demuxer more resilient against broken or incomplete files.reimar2009-01-011-2/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28224 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify and comment spudec bilinear scaling codereimar2009-01-011-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28223 b3059339-0415-0410-9bf9-f77b7e298cf2
* Include alloca.h when using alloca to make sure it is defined.reimar2009-01-012-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28222 b3059339-0415-0410-9bf9-f77b7e298cf2
* XVID profile array should be const, so it is in rodatareimar2009-01-011-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28221 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid a uselessly high number of wakeups when playing audio-only files.reimar2009-01-011-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28220 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l, play_tree_parser_stop_keeping broke 0-termination of bufferreimar2009-01-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28219 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add zero termination missing in two cases.reimar2009-01-011-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28218 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add asserts to detect when assumptions for play_tree_parser_get_linereimar2009-01-011-2/+4
| | | | | | | fail (mostly due to parsers using it incorrectly). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28217 b3059339-0415-0410-9bf9-f77b7e298cf2
* Work around a dvdread bug where DVDReadBlocks would return values < 0 on ↵reimar2008-12-311-1/+2
| | | | | | | | | | read error, causing hangs e.g. when seeking to the very last chapter (which would read beyond the size of the DVD). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28216 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an option to vo_macosx to set a custom buffer_name.gpoirier2008-12-302-6/+27
| | | | | | | | | | | | | | | This allows to have multiple instances of MPlayerOSX running without stepping on each other's toes. Patch by Adrian Stutz % adrian A sttz P ch % Original thread: date: Tue, Dec 9, 2008 at 2:46 PM subject: [MPlayer-dev-eng] [PATCH] vo_macosx: option to set shared buffer name to allow multiple instances git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28215 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support F- and numpad keys for w32_common based vos.reimar2008-12-301-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28214 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update outdated availability note for -mouse-movementsreimar2008-12-301-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28213 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28211Gabrov2008-12-307-469/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28212 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix OSD flickering with filters that add frames (tfields, yadif) andreimar2008-12-301-0/+6
| | | | | | -correct-pts git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28211 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix OSD flicker with tfields as well.reimar2008-12-301-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28210 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid flickering OSD with -vf yadif=1reimar2008-12-303-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28209 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add nocache to example dvdnav profile, otherwise dvdnav is unusable.reimar2008-12-291-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28208 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove audio output section, it provides little to no useful information.diego2008-12-273-66/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28207 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix Chinese documentation build, English codecs.xml was removed.diego2008-12-271-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28206 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix error message examplecompn2008-12-271-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28205 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove (audio) codecs section, its contents are part of the usage section.diego2008-12-273-102/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28204 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert Win32 codec importing HOWTO into a text document in the tech section.diego2008-12-273-160/+91
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28203 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove/fix ancient CVS references.diego2008-12-273-13/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28202 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove known bugs section, it contains little useful information.diego2008-12-273-140/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28201 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add entry about mysterious coredumps.diego2008-12-271-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28200 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix ugly borders problem with ati-hackreimar2008-12-271-0/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28199 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reorder sections: Put FAQ at the end, group usage sections together.diego2008-12-271-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28198 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid u_ BSD type names.diego2008-12-272-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28197 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set and use only ARCH_PPC, not also ARCH_POWERPC.diego2008-12-272-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28196 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid POSIX-reserved _t namespace.diego2008-12-271-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28195 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency cosmetics: Rename POWERPC identifiers to PPC.diego2008-12-271-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28194 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar fix by Vineeth N, nvineeth gmail comdiego2008-12-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28193 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add nomsgmodule option, patch by Onur Küçük, onur delipenguen net.diego2008-12-241-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28192 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable.diego2008-12-241-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28191 b3059339-0415-0410-9bf9-f77b7e298cf2
* Increase MAX_PACK_BYTES from 8 or 32 MB (with/without CONFIG_TV_BSDBT848) to ↵reimar2008-12-241-4/+0
| | | | | | | | | | | always 32 MB. Firstly 32 MB is not that much with HD video and the different values depending on whether CONFIG_TV_BSDBT848 is set or not makes debugging harder. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28190 b3059339-0415-0410-9bf9-f77b7e298cf2
* add zygo audio (SPXN) qtaudio codeccompn2008-12-241-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28189 b3059339-0415-0410-9bf9-f77b7e298cf2
* Warn when using features that are broken due to ATI driver bugs.reimar2008-12-231-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28188 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not default to rectangle=2, it is at least for ATI HD4850 cards with 8.12 ↵reimar2008-12-231-1/+1
| | | | | | drivers 20% slower at HD resolutions git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28187 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce the priority of the rv3040 native Linux RealVideo decoders since it ↵reimar2008-12-231-1/+1
| | | | | | crashes on SMP systems git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28186 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatescompn2008-12-231-1/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28185 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless forward declaration.diego2008-12-231-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28184 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set fast_cmov for all x86_64 systems, except for P4-based systems thisreimar2008-12-231-1/+1
| | | | | | should be better, in particular cmov is recommended for future systems. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28183 b3059339-0415-0410-9bf9-f77b7e298cf2
* Define HAVE_FAST_64BIT if appropriatereimar2008-12-231-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28182 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix poorly worded changelog entriescompn2008-12-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28181 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow compilation of 32bit mplayer on 64 bit systems with --cc='cc -m32'.cehoyos2008-12-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28180 b3059339-0415-0410-9bf9-f77b7e298cf2
* re-add codecs: sif1 (directshow version) and acdsee mjpegcompn2008-12-221-1/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28179 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest FFmpeg changes.diego2008-12-222-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28178 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavcodec/i386/ was renamed to libavcodec/x86/.diego2008-12-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28177 b3059339-0415-0410-9bf9-f77b7e298cf2
* add amr format tags, fixes:compn2008-12-211-0/+2
| | | | | | | http://www.pdafrance.com/img/testproduit_pocketpc/a730/video4.avi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28176 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, forgot an assignment, broke special keys handling for X11-based vos.reimar2008-12-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28175 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove acdsee mjpeg binary codec, works with ffmjpegcompn2008-12-201-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28174 b3059339-0415-0410-9bf9-f77b7e298cf2
* FFmpeg now has RV30 decoder enabledkostya2008-12-201-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28173 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add and use a special lookup function to do table-based translation to ↵reimar2008-12-204-55/+49
| | | | | | MPlayer keycodes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28172 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: get rid of some tabs and trailing whitespace.reimar2008-12-201-32/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28171 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a table to translate X11 to MPlayer keycodes.reimar2008-12-201-145/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28170 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of pointless and now unused defines.reimar2008-12-201-88/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28169 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify handling of X11 key events that are just passed through.reimar2008-12-201-97/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28168 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix imaadpcm extradata with lavc encoder.reimar2008-12-201-2/+2
| | | | | | | | | The formula to calculate frame size was wrong, duplicated code from the encoder and did not take endianness into account when writing the value into extradata. Patch by Edouard Gomez [ed gomez (at) free fr]. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28167 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document vo_macosx's shared_buffer option.gpoirier2008-12-191-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28166 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace vo_macosx's custom options parsing with a subopt_parse()-based onegpoirier2008-12-191-22/+24
| | | | | | | | | | | (in the same way as vo_gl). Patch by Adrian Stutz %adrian A sttz P ch% Original thread: date: Tue, Dec 9, 2008 at 3:20 PM subject: Re: [MPlayer-dev-eng] [PATCH] vo_macosx: option to set shared buffer name to allow multiple instances git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28165 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless malloc.h #include.diego2008-12-193-9/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28164 b3059339-0415-0410-9bf9-f77b7e298cf2
* Include config.h in mangle.h, fixes make checkheaders.reimar2008-12-191-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28163 b3059339-0415-0410-9bf9-f77b7e298cf2
* add binary codecs:compn2008-12-171-2/+31
| | | | | | | | | yuv8 - yuv8 vfw decoder WCMV - Wincam Screen capture codec AJPG,ABYR - Kensington videocam codec git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28162 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28160Gabrov2008-12-174-11/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28161 b3059339-0415-0410-9bf9-f77b7e298cf2
* add binary codec for fourcc wavccompn2008-12-171-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28160 b3059339-0415-0410-9bf9-f77b7e298cf2
* another round of armv4l --> arm changesdiego2008-12-172-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28159 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavcodec/armv4l/ was renamed to libavcodec/arm/.diego2008-12-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28158 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use full relative #include path for headers in the same directory.diego2008-12-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28157 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include sub.h instead of locally declaring vo_draw_text().diego2008-12-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28156 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added FOURCCS:compn2008-12-161-4/+37
| | | | | | | | | | | | | | | | RPZA,AZPR to ffrpza DVX3 to ffdivx INMC to ffodivx and xvid QIVG to ffmjpeg Added binary codecs: GMP4,GM40 to Geovision MPEG4 XJPG to Xiricam JPEG SP60,SP61,SP62 to SP6x Codec SMSV to WorldConnect Wavelet Codec git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28155 b3059339-0415-0410-9bf9-f77b7e298cf2
* xvmc is now a CONFIG_ option in FFmpeg.diego2008-12-153-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28154 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, reorder check for AC3 format to avoid a possible memleakreimar2008-12-151-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28153 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently include config.h before mangle.h, fixes possible compilationreimar2008-12-152-0/+2
| | | | | | | issues due to r28151 (using EXTERN_PREFIX). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28152 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify the definition of MANGLE, possibly also makes it easier to support ↵reimar2008-12-151-7/+1
| | | | | | more systems. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28151 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add extra checks to avoid crashes with broken vqf filesreimar2008-12-141-6/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28149 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update links to RPM packages, now that Livna has merged into RPMFusion.rathann2008-12-142-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28148 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add standard GPL headers.diego2008-12-1312-0/+206
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28147 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add standard GPL license header.diego2008-12-137-0/+124
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28146 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace informal GPL notices by standard GPL headers.diego2008-12-132-6/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28145 b3059339-0415-0410-9bf9-f77b7e298cf2
* license header consistency cosmeticsdiego2008-12-134-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28144 b3059339-0415-0410-9bf9-f77b7e298cf2
* Apparently Real codecs work on OpenBSD, taken from the OpenBSD ports tree.diego2008-12-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28143 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge two identical NetBSD/OpenBSD conditions.diego2008-12-131-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28142 b3059339-0415-0410-9bf9-f77b7e298cf2
* Apparently VCDs work on OpenBSD, taken from the OpenBSD ports tree.diego2008-12-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28141 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace informal GPL notes by standard GPL header.diego2008-12-135-32/+107
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28140 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify: use AV_RL32/AV_RB32reimar2008-12-131-10/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28139 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid useless casts.reimar2008-12-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28138 b3059339-0415-0410-9bf9-f77b7e298cf2
* another mpeg4 fourcc and add binary vdo codeccompn2008-12-131-2/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28137 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some forgotten eax -> REG_a changes.reimar2008-12-121-24/+24
| | | | | | | It seems that binutils >= 2.18 just treat eax as rax but older versions fail. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28136 b3059339-0415-0410-9bf9-f77b7e298cf2
* Warning fixes for demux_nutods152008-12-121-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28135 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove resync_audio_stream() from demux_nut seek functionods152008-12-121-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28134 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename typedefs in demux_nut to _tt instead of _t, sync to new libnut APIods152008-12-121-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28133 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ac-3 fourcc from mp4 filecompn2008-12-111-0/+3
| | | | | | | fixes incoming/AC3inMP4.mp4 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28132 b3059339-0415-0410-9bf9-f77b7e298cf2
* Search live555 library also in /usr/lib64.cehoyos2008-12-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28131 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rework Theora test, it was throwing away CFLAGS provided by pkg-config.diego2008-12-111-8/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28130 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing 'void' to parameterless function declaration.diego2008-12-112-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28129 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change some printf calls to 'Debug printf' so as not to pollute stdout.diego2008-12-111-6/+6
| | | | | | | based on a patch by Zhou Zongyi, zhouzongyi pset.suntec net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28128 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28126gpoirier2008-12-101-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28127 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for writing PNG files with alpha channel in -vo pngreimar2008-12-102-2/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28126 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try to auto-detect several vo_gl settings (ati-hack, force-pbo and rectangle).reimar2008-12-101-3/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28125 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: actually disable quartz vo when detection failed.gpoirier2008-12-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28124 b3059339-0415-0410-9bf9-f77b7e298cf2
* add acdv fourcc to ffmjpegcompn2008-12-101-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28123 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix MGSTR vs. MSGTR typo.diego2008-12-0913-23/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28122 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set d3d_handle to NULL after release.reimar2008-12-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28121 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forgotten part of previous cosmetics commitreimar2008-12-091-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28120 b3059339-0415-0410-9bf9-f77b7e298cf2
* Slightly simplify the conditional release/free codereimar2008-12-091-21/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28119 b3059339-0415-0410-9bf9-f77b7e298cf2
* First version of OSD support for vo_direct3dreimar2008-12-091-7/+282
| | | | | | | Patch by Jim Hauxwell [james dattrax co uk] with modifications by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28118 b3059339-0415-0410-9bf9-f77b7e298cf2
* add binary voxware metavoice audio codec, format 0x74compn2008-12-091-0/+9
| | | | | | | works on http://www.hfhrpol.waw.pl/Tybet/multimedia/MaoMacha.asx git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28117 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove duplicated fourcccompn2008-12-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28116 b3059339-0415-0410-9bf9-f77b7e298cf2
* add some fourcc's and ulead dv audio codec, fixes samples from:compn2008-12-081-1/+15
| | | | | | | http://home.twmi.rr.com/compn//uncommon_audio_codecs.txt git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28115 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use svn.ffmpeg.org for the externals which is both more correct and more ↵reimar2008-12-080-0/+0
| | | | | | reliable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28114 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: indentationdiego2008-12-081-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28113 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless or even wrong N/A return values doxy commentsreimar2008-12-081-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28112 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing unistd.h #include, fixes the warning:diego2008-12-081-0/+1
| | | | | | | libvo/vo_macosx.m:177: warning: implicit declaration of function 'ftruncate' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28111 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable, fixes the warning:diego2008-12-081-1/+0
| | | | | | | libvo/vo_macosx.m:735: warning: unused variable 'lastTime' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28110 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include appropriate headers instead of locally declaring function prototypes.diego2008-12-082-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28109 b3059339-0415-0410-9bf9-f77b7e298cf2
* ati_hack only makes sense when PBOs are used, not with mesa_buffer.reimar2008-12-061-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28108 b3059339-0415-0410-9bf9-f77b7e298cf2
* More possible fixes for mesa-buffer mode.reimar2008-12-061-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28107 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move one ati_hack check to a better place.reimar2008-12-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28106 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindentreimar2008-12-061-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28105 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, forgot setting GL_UNPACK_CLIENT_STORAGE_APPLE for mesa-buffer mode.reimar2008-12-062-5/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28104 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, add forgotten a #ifndef GL_WIN32, fixes win32 builds.reimar2008-12-051-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28103 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix indentationreimar2008-12-051-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28102 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add experimental support for glXAllocateMemoryMESAreimar2008-12-053-5/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28101 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28096gpoirier2008-12-051-6/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28100 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid one more duplicated logic.reimar2008-12-051-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28099 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify, do not duplicate buffer size calculationreimar2008-12-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28098 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set the base size window manager hint, otherwise some subtract the minimumreimar2008-12-051-0/+7
| | | | | | | | size of 4x4 from the numbers displayed to the user which might be confusing. Based on patch by Bert Wesarg [bert wesarg googlemail com]. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28097 b3059339-0415-0410-9bf9-f77b7e298cf2
* Using rectangle=2 for vo_gl is probably a good idea nowadays.reimar2008-12-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28096 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document missing vo_gl suboptionsreimar2008-12-051-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28095 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some forgotten documentation for gl suboptionsreimar2008-12-051-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28094 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for YCBCR MESA texture format to vo_gl.reimar2008-12-053-0/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28093 b3059339-0415-0410-9bf9-f77b7e298cf2
* add a bunch of binary codecs with samples from this list: compn2008-12-051-11/+108
| | | | | | | | | http://home.twmi.rr.com/compn/uncommon_video_codecs_final.txt change sif1 codec to vfw since the dshow codec was terrible mark videocodec alaris as working git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28092 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add const to avoid warnings about discarded qualifiers.reimar2008-12-051-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28091 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r28089Gabrov2008-12-052-15/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28090 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add entry for FFmpeg QCELP decoder, currently produces white noise.diego2008-12-041-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28089 b3059339-0415-0410-9bf9-f77b7e298cf2
* Re-add "extern"s incorrectly removed in r28085reimar2008-12-042-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28088 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore two mistakenly removed 'extern' keywords.diego2008-12-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28087 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow mp2 in mov.cehoyos2008-12-031-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28086 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of pointless 'extern' keywords.diego2008-12-03109-511/+510
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28085 b3059339-0415-0410-9bf9-f77b7e298cf2
* add bunch of fourccs and updates fromcompn2008-12-031-3/+30
| | | | | | | http://tranquillity.ath.cx/uncommon_video_codecs_final.txt git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28084 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused declarations and references to vo_draw_text_osd(),diego2008-12-033-16/+1
| | | | | | | vo_draw_text_progbar(), vo_draw_text_sub(). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28083 b3059339-0415-0410-9bf9-f77b7e298cf2
* Delete unnecessary 'extern' keywords.diego2008-12-033-31/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28082 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmetics in test programsdiego2008-12-031-22/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28081 b3059339-0415-0410-9bf9-f77b7e298cf2
* Treat video output objects the same as everything else in the build system,diego2008-12-032-51/+76
| | | | | | | | i.e. have lines that conditionally enable each in the Makefile and corresponding variables set from configure. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28080 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: consistent CONFIG_PNM definitiondiego2008-12-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28079 b3059339-0415-0410-9bf9-f77b7e298cf2
* add FFDS fourcccompn2008-12-031-0/+2
| | | | | | | | fixes FFDS avi files from this list: http://tranquillity.ath.cx/uncommon_video_codecs_final.txt git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28078 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Rename ZORAN Makefile variable to ZR for consistency.diego2008-12-032-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28077 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix indentation.reimar2008-12-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28076 b3059339-0415-0410-9bf9-f77b7e298cf2
* Treat audio output objects the same as everything else in the build system,diego2008-12-032-24/+34
| | | | | | | | i.e. have lines that conditionally enable each in the Makefile and corresponding variables set from configure. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28075 b3059339-0415-0410-9bf9-f77b7e298cf2
* More robust w32 -wid size handlingreimar2008-12-031-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28074 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindent after previous commitreimar2008-12-031-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28073 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not override the vo_dwidth/vo_dheight values in vo_w32_configreimar2008-12-031-0/+3
| | | | | | | in -wid mode because we ignore the requested size in that case. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28072 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r28056gpoirier2008-12-031-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28071 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics, whitespace and "... == NULL" to "!..."reimar2008-12-031-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28070 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some whitespace and () cosmeticsreimar2008-12-031-17/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28069 b3059339-0415-0410-9bf9-f77b7e298cf2
* Pass "-f macho" to yasm when enabling YASM support on a 32-bits machine asgpoirier2008-12-031-1/+1
| | | | | | | | | libavcodec/i386/x86inc.asm checks that __OUTPUT_FORMAT__ is 'macho' in 32-bits mode, not 'macho32'. This is a workaround until FFmpeg code is fixed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28068 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, actually put the PTHREAD_CACHE define into config.hreimar2008-12-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28067 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print ID_EXIT and exit reason message in identify mode when exiting.reimar2008-12-023-23/+44
| | | | | | | Patch by rvm [rvm3000 ya com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28066 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove resize_d3d call from render_d3d_frame that was made uselessreimar2008-12-021-2/+0
| | | | | | | | | by previous commit. If this is necessary e.g. to prevent flicker while resizing, check_events should be called instead or even better the functionality be moved to some higher layer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28065 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, do not call check_events from resize_d3d since there should bereimar2008-12-021-3/+0
| | | | | | | | no reason to do it and it might call resize_d3d again which makes it hard to guarantee that it works correctly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28064 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: Remove unnecessary ()reimar2008-12-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28063 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistency cosmetics: do not compare against NULL in ifsreimar2008-12-021-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28062 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: remove spaces before argument (reimar2008-12-021-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28061 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reorganize Direct3D initialization code.reimar2008-12-021-51/+150
| | | | | | | Patch by Georgi Petrov [gogothebee gmail com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28060 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_direct3d.o depends on w32_common.o.diego2008-12-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28059 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove commented-out duplicate declarations.diego2008-12-021-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28058 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused declarations.diego2008-12-021-15/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28057 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a note about some known issues with -vo sdlreimar2008-12-011-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28056 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a lot of completely pointless mp_msg_test calls.reimar2008-12-011-53/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28055 b3059339-0415-0410-9bf9-f77b7e298cf2
* FFmpeg now has RV40 decoderkostya2008-12-011-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28054 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard unsigned long type instead of u_long.diego2008-11-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28053 b3059339-0415-0410-9bf9-f77b7e298cf2
* MNG demuxer by Stefan Schuermans, stefan blinkenarea orgdiego2008-11-307-1/+662
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28052 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmeticsdiego2008-11-301-2/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28051 b3059339-0415-0410-9bf9-f77b7e298cf2
* use mmap instead of shmat for MPlayerOSX, patch by Adrian Stutz<adrian@sttz.ch>nplourde2008-11-301-17/+32
| | | | | | | | | Original thread: date: Sun, Oct 12, 2008 at 10:32 PM subject: [MPlayer-dev-eng] [PATCH] vo_macosx: use mmap instead of shmat for MPlayerOSX git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28050 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correct detection of SSSE3 and SSE4a feature bits.zuxy2008-11-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28049 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move PTHREAD_CACHE define logic to configure.reimar2008-11-282-4/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28048 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc mplayer fixescompn2008-11-281-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28047 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix cross-compilation: autodetect correct nm toolreimar2008-11-281-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28046 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmetics: prettyprinting and indentationdiego2008-11-281-77/+81
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28045 b3059339-0415-0410-9bf9-f77b7e298cf2
* factorize mouse hiding and screensaver disabling codegpoirier2008-11-272-10/+11
| | | | | | | | | | Based on the patch posted in thread: from Gregor Riepl %onitake A gmail P com% date: Wed, Oct 29, 2008 at 7:26 PM subject: Re: [MPlayer-dev-eng] [PATCH] Replaced deprecated QuickDraw calls in vo_quartz git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28044 b3059339-0415-0410-9bf9-f77b7e298cf2
* configure: Move AANDCT config.mak entry and add config.h #definesuau2008-11-261-1/+3
| | | | | | | | Move the config.mak "CONFIG_AANDCT=yes" line to where other similar features are, and add missing CONFIG_AANDCT and ENABLE_AANDCT #defines to config.h (though current FFmpeg code works without them). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28043 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after FFmpeg r15940reimar2008-11-261-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28042 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use D3DFMT_ constants where possible instead of MAKEFOURCCreimar2008-11-261-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28041 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for RGB formats to vo_direct3dreimar2008-11-261-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28040 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update Tremor comment regarding fixed-point mode.diego2008-11-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28039 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable compilation with icc 11.0.cehoyos2008-11-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28038 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace pushf/popf by explicit pushfl/popfl (32 bit) or pushfq/popfqcehoyos2008-11-251-3/+12
| | | | | | | | (x86_64), to fix generated code on ICC 11.0. Original FFmpeg patch by Reimar. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28037 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, OSD alpha textures were cleared to the wrong value.reimar2008-11-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28036 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fix + readability improvementgpoirier2008-11-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28035 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another part of sync to 27843torinthiel2008-11-241-76/+80
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28034 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest FFmpeg changes.diego2008-11-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28033 b3059339-0415-0410-9bf9-f77b7e298cf2
* add more informative commentcompn2008-11-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28032 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary #ifdef around a struct and a bunch of extern declarations.diego2008-11-241-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28031 b3059339-0415-0410-9bf9-f77b7e298cf2
* now that we have a specific check to enable ao_macosx or not, don't let testgpoirier2008-11-241-10/+4
| | | | | | | for vo_quartz set if ao_macosx should be enabled or not: it's redundant. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28030 b3059339-0415-0410-9bf9-f77b7e298cf2
* add specific test to check if we can enable ao_macosx not matter how ↵gpoirier2008-11-241-1/+15
| | | | | | vo_quartz test may turn out git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28029 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not initialize fb_dev_fd to -1, similar to vo_fbdev.c.diego2008-11-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28028 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Add/remove a few newlines similar to vo_fbdev.c.diego2008-11-241-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28027 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics (svn diff --diff-cmd diff -x '-duwbBE' gives no differences)gpoirier2008-11-241-1186/+1189
| | | | | | | | replace tabs by 4 spaces. prettier intentation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28026 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid putting several statements on a single linegpoirier2008-11-241-9/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28025 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use doxygen-style comments in file header. Remove tabs usage.gpoirier2008-11-241-12/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28024 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace-cleanupgpoirier2008-11-241-175/+175
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28023 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow vo_macosx to be compiled in 64-bits mode:gpoirier2008-11-241-3/+7
| | | | | | | | | | | | | | | - Replace usage of undocumented Apple function CPSEnableForegroundOperation() (which is available in 32-bits mode, but not in 64-bits mode) by TransformProcessType() which is public, documented, and available since OSX 10.3. - Work around Apple bug #6267445 since OSServices Power API is diabled in 64-bits systems Based on patch by Gregor Riepl %onitake A gmail P com% posted in thread: date: Fri, Oct 3, 2008 at 4:49 PM subject: Re: [MPlayer-dev-eng] [PATCH] Replaced deprecated QuickDraw calls in vo_quartz git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28022 b3059339-0415-0410-9bf9-f77b7e298cf2
* More hacks around ATI driver problems, 8.11 ignores UNPACK_BUFFER pointer ↵reimar2008-11-241-0/+40
| | | | | | offsets. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28021 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace QuickDraw calls in vo_quartz.c to fix warnings when compiling with ↵gpoirier2008-11-241-69/+96
| | | | | | | | | | | | current SDK versions. Patch by Gregor Riepl %onitake A gmail P com% Original thread: Date: Wed, Oct 29, 2008 at 7:26 PM Subject: Re: [MPlayer-dev-eng] [PATCH] Replaced deprecated QuickDraw calls in vo_quartz git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28020 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a ColorFill that is not necessary since the surface it is usedreimar2008-11-241-4/+0
| | | | | | | | on has exactly the same size as the video image and the video will be copied into it before it is used the first time. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28019 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure the backbuffer is cleared when the border size might have changed.reimar2008-11-241-1/+14
| | | | | | | Patch by Georgi Petrov [gogothebee gmail com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28018 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless setting of frame_buffer to NULL as suggested by Reimar.diego2008-11-242-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28017 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: indentationdiego2008-11-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28016 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move setting of frame_buffer variable out of 'if', as preferred by Reimar.diego2008-11-242-4/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28015 b3059339-0415-0410-9bf9-f77b7e298cf2
* Create a separate codecs.conf entry for Tremor and use it if MPlayer isdiego2008-11-242-0/+13
| | | | | | | | with Tremor support instead of libvorbis. Previously MPlayer would show the same output on the console when decoding with libvorbis and Tremor. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28014 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix HAVE_VIS vs. HAVE_MVI typo, SPARC has MVI, not VIS.diego2008-11-242-2/+2
| | | | | | | patch by Alexis Ballier, alexis.ballier gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28013 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27979gpoirier2008-11-231-3/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28012 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clear the whole window on resize in vo_x11 since we do notreimar2008-11-231-1/+3
| | | | | | | yet know how large the borders will be. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28011 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify vo_x11 check_events functionreimar2008-11-231-7/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28010 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not draw in window if our image has not yet been adjusted to the new ↵reimar2008-11-231-0/+5
| | | | | | | | | | window size. Fixes some cases of borders not being black in fullscreen when fullscreen image is scaled down. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28009 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary xf86vmode.h include.reimar2008-11-231-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28008 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some usnused variables and commented-out code.reimar2008-11-231-6/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28007 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use aspect.c code in vo_x11.c. Removes some inconsistencies in -wid handling.reimar2008-11-231-9/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28006 b3059339-0415-0410-9bf9-f77b7e298cf2
* Patch to improve/consistify coding style.reimar2008-11-231-20/+20
| | | | | | | Patch by Georgi Petrov [gogothebee gmail com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28005 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix indentationreimar2008-11-231-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28004 b3059339-0415-0410-9bf9-f77b7e298cf2
* Lock/unlock surface only once even when drawing many slices.reimar2008-11-231-7/+14
| | | | | | | Patch originally by Jim Hauxwell [james dattrax co.uk] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28003 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move locked_rect from stack to priv struct in preparation for following patch.reimar2008-11-231-17/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28002 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move the StretchRect call from draw_slices to render_d3d_frame.reimar2008-11-231-28/+8
| | | | | | | | This avoids calling it (and BeginScene/EndScene) many times with slices and also avoids code duplication. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28001 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless is_cfG_finished variable.reimar2008-11-231-17/+3
| | | | | | | Patch by Georgi Petrov [gogothebee gmail com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28000 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle fb_dev_name similar to vo_fbdev in vo_wii.diego2008-11-232-6/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27999 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge another if condition check to lessen differences to vo_fbdev.c.diego2008-11-231-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27998 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use static variable instead of #define to lessen differences to vo_fbdev.c.diego2008-11-231-6/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27997 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of TTY_DEV_NAME #define to lessen differences to vo_fbdev.c.diego2008-11-231-6/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27996 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge another if condition check to lessen differences to vo_fbdev.c.diego2008-11-231-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27995 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge if condition check to lessen differences to vo_fbdev.c.diego2008-11-231-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27994 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove debug function.diego2008-11-231-70/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27993 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: one more round of whitespace changesdiego2008-11-231-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27992 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: further reformatting to lessen differences to vo_fbdev.cdiego2008-11-231-56/+53
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27991 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: complete reformatting, tabs to spaces, etc.diego2008-11-231-956/+952
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27990 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Lessen differences to vo_wii.c.diego2008-11-231-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27989 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: consistent formatting for if/else/casediego2008-11-231-36/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27988 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reimplement -endchapter support again for -dump*, it was broken in r25987.reimar2008-11-231-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27987 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify handling of VOFLAG_MODESWITCHNG, merge assignment and declarationreimar2008-11-232-10/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27986 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused flip_flag variablereimar2008-11-231-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27985 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Reformat some lines to lessen differences to vo_fbdev.c.diego2008-11-231-118/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27984 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move up uninit() to avoid a forward declaration.diego2008-11-231-10/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27983 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: consistent function declarations.diego2008-11-231-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27982 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove tabs and trailing whitespace.diego2008-11-231-69/+69
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27981 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variables and the related warnings along with them.diego2008-11-231-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27980 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make description of the option more clear as suggested by bircoph2008-11-221-2/+3
| | | | | | | Reimar Döffinger. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27979 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a aspect calculation line.reimar2008-11-212-2/+0
| | | | | | | | | | It is useless because with the new API enabled by VOCTRL_UPDATE_SCREENINFO it is not necessary because it is already done in video_out.c:config_video_out. Secondly, the removal of the aspect_save_prescale triggered a regression because of it, with -wid the window would not be filled completely initially. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27978 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify handling of "flags" parameterreimar2008-11-211-13/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27977 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add forgotten initialization if Flip_Flag to 0.reimar2008-11-211-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27976 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: typo fixesdiego2008-11-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27975 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Write revision number with leading 'r'.diego2008-11-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27974 b3059339-0415-0410-9bf9-f77b7e298cf2
* add direct3d docs, ok'd by Guillaumecompn2008-11-212-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27973 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r27967.bircoph2008-11-211-12/+11
| | | | | | | These changes are cosmetics only. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27972 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix and enable panscan handling for vo_direct3dreimar2008-11-211-77/+43
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27971 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Consistently place HEADERS before OBJS in all Makefiles.diego2008-11-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27970 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add all still missing lines, full sync against r27967reynaldo2008-11-201-1/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27969 b3059339-0415-0410-9bf9-f77b7e298cf2
* Trivial, add some more lines that were missingreynaldo2008-11-201-4/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27968 b3059339-0415-0410-9bf9-f77b7e298cf2
* Trivial, Cosmeticsreynaldo2008-11-202-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27967 b3059339-0415-0410-9bf9-f77b7e298cf2
* COSMETICS, More line shifting to match English masterreynaldo2008-11-201-45/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27966 b3059339-0415-0410-9bf9-f77b7e298cf2
* TRIVIAL, add some more missing linesreynaldo2008-11-201-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27965 b3059339-0415-0410-9bf9-f77b7e298cf2
* COSMETICS, More line shifting to match English masterreynaldo2008-11-201-262/+252
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27964 b3059339-0415-0410-9bf9-f77b7e298cf2
* TRIVIAL, some missing lines and a grammar correctionreynaldo2008-11-201-1/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27963 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: rename variables etc. in vo_direct3d.creimar2008-11-201-253/+225
| | | | | | | Patch by Georgi Petrov (gogothebee gmail com) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27962 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factor common code like -wid handling, vo_gc creation etc. out intoreimar2008-11-199-191/+30
| | | | | | | x11_common.c git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27961 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add detection of x86 CPU features SSSE3 and SSE4a.gpoirier2008-11-192-0/+6
| | | | | | | | | | Patch by Zhou, Zongyi %zz65 A cornell P edu% Original thread: date: Wed, Nov 19, 2008 at 4:22 PM subject: Re: [MPlayer-dev-eng] [PATCH] yadif SSE2/SSSE3 optimization git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27960 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify conditions in direct3d vo: remove == 1, change == 0 to ! etc.reimar2008-11-191-12/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27959 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics, mostly line shifting to match English masterreynaldo2008-11-182-509/+483
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27958 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing "static" qualifiers to vo_direct3dreimar2008-11-181-18/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27957 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, the video_out_drivers list must be sorted by priority, notreimar2008-11-181-3/+3
| | | | | | | alphabetically. For now, vo_directx should be preferred over vo_direct3d. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27956 b3059339-0415-0410-9bf9-f77b7e298cf2
* Direct3D based video_out module.reimar2008-11-185-0/+785
| | | | | | | | Patch by Georgi Petrov (gogothebee gmail com) Panscan handling is still disabled and needs to be fixed for negative -panscan. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27955 b3059339-0415-0410-9bf9-f77b7e298cf2
* Doxygen documentation for w32_common.creimar2008-11-181-0/+98
| | | | | | Patch by Georgi Petrov (gogothebee gmail com) with several modifications by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27954 b3059339-0415-0410-9bf9-f77b7e298cf2
* On OpenBSD socklen_t is defined at sys/types.h, so latter is addedbircoph2008-11-181-1/+1
| | | | | | | to the header search path. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27953 b3059339-0415-0410-9bf9-f77b7e298cf2
* Trivial, Cosmeticsreynaldo2008-11-182-88/+83
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27952 b3059339-0415-0410-9bf9-f77b7e298cf2
* Trivial, Cosmeticsreynaldo2008-11-182-17/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27951 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some more missing messagesreynaldo2008-11-181-0/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27950 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, missing ' s' in sed command, probably caused all decoders to bereimar2008-11-171-1/+1
| | | | | | disabled when zlib is not available. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27949 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only enable CONFIG_FFT_MMX if both yasm and MMX are enabled.diego2008-11-171-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27948 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set _have_yasm to "no" if yasm detection failed.diego2008-11-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27947 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a useless XGetGeometry call, the X11 event handling alreadyreimar2008-11-171-5/+0
| | | | | | | updates vo_dwidth/vo_dheight. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27946 b3059339-0415-0410-9bf9-f77b7e298cf2
* Put variable declaration inside an #ifdef to avoid an unused variable warning.diego2008-11-171-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27945 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow compilation with icc 10.1.cehoyos2008-11-171-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27944 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix build: Remove some references to sections that no longer exist.diego2008-11-162-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27943 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of (besides useless assignments) unused XSizeHints variablereimar2008-11-161-7/+0
| | | | | | in vo_xvmc. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27942 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix missing -DARCH_X86_64 for yasm on x86_64.reimar2008-11-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27941 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add yasm support to the build system.bircoph2008-11-162-3/+58
| | | | | | | | This allows to use yasm assembler optimizations from FFmpeg code, in particular, from libavcodec/fft.c. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27940 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27938Gabrov2008-11-163-630/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27939 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use 64 bit numbers for file positions in the seek function in audio demuxer.reimar2008-11-161-1/+1
| | | | | | | Hopefully fixes seeking in wav files in-between 2 and 4 GB. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27938 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove explicit setting of vo_ontop since that is already done by ↵reimar2008-11-158-22/+0
| | | | | | vo_x11_create_vo_window git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27937 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a duplicated vo_x11_selectinput_witherrreimar2008-11-151-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27936 b3059339-0415-0410-9bf9-f77b7e298cf2
* respect -vf dsize etc. also for -rootwin, just like vo_xv does.reimar2008-11-151-10/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27935 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix phrase to maintain consistency.bircoph2008-11-151-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27934 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with vo_x11: make sure we get expose events even when drawing to the ↵reimar2008-11-151-1/+2
| | | | | | root window. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27933 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r26763.bircoph2008-11-151-34/+117
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27932 b3059339-0415-0410-9bf9-f77b7e298cf2
* On Darwin, don't use hostinfo on _all_ x86 variants to detect the running CPU,gpoirier2008-11-151-1/+1
| | | | | | | | | use cpuinfo instead. This allows MPlayer to get one step closer to building in 64 bits mode on Darwin, if one passes --target=x86_64-darwin to configure. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27931 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, stream->cache_pid can not be used directly in pthread_create,reimar2008-11-151-1/+5
| | | | | | | it has the wrong type. Luckily we currently do not need the value anyway. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27930 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a nonsensical "else" for the video mode switching case.reimar2008-11-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27929 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use pthreads for the cache on Cygwin, since _beginthread is not availablereimar2008-11-151-11/+27
| | | | | | | | and the previous CreateThread method would probably leak memory here, too. Also pthreads seems to be the official Cygwin threading API. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27928 b3059339-0415-0410-9bf9-f77b7e298cf2
* include limits.h for INT_MAX.reimar2008-11-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27927 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove now unused variables.reimar2008-11-153-12/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27926 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use vo_dwidth/vo_dheight for creating the windows instead of d_width/d_height.reimar2008-11-152-2/+2
| | | | | | | This fixes the -vm bug that the created window is too small. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27925 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify vo_vm_switch and vo_vm_close, everyone was using the (almost) samereimar2008-11-155-59/+26
| | | | | | | boiler-plate code with them, just with different bugs. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27924 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set modified window position and monitor aspect in vo_vm_switch instead of inreimar2008-11-153-5/+7
| | | | | | | individual vo drivers. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27923 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of (besides useless assignments) unused XSizeHints variablereimar2008-11-151-12/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27922 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set modeline_width/height to sane values in vo_vm_switch even whenreimar2008-11-151-1/+4
| | | | | | | the XF86VidMode extension is not available. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27921 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: remove useless "extern"reimar2008-11-151-33/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27920 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace some of the different inconsistent XGetGeometry uses by areimar2008-11-155-34/+21
| | | | | | | vo_x11_update_geometry function. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27919 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a useless XGetGeometry call, the X11 event handling already takes ↵reimar2008-11-151-5/+0
| | | | | | care of this. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27918 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove code from unused and since ages deprecated draw_frame function.reimar2008-11-152-23/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27917 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove vo_xv code that has been under #if 0 since ages.reimar2008-11-151-29/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27916 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_x11: do not replace the vo_gc created by the Gui.reimar2008-11-151-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27915 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetic changes to vo_x11 to reduce diff to vo_xv for future refactoring.reimar2008-11-151-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27914 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics for vo_x11 control() to make it more similar to vo_xv.creimar2008-11-151-8/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27913 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix grammar of comment and sync it with vo_x11.creimar2008-11-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27912 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds Some missing messages - 1 of 3reynaldo2008-11-151-0/+53
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27911 b3059339-0415-0410-9bf9-f77b7e298cf2
* Include cache2.h in cache2.c, fixes an implicit declaration warning for ↵reimar2008-11-141-0/+1
| | | | | | cache_do_control git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27910 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27906gpoirier2008-11-141-10/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27909 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix ati-hack to work again with ATI 8.9 and later drivers.reimar2008-11-141-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27908 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the proper IMGFMT_RGB24 and IMGFMT_BGR24 defines instead ofreimar2008-11-131-2/+2
| | | | | | | IMGFMT_RGB|24 and IMGFMT_BGR|24. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27907 b3059339-0415-0410-9bf9-f77b7e298cf2
* document x264's option subq=0, plus a bit of factoring and added detailsgpoirier2008-11-131-8/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27906 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print out that vo_macosx is disabled when Mac OS X APIs are not available.diego2008-11-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27905 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix Windows OpenGL -wid:reimar2008-11-111-15/+1
| | | | | | | Disable the Window instead of explicitly passing on click events. This also makes Drag-and-Drop work if the -wid window supports it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27904 b3059339-0415-0410-9bf9-f77b7e298cf2
* Partial sync to 27843torinthiel2008-11-111-1933/+3027
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27903 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest FFmpeg changes.diego2008-11-081-9/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27902 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r25786.bircoph2008-11-081-378/+504
| | | | | | | | '-' signs are escaped throughout the manual page. Some spelling fixes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27901 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with r27402. Some spelling, typo fixes.bircoph2008-11-071-786/+735
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27900 b3059339-0415-0410-9bf9-f77b7e298cf2
* For fragment programs, check GL_MAX_TEXTURE_IMAGE_UNITS instead of ↵reimar2008-11-062-1/+4
| | | | | | GL_MAX_TEXTURE_UNITS. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27899 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27895gpoirier2008-11-061-23/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27898 b3059339-0415-0410-9bf9-f77b7e298cf2
* set to -1 fds that were closed; handle the sec_fd only if CONFIG_DVB_HEAD ↵nicodvb2008-11-052-3/+3
| | | | | | isn't defined; patch by Reimar git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27897 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add #include <string.h> for memset.diego2008-11-041-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27896 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in psy-rd x264 option description.diego2008-11-041-1/+1
| | | | | | | Noticed by Grozdan, microchip telenet be. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27895 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some const specifiers to function name variables; fixes a bunch ofdiego2008-11-041-2/+2
| | | | | | | "initialization discards qualifiers from pointer target type" warnings. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27894 b3059339-0415-0410-9bf9-f77b7e298cf2
* Intialize unused fd variables to -1 (which is actually invalid) insteadreimar2008-11-041-1/+1
| | | | | | | of 0 (which is stdin and can cause weird side-effects). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27893 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix condition broken in r27401 which incorrectly caused stdin to be closed ↵reimar2008-11-041-1/+1
| | | | | | after playing DVB. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27892 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a typo.bircoph2008-11-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27891 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove outdated sections.diego2008-11-031-79/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27890 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge ARCH_BFIN lines.diego2008-11-031-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27889 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add tests target for libswscale test programs.diego2008-11-031-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27888 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove forgotten ASM_OBJS in libswscalemru2008-11-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27887 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27885Gabrov2008-11-037-482/+176
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27886 b3059339-0415-0410-9bf9-f77b7e298cf2
* 44% synced with r22753 (going on... ;))ptt2008-11-031-101/+96
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27885 b3059339-0415-0410-9bf9-f77b7e298cf2
* lavc tscc decoder now also depends on zlibreimar2008-11-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27884 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a few more supported URL protocolsreimar2008-11-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27883 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forgotten reindentreimar2008-11-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27882 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a noicyx:// protocol to allow easier testing for misconfigured servers.reimar2008-11-022-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27881 b3059339-0415-0410-9bf9-f77b7e298cf2
* vfw.h needs a windows.h include before on MinGW64.reimar2008-11-021-0/+1
| | | | | | | Since vfw.h on MinGW32 includes windows.h automatically it should not make a difference there. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27880 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change OpenGL support to work on unmodified MinGW64reimar2008-11-022-4/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27879 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use libavutil FFMIN etc. instead of defining our own variants.reimar2008-11-021-21/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27878 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid pointless casting of void*reimar2008-11-021-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27877 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use NULL for pointers instead of 0.reimar2008-11-021-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27876 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fallback to non-fontconfig behaviour when fontconfig initialization fails.reimar2008-11-021-5/+3
| | | | | | | Also fixes a memleak in that case, bug #1313. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27875 b3059339-0415-0410-9bf9-f77b7e298cf2
* vobsub: move extradata out of vobsub_t structaurel2008-11-011-12/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27874 b3059339-0415-0410-9bf9-f77b7e298cf2
* vobsub: add sanity checkaurel2008-11-011-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27873 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an option that sets initial playback volume.diego2008-10-314-0/+16
| | | | | | | patch by Reimar and rvm, rvm3000 ya com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27872 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing free in malloc error case in COutputPinCreate.reimar2008-10-311-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27871 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid useless casts of malloc results.reimar2008-10-311-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27870 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid a potential memleak in parse_obj_params in case of a missingreimar2008-10-311-1/+2
| | | | | | m_ob_params_t part. Fixes bug #1318. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27869 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid a memleak if allocation of field_name fails, fixes bug #1319.reimar2008-10-311-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27868 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use dashes to separate words in section IDs.diego2008-10-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27867 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo noticed by Paul TT.diego2008-10-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27866 b3059339-0415-0410-9bf9-f77b7e298cf2
* linking correctionsptt2008-10-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27865 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27843ptt2008-10-301-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27864 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27843ptt2008-10-301-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27863 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27852ptt2008-10-302-191/+166
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27862 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed, as rev.27771ptt2008-10-301-539/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27861 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27770ptt2008-10-301-50/+59
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27860 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27815ptt2008-10-301-7/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27859 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27640ptt2008-10-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27858 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27663ptt2008-10-301-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27857 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27683ptt2008-10-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27856 b3059339-0415-0410-9bf9-f77b7e298cf2
* updated links for other commit referenceptt2008-10-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27855 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27771ptt2008-10-301-27/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27854 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27833ptt2008-10-301-300/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27853 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move codec installation instructions from the codecs section to a morediego2008-10-302-148/+152
| | | | | | | sensible place in the installation section. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27852 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore XMMS input plugin section from removed section in a better place.diego2008-10-301-0/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27851 b3059339-0415-0410-9bf9-f77b7e298cf2
* We now require GNU make 3.81.diego2008-10-291-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27850 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove X11 backing store: this is now a useless flag.ben2008-10-291-2/+2
| | | | | | | | | | | | | | | Also, it is mandatory for Xserver 1.5.x (part of Xorg 7.4, shipped on all Linux distributions starting from Oct. 08) and will be removed from Xserver 1.6 anyhow ... Patch by Stephane Marchesin (marchesin at icps dot u dash strasbg dot fr). For more info, see long flame thread at: http://lists.mplayerhq.hu/pipermail/mplayer-dev-eng/2008-August/058323.html git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27849 b3059339-0415-0410-9bf9-f77b7e298cf2
* zlib is used in many places.diego2008-10-291-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27848 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move libmad codec installation section to software requirements.diego2008-10-292-22/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27847 b3059339-0415-0410-9bf9-f77b7e298cf2
* section title wording fixesdiego2008-10-281-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27846 b3059339-0415-0410-9bf9-f77b7e298cf2
* Group codec library installation instructions together in a codecdiego2008-10-281-76/+76
| | | | | | | installation subsection. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27845 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move general comments from the video codec section to the top level.diego2008-10-281-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27844 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless FFmpeg codec section.diego2008-10-284-35/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27843 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure that linker flags passed as configure parameters appear beforediego2008-10-281-1/+1
| | | | | | | | those detected by configure so that the former can override the latter. patch by Giacomo Comes, comes naic edu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27842 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize vobsub idx/extradata handling.aurel2008-10-278-420/+81
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27841 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disallow the modification of teletext properties when the tv demuxer isfaust32008-10-271-0/+2
| | | | | | | not active. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27840 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid calling init_vo_spudec() too early.aurel2008-10-271-1/+1
| | | | | | | (before mpctx->d_sub->sh initialization) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27839 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix smartblur filter crash due to missing default scaler choice;diego2008-10-271-1/+1
| | | | | | | | set bicubic as the default scaler. patch by Kurt Garloff, kurt garloff de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27838 b3059339-0415-0410-9bf9-f77b7e298cf2
* Silence GCC warnings:vitor2008-10-271-1/+2
| | | | | | | | | | | | | ibswscale/swscale.c: In function ‘sws_scale’: libswscale/swscale.c:2678: warning: ‘b’ may be used uninitialized in this function libswscale/swscale.c:2678: warning: ‘g’ may be used uninitialized in this function libswscale/swscale.c:2678: warning: ‘r’ may be used uninitialized in this function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27837 b3059339-0415-0410-9bf9-f77b7e298cf2
* rgb2rgb.h was not really intended to be a public header, thus remove it.michael2008-10-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27836 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove rgb2rgb.h dependancy.michael2008-10-271-6/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27835 b3059339-0415-0410-9bf9-f77b7e298cf2
* Silence the following GCC warning:vitor2008-10-261-1/+1
| | | | | | | | | | libswscale/swscale.c: In function ‘pal2rgbWrapper’: libswscale/swscale.c:1744: warning: passing argument 4 of ‘conv’ from incompatible pointer type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27834 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge two Xvid build steps.diego2008-10-261-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27833 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove reference to containers.xml, which was removed.diego2008-10-261-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27832 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove notice about necessary tool versions in Xvid section, the info isdiego2008-10-261-3/+1
| | | | | | | most likely outdated. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27831 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete and pointless reference to Xvid divxcompat mode.diego2008-10-261-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27830 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: alphabetical orderdiego2008-10-261-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27829 b3059339-0415-0410-9bf9-f77b7e298cf2
* configure: Set CONFIG_MDCT and CONFIG_GOLOMB for libavcodecuau2008-10-261-2/+9
| | | | | | | After the latest FFmpeg changes these must be set if certain codecs are enabled. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27828 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused code that can't be compiled without svn archive.cehoyos2008-10-251-269/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27827 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not attempt to use the unscaled yuv2rgb converter when height is odd becausemichael2008-10-251-1/+1
| | | | | | | it will overflow the buffer by 1 line. This might have been exploitable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27826 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor fix in example command line for userscompn2008-10-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27825 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Reorder some FFmpeg-related config.h and config.mak entries.diego2008-10-251-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27824 b3059339-0415-0410-9bf9-f77b7e298cf2
* configure: Set CONFIG_FFT to fix libavcodec compilationuau2008-10-251-0/+7
| | | | | | | | | After the latest FFmpeg changes some codecs require that CONFIG_FFT is also set if the codec is enabled. This commit enables CONFIG_FFT unconditionally though in principle all the codecs requiring it could be disabled. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27823 b3059339-0415-0410-9bf9-f77b7e298cf2
* vf_palette: Fix compilation after libswscale API changesuau2008-10-251-8/+8
| | | | | | | Patch from Guillaume Poirier. I didn't test the functionality of the filter but at least it fixes compilation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27822 b3059339-0415-0410-9bf9-f77b7e298cf2
* updated to r27402, jumping over 27072, by now, i'll do soonptt2008-10-241-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27821 b3059339-0415-0410-9bf9-f77b7e298cf2
* Conditionally declare a conditionally used variable, fixes the warning:diego2008-10-241-1/+4
| | | | | | | stream/dvb_tune.c:99: warning: unused variable 'sec_dev' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27820 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Revert SH4 removal, which is required in FFmpeg.diego2008-10-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27819 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: alignmentvitor2008-10-231-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27818 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix broken palette8to*.vitor2008-10-233-75/+43
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27817 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: typo fixdiego2008-10-233-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27816 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove outdated message about outfmt=i420compn2008-10-231-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27815 b3059339-0415-0410-9bf9-f77b7e298cf2
* SH4 is an architecture, not a CPU extension.diego2008-10-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27814 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add ARM pld instruction test for FFmpeg ARM optimizations.diego2008-10-231-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27813 b3059339-0415-0410-9bf9-f77b7e298cf2
* IWMMXT optimizations were removed from our internal libmpeg2 copy, so nowdiego2008-10-221-3/+1
| | | | | | | remove it from the library interface code as well. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27812 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try to improve binary codec pack installation instructions.diego2008-10-221-7/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27811 b3059339-0415-0410-9bf9-f77b7e298cf2
* increase the max RTP packet size to 5MB as modern Elphelattila2008-10-221-1/+1
| | | | | | | | cameras do produce such huge packets. Requested by Alexandre Poltorak git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27810 b3059339-0415-0410-9bf9-f77b7e298cf2
* Determine default CD/DVD device in configure instead of using an #ifdef jungle.diego2008-10-212-26/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27809 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make cpuinfo.c compile under MinGW64reimar2008-10-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27808 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace typeof by __typeof__, the former is a non-portable GNU extension.diego2008-10-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27807 b3059339-0415-0410-9bf9-f77b7e298cf2
* Translate a Hungarian comment, thanks to Denes Balatoni.diego2008-10-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27806 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert typeof keyword into __typeof__conrad2008-10-191-10/+10
| | | | | | | | | typeof is a gcc extension and the former is not accepted in C99 without GNU extensions enabled (e.g. via -fasm). This fixes compilation on PPC. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27805 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid CreateThread and especially TerminateThread since they cause a memleak.reimar2008-10-191-21/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27804 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless casts.reimar2008-10-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27803 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improve error message when screen width and height are not set.diego2008-10-191-3/+8
| | | | | | | patch by Christian Ohm, chr.ohm gmx net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27802 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify screenw/screenh options, patch by Christian Ohm, chr.ohm gmx net.diego2008-10-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27801 b3059339-0415-0410-9bf9-f77b7e298cf2
* improve documentation of latest x264's optionsgpoirier2008-10-181-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27800 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use av_malloc/av_free for audio-related buffers to avoid crashes due toreimar2008-10-182-11/+5
| | | | | | | | insufficient alignment on systems without memalign. http://lists.mplayerhq.hu/pipermail/mplayer-dev-eng/2008-October/058743.html git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27799 b3059339-0415-0410-9bf9-f77b7e298cf2
* pci.c includes dha.h, remove redundant MAX_* definesranma2008-10-181-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27798 b3059339-0415-0410-9bf9-f77b7e298cf2
* MAX_PCI_DEVICES 64 is not enough on my system (even though lspci only shows ↵ranma2008-10-182-2/+2
| | | | | | 25 devices), upped to 256 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27797 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed image format detection for 15 bit color depthsfaust32008-10-171-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27796 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Reorganize config.h. Remove pointless comments, group togetherdiego2008-10-161-449/+195
| | | | | | | options in sensible parts and order them alphabetically. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27795 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo: _dev_dvd_openbsd --> _def_dvd_openbsddiego2008-10-161-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27794 b3059339-0415-0410-9bf9-f77b7e298cf2
* Create LIBDIR for binary codecs upon make install.diego2008-10-162-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27793 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move dcbzl definition to the FFmpeg section of config.h where it belongs.diego2008-10-161-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27792 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace all occurrences of '__volatile__' and '__volatile' by plain 'volatile'.diego2008-10-1625-101/+101
| | | | | | | | We were using an inconsistent mix of the three variants and 'volatile' should be the most correct and portable variant. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27791 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert declaring ThreadProc as void, it breaks the WINAPI.diego2008-10-161-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27790 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add -nomsgcolor option to match -msgcolor, patch by swell.k gmail com.diego2008-10-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27789 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change all occurrences of asm and __asm to __asm__, same as was done for FFmpeg.diego2008-10-1643-243/+238
| | | | | | | Neither variant is valid C99 syntax, but __asm__ is the most portable variant. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27788 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move DEFAULT_CDROM_DEVICE/DEFAULT_DVD_DEVICE to stream.h where it belongs.diego2008-10-162-27/+27
| | | | | | | config.h should only contain option definitions, no logic. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27787 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move likely/unlikely macros to libmpdemux/demuxer.h where they are used.diego2008-10-162-7/+8
| | | | | | | config.h should only contain option definitions, no logic. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27786 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move SCREEN_SIZE_X/Y definition to libmpcodecs/vd.c where it is used.diego2008-10-162-2/+3
| | | | | | | config.h should only contain option definitions, no logic. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27785 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move X11_FULLSCREEN definition to x11_common.h where it belongs.diego2008-10-163-6/+6
| | | | | | | config.h should only contain option definitions, no logic. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27784 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Merge some preprocessor checks.diego2008-10-161-9/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27783 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed overlay x and y calculationfaust32008-10-161-38/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27782 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move attribute_used declaration from config.h to mangle.h where it is useful.diego2008-10-162-7/+6
| | | | | | | config.h should only contain definitions, no logic. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27781 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless attribute_used from variable declaration.diego2008-10-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27780 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename stream/netstream.h to stream/stream_netstream.h; netstream.h to make itdiego2008-10-163-2/+2
| | | | | | | clearer that netstream.h belongs to stream_netstream.c. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27779 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert asm keyword into __asm__.flameeyes2008-10-166-180/+180
| | | | | | | | | | | | | | Neither the asm() nor the __asm__() keyword is part of the C99 standard, but while GCC accepts the former in C89 syntax, it is not accepted in C99 unless GNU extensions are turned on (with -fasm). The latter form is accepted in any syntax as an extension (without requiring further command-line options). Sun Studio C99 compiler also does not accept asm() while accepting __asm__(), albeit reporting warnings that it's not valid C99 syntax. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27778 b3059339-0415-0410-9bf9-f77b7e298cf2
* sun --> __sun in config.h preprocessor checkdiego2008-10-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27777 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc updates for the Xvid, x264 and AAC sectionsdiego2008-10-142-77/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27776 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move _def_fast_unaligned to the FFmpeg section of config.h.diego2008-10-141-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27775 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Consistently name all header #define variables.diego2008-10-141-40/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27774 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some pointless and/or outdated codec documentation sections.diego2008-10-141-204/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27773 b3059339-0415-0410-9bf9-f77b7e298cf2
* Honour differences between src and dst stride for packed yuvfaust32008-10-141-1/+1
| | | | | | | | patch by Laurent <laurent.aml at gmail.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27772 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove section about containers. Its contents are non-informative, redundant,diego2008-10-142-521/+0
| | | | | | | outdated and generally not worth the trouble. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27771 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update VIDIX vs. svgalib documentation.diego2008-10-141-8/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27770 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include necessary libavcodec header and remove duplicated struct declaration.diego2008-10-141-17/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27769 b3059339-0415-0410-9bf9-f77b7e298cf2
* update x264's section with r999 of x264gpoirier2008-10-141-16/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27768 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless '#undef realloc', realloc is not referenced anywhere near.diego2008-10-141-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27767 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicate extern declaration, fixes the warning:diego2008-10-141-2/+0
| | | | | | | libmpcodecs/vf_zrmjpeg.c:73: warning: redundant redeclaration of 'avcodec_initialized' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27766 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable ncomps.diego2008-10-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27765 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix double free in demux_nut, patch by Onur Küçük.ods152008-10-131-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27764 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set HAVE_FAST_UNALIGNED for PowerPC as well, patch by Emanuele Giaquinta.diego2008-10-131-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27763 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove global definition of WIN32 in config.h for Cygwin.diego2008-10-131-8/+1
| | | | | | | Instead just define it for libdvdcss, where it is strictly needed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27762 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace preprocessor check for WIN32 with checks for __MINGW32__ and __CYGWIN__.diego2008-10-1319-63/+87
| | | | | | | This avoids a pointless indirection that only obscures what is really done. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27761 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless #ifdef around the whole file, it is just a complicated #if 1.diego2008-10-131-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27760 b3059339-0415-0410-9bf9-f77b7e298cf2
* Declare ThreadProc as void, it does not return anything, fixes the warning:diego2008-10-131-6/+2
| | | | | | | stream/cache2.c:364: warning: control reaches end of non-void function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27759 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused function, fixes the warning:diego2008-10-131-46/+0
| | | | | | | stream/tvi_dshow.c:1311: warning: 'reconnect_pins' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27758 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unconditionally #include osdep/shem.h, fixes the warnings on Cygwin:diego2008-10-131-1/+1
| | | | | | | | stream/cache2.c:244: warning: implicit declaration of function `shmem_alloc' stream/cache2.c:265: warning: implicit declaration of function `shmem_free' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27757 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing Cygwin header, fixes the warning:diego2008-10-131-1/+6
| | | | | | | | get_path.c:151: warning: implicit declaration of function `cygwin_conv_to_full_w in32_path' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27756 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundantly declared definitions FILE_ANY_ACCESS and CTL_CODE, fixes:diego2008-10-131-3/+0
| | | | | | | | vidix/sysdep/libdha_win32.c:34:1: warning: "FILE_ANY_ACCESS" redefined vidix/sysdep/libdha_win32.c:35:1: warning: "CTL_CODE" redefined git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27755 b3059339-0415-0410-9bf9-f77b7e298cf2
* Surround conditionally used function with corresponding #ifdef, fixes:diego2008-10-131-0/+2
| | | | | | | libvo/vo_gl2.c:681: warning: 'gl_handlekey' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27754 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant variable declaration, fixes the warning:diego2008-10-131-1/+0
| | | | | | | | libvo/vo_winvidix.c:52: warning: redundant redeclaration of 'hWnd' libvo/vo_winvidix.c:50: warning: previous declaration of 'hWnd' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27753 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove check for byteswap.h, it was removed from FFmpeg.diego2008-10-131-18/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27752 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variables.diego2008-10-121-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27751 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant declaration of proc_priority.diego2008-10-121-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27750 b3059339-0415-0410-9bf9-f77b7e298cf2
* Filter out .hh and .h files in the C++ dependency generation command.diego2008-10-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27749 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless HAVE_STRCHR definition from config.h.diego2008-10-121-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27748 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing support for some multimedia keys to X11 backend code.diego2008-10-121-0/+9
| | | | | | | patch by Jorge Lopez, jorgelt gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27747 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move socklen_t typedef from config.h to stream/network.h.diego2008-10-123-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27744 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not provide a prototype for setenv in config.h, we do not provide adiego2008-10-111-3/+0
| | | | | | | prototype for all the other functions that we have in osdep/. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27743 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move some config.h entries to more sensible places.diego2008-10-101-23/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27742 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Group codec-, network- and gui-related options together in config.h.diego2008-10-101-39/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27741 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Group system header and function definitions together in config.h.diego2008-10-091-68/+66
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27740 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused line (and fix an icc warning).cehoyos2008-10-091-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27739 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace numeric constants by their defines.cehoyos2008-10-092-5/+5
| | | | | | | Fixes icc warning #188: enumerated type mixed with another type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27738 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark some symbols in swscale.c as constant.flameeyes2008-10-091-7/+7
| | | | | | | | | These are only used in swscale_template.c (and thus don't need to be made extern), and can be declared as ASM constants. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27737 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark dither_2x2_{8,4} static to swscale.cflameeyes2008-10-092-4/+2
| | | | | | | | | These two tables are not used outside swscale.c even though they are declared also in yuv2rgb.c. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27736 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark variation-specific interleaveBytes static.flameeyes2008-10-091-1/+1
| | | | | | | | | These functions are never called by themselves, the alias interleaveBytes is used instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27735 b3059339-0415-0410-9bf9-f77b7e298cf2
* Invert logic for the single-pass in swScale() functions.flameeyes2008-10-091-3/+3
| | | | | | | | | | | | | | | | Instead of having a firstTime variable defaulting to 1, have a warnedAlready defaulting to 0. While this should make no difference in code speed at runtime, it allows to aggregate the four bytes of that variable with clip_table in .bss section, rather than issuing a .data section just for that. As it is, libswscale require no .data section but .data.rel.ro (that can be mitigated by prelinking), so the change might actually save one page of memory at runtime (per process). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27734 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change variable types from int to enum PixelFormat.cehoyos2008-10-091-2/+2
| | | | | | | Fixes icc warning #188: enumerated type mixed with another type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27733 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix channel order for ffmpeg flac codec.ulion2008-10-093-1/+8
| | | | | | | This patch comes from Andrew de Quincey <adq_dvb at lidskialf dot net>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27732 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not set src[1] to the palette, it is now in the contextvitor2008-10-082-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27731 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a new unscaled PAL8 -> RGB converter.vitor2008-10-082-10/+55
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27730 b3059339-0415-0410-9bf9-f77b7e298cf2
* r27182: apply parameter name change of no-correct-pts from r26842 to man pagekraymer2008-10-081-12/+16
| | | | | | | | | | | | | | | | | r27208: dvd:// streams accept the device path in the url; patch by Mathieu SCHROETER mathieu.schroeter gamesover ch r27230: Give all shell scripts a .sh suffix for consistency. r27235: moved o option beetwen m* and p* r27236: another alphabetical order correction r27334: -border/-noborder are supported by gl/gl2, too, but only on Windows. r27337: No idea which vos support -noborder how well, though those based on X11 or running on Windows _should_ work. Just remove that line for now. r27342: Remove outdated "X11 only" from xineramascreen option and try to make clearer what it does and what it does not. r27348: add list of supported vo's to -xineramascreen git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27729 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change one more variable type from int to enum PixelFormat.aurel2008-10-081-1/+1
| | | | | | | This one was missing from r27727. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27728 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change variable types from int to enum PixelFormat.cehoyos2008-10-072-6/+6
| | | | | | | Fixes icc warning #188: enumerated type mixed with another type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27727 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary HAVE_AV_CONFIG_H #define.diego2008-10-072-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27726 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27691gpoirier2008-10-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27725 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correctly place second const in declaration.cehoyos2008-10-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27724 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move find_backwards_asf_guid asfguid.h to asfheader.c, the only place wherediego2008-10-052-10/+10
| | | | | | | | it is used. Fixes the following warning: ./libmpdemux/asfguid.h:94: warning: 'find_backwards_asf_guid' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27723 b3059339-0415-0410-9bf9-f77b7e298cf2
* gcc-apple specific fallback not necessary anymorelu_zero2008-10-051-5/+0
| | | | | | | | (btw no apple hardware is less than a Intel core, thus it won't come there w/out disabling all the optimizations) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27722 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable mp3lib and liba52-internal for icc.cehoyos2008-10-051-3/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27721 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use HAVE_FAST_64BIT instead of nonstandard __WORDSIZE macro.diego2008-10-051-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27720 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27718Gabrov2008-10-054-28/+71
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27719 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove b5Dither, g5Dither and r5Dither from libswscale.cehoyos2008-10-044-58/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27718 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert the removal of the likely/unlikely macros, they are still used.diego2008-10-041-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27717 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge variable declaration and export.diego2008-10-041-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27716 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove g6Dither from libswscale.cehoyos2008-10-044-14/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27715 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix "format '%d' expects type 'int', but argument 6 has type 'size_t'" warning.ranma2008-10-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27714 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a comment to lonely 'fi' for clarification.diego2008-10-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27713 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make alsa resume after suspend to disk (would say 'file descriptor is in bad ↵ranma2008-10-041-0/+4
| | | | | | state' before this change) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27712 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: more config.h reorderingdiego2008-10-041-218/+213
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27711 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Reorder entries in config.h.diego2008-10-041-103/+102
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27710 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l: Revert incorrect removal or --ar and --ranlib options.diego2008-10-041-0/+18
| | | | | | | They are still needed for FFmpeg. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27709 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Improve some config.h comments.diego2008-10-041-6/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27708 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not duplicate likely/unlikely #defines from libmpeg2/libavcodec in config.h.diego2008-10-041-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27707 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused HAVE_SYS_POLL_H definition from config.h.diego2008-10-041-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27706 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move around some more stuff in config.mak.diego2008-10-041-15/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27705 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move around stuff in config.mak.diego2008-10-041-15/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27704 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused LIBDIR Makefile variable from config.mak.diego2008-10-041-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27703 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused options --ar and --ranlib.diego2008-10-041-18/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27702 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not set DESTDIR to an empty value so that it can be overridden on thediego2008-10-041-1/+0
| | | | | | | command line. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27701 b3059339-0415-0410-9bf9-f77b7e298cf2
* FAAC/FAAD are no longer the only available AAC encoders/decoders.diego2008-10-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27700 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove word size check and macro and use __WORDSIZE directly instead.diego2008-10-042-15/+2
| | | | | | | It has been done this way in libswscale for years without apparent ill effect. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27699 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove MPlayer-specific MP_WORDSIZE hack.diego2008-10-041-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27698 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge SPARC and SPARC64 sections in the CPU detection code.diego2008-10-041-12/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27697 b3059339-0415-0410-9bf9-f77b7e298cf2
* Skip setting variables to empty values in the CPU detection code.diego2008-10-041-48/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27696 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove MinGW cruft.diego2008-10-031-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27695 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l copy and paste typo fixdiego2008-10-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27694 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling cosmeticsdiego2008-10-031-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27693 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix vsscanf test.diego2008-10-031-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27692 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_fbdev now supports -geometry.diego2008-10-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27691 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmeticsdiego2008-10-031-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27690 b3059339-0415-0410-9bf9-f77b7e298cf2
* CVS --> Subversiondiego2008-10-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27689 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compilation w/ FFmpeg r15533gpoirier2008-10-032-3/+3
| | | | | | | patch by Andrew Wason %rectalogic A rectalogic P com% git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27688 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include for mplayer.h, fixes the warning:diego2008-10-031-0/+1
| | | | | | | libvo/vo_png.c:67: warning: implicit declaration of function 'exit_player' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27687 b3059339-0415-0410-9bf9-f77b7e298cf2
* Filter out xpm files from the list of dependencies to check for recursivediego2008-10-031-2/+2
| | | | | | | | dependencies. This avoids a ton of spurious warnings when generating dependency information in the gui subdirectory. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27686 b3059339-0415-0410-9bf9-f77b7e298cf2
* External liba52 parameters should only be enabled if the check succeeded.diego2008-10-031-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27685 b3059339-0415-0410-9bf9-f77b7e298cf2
* Internal liba52 should default to enabled.diego2008-10-031-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27684 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix FAQ about compiling 32 bit mplayer on x86_64gpoirier2008-10-028-8/+8
| | | | | | | Suggested by Wolfgang Knauf git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27683 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the existing pt_iter_goto_head function instead of reimplementing itreimar2008-10-011-2/+2
| | | | | | (incorrectly). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27682 b3059339-0415-0410-9bf9-f77b7e298cf2
* mpctx->playtree is a node, files can not be directly appended to it,reimar2008-10-011-2/+2
| | | | | | append them to its child instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27681 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a "pause" property to allow checking if MPlayer is paused.reimar2008-10-012-0/+9
| | | | | | Behaviour without pausing_keep_force prefix is a bit weird. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27680 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a m_property_flag_ro function for the default behaviour of areimar2008-10-012-3/+15
| | | | | | read-only flag. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27679 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Remove deleted file libmpeg2/motion_comp_iwmmxt.c from Makefile as well.diego2008-10-011-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27678 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove IWMMXT optimizations through libavcodec from libmpeg2.diego2008-10-015-153/+1
| | | | | | | | | | According to Siarhei Siamashka libavcodec is faster on ARM so it is better to use it directly instead of creating this hackish mix of two libraries. Plus, these local changes would never be acceptable upstream, so no good reason for keeping it in our local patchset remains. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27677 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27651gpoirier2008-09-301-13/+61
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27676 b3059339-0415-0410-9bf9-f77b7e298cf2
* Apply patch for oCERT #2008-013 / CVE-2008-3827reimar2008-09-301-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27675 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27607gpoirier2008-09-291-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27674 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused function fast_memcpy.diego2008-09-291-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27673 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: indentationdiego2008-09-291-6/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27672 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert mistakenly committed hunk.michael2008-09-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27671 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print all cases that are tested, not just the ones that are bad.michael2008-09-291-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27670 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix infinite loop with spline, bug was introduced in r27612 by me.michael2008-09-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27669 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: prettyprintingdiego2008-09-281-149/+167
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27668 b3059339-0415-0410-9bf9-f77b7e298cf2
* slave command to get the number of chapters; patch by Kevin DeKorte - ↵nicodvb2008-09-263-0/+19
| | | | | | kdekorte gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27667 b3059339-0415-0410-9bf9-f77b7e298cf2
* Since the pause loop now also runs commands, set mpctx->was_pausedreimar2008-09-251-1/+1
| | | | | | before entering it for more consistency. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27666 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an experimental pausing_keep_force slave mode command prefixreimar2008-09-253-1/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27665 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not special-case a grouping-subsegment length of 0.reimar2008-09-251-1/+0
| | | | | | | Fixes samples/asf-wmv/quicktime.wmv git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27664 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc fixes for the GUI sectiondiego2008-09-251-8/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27663 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add debug message about loaded frequency tables.voroshil2008-09-241-1/+2
| | | | | | | | | Replace printed code of input type with user-frendly "broadcast"/"cable" strings. patch from Laurent laurent dot aml at gmail dot com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27662 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make output messages of frequency selection code more useful byvoroshil2008-09-241-2/+4
| | | | | | | | | | providing additional information like requested frequency and found nearest fequency/channel. patch from Laurent laurent dot aml at gmail dot com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27661 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix overflow in frequency conversion code inside tvi_dshow.voroshil2008-09-241-2/+2
| | | | | | | patch from Laurent laurent dot aml at gmail dot com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27660 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add RVTR fourcc to ffrv20 decoder.diego2008-09-231-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27659 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove one more pointless and gcc-specific __attribute__ ((unused)).diego2008-09-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27658 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore function parameters mistakenly removed in previous commit.diego2008-09-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27657 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless and gcc-specific __attribute__ ((unused)).diego2008-09-231-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27656 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure -I. appears before all other -I flags.diego2008-09-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27655 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix glAdjustAlignment parameter in glCreateClearTexreimar2008-09-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27654 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change glCreateClearTex to use the same host data format as later uploads.reimar2008-09-204-20/+26
| | | | | | | This fixes at least some of the massive performance problems the ATI drivers have. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27653 b3059339-0415-0410-9bf9-f77b7e298cf2
* add blackmagic 10bit decoder, works on v-codecs/R210/compn2008-09-201-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27652 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fix spotted by diegocompn2008-09-201-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27651 b3059339-0415-0410-9bf9-f77b7e298cf2
* add outdir sub-option to vo pngben2008-09-203-2/+68
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27650 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove already disabled and probably long obsolete code that worked around ↵reimar2008-09-201-16/+0
| | | | | | | | | an OpenBox bug. Patch by Julien Danjou [ julien danjou info ] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27649 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use already "prefetched" atoms instead of calling XInternAtom each time.reimar2008-09-201-5/+2
| | | | | | | Patch by Julien Danjou [ julien danjou info ] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27648 b3059339-0415-0410-9bf9-f77b7e298cf2
* another dupcompn2008-09-201-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27647 b3059339-0415-0410-9bf9-f77b7e298cf2
* duplicate fourcc spotted by uoticompn2008-09-201-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27646 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix typocompn2008-09-201-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27645 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with videolancompn2008-09-191-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27644 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with xinecompn2008-09-191-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27643 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with libavformat/riff.ccompn2008-09-191-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27642 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with libavformat/isom.c fourcccompn2008-09-191-6/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27641 b3059339-0415-0410-9bf9-f77b7e298cf2
* add windows NUL infocompn2008-09-191-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27640 b3059339-0415-0410-9bf9-f77b7e298cf2
* document lavc/lavf avoption o suboptioncompn2008-09-191-10/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27639 b3059339-0415-0410-9bf9-f77b7e298cf2
* add lavfopts matroska suboptioncompn2008-09-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27638 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify cpudetect OS-support detection code, e.g. using one mp_msg to print ↵reimar2008-09-181-28/+8
| | | | | | | | | either yes or no instead of two. Should not change code behaviour. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27637 b3059339-0415-0410-9bf9-f77b7e298cf2
* Uniform *ToY and *ToUV function signatureslu_zero2008-09-181-51/+51
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27636 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split mono2Y in monowhite and monoblacklu_zero2008-09-181-4/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27635 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize unit32_t* casts for palette pointerlu_zero2008-09-181-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27634 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mapping between MPlayer and FFmpeg colorspaces after libswscale changes.diego2008-09-171-10/+10
| | | | | | | patch by Reimar git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27633 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add shared libswscale support.rathann2008-09-162-1/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27632 b3059339-0415-0410-9bf9-f77b7e298cf2
* With -identify, ID_DVD_VOLUME_ID is not shown on some systems.diego2008-09-161-1/+1
| | | | | | | | Using DVDISOVolumeInfo instead of DVDUDFVolumeInfo fixes this. patch by Mathieu SCHROETER, mathieu.schroeter gamesover ch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27631 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not clobber _inc_extra variable when setting initial include flags.diego2008-09-161-1/+1
| | | | | | | based on patch by Andrew Wason, rectalogic rectalogic com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27630 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialize _def_liba52 and _def_liba52_internal before the liba52 checksdiego2008-09-161-2/+2
| | | | | | | so that they are always set to some value. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27629 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix segfault with rgb24 and full_internal_chroma due to non-existing alphamichael2008-09-161-2/+7
| | | | | | | byte being written after the array. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27628 b3059339-0415-0410-9bf9-f77b7e298cf2
* yet another mpeg2 in mov fourcc xd5b, fixes XDCAMHD.movcompn2008-09-161-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27627 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update the copyright statement.syrjala2008-09-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27626 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics:syrjala2008-09-151-143/+132
| | | | | | | | | - Convert tabs to spaces - Remove trailing whitespace - Remove useless comments git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27625 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't limit BES to non-synced single buffering when CRTC2 is used.syrjala2008-09-151-5/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27624 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename some variables and change some strings to make the CRTC1 code clearer.syrjala2008-09-151-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27623 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add CRTC1 support.syrjala2008-09-151-8/+112
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27622 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove BGR24 support since it has never worked anyway.syrjala2008-09-151-10/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27621 b3059339-0415-0410-9bf9-f77b7e298cf2
* External liba52 support, part 2 of 2.rathann2008-09-154-6/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27620 b3059339-0415-0410-9bf9-f77b7e298cf2
* External liba52 support part 1 of 2.rathann2008-09-151-0/+6
| | | | | | | | | | Conditionalize enabling of some the acceleration because liba52-0.7.4 doesn't support all that MPlayer's included copy does. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27619 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard -I flags to compile codec-cfg.diego2008-09-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27618 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add -I. to _inc_extra at the beginning instead of to CFLAGS at the end.diego2008-09-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27617 b3059339-0415-0410-9bf9-f77b7e298cf2
* riff.h and avi.h are not needed, but avio.h is.diego2008-09-151-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27616 b3059339-0415-0410-9bf9-f77b7e298cf2
* Eliminate void * arithmetic.syrjala2008-09-151-14/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27615 b3059339-0415-0410-9bf9-f77b7e298cf2
* Upgrade license of LGPL 2 or later files to LGPL 2.1 or later.diego2008-09-157-88/+89
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27614 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid useless line in libpostproc test.diego2008-09-151-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27613 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid using floating point for calculating filter coefficients.michael2008-09-151-81/+83
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27612 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid some explicit types in sizeof().michael2008-09-141-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27611 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use av_mallocz() instead of for() =0;michael2008-09-141-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27610 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move dither tables from yuv2rgb to swscale, they have been written by me andmichael2008-09-142-111/+111
| | | | | | | can be used under LGPL. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27609 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27607Gabrov2008-09-141-7/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27608 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording consistency cosmeticsdiego2008-09-141-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27607 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make -heartbeat-cmd and -stop-xscreensaver sections reference each other.reimar2008-09-141-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27606 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync diff with libmpeg2 update.diego2008-09-131-742/+75
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27605 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update internal libmpeg2 copy to version 0.5.1.diego2008-09-1322-289/+421
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27604 b3059339-0415-0410-9bf9-f77b7e298cf2
* libmpeg-0.4.1.diff was renamed to libmpeg2_changes.diff.diego2008-09-1311-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27603 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix libswscale build after r27561 if --enable-runtime-cpudetection is used.ben2008-09-131-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27602 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove version string from name of local changes diff file.diego2008-09-131-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27601 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix indention.michael2008-09-131-313/+313
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27600 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename yuv2rgb variables to avoid name clashes with the ones used by bfin asm.michael2008-09-132-12/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27599 b3059339-0415-0410-9bf9-f77b7e298cf2
* multiple locales in mplayer wishcompn2008-09-131-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27598 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable mmx routines that are not bitexact when the user wantsmichael2008-09-131-6/+15
| | | | | | | bitexact ones. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27597 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make horizontal mmx scaling code match C code.michael2008-09-131-16/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27596 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ensure that additional filter coeffs that exist due to alignmentmichael2008-09-131-0/+2
| | | | | | | are 0 if bitexact mode is requested. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27595 b3059339-0415-0410-9bf9-f77b7e298cf2
* yvu9toyv12Wrapper is not bitexact so disable it when the user wantsmichael2008-09-121-1/+1
| | | | | | | bitexactness to C. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27594 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the horizontal C scaler code clip only against INT16_MAX not 0,michael2008-09-121-1/+1
| | | | | | | this decreases the difference between C and MMX, its also faster. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27593 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add bitexact flag.michael2008-09-122-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27592 b3059339-0415-0410-9bf9-f77b7e298cf2
* The yuv->rgb tables are too small for cliping to be avoidable,michael2008-09-121-1/+1
| | | | | | | | | thus revert the respective optimization. The table generator code has to be rewritten anyway one day by some volunteer because its not LGPL, fixing the GPL table generator thus seems like wasted time. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27591 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix another 1000l bug in the mono input code.michael2008-09-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27590 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for PIX_FMT_YUV440P.michael2008-09-121-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27589 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10000l PIX_FMT_MONOWHITE check was really a || 1.michael2008-09-121-1/+1
| | | | | | | | Thats what happens when one does not do the full set of tests before each commit and just quickly goes over the diff thinking, "hey it is a trivial change". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27588 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support mono as input format.michael2008-09-122-1/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27587 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for PIX_FMT_MONOWHITE as output format.michael2008-09-123-8/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27586 b3059339-0415-0410-9bf9-f77b7e298cf2
* rgb24toyv12 is not accurately rounding, so disable it as well when themichael2008-09-121-1/+1
| | | | | | | user asks for accurate rounding. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27585 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use the unscaled yuv->rgb converters if SWS_ACCURATE_RND is set,michael2008-09-121-1/+2
| | | | | | | because they do not accurately round. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27584 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100000000000000l, forgot to commit header change for r27580.michael2008-09-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27583 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo that lead to averaging of the same pixel in rgb24ToUV_half().michael2008-09-111-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27582 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove mistakely commited code i used for testing.michael2008-09-111-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27581 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement full horizontal chroma for rgb/bgr24/32 output. michael2008-09-112-1/+115
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27580 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not do unneeded clipping in YSCALE_YUV_2_PACKEDX_C.michael2008-09-111-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27579 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize yuv2packedXinC().michael2008-09-112-228/+58
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27578 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set rgb2yuv constants more accurately, makes no real difference though.michael2008-09-111-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27577 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix chroma yuv->rgb tables for jpeg style yuv, this was missed as itmichael2008-09-111-4/+4
| | | | | | | only affects the C code while mmx uses different tables. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27576 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correct normalization constant for the vertical filter.michael2008-09-101-2/+2
| | | | | | | | I am not completely sure why this was at such an incorrect value, but I could not find any problems when it was set correctly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27575 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the 2point linear interpolation coefficients correct even for themichael2008-09-101-2/+2
| | | | | | | nearly never occurring 0.0, 1.0. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27574 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix overflow.michael2008-09-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27573 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26990 and wording fixes, patch by Cédric Viougpoirier2008-09-101-73/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27572 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording fixes by Cédric Viougpoirier2008-09-101-34/+66
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27571 b3059339-0415-0410-9bf9-f77b7e298cf2
* typography and wording fixes, by Cédric Viou and myselfgpoirier2008-09-101-197/+268
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27570 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix build failure due to %%eip on x86_64.michael2008-09-101-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27569 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change RGB2YUV_SHIFT from 16 to 15 to make it able to workmichael2008-09-102-5/+3
| | | | | | | with 16bit signed constants (like SIMD might use). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27568 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add bgr/rgb15/16/32->UV-half to the macro so there is less code duplicationmichael2008-09-101-124/+24
| | | | | | | at the source level. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27567 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize RGB/BGR15/16/32->UV by using the preprocessor.michael2008-09-101-93/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27566 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize rgb/bgr15/16/32->Y by using the preprocessor.michael2008-09-101-81/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27565 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make SWS_FULL_CHR_H_INP work.michael2008-09-102-11/+165
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27564 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/wording cosmeticsdiego2008-09-101-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27563 b3059339-0415-0410-9bf9-f77b7e298cf2
* More accurate rounding for 8bit inputs.michael2008-09-091-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27562 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rewrite bgr24->yuv mmx code, the new code is cleaner, more accurate,michael2008-09-092-196/+147
| | | | | | | and does not throw half the chroma away. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27561 b3059339-0415-0410-9bf9-f77b7e298cf2
* more French typography fixes and wording fixes, by Cédric Viou and myselfgpoirier2008-09-091-72/+84
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27560 b3059339-0415-0410-9bf9-f77b7e298cf2
* lots of fixes, original patch by Cédric Viougpoirier2008-09-091-50/+67
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27559 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add table of rgb->yuv conversion coefficients.michael2008-09-091-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27558 b3059339-0415-0410-9bf9-f77b7e298cf2
* More correct rounding for the rgb/bgr->yuv converters.michael2008-09-091-20/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27557 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make internal Matroska demuxer default againuau2008-09-091-1/+0
| | | | | | | | | | Undo Aurelien's previous commit which made the lavf demuxer the default. SSA/ASS subtitles do not work properly with the lavf demuxer at the moment. That's much more important than any issues with the internal demuxer. The internal demuxer must remain the default at least until the subtitle issues are resolved. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27556 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert r27551 which break much more things than it fixesaurel2008-09-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27555 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use preprocessor conditionals to disable CPU-extension-specific code. We cannotdiego2008-09-093-12/+85
| | | | | | | | rely on libmpeg2's internal CPU extension handling, it leads to link failures with our build system. Fixes Bugzilla #1188. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27554 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix offsets and fuzz in local diff.diego2008-09-091-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27553 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prevent overflows during mpeg->jpeg yuv.michael2008-09-091-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27552 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use internal demuxer for Matroska files for nowuau2008-09-081-1/+0
| | | | | | | | | Change the default demuxer back to the internal one at least until the current lavf breakage with SSA/ASS subtitles is sorted out. There have also been quite a few other regressions so maybe the lavf demuxer should be tested a bit more before trying to make it the default again. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27551 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert bad changes to SSA/ASS subtitle packet formatuau2008-09-082-40/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The following commits are reverted partially or completely: "a valid ASS line contains 9 ',' before actual text" "demux_mkv: output correctly formated ASS packets" "libass: add a new ass_process_data() to process demuxed subtitle packets" These commits converted the internal representation of SSA/ASS subtitle packets from the format used by Matroska to a custom format where each packet has contents exactly matching one line in complete SSA script files. AFAIK no files natively use such a format for muxed subtitles. The stated reason for this change was to use a format that could in principle be muxed into a maximal number of containers. SSA subtitles do not have an implicit duration so both start time and duration or end time need to be specified explicitly; the new format moved timing information inside the codec packet data so it could be muxed without modification into containers that can represent only start time at the container level. However such a change is wrong from the viewpoint of program architecture. Timing information belongs to the demuxer level, but these commits moved not only the duration but also the authoritative value of the start time to inside the codec data. Additionally the new format lost the value of the Matroska ReadOrder field which is used by MPlayer. This commit changes the internal packet format back to that used by Matroska and makes the internal Matroska demuxer output that format again. Libavformat still outputs the "new" format; it could be converted back to the Matroska format in demux_lavf.c, but I'm not adding that code at least yet. The current lavf code has similar problems as the reverted code in MPlayer, and it also currently fails to provide any way to access the value of the ReadOrder field. I hope that the lavf side will be improved; if it isn't conversion can be added later. For now I'll make MPlayer default to the internal Matroska demuxer instead of the lavf one in a separate commit. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27550 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compilation with lavc version > r15270gpoirier2008-09-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27549 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after libavcodec major version 52 changesuau2008-09-085-11/+13
| | | | | | | | | | | Some symbols were dropped or renamed, requiring corresponding changes in MPlayer. - Use AVCodecContext->bits_per_coded_sample instead of ->bits_per_sample. - Use AVCodecContext->trellis instead of ->flags&CODEC_FLAG_TRELLIS_QUANT. - Don't set AVCodecContext->rtp_mode (already marked unused before). - Use ff_eval2() instead of ff_eval(). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27548 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix jpeg yuv.michael2008-09-082-8/+37
| | | | | | | Fixes issue504. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27547 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in comment.michael2008-09-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27546 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix accurate rounding mode on x86_64.michael2008-09-073-21/+34
| | | | | | | Fixes issue222. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27545 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make ToY and ToUV family of function consistent part Ilu_zero2008-09-071-16/+16
| | | | | | | Convert width argument from int to long (note: srcW is still an int). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27544 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make fast bilinear scaler work again.michael2008-09-071-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27543 b3059339-0415-0410-9bf9-f77b7e298cf2
* 'mp3lame' audio output codec was wrongly listed as 'lame'.diego2008-09-071-2/+2
| | | | | | | noticed by Robert Vincenz, vincenz.robert t-online de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27542 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace casual GPL notices by proper license headers.diego2008-09-0721-101/+405
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27541 b3059339-0415-0410-9bf9-f77b7e298cf2
* license header cosmeticsdiego2008-09-071-18/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27540 b3059339-0415-0410-9bf9-f77b7e298cf2
* license header cosmeticsdiego2008-09-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27539 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove wrong compilation instructions.diego2008-09-071-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27538 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove encode2mpeglight, it is only an outdated stripped-down version of thediego2008-09-072-2016/+0
| | | | | | | tool maintained externally at http://encode2mpeg.sf.net/. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27537 b3059339-0415-0410-9bf9-f77b7e298cf2
* license header cosmeticsdiego2008-09-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27536 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix incorrect FSF address in license header.diego2008-09-061-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27535 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace casual GPL notice by proper license header.diego2008-09-061-3/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27534 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove outdated URL from vd_info_t struct.diego2008-09-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27533 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove version information from libmpeg2 vd_info_t struct.diego2008-09-061-1/+1
| | | | | | | It is available in other places and needs to be updated continuously. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27532 b3059339-0415-0410-9bf9-f77b7e298cf2
* libass: fix type mismatch between size parameter and the way it's usedaurel2008-09-052-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27531 b3059339-0415-0410-9bf9-f77b7e298cf2
* libass: add a new ass_process_data() to process demuxed subtitle packetsaurel2008-09-053-7/+25
| | | | | | | conforming to the ASS spec git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27530 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux_mkv: output correctly formated ASS packetsaurel2008-09-051-1/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27529 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplify function selection codebcoudurier2008-09-051-6/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27528 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable yuv422p to uyvy converterbcoudurier2008-09-054-0/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27527 b3059339-0415-0410-9bf9-f77b7e298cf2
* a valid ASS line contains 9 ',' before actual textaurel2008-09-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27526 b3059339-0415-0410-9bf9-f77b7e298cf2
* lavf: the subtitles display duration is stored in pkt.convergence_durationaurel2008-09-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27525 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make 16bit grayscale output work.michael2008-09-042-6/+75
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27524 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix SWS_FAST_BILINEAR and SWS_POINT with some unscaled rgb<->bgr converters.michael2008-09-041-7/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27523 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support PIX_FMT_RGB32_1 and PIX_FMT_BGR32_1.michael2008-09-044-8/+53
| | | | | | | Fixes issue248. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27522 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 4 and 8 bit RGB/BGR input.michael2008-09-041-9/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27521 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove workaround for rgb/bgr mess.michael2008-09-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27520 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 4 of the unscaled rgb15/16 converters, each of these containedmichael2008-09-041-28/+10
| | | | | | | | | 2-3 bugs each of which made it fail completely, this code clearly has never been tested and been written by somone who knows the difference between a potato and a computer is that the first is round. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27519 b3059339-0415-0410-9bf9-f77b7e298cf2
* rgb vs bgr fix for the unscaled converters.michael2008-09-043-42/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27518 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix rgb15/16 vs. bgr part2.michael2008-09-041-24/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27517 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix rgb15/16 vs. bgr part1.michael2008-09-041-5/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27516 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add fflush to prevent stdout & stderr from being mixed.michael2008-09-041-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27515 b3059339-0415-0410-9bf9-f77b7e298cf2
* support E-AC-3 decoding using ffmpegaurel2008-09-013-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27514 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove Windows-specific #ifdefs, the file does not compile on MinGW anyway.diego2008-09-011-10/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27513 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore .exe files on Windows.diego2008-09-010-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27512 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename --enable-tremor-external option to --enable-tremor along with thediego2008-09-011-8/+8
| | | | | | | corresponding variables. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27511 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not refer to libcdio and liblzo as external in the help output.diego2008-09-011-2/+2
| | | | | | | External libraries are the default, no need to stress this fact. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27510 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename --enable-faad-external option to --enable-faad along with thediego2008-09-011-14/+10
| | | | | | | corresponding variables. This allows simplifying the libfaad check. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27509 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialize _def_faad* variables to disabled before setting them.diego2008-09-011-2/+2
| | | | | | | This fixes _def_faad_internal never being set when using external libfaad. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27508 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fall back on external libfaad check if internal libfaad check failed.diego2008-09-011-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27507 b3059339-0415-0410-9bf9-f77b7e298cf2
* Put '#define closesocket close' under proper '#ifndef HAVE_CLOSESOCKET'diego2008-09-011-1/+4
| | | | | | | preprocessor condition. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27506 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move '#define closesocket close' preprocessor directive to a common placediego2008-09-0114-23/+17
| | | | | | | and put it under the proper '#ifndef HAVE_CLOSESOCKET' condition. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27505 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert moving closesocket definition and network headers to network.h.diego2008-08-3114-15/+115
| | | | | | | This caused lots of trouble on MinGW, we need a different solution. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27504 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only use winsock2.h to check for closesocket().diego2008-08-311-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27503 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix closesocket test, patch by Serge Levin, serge.levin.spb gmail com.diego2008-08-311-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27502 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add necessary #include <stdlib.h> for realloc/calloc/free.diego2008-08-311-0/+1
| | | | | | | patch by JonY, 10walls gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27501 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused GUID_t definition that also incorrectly defined GUID_DEFINEDreimar2008-08-311-14/+0
| | | | | | (while actually not defining GUID, only GUID_t). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27500 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change header inclusion guard names in line with FFmpeg r15120.stefano2008-08-313-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27499 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename internal libdvdread fork from dvdread to libdvdreadrathann2008-08-3029-37/+37
| | | | | | | | to avoid clashing with external libdvdread. (Sync with libdvdread r1122) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27498 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print DVD volume ID with -identify.reimar2008-08-301-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27497 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move duplicated '#define closesocket close' into network.h along withdiego2008-08-2914-115/+15
| | | | | | | network-related #include #ifdeffery. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27496 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency cosmetics: Avoid using .. in #include paths.diego2008-08-298-52/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27495 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync libdvdcss with upstream version 1.2.10.diego2008-08-2911-17/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27494 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename HAVE_WINSOCK preprocessor condition to HAVE_WINSOCK_H.diego2008-08-2923-59/+60
| | | | | | | | | This is what it is called in FFmpeg and more consistent with other names for similar conditionals. This fixes a potential compilation failure on MinGW, as described in Bugzilla #1262. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27493 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement swscale_version().stefano2008-08-292-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27492 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless '#if 1 [...] #endif' around has_cpuid() function.diego2008-08-291-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27491 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement check for closesocket(), needed by libavformat, fixes Bugzilla #1257.diego2008-08-291-0/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27490 b3059339-0415-0410-9bf9-f77b7e298cf2
* handle the lavfpref demuxer in the same way as the lavf oneaurel2008-08-273-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27489 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27454ptt2008-08-271-15/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27488 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync'ed to r27071ptt2008-08-271-66/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27487 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop av_always_inline definition. It is duplicated from libavutil anddiego2008-08-262-17/+5
| | | | | | | unlikely to make any difference. This reduces the diff to upstream. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27486 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename always_inline macro to av_always_inline so as not to clash withdiego2008-08-262-8/+8
| | | | | | | | with __attribute__((always_inline)) declarations. This fixes the build on Mac OS X 10.4.11. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27485 b3059339-0415-0410-9bf9-f77b7e298cf2
* prefer libavformat to demux matroska filesaurel2008-08-261-0/+1
| | | | | | | I can't spot any regression anymore. If you find one, please tell me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27484 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix forumla -> formula in commentreimar2008-08-261-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27483 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 'cast from pointer to integer of different size' on 64bit architectures. ↵ranma2008-08-241-1/+1
| | | | | | Casting to long should work for 32bit and 64bit and not make a difference to the boolean operation (since 'format' is always 32bit (int) the upper 32bit of 'arg' won't matter, but the compiler should be happy now. Casting both to unsigned makes sure the compiler isn't messing things up by sign-extending 'format' to 64bit before masking) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27482 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle AOPLAY_FINAL_CHUNKranma2008-08-241-33/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27481 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: indentationaurel2008-08-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27480 b3059339-0415-0410-9bf9-f77b7e298cf2
* use new lavf API to grab sample_aspect_ratio from the demuxersaurel2008-08-241-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27479 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compiler warningsranma2008-08-231-8/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27478 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused and untested function. It is only part of our local patchset.diego2008-08-222-67/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27477 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicate vsscanf fallback implementation, we have another in osdep/.diego2008-08-221-13/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27476 b3059339-0415-0410-9bf9-f77b7e298cf2
* -geometry support for -vo fbdev.reimar2008-08-221-0/+2
| | | | | | | Patch by Sander (thrill12 gmx net) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27475 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync libdvdcss with upstream version r212.diego2008-08-2110-15/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27474 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for AAC decoding through FFmpeg; libfaad is preferred for now.diego2008-08-211-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27473 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove trailing whitespace and tabs.diego2008-08-211-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27472 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove SKIP_DEPS trick. The same effect can be achieved without it.diego2008-08-181-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27471 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix for alignment problem on older ARM coresdiego2008-08-172-2/+2
| | | | | | | patch by Siarhei Siamashka, siarhei.siamashka gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27470 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add check for ARM VFP instructions.diego2008-08-171-1/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27469 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27466gpoirier2008-08-151-1/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27468 b3059339-0415-0410-9bf9-f77b7e298cf2
* Work correctly with very small files where less than outburst is to be played.diego2008-08-151-0/+23
| | | | | | | patch by Tobias Diedrich, ranma tdiedrich de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27467 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document -lavcopts o, aka libavcodec AVOption.michael2008-08-151-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27466 b3059339-0415-0410-9bf9-f77b7e298cf2
* FFmpeg no longer has fastmemcpy support, so no longer trigger recursingdiego2008-08-141-1/+1
| | | | | | | into the FFmpeg directories if libvo/fastmemcpy.h changed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27465 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused static declarations, fixes the warnings:diego2008-08-141-6/+0
| | | | | | | | libmpcodecs/vd_qtvideo.c:69: warning: 'ImageCodecDrawBand' defined but not used libmpcodecs/vd_qtvideo.c:71: warning: 'ImageCodecEndBand' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27464 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use '#include <poll.h>' instead of '#include <sys/poll.h>'.diego2008-08-146-8/+8
| | | | | | | It is the standard location as defined by the Open Group. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27463 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l: Rename missed preprocessor directives from a HAVE_ prefix to CONFIG_.diego2008-08-142-16/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27462 b3059339-0415-0410-9bf9-f77b7e298cf2
* add mapping for real audio and video CODEC_ID to MPlayer's fourccaurel2008-08-131-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27461 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes spotted by diegocompn2008-08-131-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27460 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux_lavf: fix mp_seek behavior in case of seeking erroraurel2008-08-131-1/+6
| | | | | | | | | | | | When trying to seek past the end of file, the ByteIOContext expect that the stream is left in the same state as it was before the tentative seek. stream_seek() does not meet this expectation. It changes current position when seeking past the end of file. Thus, it is necessary to reset the stream to its previous state after a seek failure. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27459 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless #ifdefs around extern declarations.diego2008-08-121-6/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27458 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless DVB-related #include.diego2008-08-121-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27457 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable PNG encoder in libavcodec for vf_screenshot only if zlib is enabled.diego2008-08-121-1/+2
| | | | | | | based on a patch by Magnus Damm, magnus.damm gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27456 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatescompn2008-08-121-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27455 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention IVTV, S3 and SH_VEU drivers within VIDIX section of manpage.ben2008-08-112-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27454 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update ChangeLog with latest VIDIX related changes regarding SuperH.ben2008-08-111-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27453 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add VIDIX driver for SuperH Mobile VEU hardware block.ben2008-08-114-2/+606
| | | | | | | | Patch by Magnus Damm <magnus dot damm at gmail dot com>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27452 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add proper VIDIX support for SuperH architecture.ben2008-08-114-5/+11
| | | | | | | | Patch by Magnus Damm <magnus dot damm at gmail dot com>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27451 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27348, patch by JRaSHgpoirier2008-08-111-17/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27450 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix audio in some rtsp streams, ok'd by lu_zerocompn2008-08-111-0/+1
| | | | | | | | patch by Changjin Liu - !lcj.liu!at!gmail!com! http://thread.gmane.org/gmane.comp.video.mplayer.user/56893/focus=56894 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27449 b3059339-0415-0410-9bf9-f77b7e298cf2
* The PNG encoder in libavcodec needs to be enabled for vf_screenshot even ifdiego2008-08-101-2/+2
| | | | | | | MEncoder is disabled. patch by Adrian Stutz, adrian sttz ch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27448 b3059339-0415-0410-9bf9-f77b7e298cf2
* codecs.c note is very old and unneeded.compn2008-08-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27447 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/27407 + fixesgpoirier2008-08-091-14/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27446 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use translatable string instead of hardcoded message for process priority.diego2008-08-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27445 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicated prototype for XShmGetEventBase(), becausediego2008-08-092-5/+0
| | | | | | | | | - it is used in other places without checking, - it is a workaround for a bug elsewhere, - if the problem is real at all, there should be a proper configure check. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27444 b3059339-0415-0410-9bf9-f77b7e298cf2
* Skip dependency generation if we just run distclean or if skippingdiego2008-08-091-0/+6
| | | | | | | is requested explicitly on the command line. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27443 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't print drawing commands on screen.eugeni2008-08-081-1/+12
| | | | | | | Drawing mode is not implemented in libass. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27442 b3059339-0415-0410-9bf9-f77b7e298cf2
* If (has outline) blur(outline) else blur(glyph).eugeni2008-08-071-1/+2
| | | | | | | | | | | If there is an outline, the glyph itself should not be blurred. Keeps the border between glyph and outline clear (unblurred), which is probably how it should be. Patch by Diogo Franco (diogomfranco gmail com). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27441 b3059339-0415-0410-9bf9-f77b7e298cf2
* \org turns off collision detection.eugeni2008-08-071-0/+1
| | | | | | | Patch by Diogo Franco (diogomfranco gmail com). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27440 b3059339-0415-0410-9bf9-f77b7e298cf2
* Treat \h as space character.eugeni2008-08-071-1/+1
| | | | | | | Patch by Robert Rudd (robrudd at users sourceforge net). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27439 b3059339-0415-0410-9bf9-f77b7e298cf2
* Calculate subtitle origin in floating point.eugeni2008-08-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27438 b3059339-0415-0410-9bf9-f77b7e298cf2
* Calculate subtitle position in floating point.eugeni2008-08-071-7/+7
| | | | | | | | Improves subtitle position precision from a unit of script coordinates to a screen pixel. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27437 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add separate variables for CFLAGS that are specific to internal librariesdiego2008-08-072-7/+12
| | | | | | | and only add them to CFLAGS when compiling objects from those libraries. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27436 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused Makefile variable.diego2008-08-071-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27435 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Rename some CFLAGS-related variables.diego2008-08-072-17/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27434 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Remove stray backslash at end of line.diego2008-08-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27433 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge two redundantly declared lines into one.diego2008-08-071-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27432 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Sort things into alphabetical order in various places.diego2008-08-071-88/+88
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27431 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add NV12 colorspace support to VIDIX driver.ben2008-08-072-0/+33
| | | | | | | patch by Magnus Damm <magnus dot damm at gmail dot com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27430 b3059339-0415-0410-9bf9-f77b7e298cf2
* Give a CONFIG_ prefix to preprocessor directives that lacked one anddiego2008-08-0719-77/+77
| | | | | | | change arbitrary prefixes to CONFIG_. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27429 b3059339-0415-0410-9bf9-f77b7e298cf2
* generalized SH architecture support by Magnus Damm, magnus.damm gmail comdiego2008-08-071-16/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27428 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: MUSEPACK --> CONFIG_MUSEPACKdiego2008-08-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27427 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ahem, the MACOSX_FINDER_SUPPORT directive was renamed to MACOSX_FINDER.diego2008-08-074-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27426 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename font-related preprocessor directives.diego2008-08-0731-130/+130
| | | | | | | Switch them from a HAVE_ to a CONFIG_ prefix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27425 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix wrong behavior with slave command by going back to the starting pointben2008-08-071-0/+4
| | | | | | | | | of the play_tree to pop all existing configurations. Patch by Mathieu Schroeter <mathieu dot schroeter at gamesover dot ch>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27424 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename a bunch of miscellaneous preprocessor directives.diego2008-08-0713-55/+55
| | | | | | | Switch them from a HAVE_ to a CONFIG_ prefix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27423 b3059339-0415-0410-9bf9-f77b7e298cf2
* Introduce CONFIG_ALSA preprocessor directive for ALSA 0.9 and 1.x.diego2008-08-0611-29/+35
| | | | | | | Use it in all the places that checked for either ALSA 0.9 or 1.x. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27422 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27420Gabrov2008-08-062-16/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27421 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename all preprocessor directives related to Apple / Mac OS X.diego2008-08-067-32/+32
| | | | | | | Switch them from a HAVE_ to a CONFIG_ prefix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27420 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename some audio-output-related preprocessor directives.diego2008-08-0512-50/+50
| | | | | | | Switch them from a HAVE_ prefix to a CONFIG_ prefix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27419 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename preprocessor definition in check skeleton.diego2008-08-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27418 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename preprocessor directives related to image libraries.diego2008-08-057-27/+27
| | | | | | | Change a HAVE_ prefix to a CONFIG_ prefix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27417 b3059339-0415-0410-9bf9-f77b7e298cf2
* Detect ppc64 and powerpc64 architectures as PowerPC variants.ben2008-08-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27416 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic: reindent after r27414ben2008-08-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27415 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes unsafe 'chapter' command with get_property() call.ben2008-08-041-1/+2
| | | | | | | | | Without it, MPlayer segv trying to dereference NULL demuxer. Patch by Mathieu Schroeter (mathieu dot schroeter at gamesover dot ch) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27414 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic: reindent after r27412ben2008-08-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27413 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes unsafe 'angle' command with get_property() call.ben2008-08-041-1/+2
| | | | | | | | | Without it, MPlayer segv trying to dereference NULL demuxer. Patch by Mathieu Schroeter (mathieu dot schroeter at gamesover dot ch) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27412 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes unsafe 'switch_audio' command with set_property() call.ben2008-08-041-0/+2
| | | | | | | | | Without it, MPlayer segv trying to dereference NULL demuxer. Patch by Mathieu Schroeter (mathieu dot schroeter at gamesover dot ch) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27411 b3059339-0415-0410-9bf9-f77b7e298cf2
* another round to get it in utf-8...ptt2008-08-041-231/+235
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27410 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change a bunch of X11-specific preprocessor directives.diego2008-08-0420-125/+125
| | | | | | | Switch from a HAVE_ prefix to a CONFIG_ prefix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27409 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fix, bump sync taggpoirier2008-08-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27408 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add video driver for Nintendo Wii/GameCube.ben2008-08-037-0/+449
| | | | | | | | | | | | | | | | | | | | Original patch by Jing Liu <fatersh-1@yahoo.com>, based on vo_fbdev.c and adapted to Nintendo's specific GPU. This driver handles dedicated ATI GPU, which can be found in: - Nintendo GameCube (ATI LSI Flipper @ 162 MHz) - Nintendo Wii (ATI Hollywood @ 243 MHz) Flipper and Hollywood chipsets are pretty similar, except from clock speed: - Embedded framebuffer is 2MB. - Texture cache is 1MB. - Vertex cache is 0.1 MB. - Framebuffer is YUY2, not RGB. - Best resolution is 480p (854x480) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27407 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicated DVB definition line.diego2008-08-031-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27406 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert mistakenly committed temporary local change.diego2008-08-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27405 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename --enable-macosx-finder-support option to --enable-macosx-finderdiego2008-08-031-16/+16
| | | | | | | and rename related variables accordingly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27404 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename _smbsupport variable to _smb.diego2008-08-031-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27403 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change a bunch of video/audio-output-specific preprocessor directives fromdiego2008-08-0361-239/+240
| | | | | | | a HAVE_ prefix to a CONFIG_ prefix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27402 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set HAVE_DVB in configure when HAVE_DVB_HEAD is defineddiego2008-08-023-8/+5
| | | | | | | instead of doing in redundantly in DVB-specific files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27401 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: typo fixesdiego2008-08-022-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27400 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: reindent after last commitcompn2008-08-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27399 b3059339-0415-0410-9bf9-f77b7e298cf2
* change ve_raw.c:set_format to not overwrite biCompression if force_fourcc is ↵compn2008-08-021-0/+1
| | | | | | | | | | set. fixes -ovc raw -ffourcc patch by "Andrew Wason" rectalogic !@! rectalogic !.! com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27398 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change a bunch of video-output-specific preprocessor directives from a HAVE_diego2008-08-027-85/+85
| | | | | | | prefix to a CONFIG_ prefix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27397 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not provide a prototype for vsscanf when vsscanf is available.diego2008-08-021-3/+1
| | | | | | | Fixes a redundant redeclaration warning. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27396 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change a bunch of codec-specific preprocessor directives from a HAVE_diego2008-08-0212-91/+91
| | | | | | | prefix to a CONFIG_ prefix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27395 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove checks for HAVE_XVID3, that conditional was removed a long time ago.diego2008-08-022-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27394 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix ARM linking failure when IWMMXT support is disabled.diego2008-08-012-3/+9
| | | | | | | patch by Siarhei Siamashka, siarhei.siamashka gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27393 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete diff hunk that is no longer applied to the code.diego2008-08-011-14/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27392 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename some preprocessor directives from CONFIG_* to HAVE_* where appropriate;diego2008-08-0121-86/+86
| | | | | | | CONFIG_ prefix for configurable options, HAVE_ for system-dependent stuff. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27391 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a misleading section in the libavcodec options manual indicating that adiego2008-08-011-11/+1
| | | | | | | | | rc_eq of 1 will return a CBR encode and a rc_eq of tex a const QP encode; likewise for qcomp. patch by tripp, eliared yahoo com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27390 b3059339-0415-0410-9bf9-f77b7e298cf2
* add hdv1 fourcccompn2008-08-011-0/+6
| | | | | | | sync from vlc's fourcc.h git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27389 b3059339-0415-0410-9bf9-f77b7e298cf2
* add some h263 fourccscompn2008-08-011-1/+3
| | | | | | | sync with vlc's fourcc.h git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27388 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ADJV fourcc to mjpegcompn2008-08-011-0/+1
| | | | | | | fourcc found in vlc/modules/codec/avcodec/fourcc.h git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27387 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialize socklen_t variable to "no".diego2008-08-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27386 b3059339-0415-0410-9bf9-f77b7e298cf2
* add XIXL fourcc to videoxl codeccompn2008-08-011-0/+1
| | | | | | | fourcc found in xine-engine/buffer_types.c git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27385 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename binary-codecs.sh to binary_codecs.sh as it is called in Debian.diego2008-07-312-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27384 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert previous broken rename of binary-codecs.sh that had random changes.diego2008-07-312-67/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27383 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename binary-codecs.sh once more to binary_codecs.sh as it is called in Debian.diego2008-07-312-23/+67
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27382 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename install-w32codecs.sh --> binary-codecs.sh.diego2008-07-312-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27381 b3059339-0415-0410-9bf9-f77b7e298cf2
* bump sync taggpoirier2008-07-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27380 b3059339-0415-0410-9bf9-f77b7e298cf2
* For the case that we add a typedef for socklen_t, we should #definediego2008-07-301-0/+1
| | | | | | | HAVE_SOCKLEN_T as well to avoid clashing with other typedefs. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27379 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for socklen_t in ws2tcpip.h as well.diego2008-07-301-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27378 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename preprocessor directive HAVE_MENU --> CONFIG_MENU.diego2008-07-305-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27377 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused HAVE_MENCODER definition.diego2008-07-301-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27376 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename two GUI-related preprocessor directives:diego2008-07-3045-116/+116
| | | | | | | HAVE_NEW_GUI --> CONFIG_GUI, HAVE_GTK2_GUI --> CONFIG_GTK2 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27375 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused definition from config.h.diego2008-07-301-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27374 b3059339-0415-0410-9bf9-f77b7e298cf2
* Start unifying names of internal preprocessor directives.diego2008-07-30114-582/+581
| | | | | | | | Replace all USE_ prefixes by CONFIG_ prefixes to indicate options which are configurable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27373 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop USE_ prefix from USE_MPLAYER_CPUDETECT #define.diego2008-07-302-8/+8
| | | | | | | It is unlike the other USE_ #defines set by configure. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27372 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use conditional compilation instead of an #ifdef around the whole file.diego2008-07-302-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27371 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused definition from config.h.diego2008-07-301-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27370 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add proper check for socklen_t.diego2008-07-301-2/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27369 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Group FFmpeg definitions together in config.h.diego2008-07-301-15/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27368 b3059339-0415-0410-9bf9-f77b7e298cf2
* add XDCAM and more HDV MPEG2 fourccscompn2008-07-301-0/+30
| | | | | | | | tested on /MPlayer/incoming/hdv6/hdv6.mov http://lists.mplayerhq.hu/pipermail/ffmpeg-devel/2008-July/050348.html git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27367 b3059339-0415-0410-9bf9-f77b7e298cf2
* change arbitrary CODECS_MAX_FOURCC limit to larger arbitrary limitcompn2008-07-301-1/+1
| | | | | | | | some camera generates different MPEG2 fourccs for each res and fps. http://lists.mplayerhq.hu/pipermail/ffmpeg-devel/2008-July/050348.html git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27366 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed 'Audio file' to 'Audio only' (to not get 'Audio file file' when played)ptt2008-07-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27365 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not add __CYGWIN__ to CFLAGS on Cygwin, the system defines it anyway.diego2008-07-281-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27364 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rework OS/2 configuration with respect to linker output formats.diego2008-07-281-8/+8
| | | | | | | | | Since nm only supports a.out on OS/2, the linker options to specify a different output format need to be added after the check using nm. based on a patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27363 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Add a separator comment.diego2008-07-281-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27362 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move libdvdnav check before the CFLAGS section. It is still the last checkdiego2008-07-281-35/+35
| | | | | | | at this position. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27361 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27348ptt2008-07-281-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27360 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move CFLAGS specific to internal libdvdread and libfaad2 to the Makefile anddiego2008-07-282-7/+2
| | | | | | | use them only when compiling objects from those subdirectories. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27359 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused HPUX #define from command line.diego2008-07-281-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27358 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move libdvdcss-specific CFLAG settings to libdvdcss test.diego2008-07-281-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27357 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ffvp6a codeccompn2008-07-282-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27356 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ffmotionpixels codeccompn2008-07-282-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27355 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of horrible code that relies on codec-set context variable,reimar2008-07-261-25/+8
| | | | | | | | it is useless anyway since all the necessary information is available anyway. This also makes MPlayer display the correct length for Theora-in-Ogg-Videos. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27354 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use GetTimerMS() instead of time() with srand.reimar2008-07-261-2/+1
| | | | | | | | This is more portable and avoids generating the same random numbers for a whole second (and on MinGW for some unexplainable reason for almost 10 seconds). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27353 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not include sys/socket.h when using winsock2, it is pointlessreimar2008-07-261-1/+2
| | | | | | and breaks compilation under MinGW. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27352 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert to previous dependency checking behavior.diego2008-07-262-3/+2
| | | | | | | | | Take included header files into account when generating dependency files. This has problems when header files are removed or renamed, but does not silently miscompile files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27351 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove AltiVec vector declaration compiler compatibility macros.diego2008-07-264-33/+12
| | | | | | | | | | | The original problem was that FSF and Apple gcc used a different syntax for vector declarations, i.e. {} vs. (). Nowadays Apple gcc versions support the standard {} syntax and versions that support {} are available on all relevant Mac OS X versions. Thus the greater compatibility is no longer worth cluttering the code with macros. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27350 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fix with GCC 4.0.1 on MacOSX tiger, broken by the removal of ↵gpoirier2008-07-251-8/+8
| | | | | | AVV() macro git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27349 b3059339-0415-0410-9bf9-f77b7e298cf2
* add list of supported vo's to -xineramascreencompn2008-07-251-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27348 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some more information about FTP mirror setup.diego2008-07-241-4/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27347 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mailinglist vs. mailing list typo.diego2008-07-241-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27346 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix indentation after last commit.diego2008-07-241-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27345 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove AltiVec vector declaration compiler compatibility macros.diego2008-07-241-47/+47
| | | | | | | | | | | The original problem was that FSF and Apple gcc used a different syntax for vector declarations, i.e. {} vs. (). Nowadays Apple gcc versions support the standard {} syntax and versions that support {} are available on all relevant Mac OS X versions. Thus the greater compatibility is no longer worth cluttering the code with macros. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27344 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix configure hanging forever in iconv check using --charset=noconvreimar2008-07-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27343 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove outdated "X11 only" from xineramascreen option and try to make clearerreimar2008-07-241-1/+4
| | | | | | | what it does and what it does not. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27342 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27337gpoirier2008-07-231-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27341 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync'd with r27337ptt2008-07-231-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27340 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add Dirac video support via libdirac and libschroedinger in libavcodec.diego2008-07-223-0/+106
| | | | | | | patch by Anuradha Suraparaju, anuradha rd.bbc.co uk git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27339 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable runtime border/window decorations-toggling for Linux gl and gl2 vos.reimar2008-07-225-6/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27338 b3059339-0415-0410-9bf9-f77b7e298cf2
* No idea which vos support -noborder how well, though those based onreimar2008-07-221-1/+0
| | | | | | | | X11 or running on Windows _should_ work. Just remove that line for now. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27337 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support -noborder with X11-based vosreimar2008-07-221-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27336 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make vo_x11_fullscreen not break vo_border (proper support still needs vo ↵reimar2008-07-221-1/+1
| | | | | | changes) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27335 b3059339-0415-0410-9bf9-f77b7e298cf2
* -border/-noborder are supported by gl/gl2, too, but only on Windows.reimar2008-07-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27334 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add instructions how to test the DNS round-robin virtual host, add adiego2008-07-221-0/+21
| | | | | | | webserver configuration checklist and a note about netiquette. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27333 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix memleakmichael2008-07-211-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27332 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cleanup, use av_freep() instead of av_free(x); x=NULLmichael2008-07-211-46/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27331 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove "en" from list of all man page languages when generating man pagediego2008-07-191-2/+2
| | | | | | | installation rules from a pattern. There is a separate rule for English above. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27330 b3059339-0415-0410-9bf9-f77b7e298cf2
* docs build fixhenry2008-07-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27329 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only build the documentation in the languages requested from configure.diego2008-07-192-11/+13
| | | | | | | | Fixes Bugzilla #978. inspired by a patch from Jonas Berlin, bugs outerspace.dyndns org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27328 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27326Gabrov2008-07-1819-896/+833
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27327 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing revisions (26762 & 26795)ptt2008-07-181-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27326 b3059339-0415-0410-9bf9-f77b7e298cf2
* restored file encoding tu utf8 and corrected wrong chars, hoping it's ok nowptt2008-07-181-232/+232
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27325 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary and troublesome inlinezuxy2008-07-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27324 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make C code in yuv2yuv1() do accurate rounding, this could be splitmichael2008-07-181-3/+3
| | | | | | | depending on SWS_ACCURATE as well if someone wants. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27323 b3059339-0415-0410-9bf9-f77b7e298cf2
* indentmichael2008-07-171-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27322 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forgotten accurate rounding function YSCALEYUV2YV121_ACCURATE.michael2008-07-171-2/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27321 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplify yuv2yuv1()michael2008-07-171-16/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27320 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in msg_lang variable name that prevented the correct messagediego2008-07-171-1/+1
| | | | | | | filename from being generated. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27319 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l forgot SWS_BILINEARmichael2008-07-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27318 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ensure that exactly one scaler algo is used.michael2008-07-171-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27317 b3059339-0415-0410-9bf9-f77b7e298cf2
* File was missing its dedicated header inclusion.ben2008-07-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27316 b3059339-0415-0410-9bf9-f77b7e298cf2
* Maemo platform runs on Nokia N8x0 series too.ben2008-07-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27315 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid including avcodec.h in demuxer.h (and thus many other files) just to getreimar2008-07-176-23/+26
| | | | | | | | | FF_INPUT_BUFFER_PADDING_SIZE. Instead use MP_INPUT_BUFFER_PADDING_SIZE and add a preprocessor check that it is big enough. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27314 b3059339-0415-0410-9bf9-f77b7e298cf2
* Our ALSA code needs alloca, so check for it in configure and include alloca.hreimar2008-07-174-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27313 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Indent language handling after last commit.diego2008-07-171-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27312 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rewrite translation handling in the build system.diego2008-07-172-25/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27311 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify summary output, add an extra empty line to it.diego2008-07-171-6/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27310 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove note about localization from configure output.diego2008-07-171-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27309 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Rename _doc_lang variable to doc_lang.diego2008-07-171-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27308 b3059339-0415-0410-9bf9-f77b7e298cf2
* Evaluate man page installation rule for all available languages,diego2008-07-171-4/+4
| | | | | | | but only install the requested languages. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27307 b3059339-0415-0410-9bf9-f77b7e298cf2
* Force gcc to emit function body under -gnu99zuxy2008-07-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27306 b3059339-0415-0410-9bf9-f77b7e298cf2
* limits.h is required for UINT_MAXreimar2008-07-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27305 b3059339-0415-0410-9bf9-f77b7e298cf2
* And a 1000l for r27263, swapped a condition, thus setting size toreimar2008-07-161-1/+1
| | | | | | | 0 when malloc succeeded instead of when it failed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27304 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, fix calloc being called with the wrong argument due to reorderingreimar2008-07-161-1/+1
| | | | | | | two lines in SVN r27263 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27303 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure demuxed ASF packet is properly padded after descramblingreimar2008-07-161-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27302 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move duplicate FF_INPUT_BUFFER_PADDING_SIZE handling into demuxer.hreimar2008-07-165-26/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27301 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add variables for all available man page and documentation languages.diego2008-07-161-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27300 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not just print a warning, also fix the len in ASF demuxer!reimar2008-07-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27299 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant check in message language test.diego2008-07-161-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27298 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move the "all" option to the front of the list of available languages indiego2008-07-161-1/+1
| | | | | | | the configure help output so it can be noticed more easily. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27297 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Rename LANGUAGES variable to msg_langs.diego2008-07-161-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27296 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace output redirection with grep by POSIX standard options.diego2008-07-161-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27295 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace simple sed invocation by even simpler tr invocation.diego2008-07-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27294 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge two consecutive sed calls into one.diego2008-07-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27293 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add IDs to some XML elements to avoid warnings.diego2008-07-156-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27292 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make af_hrtf tables static constreimar2008-07-151-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27291 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add const to libaf/filter.c functions.reimar2008-07-152-17/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27290 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace S_IREAD|S_IWRITE by POSIX-compatible S_IRUSR|S_IWUSR (not exactly ↵reimar2008-07-151-1/+1
| | | | | | the same, but should not matter). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27289 b3059339-0415-0410-9bf9-f77b7e298cf2
* ALSA stupidly tries to define struct timeval and struct timespec, whichreimar2008-07-151-0/+5
| | | | | | | may cause compilation errors. Check for this and disable ALSA. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27288 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix dlopen(), dlclose() dlsym() calls in configure test.diego2008-07-151-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27287 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix tgetent call in termcap configure test.diego2008-07-151-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27286 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add two more missing headers to configure checks.diego2008-07-151-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27285 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing return statements to configure tests.diego2008-07-151-12/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27284 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing headers to configure checks.diego2008-07-151-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27283 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove -std=gnu99/gnu89/default dialect linux define, as it violates themichael2008-07-155-8/+8
| | | | | | | C standard. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27282 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try to keep decoded audio buffer aligned.reimar2008-07-141-1/+1
| | | | | | | Seems to be enough to avoid crashes (due to unaligned SSE2) with FFmpeg vorbis decoding for now. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27281 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change a broken check. FFMAX does not work as intended because ↵reimar2008-07-141-2/+2
| | | | | | | | | trak->chunkmap[i].first is unsigned and j is signed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27280 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: reindent.astrange2008-07-131-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27279 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove const vector casts from Altivec.astrange2008-07-131-7/+7
| | | | | | | | Fixes compatibility with C99. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27278 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for FFmpeg DK3 ADPCM codec and prefer it over MPlayer'sreimar2008-07-131-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27277 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for FFmpeg's ADPCM codecs and make them the defaultreimar2008-07-131-0/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27276 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, do not use macros on functions that are not idempotentreimar2008-07-131-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27275 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not set _dvdreadconfig unconditionally.rathann2008-07-131-1/+0
| | | | | | | Makes --with-dvdread-config actually work. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27274 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: main (void) --> main(void)diego2008-07-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27273 b3059339-0415-0410-9bf9-f77b7e298cf2
* main(void) --> int main(void) in .align testdiego2008-07-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27272 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use correct header in libamr narrowband test.diego2008-07-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27271 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify and clamp coefficient index for MS ADPCMreimar2008-07-121-12/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27270 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, fix MS ADPCM decoding for e.g. ↵reimar2008-07-121-1/+1
| | | | | | | | | http://samples.mplayerhq.hu/mov/qtaudio/surge-2-16-L-ms02.mov First coefficient array must be unsigned to fit in 8 bits git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27269 b3059339-0415-0410-9bf9-f77b7e298cf2
* Dependency files should be refreshed when object files are rebuilt.diego2008-07-122-2/+3
| | | | | | | | Express this with Makefile syntax instead of in the dependency file generation command. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27268 b3059339-0415-0410-9bf9-f77b7e298cf2
* in dvd streams the title part ranges from 1 to 99nicodvb2008-07-122-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27267 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindent after last commitreimar2008-07-111-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27266 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check size of tkdata before using it in mov demuxer.reimar2008-07-111-0/+2
| | | | | | | Fixes bug #1170 and others. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27265 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add atom_len sanity check to mov demuxer.reimar2008-07-111-0/+1
| | | | | | | Fixes bug #1168 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27264 b3059339-0415-0410-9bf9-f77b7e298cf2
* Quick hack to fix demux_mov crashes where easily possible.reimar2008-07-111-16/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27263 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make really sure channels can only be 1 or 2 for imaadpcmreimar2008-07-111-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27262 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify imaadpcm return statementreimar2008-07-111-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27261 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check length of input buffer for msadpcmreimar2008-07-111-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27260 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a comment on shift vs. divisionreimar2008-07-111-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27259 b3059339-0415-0410-9bf9-f77b7e298cf2
* Scale msadpcm coefficients to fit into 8 bitsreimar2008-07-111-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27258 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify ad_msadpmc.c: Use AV_RL16, merge sign extension into LE_16 read andreimar2008-07-111-9/+2
| | | | | | | | use (int16_t) to let the compiler do the sign extension. Reduces code size on x86_64, gcc 4.3.1 by 248 bytes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27257 b3059339-0415-0410-9bf9-f77b7e298cf2
* Copy macro simplification from imaadpcm to msadpcmreimar2008-07-111-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27256 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless comments from ad_msadpcmreimar2008-07-111-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27255 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make msadpcm arrays constreimar2008-07-111-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27254 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused macrosreimar2008-07-111-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27253 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explicitly include inttypes.h in ad_imaadpcmreimar2008-07-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27252 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l, fix demux_lavf compilationreimar2008-07-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27251 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correct stream-seekability tests in demux_audio and demux_lavfreimar2008-07-112-2/+2
| | | | | | | Based on a patch by Alexander Kanavin (alexander.kanavin nokia com) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27250 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only read wav header cbSize when there is enough space in header.reimar2008-07-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27249 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, assignment introduced in r27246 was exactly the wrong way around.reimar2008-07-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27248 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: reindentreimar2008-07-101-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27247 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clean up reading of wav extradata.reimar2008-07-101-7/+3
| | | | | | | Fixes bug #1135 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27246 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, avoption splitted code added, I should double check with svn status...lu_zero2008-07-101-0/+59
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27245 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split AVOption/AVClass in a separate file. SoC Patch from Keiji Costantinilu_zero2008-07-093-40/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27244 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix stupid and almost pointless check-after-read code in asfheader.c.reimar2008-07-091-3/+3
| | | | | | | Fixes bug #1133. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27243 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix \fn without an argument consuming the next '\'.eugeni2008-07-091-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27242 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27236gpoirier2008-07-091-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27241 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add -std=gnu99 to gcc CFLAGS if supported. This sets appropriate #defines todiego2008-07-081-0/+1
| | | | | | | | avoid a bunch of implicit declaration warnings in (g)libc headers that define certain functions conditional to those #defines. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27240 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark function not used outside of the file as static.diego2008-07-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27239 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove declaration of extern inline function that is used nowhere from headerdiego2008-07-081-1/+0
| | | | | | | | | file, fixes the warnings: gui/mplayer/gui_common.h:32: warning: inline function 'TranslateFilename' declared but never defined gui/mplayer/gui_common.h:32: warning: inline function 'TranslateFilename' declared but never defined git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27238 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r27236ptt2008-07-081-35/+175
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27237 b3059339-0415-0410-9bf9-f77b7e298cf2
* another alphabetical order correctionptt2008-07-081-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27236 b3059339-0415-0410-9bf9-f77b7e298cf2
* moved o option beetwen m* and p*ptt2008-07-081-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27235 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include <sys/socket.h>, fixes the warnings:diego2008-07-081-0/+1
| | | | | | | | | | stream/librtsp/rtsp.c: In function 'write_stream': stream/librtsp/rtsp.c:68: warning: implicit declaration of function 'send' stream/librtsp/rtsp.c: In function 'read_stream': stream/librtsp/rtsp.c:95: warning: implicit declaration of function 'recv' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27234 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use correct PRIu64 length modifier for uint64_t value, fixes the warning:diego2008-07-081-1/+1
| | | | | | | libmpdemux/mpeg_packetizer.c:61: warning: format '%lu' expects type 'long unsigned int', but argument 6 has type 'uint64_t' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27233 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for MLP audio through FFmpeg.diego2008-07-072-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27232 b3059339-0415-0410-9bf9-f77b7e298cf2
* Run bash-specific shell scripts with bash, not sh.diego2008-07-074-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27231 b3059339-0415-0410-9bf9-f77b7e298cf2
* Give all shell scripts a .sh suffix for consistency.diego2008-07-0726-55/+55
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27230 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace bash-specific [[]] construct by proper a proper [] test.diego2008-07-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27229 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace == in []/test constructs with =, == is a bashism.diego2008-07-074-35/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27228 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary function keyword from shell script function declarations,diego2008-07-073-5/+5
| | | | | | | it is a bashism. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27227 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid unnecessary strdup(); patch by Aurelnicodvb2008-07-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27226 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update homepage and license info for NuppelVideo.diego2008-07-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27225 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add standard license header for NuppelVideo, i.e. GPL v2+.diego2008-07-061-1/+18
| | | | | | | | The code taken from NuppelVideo consists of just a bunch of struct definitions, which are not copyrightable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27224 b3059339-0415-0410-9bf9-f77b7e298cf2
* Introduce DRIVER_OBJS variable for list of all driver targets.diego2008-07-061-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27223 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify codecs.conf.h generation rule.diego2008-07-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27222 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge version.h dependency declarations.diego2008-07-061-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27221 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant dependencies for .rc files.diego2008-07-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27220 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a generic rule for .rc files and use it.diego2008-07-061-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27219 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Merge three lines into two.diego2008-07-061-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27218 b3059339-0415-0410-9bf9-f77b7e298cf2
* Also remove dhahelper and dhahelperwin on distclean.diego2008-07-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27217 b3059339-0415-0410-9bf9-f77b7e298cf2
* One more hack for PBOs on ATI cards.reimar2008-07-061-0/+3
| | | | | | | Either I am doing something very wrong or they managed to code at about 1 bug per line... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27216 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move at-hack code a bit up for further changesreimar2008-07-061-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27215 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove ASSERT() macro. SoC Patch from Keiji Costantinilu_zero2008-07-062-33/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27214 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindent. SoC Patch from Keiji Costantinilu_zero2008-07-061-45/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27213 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split simpleCopy into packedCopy and planarCopy. SoC Patch from Keiji Costantinilu_zero2008-07-061-8/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27212 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix a FIXME: give the URL of the list of mailing lists (since we don't have ↵gpoirier2008-07-052-4/+2
| | | | | | a direct link to the list of archives) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27211 b3059339-0415-0410-9bf9-f77b7e298cf2
* Surround stream cache specific code by an appropriate #ifdef; fixes linkingdiego2008-07-051-0/+2
| | | | | | | | when stream cache is disabled. noticed by Andrea Palmatè, andrea amigasoft net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27210 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with r27208.diego2008-07-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27209 b3059339-0415-0410-9bf9-f77b7e298cf2
* dvd:// streams accept the device path in the url; patch by Mathieu SCHROETER ↵nicodvb2008-07-051-1/+1
| | | | | | mathieu.schroeter gamesover ch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27208 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some more -identify information for CDDB.diego2008-07-051-0/+9
| | | | | | | patch by Mathieu Schroeter, mathieu.schroeter gamesover ch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27207 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add disc ID to -identify output.diego2008-07-051-0/+2
| | | | | | | patch by Mathieu Schroeter, mathieu.schroeter gamesover ch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27206 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename ALLPARTSLIBS variable to FFMPEGLIBS.diego2008-07-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27205 b3059339-0415-0410-9bf9-f77b7e298cf2
* Group some variable declarations together in sensible places.diego2008-07-051-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27204 b3059339-0415-0410-9bf9-f77b7e298cf2
* Declare FFmpeg dependencies in a more elegant way using the PARTS variable.diego2008-07-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27203 b3059339-0415-0410-9bf9-f77b7e298cf2
* r27182: apply parameter name change of no-correct-pts from r26842 to man pagekraymer2008-07-041-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27202 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l: finally understood ATI PBO problem: width must be a power of two.reimar2008-07-041-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27201 b3059339-0415-0410-9bf9-f77b7e298cf2
* More stride alignment is needed to work reliably on ATI cards :-(reimar2008-07-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27200 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename stream_livedotcom.c to stream_live555.c, the name is used everywhere.diego2008-07-042-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27199 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: in ifo_stream_oped() aligned the prototype to the stylenicodvb2008-07-041-9/+8
| | | | | | | | | of the rest of the file and renamed dvd_priv to spriv (it's a stream_priv_s*, while dvd_priv is used for other purposes in the rest of the file) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27198 b3059339-0415-0410-9bf9-f77b7e298cf2
* in ifo_stream_open() propagate the device based on the dirname of ↵nicodvb2008-07-041-0/+1
| | | | | | stream->url; patch by Mathieu SCHROETER mathieu.schroeter gamesover ch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27197 b3059339-0415-0410-9bf9-f77b7e298cf2
* dvd_device must be handled exclusively by the option parser; it can't be ↵nicodvb2008-07-041-2/+0
| | | | | | changed at will in ifo_stream_open() git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27196 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for the device part in the url; patch bynicodvb2008-07-041-8/+17
| | | | | | | Mathieu SCHROETER mathieu.schroeter gamesover ch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27195 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check stdata_len before accessing stdata. Fixes bug #1125reimar2008-07-041-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27194 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify tool generation rules with a pattern rule.diego2008-07-041-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27193 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only build loader tests on x86.diego2008-07-041-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27192 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix liba52/test linking, it needs -lm.diego2008-07-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27191 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/grammar/wording overhauldiego2008-07-0413-176/+178
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27190 b3059339-0415-0410-9bf9-f77b7e298cf2
* Put common dependencies of mp3lib/test + mp3lib/test2 on a common line.diego2008-07-041-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27189 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmeticsdiego2008-07-042-82/+81
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27188 b3059339-0415-0410-9bf9-f77b7e298cf2
* Place license header at the top of the file for consistency.diego2008-07-041-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27187 b3059339-0415-0410-9bf9-f77b7e298cf2
* Declare common netstream + vivodump dependencies in the common place.diego2008-07-041-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27186 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable.diego2008-07-021-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27185 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27182gpoirier2008-07-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27184 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix FFmpeg subdirectory dependencies: The FFmpeg libraries depend on eachdiego2008-07-011-7/+1
| | | | | | | other as well as on two header files in MPlayer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27183 b3059339-0415-0410-9bf9-f77b7e298cf2
* apply parameter name change of no-correct-pts from r26842 to man pagekraymer2008-07-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27182 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27179 + misc fixes of untranslated chunksgpoirier2008-06-301-16/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27181 b3059339-0415-0410-9bf9-f77b7e298cf2
* r26502: Document rgbtest argumentskraymer2008-06-301-44/+164
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | r26057: Fix copy&paste typo in rgbtest documentation r26198: Grayscale encoding/decoding with FFmpeg is no longer enabled, remove references r26221: Try to fix the description of what mbcmp influences, please fix if I misunderstood the code. r26231: better syntax for A key r26232: added missing escapes r26260: Experimental support for -framedrop with -correct-pts. r26271: Mention that '-frames 0' is useful with -identify, closes bug #1046. r26273: add "ipod" to the list of formats handled by lavf r26297: compacted new libavformat's 'ipod' description r26402: Enable runtime control for colorful and/or module name output r26427: Restore grayscale decoding support with FFmpeg. r26449: 10L, forgot to commit the documentation for the -noconfig options. r26460: restore options alphabetical order r26650: Update documentation for the gl2 driver to make clear gl is usually preferred. r26674: add h264 to list of supported codecs r26732: Mark new options Michael committed as undocumented. r26739: Oops, remove stray .TP. r26749: -psprobe can be used in mpeg-pes streams, too r26762: Add a new suboption to -vo xv and -vo xvmc that allows selection r26763: Remove '(pass 1/2)' from some lavcopts. These options really worked on r26795: Add support for AppleIR Remote as an input under Linux systems. r26798: Document the -noar command-line option in en/fr manpages. r26806: Document x264's AQ options r26853: Update gl vo section with the new force-pbo suboption. r26909: Add a slave command to stop stream playback. r26979: small spelling/wording fixes r26986: Document VIDIXIVTVALPHA environment variable. r26997: Fix codec-specific options syntax declaration to be less confusing and wrong. r27057: Ability for specifying TV standard individually for each TV channel. r27132: Fix/restore the description of the rectangle video filter. previously applied: r27169: add missing escapes and full stops for scaletempo filter r27179: remove two trailing whitespaces git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27180 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove two trailing whitespaceskraymer2008-06-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27179 b3059339-0415-0410-9bf9-f77b7e298cf2
* r25756: Document vo gl lscale=3kraymer2008-06-301-16/+30
| | | | | | | | | | | | | | | | | | r25757: Add experimental unsharp-mask OpenGL scaler. r25767: misc spelling fixes r25768: misc markup fixes r25769: better ao/vo profile examples r25786: Add a fragment program for 5x5 unsharp masking r25821: (instead of adding quotation mark, this added a missing paragraph!) r25955: (previously applied) r25973: Hint about possible libmpeg2 problems with -hardframedrop r25984: Slightly document alpha for OSD color r26014: -dumpstream will not dump chapters anymore r26015: Document that framedrop needs -no-correct-pts r26017: removed wrong example git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27178 b3059339-0415-0410-9bf9-f77b7e298cf2
* r25385: Add new audio filter for encoding multi-channel audio into ac3 at ↵kraymer2008-06-301-10/+111
| | | | | | | | | | | | | | | | | | | | | | | | | | | runtime. r25389: Support using unrar executable to access rar-compressed vobsub files. r25440: Fix the expand text's format by the source. r25455: (previously applied) typo noticed by Paul TT r25529: Support ?(!NAME:TEXT) format for expanding string by property. r25566: update copyright year to 2008 r25585: Add an example for dvdnav:// usage with path. r25587: when {v|a}_o_mpegpes:card isn't specified by the user [...] r25607: documented angle commands r25610: Allow overriding [Script Info] parameters with -ass-force-style option. r25639: Add heartbeat-cmd option r25656: dvd-device can specify iso files too r25657: dumpstream is NOT a better way to copy a dvd title r25665: updated english manpage with protocol/extension profile loading feature r25671: document vo.* and ao.* playback profiles r25751: Extend heartbeat-cmd man page entry r25752: Seems that all - should be escaped in the man page r25762: added missing escapes r25763: added missing "&" git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27177 b3059339-0415-0410-9bf9-f77b7e298cf2
* r25179: Add missing forced linebreak, slight wording improvement.kraymer2008-06-301-21/+39
| | | | | | | | | | | | r25189: Add an example for play DTS-CD with passsthrough. r25194: -identify shows chapters times when playing dvd streams r25314: cleanup and conformation of values description for -ass-hinting r25315: minor spelling/grammar fixes r25343: Fix all current known multi-channel wrong order problems [...] r25379: Fix libass to support -nofontconfig. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27176 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency fix: capitalize Windows Media Player, and add <application> tag ↵gpoirier2008-06-301-2/+3
| | | | | | around it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27175 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc fixes, patch by Cédric Viougpoirier2008-06-301-18/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27174 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27132, patch by JRaSHgpoirier2008-06-301-9/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27173 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27169gpoirier2008-06-301-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27172 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try to get frame rate information through VIDIOC_G_PARM ifvoroshil2008-06-301-0/+12
| | | | | | | | capture device driver (such as uvcvideo USB video driver) does not provide VIDIOC_G_STD ioctl. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27171 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix division by zero in tvi_v4l2 which occures when capture devicevoroshil2008-06-301-8/+18
| | | | | | | driver (such as uvcvideo USB video driver) does not provide VIDIOC_G_STD ioctl. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27170 b3059339-0415-0410-9bf9-f77b7e298cf2
* add missing escapes and full stops for scaletempo filterkraymer2008-06-301-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27169 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24808: Add a space behind openal to get minimum length of 7kraymer2008-06-301-6/+98
| | | | | | | | | | | | | | | r24809: Replace Polyp- by PulseAudio output. r24820: Clarify that -vo gl bicubic filtering is B-spline, not polynomial r24837: Spelling, vf_ow parameters are optional. r24875: program switching in demux_lavf r24897+r24909 (already applied by Diego in r24955, at least in parts - did not check) r24924: Add audio filter scaletempo r24950: Explain new ao_pulse option syntax r24952, r24953, r24954: (appears to be in current version already, probably due to r24955) r25134: Fix a wrong cmdline example of using -menu-chroot. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27168 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24772: DirectShow based tv:// driver for win32kraymer2008-06-301-3/+30
| | | | | | | | | | r24783: Consistently set NOTE: in italics. r24784: small grammar fix r24785: Add -lavfdopts cryptokey r24807: Docs update: -ao openal handles more than one channels since some time already git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27167 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24727: H.264 content can also be decoded with multiple threadskraymer2008-06-301-6/+21
| | | | | | | | r24740: misc roff fixes r24746: document filter -vf ow: Overcomplete Wavelet denoiser. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27166 b3059339-0415-0410-9bf9-f77b7e298cf2
* version bump to 24719kraymer2008-06-301-6/+6
| | | | | | | remove some trailing whitespaces (no idea how these got there..) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27165 b3059339-0415-0410-9bf9-f77b7e298cf2
* r27123: Add verbose messages about trying and searching for audio output ↵kraymer2008-06-301-1/+6
| | | | | | | | | drivers. Add messages showing why a specified audio output driver failed to be used. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27164 b3059339-0415-0410-9bf9-f77b7e298cf2
* r27067: Remove pointless #ifdef.kraymer2008-06-301-5/+2
| | | | | | | | | r27068: Remove pointless HELP_MP_DEFINE_STATIC definition. r27069: -alang/-slang do not depend on dvdread support. r27071: Add the ugly HELP_MP_DEFINE_STATIC back, [...] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27163 b3059339-0415-0410-9bf9-f77b7e298cf2
* r27066: update comments, whitespace cosmeticskraymer2008-06-301-19/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27162 b3059339-0415-0410-9bf9-f77b7e298cf2
* r27065: whitespace consistency cosmeticskraymer2008-06-301-56/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27161 b3059339-0415-0410-9bf9-f77b7e298cf2
* r26863: make use of the new MGA_VID_VERSION ioctl to checkkraymer2008-06-301-3/+4
| | | | | | | | | | r26900: Fix typo in string name. r26901: mga_vid string wording fix r26911: mga_vid driver wording fixes r27063: Move message about which adapter is used to verbose mode. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27160 b3059339-0415-0410-9bf9-f77b7e298cf2
* r25605: properties to get and set anglekraymer2008-06-301-3/+15
| | | | | | | | | | | | r25663: add support for per protocol and per extension playback profile loading r25947: Add windows cp1256 encoding for arabic, fixes bug #1007 r26067: Check glyph bounding box before rasterizing and complain if it is too large. r26649: Fix some not entirely correct and misleading messages. r26762: Add a new suboption to -vo xv and -vo xvmc that allows ... r26795: Add support for AppleIR Remote as an input under Linux systems. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27159 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24924: Add audio filter scaletempokraymer2008-06-301-1/+7
| | | | | | | | r25058: Add missed translatable string in my previous commit r25158: Make up missed update for osd message. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27158 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed struct dvdnav_event_t that is 1) unused; 2) has an improper name. ↵nicodvb2008-06-291-6/+0
| | | | | | You can't turn your back for a second... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27157 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24790: Disable channel scanner when no tuner is present.kraymer2008-06-291-1/+13
| | | | | | | r24892: move errors and a warning to help_mp-en.h git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27156 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove trailing whitespaceskraymer2008-06-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27155 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace asserts by proper conditions to allow playback of some broken butreimar2008-06-291-4/+5
| | | | | | | still playable files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27154 b3059339-0415-0410-9bf9-f77b7e298cf2
* Half size for adpcm_indexreimar2008-06-291-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27153 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify predictor updatesreimar2008-06-291-9/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27152 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of 16-bit sign extension macroreimar2008-06-291-9/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27151 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify some imaadpcm macrosreimar2008-06-291-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27150 b3059339-0415-0410-9bf9-f77b7e298cf2
* Directly pass arrays into decode_nibblesreimar2008-06-291-16/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27149 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use smaller types for tablesreimar2008-06-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27148 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make imaadpcm tables constreimar2008-06-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27147 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify code to read index/predictorreimar2008-06-291-57/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27146 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a few size checks to IMA decoder. The code is still a mess though,reimar2008-06-291-0/+12
| | | | | | | but bug # 1114 is probably fixed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27145 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify ad_imaadpcm decode_audio functionreimar2008-06-291-16/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27144 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure we do not use uninitialized data in case of a short read.reimar2008-06-291-0/+1
| | | | | | | Not really relevant but fixes bug #1109 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27143 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use stdata before checking its lengthreimar2008-06-291-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27142 b3059339-0415-0410-9bf9-f77b7e298cf2
* mingw uses Windows sockets.vayne2008-06-281-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27141 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27123, patch by JRaSH, %jrash06 A 163 P com%gpoirier2008-06-281-717/+663
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27140 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27132gpoirier2008-06-271-3/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27139 b3059339-0415-0410-9bf9-f77b7e298cf2
* one more wish, and an updatecompn2008-06-261-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27138 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24772: DirectShow based tv:// driver for win32kraymer2008-06-251-1/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27137 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the issue instead of revertinglu_zero2008-06-253-58/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27136 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move rtsp_close away by simplification - avoids symbol clash with libnemesilu_zero2008-06-253-33/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27135 b3059339-0415-0410-9bf9-f77b7e298cf2
* some updatescompn2008-06-241-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27134 b3059339-0415-0410-9bf9-f77b7e298cf2
* add support for /game-formats/psx-str/compn2008-06-244-1/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27133 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix/restore the description of the rectangle video filter.diego2008-06-241-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27132 b3059339-0415-0410-9bf9-f77b7e298cf2
* Touch FFmpeg libraries after recursing into their subdirectories.diego2008-06-241-0/+1
| | | | | | | | Otherwise, if the recursion was due to a changed file that is not built into the library, the recursion will become unconditional. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27131 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not unconditionally recurse into FFmpeg subdirectories. Instead, justdiego2008-06-241-2/+8
| | | | | | | recurse if any file in the subdirectory changed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27130 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing 'struct input_id id' to Apple IR configure check.diego2008-06-241-0/+1
| | | | | | | patch by Jan Knutar, jknutar nic fi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27129 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check if the font set returned from FcFontSort in not NULL.eugeni2008-06-231-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27128 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindent.eugeni2008-06-231-35/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27127 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only use application font dir if library->fonts_dir is not NULL.eugeni2008-06-231-0/+2
| | | | | | | | This can be the case if ass_set_fonts_dir() call is omitted, results in segfault. Never happens in the current MPlayer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27126 b3059339-0415-0410-9bf9-f77b7e298cf2
* Dependency files need to get updated when any of their dependencies arediego2008-06-231-2/+2
| | | | | | | | modified. Otherwise new header inclusions might get missed and necessary recompilations would get skipped. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27125 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename some definitions to avoid clashing with system headers, fixes:diego2008-06-231-4/+4
| | | | | | | | | | ./drivers/3dfx.h:262:1: warning: "ROP_COPY" redefined /usr/include/linux/fb.h:311:1: warning: this is the location of the previous definition ./drivers/3dfx.h:264:1: warning: "ROP_XOR" redefined /usr/include/linux/fb.h:312:1: warning: this is the location of the previous definition git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27124 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add verbose messages about trying and searching for audio output drivers.corey2008-06-222-0/+16
| | | | | | | | | Add messages showing why a specified audio output driver failed to be used. Based on a patch from Bryan Henderson, giraffedata [[]] gmail :: com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27123 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace misuse of echores in libdvdnav check by _res_comment.diego2008-06-221-1/+1
| | | | | | | Reword the informative message. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27122 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, bpp is bits per pixel, not bytesreimar2008-06-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27121 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert non-acked r27106ben2008-06-211-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27120 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic: be consistentben2008-06-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27119 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes two bugs:ben2008-06-201-7/+18
| | | | | | | | | | | | | 1. doesn't add \ before spaces when showing dirname in interface title. 2. when replace_path() string is to be parsed by input command, I assume that the path is to be run in shell, and I do special escaping of 'into \'\\\'\' (tested useful and ok with geexbox for last 3 years ...) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27118 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix obviously wrong option descriptionben2008-06-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27117 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove useless typedef againstfor VDXContextben2008-06-203-33/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27116 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic: give a coherent indentationben2008-06-201-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27115 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove some useless functions from vidix apiben2008-06-202-27/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27114 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove useless 'else'ben2008-06-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27113 b3059339-0415-0410-9bf9-f77b7e298cf2
* renamed vidixlib.c to vidix.cben2008-06-202-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27112 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove now useless vidixlib.h fileben2008-06-2019-59/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27111 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27107, patch by Cédric Viougpoirier2008-06-201-42/+87
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27110 b3059339-0415-0410-9bf9-f77b7e298cf2
* move content of vidixlib.h into vidix.hben2008-06-202-92/+96
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27109 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic: give coherent indentationben2008-06-201-45/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27108 b3059339-0415-0410-9bf9-f77b7e298cf2
* use the new URL of NUT container websitegpoirier2008-06-201-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27107 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only "pop" subtree params if they had previously been "pushed",ben2008-06-201-1/+2
| | | | | | | | | | and afterwards reset the "pushed" value to 0 again. Similarly only set the PLAY_TREE_RND_PLAYED flag if the entry had been pushed before. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27106 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27102, patch by Cédric Viou and minor fixes by myselfgpoirier2008-06-201-62/+74
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27105 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add auto-close option to libmenu playlist handling part.ben2008-06-201-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27104 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow conditionnal compilation of yuv4mpeg video out.ben2008-06-203-1/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27103 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix a couple of broken URL linksgpoirier2008-06-202-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27102 b3059339-0415-0410-9bf9-f77b7e298cf2
* Keep old dvdnav sub-command options for a while in orderben2008-06-201-0/+13
| | | | | | | | not to break slave-mode API too suddenly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27101 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change DVDNAV command key names.ben2008-06-195-39/+66
| | | | | | | | Parameters now use a string much more intuitive than previous int value. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27100 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reorder some functions to avoid implicit declaration warnings.diego2008-06-191-27/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27099 b3059339-0415-0410-9bf9-f77b7e298cf2
* Group all input command defines in one big enumben2008-06-181-128/+130
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27098 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add copyright and license statement.diego2008-06-171-5/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27097 b3059339-0415-0410-9bf9-f77b7e298cf2
* It cannot hurt to add -E to the diff options to avoid whitespace changes.diego2008-06-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27096 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #includes that are required for things used in the header.diego2008-06-172-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27095 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27057gpoirier2008-06-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27094 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #includes to fix 'make checkheaders'.diego2008-06-171-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27093 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try harder to honour CTRL+C etc. during dumpstreamreimar2008-06-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27092 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove useless parentheses, align.diego2008-06-161-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27091 b3059339-0415-0410-9bf9-f77b7e298cf2
* Chapter support for lavf demuxer.reimar2008-06-161-0/+7
| | | | | | | Patch by Anton Khirnov [wyskas gmail com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27090 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support NULL name parameter for demuxer_add_chapter.reimar2008-06-161-1/+1
| | | | | | | Patch by Anton Khirnov [wyskas gmail com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27089 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Break overly long lines.diego2008-06-161-97/+178
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27088 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: indentation, whitespace changesdiego2008-06-161-648/+645
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27087 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: consistent * placementdiego2008-06-161-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27086 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: one more if brace placement fixdiego2008-06-161-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27085 b3059339-0415-0410-9bf9-f77b7e298cf2
* M-x untabifydiego2008-06-161-24/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27084 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove all trailing whitespace.diego2008-06-161-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27083 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Split/join multiline statements.diego2008-06-161-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27082 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Consistently format all if, for, while constructs.diego2008-06-161-140/+170
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27081 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove one more commented-out line.diego2008-06-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27080 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Make all function declarations consistent by moving the openingdiego2008-06-161-42/+90
| | | | | | | braces to the next line and breaking long lines. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27079 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove one more commented-out line.diego2008-06-161-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27078 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless comments and commented-out code.diego2008-06-161-19/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27077 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing string.h #include for memcpy prototype;diego2008-06-161-0/+1
| | | | | | | fixes warnings with 'make checkheaders'. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27076 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #includes to fix 'make checkheaders'.diego2008-06-162-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27075 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Group internal codec library tests together.diego2008-06-151-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27074 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document where the files vidix/dhahelperwin/ntverp.h anddiego2008-06-151-0/+7
| | | | | | | vidix/dhahelperwin/common.ver come from (ReactOS). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27073 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Group entries by directory instead of randomly.diego2008-06-151-656/+652
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27072 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add the ugly HELP_MP_DEFINE_STATIC back, otherwise we produce warnings likediego2008-06-152-1/+4
| | | | | | | ./help_mp.h:21: warning: 'help_text' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27071 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove empty line for consistency.diego2008-06-151-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27070 b3059339-0415-0410-9bf9-f77b7e298cf2
* -alang/-slang do not depend on dvdread support.diego2008-06-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27069 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless HELP_MP_DEFINE_STATIC definition.diego2008-06-152-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27068 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless #ifdef.diego2008-06-151-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27067 b3059339-0415-0410-9bf9-f77b7e298cf2
* update comments, whitespace cosmeticsdiego2008-06-151-17/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27066 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace consistency cosmeticsdiego2008-06-151-52/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27065 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove now unused messages.diego2008-06-154-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27064 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move message about which adapter is used to verbose mode.diego2008-06-152-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27063 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/wording fixesdiego2008-06-151-27/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27062 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add parentheses to expression to avoid the warning:diego2008-06-151-1/+1
| | | | | | | | libvo/x11_common.c: In function 'xss_suspend': libvo/x11_common.c:1618: warning: suggest parentheses around && within || git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27061 b3059339-0415-0410-9bf9-f77b7e298cf2
* 6 months of changescompn2008-06-151-0/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27060 b3059339-0415-0410-9bf9-f77b7e298cf2
* standard license headers for mga_viddiego2008-06-143-17/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27059 b3059339-0415-0410-9bf9-f77b7e298cf2
* add MGA_VID_GET_VERSION ioctl to old mga_vid driver for compatibility with ↵attila2008-06-141-0/+8
| | | | | | "new" mplayer git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27058 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ability for specifying TV standard individually for each TV channel.voroshil2008-06-143-7/+33
| | | | | | | | Slightly modified patch by Ildar devel at pop3 dot ru git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27057 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix support for libnemesi installed on nonstandard pathslu_zero2008-06-131-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27056 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unbreak audio, thanks to Uoti for the insightlu_zero2008-06-121-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27055 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r23225, plus misc fixesgpoirier2008-06-111-41/+104
| | | | | | | Patch by Cédric Viou git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27054 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix w/r24604, misc fixesgpoirier2008-06-111-25/+132
| | | | | | | Patch by Cédric Viou git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27053 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r21537 and misc fixesgpoirier2008-06-111-92/+196
| | | | | | | patch by Cédric Viou git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27052 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix file to conform to French typographygpoirier2008-06-111-200/+182
| | | | | | | | fix parts that were left out by some previous translation updates. Patch by Cedric Viou git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27051 b3059339-0415-0410-9bf9-f77b7e298cf2
* add missing <application> tag around MPlayer,gpoirier2008-06-111-1/+2
| | | | | | | patch by Cedric Viou git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27050 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26997gpoirier2008-06-111-4/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27049 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r27044, patch by Cedric Dumez-Viou %Cedric P Dumez-Viou A obs-nancay ↵gpoirier2008-06-101-708/+1243
| | | | | | P fr% git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27048 b3059339-0415-0410-9bf9-f77b7e298cf2
* libdvdnav need libdvdread from the same repositorynicodvb2008-06-101-1/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27047 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mencoder built from dvdnav enabled.ben2008-06-091-2/+2
| | | | | | | | | (my bad, didn't compiled mencoder when i did the change). Patch by Diogo Franco <diogomfranco at gmail com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27046 b3059339-0415-0410-9bf9-f77b7e298cf2
* Give name to font_desc struct, patch by Bryan Henderson, giraffedata gmail com.diego2008-06-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27045 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add information about the mga_vid Subversion repository.diego2008-06-091-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27044 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention that svgalib_helper only works with kernel 2.4.x.diego2008-06-091-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27043 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make a section out of the svgalib_helper paragraph.diego2008-06-091-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27042 b3059339-0415-0410-9bf9-f77b7e298cf2
* require latest x264 to enable MEncoder's x264 supportgpoirier2008-06-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27041 b3059339-0415-0410-9bf9-f77b7e298cf2
* Slightly reduce VIDIX video output verbosity.diego2008-06-0813-26/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27040 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26853gpoirier2008-06-081-5/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27039 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add standard license headers.diego2008-06-083-11/+63
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27038 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add comments to a few #endif preprocessor directives.diego2008-06-082-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27037 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable, fixes the warning:diego2008-06-081-1/+0
| | | | | | | libmpdemux/demux_ts.c:3130: warning: unused variable 'd_sub' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27036 b3059339-0415-0410-9bf9-f77b7e298cf2
* OBJS should end in .o, not .c.diego2008-06-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27035 b3059339-0415-0410-9bf9-f77b7e298cf2
* VIS OBJS should end in .o, not .c; patch by Jan Knutar, jknutar nic fi.diego2008-06-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27034 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include, patch by Jan Knutar, jknutar nic fi.diego2008-06-081-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27033 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add command to create dhahelper device to install-dhahelper target.diego2008-06-081-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27032 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename loader/driver.[ch] to loader/drv.[ch], otherwise loader/driver.h candiego2008-06-088-10/+10
| | | | | | | conflict with the header by the same name in loader/wine/driver.h. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27031 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add dhahelper CFLAGS where appropriate if enabled.diego2008-06-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27030 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for enabling VIDIX dhahelper.diego2008-06-081-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27029 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless and commented-out #ifdef.diego2008-06-081-6/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27028 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix silly typo in CFLAG_SVGALIB_HELPER variable name.diego2008-06-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27027 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix dhahelper.h #include paths.diego2008-06-083-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27026 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore support for compiling with svgalib_helper.diego2008-06-073-7/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27025 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only check for VIDIX PCI device name database if VIDIX is enabled.diego2008-06-071-8/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27024 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure that the LC_ALL variable is exported to the environment ofdiego2008-06-071-1/+1
| | | | | | | shell commands invoked by make. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27023 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorizes dvdnav aid retrieval code.ben2008-06-071-30/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27022 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add routine that provides audio ID corresponding to logical numberben2008-06-072-0/+33
| | | | | | | | in dvdnav stream. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27021 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix channel order for libvorbis decoder, original patched by Nicolas George.ulion2008-06-071-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27020 b3059339-0415-0410-9bf9-f77b7e298cf2
* rename AF_CHANNEL_LAYOUT_LAVC_VORBIS* => AF_CHANNEL_LAYOUT_VORBIS*.ulion2008-06-073-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27019 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename some functions as they are mplayer related and notben2008-06-074-20/+20
| | | | | | | | from libdvdnav public API. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27018 b3059339-0415-0410-9bf9-f77b7e298cf2
* rename for consistencyben2008-06-071-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27017 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add routine to determine if SPU has changed in dvdnav stream.ben2008-06-072-0/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27016 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add routine to determine if audio has changed in dvdnav stream.ben2008-06-072-0/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27015 b3059339-0415-0410-9bf9-f77b7e298cf2
* declare some functions as staticben2008-06-072-9/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27014 b3059339-0415-0410-9bf9-f77b7e298cf2
* No need to set LC_ALL=C for individual shell commands,diego2008-06-071-1/+1
| | | | | | | it is already set from config.mak. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27013 b3059339-0415-0410-9bf9-f77b7e298cf2
* The VIDIX PCI files should be regenerated when the awk scriptdiego2008-06-071-1/+1
| | | | | | | that creates them is changed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27012 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove C++ inclusion guard from vidix headersben2008-06-074-30/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27011 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add default definition for SVGA device.diego2008-06-071-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27010 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove useless vidix versioning stuffben2008-06-076-18/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27009 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove duplicated codeben2008-06-071-6/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27008 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop some useless parameter from vidix init routineben2008-06-073-6/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27007 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop support for external libvidix (unmaintained and not up-to-date)ben2008-06-072-36/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27006 b3059339-0415-0410-9bf9-f77b7e298cf2
* Save DVDNAV palette info.ben2008-06-072-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27005 b3059339-0415-0410-9bf9-f77b7e298cf2
* vidix s3 headers was missing proper headerben2008-06-071-0/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27004 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable, fixes the warning:diego2008-06-071-1/+0
| | | | | | | vidix/sysdep/pci_linux.c:71: warning: unused variable 'config_cmd' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27003 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed unused freepath variable.ben2008-06-061-8/+3
| | | | | | | | Patch by Guillaume Lecerf <foxcore at gmail com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27002 b3059339-0415-0410-9bf9-f77b7e298cf2
* add VIDM fourcc to divx/xvid, based on this patch:compn2008-06-061-0/+2
| | | | | | | | | http://sisyphus.ru/srpm/Sisyphus/mplayer/patches/10 https://bugzilla.altlinux.org/show_bug.cgi?id=12211 tested with file created using vidm.dll git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27001 b3059339-0415-0410-9bf9-f77b7e298cf2
* add psiv codec, works on psi_v-sample.movcompn2008-06-061-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@27000 b3059339-0415-0410-9bf9-f77b7e298cf2
* add qtactl codeccompn2008-06-061-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26999 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary -o option from windres invocation.diego2008-06-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26998 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix codec-specific options syntax declaration to be less confusing and wrong.diego2008-06-061-1/+1
| | | | | | | | The option separator is a colon, all options can receive parameters, not just the first one. Closes Bugzilla #1100. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26997 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26806gpoirier2008-06-061-1/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26996 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the linking of TOOLS/netstream and TOOLS/vivodump.diego2008-06-064-67/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26995 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license header, merge changelog into license header and TODO.diego2008-06-061-27/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26994 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless braces on if() statement.ben2008-06-051-2/+1
| | | | | | | | Patch by Guillaume Lecerf <foxcore at gmail com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26993 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ensure 'path' string is 0 terminated.ben2008-06-051-1/+1
| | | | | | | | Patch by Guillaume Lecerf <foxcore at gmail com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26992 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix fixes, patch by Benoit Fouetgpoirier2008-06-041-60/+58
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26991 b3059339-0415-0410-9bf9-f77b7e298cf2
* Run the whole documentation through ispell.diego2008-06-0416-67/+67
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26990 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove another reference to a removed configure option.diego2008-06-041-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26989 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove references to removed configure options.diego2008-06-041-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26988 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of needless emphasis.diego2008-06-041-17/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26987 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document VIDIXIVTVALPHA environment variable.diego2008-06-041-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26986 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move Matrox TV-out cable section to the end of the Matrox chapter.diego2008-06-041-26/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26985 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move Matrox TV-out cable instructions into their own section.diego2008-06-041-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26984 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some typos and update the Matrox TV output section. The relevantdiego2008-06-041-30/+9
| | | | | | | tools are no longer part of the MPlayer source tree. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26983 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary mangle.h #include.diego2008-06-041-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26982 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26909, patch by JRaSH %jrash06 A 163 P com%gpoirier2008-06-041-25/+78
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26981 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove due to objections by ivan.michael2008-06-041-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26980 b3059339-0415-0410-9bf9-f77b7e298cf2
* small spelling/wording fixesdiego2008-06-041-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26979 b3059339-0415-0410-9bf9-f77b7e298cf2
* mphq2 runs svn 1.4.x.diego2008-06-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26978 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use size_t instead of int for a variable that is compared to the resultdiego2008-06-031-1/+1
| | | | | | | | of strlen. Fixes a warning about signed and unsigned comparison. patch by Guillaume LECERF, foxcore gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26977 b3059339-0415-0410-9bf9-f77b7e298cf2
* correct spelling error ;)ivo2008-06-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26976 b3059339-0415-0410-9bf9-f77b7e298cf2
* List more actions which have proven controversial in the past.michael2008-06-031-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26975 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar fixes by Benoit Fouetgpoirier2008-06-031-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26974 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26920, patch by Cedric Dumez-Viou %Cedric P Dumez-Viou A obs-nancay ↵gpoirier2008-06-031-23/+32
| | | | | | P fr% git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26973 b3059339-0415-0410-9bf9-f77b7e298cf2
* add missing <option> tags around the option "filmdint"gpoirier2008-06-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26972 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix incorrect XML structure (I should have been more carefull when I checked ↵gpoirier2008-06-031-0/+1
| | | | | | in the previous version) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26971 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26936, patch by Cedric Viou % Cedric P Dumez-Viou A obs-nancay P fr %gpoirier2008-06-031-129/+124
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26970 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add reverting commits to the list of potentially controversial actions.diego2008-06-031-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26969 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26967Gabrov2008-06-025-22/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26968 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use LC_ALL instead of LANG in config.mak to prevent locale settings fromdiego2008-06-021-1/+1
| | | | | | | messing with text processing tools. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26967 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Restore LANG variable in config.mak so that shell commands are notdiego2008-06-021-0/+3
| | | | | | | negatively affected by (broken) locale settings. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26966 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable LANG from config.mak.diego2008-06-021-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26965 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable TARGET_OS from config.mak.diego2008-06-021-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26964 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Restructure config.mak logically and alphabetically.diego2008-06-021-102/+95
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26963 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable TARGET_CPU from config.mak.diego2008-06-021-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26962 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary FFmpeg hack from config.mak.diego2008-06-021-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26961 b3059339-0415-0410-9bf9-f77b7e298cf2
* call demux_flush() where appropriatenicodvb2008-06-021-6/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26960 b3059339-0415-0410-9bf9-f77b7e298cf2
* use demux_flush() where appropriatenicodvb2008-06-021-6/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26959 b3059339-0415-0410-9bf9-f77b7e298cf2
* added and reused demux_flush() instead of emptying the demux_stream buffers;nicodvb2008-06-022-20/+11
| | | | | | | patch by Bryan Henderson - giraffedata gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26958 b3059339-0415-0410-9bf9-f77b7e298cf2
* restore needed cast to correct type with constbcoudurier2008-06-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26957 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, fix wrong order of cases in cache_do_controlreimar2008-06-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26956 b3059339-0415-0410-9bf9-f77b7e298cf2
* Properly free memory allocate by liba52.reimar2008-06-012-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26955 b3059339-0415-0410-9bf9-f77b7e298cf2
* tiny reindentationnicodvb2008-06-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26954 b3059339-0415-0410-9bf9-f77b7e298cf2
* disable dvdnav when using the internal dvdreadnicodvb2008-06-011-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26953 b3059339-0415-0410-9bf9-f77b7e298cf2
* reindented the dvdread detection blocknicodvb2008-06-011-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26952 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed the code that checks the presence of the external dvdreadnicodvb2008-06-011-6/+4
| | | | | | | to include the headers from libdvdread/ (as in current svn) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26951 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed support for Ogle's dvdreadnicodvb2008-06-011-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26950 b3059339-0415-0410-9bf9-f77b7e298cf2
* cast to correct type, suppress warningsbcoudurier2008-06-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26949 b3059339-0415-0410-9bf9-f77b7e298cf2
* cast to correct type, suppress warningsbcoudurier2008-06-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26948 b3059339-0415-0410-9bf9-f77b7e298cf2
* cast to correct type, suppress warningbcoudurier2008-06-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26947 b3059339-0415-0410-9bf9-f77b7e298cf2
* cast to correct type, suppress warningsbcoudurier2008-06-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26946 b3059339-0415-0410-9bf9-f77b7e298cf2
* add const, suppress warningsbcoudurier2008-06-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26945 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove useless castsbcoudurier2008-06-011-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26944 b3059339-0415-0410-9bf9-f77b7e298cf2
* add const, suppress warningsbcoudurier2008-06-011-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26943 b3059339-0415-0410-9bf9-f77b7e298cf2
* add const, suppress warningsbcoudurier2008-06-011-10/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26942 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove useless castsbcoudurier2008-06-011-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26941 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change spelling of XviD to Xvid as has already been done in the (rest of the)diego2008-05-316-12/+12
| | | | | | | documentation. The name change was effected a few years ago already. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26940 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation with internal dvdnavrtogni2008-05-311-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26939 b3059339-0415-0410-9bf9-f77b7e298cf2
* adapted to the dvdread->libdvdread transition in dvdnav's repositorynicodvb2008-05-313-4/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26938 b3059339-0415-0410-9bf9-f77b7e298cf2
* warn to always disable the internal dvdread; still menus are supported nownicodvb2008-05-311-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26937 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add install-dhahelperwin target to simplify dhahelper installation on Windows.diego2008-05-302-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26936 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge vidix/dhahelperwin/Makefile into top-level Makefile.diego2008-05-302-40/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26935 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge vidix/dhahelper/Makefile into top-level Makefile.diego2008-05-302-21/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26934 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename kernelhelper to dhahelper, that name is more fitting.diego2008-05-306-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26933 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix #include paths.diego2008-05-303-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26932 b3059339-0415-0410-9bf9-f77b7e298cf2
* dhasetup.exe can be created via make instead of calling gcc directly.diego2008-05-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26931 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rework AltiVec CFLAGS detection. '-maltivec -mabi=altivec' should be useddiego2008-05-301-12/+18
| | | | | | | | only when altivec.h is available and preferred over '-faltivec'. This should now finally work on all Mac OS X and gcc combinations. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26930 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle NULL control function in cache_execute_control, fixes crash with http ↵reimar2008-05-301-0/+7
| | | | | | urls. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26929 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for ALTIVEC_H instead of __APPLE_CC__ to decide which AltiVec vectordiego2008-05-302-17/+3
| | | | | | | | declaration syntax to use. Checking for HAVE_ALTIVEC_VECTOR_BRACES would be better, but this variant is more likely to be mergeable upstream. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26928 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for HAVE_ALTIVEC_VECTOR_BRACES instead of __APPLE_CC__.diego2008-05-303-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26927 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for AltiVec vector declaration syntax.diego2008-05-301-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26926 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo noticed by Mark Pilgrim, mark diveintomark orgdiego2008-05-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26925 b3059339-0415-0410-9bf9-f77b7e298cf2
* The size of output buffer is stored in 'osize', not 'size'.eugeni2008-05-291-1/+1
| | | | | | | This is just for readability, the code behaviour is not changed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26924 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clear iconv conversion state also in libass.eugeni2008-05-291-3/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26923 b3059339-0415-0410-9bf9-f77b7e298cf2
* Offset should be size_t.eugeni2008-05-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26922 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clear iconv conversion state after each subtitle line.eugeni2008-05-291-0/+5
| | | | | | | | | | This fixes a bug when the last character on a subtitle line is sometimes moved to the beginning of the next line. Patch by Guy Shapiro, bugs sguy org. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26921 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove extra messages.diego2008-05-297-17/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26920 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mismatching messages.diego2008-05-293-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26919 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mismatching translated messages as pointed out by TOOLS/mphelp_check.py.diego2008-05-2920-20/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26918 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix problems picked up by mphelp_check.pygpoirier2008-05-291-33/+233
| | | | | | | patch by cedric viou %Cedric P Dumez-Viou A obs-nancay P fr% git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26917 b3059339-0415-0410-9bf9-f77b7e298cf2
* The install-drivers target should depend on the drivers target.diego2008-05-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26916 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert commit r26897.iive2008-05-288-21/+21
| | | | | | | | | | | | | XviD is the correct spelling of the codec. You can see it written in the codec own documentation and header files. Prefered name capitalization confirmed in conversation with XviD developer (prunedtree). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26915 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge drivers/Makefile into top-level Makefile.diego2008-05-283-43/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26914 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix setting of CFLAGS for Radeon modules.diego2008-05-281-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26913 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable unused function, fixes the warning:diego2008-05-281-0/+2
| | | | | | | tdfx_vid.c:292: warning: 'setup_fifo' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26912 b3059339-0415-0410-9bf9-f77b7e298cf2
* mga_vid driver wording fixesdiego2008-05-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26911 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move messages header file creation to a separate shell script.diego2008-05-273-40/+63
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26910 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a slave command to stop stream playback.ben2008-05-278-0/+19
| | | | | | | | | Mostly useful when used with -idle mode. Patch by Mathieu Schroeter ( mathieu dot schroeter at gamesover dot ch ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26909 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialize sh_audio/sh_video->dsreimar2008-05-271-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26908 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify/make new_sh behaviour more consistent when a stream gets redefined.reimar2008-05-271-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26907 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: simplifyreimar2008-05-271-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26906 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move native musepack demuxer further down in demuxer listreimar2008-05-271-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26905 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert declaration .NOTPARALLEL. Unfortunately this special target does notdiego2008-05-271-3/+0
| | | | | | | have the expected sane semantics, but has a global effect instead... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26904 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark VIDIX_PCI_FILES targets as NOTPARALLEL. They are all createddiego2008-05-271-0/+3
| | | | | | | simultaneously by the same command. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26903 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use 'grep -q' instead of redirecting grep output to /dev/null.diego2008-05-271-2/+2
| | | | | | | The -q option is part of POSIX. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26902 b3059339-0415-0410-9bf9-f77b7e298cf2
* mga_vid string wording fixdiego2008-05-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26901 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in string name.diego2008-05-272-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26900 b3059339-0415-0410-9bf9-f77b7e298cf2
* Instead of removing code from this imported library, place it under #if 0.diego2008-05-272-65/+82
| | | | | | | This makes the differences to upstream smaller and the diff more readable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26899 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix pointless weird indentation.diego2008-05-271-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26898 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: XviD --> Xviddiego2008-05-278-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26897 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move toolsclean target to a better place.diego2008-05-271-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26896 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update comment heading.diego2008-05-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26895 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Consistently place '-o $@' in compiler command line.diego2008-05-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26894 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify codec-cfg-test command with $^.diego2008-05-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26893 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix codecs2html linking.diego2008-05-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26892 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge doxygen_clean rule into distclean.diego2008-05-271-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26891 b3059339-0415-0410-9bf9-f77b7e298cf2
* codecs2html and codec-cfg-test are removed by toolsclean. Do not removediego2008-05-271-2/+1
| | | | | | | them redundantly upon distclean. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26890 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add codecs2html to TESTS variable.diego2008-05-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26889 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix dependency declaration for codecs2html.diego2008-05-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26888 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move some rules to better places.diego2008-05-271-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26887 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing -I. to fix codecs2html compilation.diego2008-05-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26886 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add codec-cfg-test to list of TESTS.diego2008-05-271-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26885 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correct dependency declaration for codec-cfg-test.diego2008-05-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26884 b3059339-0415-0410-9bf9-f77b7e298cf2
* There is no need to ignore the return value of an 'rm -rf' command.diego2008-05-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26883 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix codec-cfg-test linking.diego2008-05-271-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26882 b3059339-0415-0410-9bf9-f77b7e298cf2
* Link codec-cfg programs against mp_msg-mencoder.o instead of mp_msg.o.diego2008-05-271-3/+3
| | | | | | | The latter can pick up GUI dependencies. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26881 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix codec-cfg-test compilation.diego2008-05-271-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26880 b3059339-0415-0410-9bf9-f77b7e298cf2
* Emulate STREAM_CTRL_GET_TIME_LENGTH if cache is used.reimar2008-05-261-2/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26879 b3059339-0415-0410-9bf9-f77b7e298cf2
* add qclp fourcccompn2008-05-261-0/+1
| | | | | | | | fixes http://samples.mplayerhq.hu/A-codecs/qclp/tube.3g2 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26878 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26863, patch by JRaSH % jrash06 A 163 P com %gpoirier2008-05-251-46/+54
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26877 b3059339-0415-0410-9bf9-f77b7e298cf2
* Readd fourcc used by MTV format. Note that BGR->YUV conversionreimar2008-05-251-0/+1
| | | | | | | is currently broken. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26876 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove incorrectly added formatsreimar2008-05-251-21/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26875 b3059339-0415-0410-9bf9-f77b7e298cf2
* Render everything as early as possible, doing as little as possible inreimar2008-05-251-4/+19
| | | | | | | | flip_page. Can improve A-V sync when playing a video that uses little CPU with GPU filtering that is very slow. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26874 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reorder flip_page to make moving around do_render call easierreimar2008-05-251-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26873 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split flip_page functionreimar2008-05-251-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26872 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify yuv to rgb conversion matrix stuff.reimar2008-05-241-51/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26871 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: alignreimar2008-05-241-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26870 b3059339-0415-0410-9bf9-f77b7e298cf2
* update doxygen commentsreimar2008-05-241-29/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26869 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a filter strength parameter for blurring/sharpening scalers.reimar2008-05-243-9/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26868 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forgotten changes to gl_common.hreimar2008-05-241-5/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26867 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a struct instead of a huge and further growing argument list.reimar2008-05-243-51/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26866 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add basic support for stream controls with cache enabled.reimar2008-05-244-7/+83
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26865 b3059339-0415-0410-9bf9-f77b7e298cf2
* Re-add (hackish) support for -chapter (only start chapter, end is not ↵reimar2008-05-241-0/+4
| | | | | | supported) with -dumpstream. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26864 b3059339-0415-0410-9bf9-f77b7e298cf2
* make use of the new MGA_VID_VERSION ioctl to checkattila2008-05-232-0/+12
| | | | | | | | whether the installed driver has the version we expect it to have. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26863 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync mga_vid.h to revision 265 from the mga_vid repoattila2008-05-231-7/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26862 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert changes 26035 and 26061attila2008-05-231-21/+12
| | | | | | | | mga_vid is _NOT_ part of MPlayer, although it has been historicaly developed in the same repo. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26861 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26853Gabrov2008-05-231-7/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26860 b3059339-0415-0410-9bf9-f77b7e298cf2
* little fixesptt2008-05-231-29/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26859 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of "define RECURSIVE_RULE" since a lot of make version have problemsreimar2008-05-231-5/+3
| | | | | | | with it, especially with -j n. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26858 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: reindent after the last commit.eugeni2008-05-221-25/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26857 b3059339-0415-0410-9bf9-f77b7e298cf2
* Read all faces of a memory font, not just the first one.eugeni2008-05-221-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26856 b3059339-0415-0410-9bf9-f77b7e298cf2
* Saner handling of VOCTRL_PAUSE/VOCTRL_RESUMEreimar2008-05-222-4/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26855 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify equalizer handling for vo glreimar2008-05-221-54/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26854 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update gl vo section with the new force-pbo suboption.reimar2008-05-221-4/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26853 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix a lot of misstranslations and typos, patch by Cedric Dumez-Viougpoirier2008-05-225-28/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26852 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation with FontConfig <= 2.2.96.eugeni2008-05-221-0/+2
| | | | | | | | It lacks FcPatternRemove function. The code will work fine, but produce an incorrect "Selected font is not the requested one" warning in rare cases. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26851 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid crash with video stream switching and -nosoundreimar2008-05-211-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26850 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make internal subtitle and subtitle switching work with -audiofilereimar2008-05-211-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26849 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use av_alloc_put_byte instead of custom protocol.reimar2008-05-211-48/+11
| | | | | | | This needs less code and less hacks. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26848 b3059339-0415-0410-9bf9-f77b7e298cf2
* r26675: update paragraphs related to x264, and update its checkout commandvoroshil2008-05-213-26/+34
| | | | | | | | | | | | | | r26729: MPlayer uses Subversion, not GIT, 10L to me, and thanks to Mizda for spotting this r26287: remove excessive space character r26451: As of r19025, the "above link" refers to an article, not a guide. r26452: Refer to where encoding quality is described. r26453: typo: crahes --> crashes r26474: add better information about inverse-telecining with vf_filmdint r26711: Consistency fix: all DVD encoding examples had ":aspect=16/9" option, so put r26258: fix typo: lavcoptc --> lavcopts git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26847 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some codec specifications needed to play MTV files.reimar2008-05-211-0/+21
| | | | | | | Fixes e.g. http://samples.mplayerhq.hu/mtv/Fun_Final.mtv git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26846 b3059339-0415-0410-9bf9-f77b7e298cf2
* r26512: consistently print fps with three digits of precisionvoroshil2008-05-211-2/+9
| | | | | | | | | r26649: Fix some not entirely correct and misleading messages. r26762: Add a new suboption to -vo xv and -vo xvmc that allows selection r26795: Add support for AppleIR Remote as an input under Linux systems. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26845 b3059339-0415-0410-9bf9-f77b7e298cf2
* Continue detection if it is not clear if we have a MP3 or flac file.reimar2008-05-211-1/+2
| | | | | | | Fixes http://samples.mplayerhq.hu/A-codecs/MP3/01%20-%20Charity%20Case.mp3 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26844 b3059339-0415-0410-9bf9-f77b7e298cf2
* left an english phrase in, removed.ptt2008-05-211-98/+92
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26843 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove extra dash in nocorrect-pts optioncompn2008-05-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26842 b3059339-0415-0410-9bf9-f77b7e298cf2
* add potentially missing typesben2008-05-202-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26841 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26839Gabrov2008-05-202-26/+79
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26840 b3059339-0415-0410-9bf9-f77b7e298cf2
* In case 2 styles have the same name, prefer the latest one.eugeni2008-05-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26839 b3059339-0415-0410-9bf9-f77b7e298cf2
* Output a better informative message if no AltiVec CFLAGS can be found.diego2008-05-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26838 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not run second AltiVec CFLAG check in a subshell; the variable that isdiego2008-05-191-1/+1
| | | | | | | | set as a result is needed in the calling shell. noticed by Michael Kostylev git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26837 b3059339-0415-0410-9bf9-f77b7e298cf2
* If character set conversion for help_mp.h is required, do it on the wholediego2008-05-191-5/+4
| | | | | | | file including the parts added from the English master file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26836 b3059339-0415-0410-9bf9-f77b7e298cf2
* The multiple inclusion guard in help_mp.h has to cover the whole file,diego2008-05-191-1/+1
| | | | | | | including the non-translated parts. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26835 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify help_mp.h generation commands by using $@.diego2008-05-181-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26834 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not hide that we are running a helper script.diego2008-05-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26833 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move the logic that decides if untranslated messages need to be added todiego2008-05-182-3/+3
| | | | | | | help_mp.h into the helper script that generates those messages. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26832 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace hack to disable iconv conversion of messages with something more sane.diego2008-05-182-7/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26831 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only run AltiVec compiler tests on PowerPC.diego2008-05-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26830 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compilation of input.c if neither macosx/linux apple remote codeben2008-05-181-1/+1
| | | | | | | | is compiled in git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26829 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused strip target.diego2008-05-181-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26828 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge directory installation commands.diego2008-05-181-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26827 b3059339-0415-0410-9bf9-f77b7e298cf2
* one less level of indirection for install and program targetsdiego2008-05-181-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26826 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Fix MAN_LANG creation for real this time.diego2008-05-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26825 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: missing quotes in sed commanddiego2008-05-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26824 b3059339-0415-0410-9bf9-f77b7e298cf2
* install-mplayer and install-mencoder targets should depend on install-dirs.diego2008-05-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26823 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not install DATADIR always, the GUI installation target takes care of this.diego2008-05-181-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26822 b3059339-0415-0410-9bf9-f77b7e298cf2
* Install the required man page directories in the man page targets.diego2008-05-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26821 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace hackish shell loops for man page installation with make constructs.diego2008-05-181-17/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26820 b3059339-0415-0410-9bf9-f77b7e298cf2
* Create directories for the translated man pages in the install-dirs target.diego2008-05-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26819 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split MAN_LANG Makefile variable into MAN_LANG and MAN_LANG_ALL withdiego2008-05-181-3/+5
| | | | | | | MAN_LANG only containing the translated languages. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26818 b3059339-0415-0410-9bf9-f77b7e298cf2
* Introduce make variable common to the GTK and Windows GUI and use itdiego2008-05-182-4/+4
| | | | | | | in the appropriate places. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26817 b3059339-0415-0410-9bf9-f77b7e298cf2
* install-mencoder-man depends on install-mplayer-man.diego2008-05-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26816 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace shell for loop with proper foreach make construct in uninstall target.diego2008-05-181-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26815 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always uninstall English man pages instead of never.diego2008-05-181-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26814 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove (hopefully obsolete) codecs.conf workaround.diego2008-05-181-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26813 b3059339-0415-0410-9bf9-f77b7e298cf2
* Introduce a pattern rule for install-mplayer and install-mencoder targets.diego2008-05-181-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26812 b3059339-0415-0410-9bf9-f77b7e298cf2
* Separate install-mencoder and install-mencoder-man targets.diego2008-05-181-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26811 b3059339-0415-0410-9bf9-f77b7e298cf2
* The install-gui target depends on the install-mplayer target.diego2008-05-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26810 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify installation rules with $<.diego2008-05-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26809 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not remove gmplayer.1, it is never installed.diego2008-05-181-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26808 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Add missing parentheses in AltiVec test logic.diego2008-05-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26807 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document x264's AQ optionsgpoirier2008-05-181-0/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26806 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sort alphabeticallyben2008-05-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26805 b3059339-0415-0410-9bf9-f77b7e298cf2
* There is no need to ignore errors from 'rm -f' commands.diego2008-05-181-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26804 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove skin download instructions, they have no place in the Makefile.diego2008-05-181-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26803 b3059339-0415-0410-9bf9-f77b7e298cf2
* Declare new Linux AppleIR remote support.ben2008-05-182-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26802 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make "Menu" button of AppleIR remote call OSD Menu insteadben2008-05-181-1/+1
| | | | | | | | of displaying the OSD status git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26801 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow DVD Menus to be controlled by AppleIR Remote.ben2008-05-181-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26800 b3059339-0415-0410-9bf9-f77b7e298cf2
* Keep AppleIR enabled by default on MacOSX but have it disable on Linux.ben2008-05-181-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26799 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document the -noar command-line option in en/fr manpages.ben2008-05-182-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26798 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not enable AppleIR by default.ben2008-05-181-1/+1
| | | | | | | | | The amount of computers capable of using it is too low in the field to enable it by default. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26797 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not consider TAGS file under SVN.ben2008-05-180-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26796 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for AppleIR Remote as an input under Linux systems.ben2008-05-188-0/+209
| | | | | | | | | | | | | This requires Linux 2.6 with evdev and appleir drivers. The keymapping is done to mimics the one that was done for MacOSX. WARNING: Most distributions do not seems to bother and only let root access to the device. Modify udev rules accordingly if you want regular user to be able to use the remote. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26795 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add section about code from NuppelVideo / RTJPEG.diego2008-05-171-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26794 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing MPLAYER_ prefix to multiple inclusion guards.diego2008-05-171-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26793 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ffmpeg ea maxis xa adpcm audio decodercompn2008-05-162-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26792 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove useless parentheses from return statements.diego2008-05-1617-134/+134
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26791 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove pointless parentheses from return statements.diego2008-05-166-20/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26790 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove pointless parentheses from return statements.diego2008-05-169-50/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26789 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove useless parentheses from return statements.diego2008-05-1612-198/+198
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26788 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove useless parentheses from from return statements.diego2008-05-1622-82/+82
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26787 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove pointless parentheses from return calls.diego2008-05-1619-151/+151
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26786 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove useless parentheses from return statements.diego2008-05-1627-138/+138
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26785 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused function, fixes the warning:diego2008-05-151-19/+0
| | | | | | | libmpdemux/demux_mkv.c:2242: warning: 'demux_mkv_reverse_id' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26784 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing stream.h #include, fixes the warning:diego2008-05-151-0/+1
| | | | | | | stream/tcp.c:197: warning: implicit declaration of function 'stream_check_interrupt' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26783 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable, fixes the warning:diego2008-05-151-1/+0
| | | | | | | libmpdemux/demux_mkv.c:1401: warning: unused variable 'mkv_d' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26782 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Break overly long lines.diego2008-05-151-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26781 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark static tables const.diego2008-05-151-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26780 b3059339-0415-0410-9bf9-f77b7e298cf2
* add gsm in aif, works on aif-gsm610.aifcompn2008-05-141-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26779 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add stanza about files taken from the MJPEG Tools suite.diego2008-05-141-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26778 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark files that were imported from the MJPEG Tools suite as such.diego2008-05-144-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26777 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Revert license header cleanup on imported files.diego2008-05-142-33/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26776 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license headers with standard formatting.diego2008-05-1414-117/+129
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26775 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license headers with standard formatting.diego2008-05-148-112/+124
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26774 b3059339-0415-0410-9bf9-f77b7e298cf2
* its typo spotted by diegocompn2008-05-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26773 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license headers with standard formatting.diego2008-05-147-41/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26772 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license headers with standard formatting.diego2008-05-1415-185/+197
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26771 b3059339-0415-0410-9bf9-f77b7e298cf2
* Speak of libass instead of MPlayer in the libass license headers.diego2008-05-1419-76/+76
| | | | | | | | We already use LIBASS_ prefixes for the multiple inclusion guards. Thus libass can be considered separate enough to warrant this. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26770 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license headers with standard formatting.diego2008-05-1417-233/+262
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26769 b3059339-0415-0410-9bf9-f77b7e298cf2
* clean up dll keywordcompn2008-05-141-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26768 b3059339-0415-0410-9bf9-f77b7e298cf2
* add rl2 codeccompn2008-05-142-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26767 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26762gpoirier2008-05-141-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26766 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add detection code for abnormal pts jump when seeking previous.ulion2008-05-141-0/+14
| | | | | | | This patch make the vobsub works more accurately according to the requested pts. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26765 b3059339-0415-0410-9bf9-f77b7e298cf2
* Seek by pts accurately.ulion2008-05-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26764 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove '(pass 1/2)' from some lavcopts. These options really worked oncorey2008-05-131-15/+15
| | | | | | | | | all passes, and most options that worked on all passes weren't marked at all. It's valid to assume that any option not marked otherwise will work on all passes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26763 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a new suboption to -vo xv and -vo xvmc that allows selectionben2008-05-135-0/+23
| | | | | | | | | | | | | of XVideo adaptor to be used (instead of default one, which is #0). This is useful for example if you'd rather like to use the original Overlay renderer of your GPU instead of the texture blitting engine (which is usually default), which is number one cause of nasty video tearing effects. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26762 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use more intuitive and user-friendly DVDNAV control keys.ben2008-05-131-7/+7
| | | | | | | | | It is particularly useful for laptops users that obviously do not have a keypad ;-) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26761 b3059339-0415-0410-9bf9-f77b7e298cf2
* Delcare a dvdnav-specific input section if the currently playedben2008-05-131-0/+1
| | | | | | | | stream is from such a type. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26760 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license headers.diego2008-05-1328-434/+482
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26759 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license header with standard formatting.diego2008-05-134-31/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26758 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add standard license header.diego2008-05-131-0/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26757 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix one more license header wording detail for consistency.diego2008-05-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26756 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license header.diego2008-05-1318-288/+324
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26755 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in install-gui target dependency.diego2008-05-131-1/+1
| | | | | | | patch by andrew, andrew.david.45 gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26754 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: remove some commented code.eugeni2008-05-121-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26753 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change subtitle selection order by giving "indirect" ways of specifying theeugeni2008-05-121-7/+9
| | | | | | | | | | | | | | desired subtitle track the least priority. Selection of displayed subtitles by language (-slang) and default track attribute is only performed if all other ways have failed. They are not directly controllable by the user (especially default tracks), therefore they should not override -sub, -vobsub and even auto-subs. Based on a patch by Sergey Malkovsky (mplayer.win32_gmail_com). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26752 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license headers.diego2008-05-1224-91/+91
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26751 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency cosmetics: Move some parts of file headers around; typo fixes.diego2008-05-1217-109/+111
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26750 b3059339-0415-0410-9bf9-f77b7e298cf2
* -psprobe can be used in mpeg-pes streams, toonicodvb2008-05-121-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26749 b3059339-0415-0410-9bf9-f77b7e298cf2
* ptx is an internal fourcccompn2008-05-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26748 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless changelogs.diego2008-05-123-32/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26747 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license header and add back credits line for Marcel Naziri.diego2008-05-121-6/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26746 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless changelog from file header.diego2008-05-121-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26745 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ffsiff, works on game-formats/SIFF/compn2008-05-121-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26744 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ffptx , works on ptx samplescompn2008-05-122-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26743 b3059339-0415-0410-9bf9-f77b7e298cf2
* When building font pattern, treat both ' ' and '-' as word separators.eugeni2008-05-111-7/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26742 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix possible free of unallocated memory.eugeni2008-05-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26741 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused file, it has never been compiled.diego2008-05-112-771/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26740 b3059339-0415-0410-9bf9-f77b7e298cf2
* Oops, remove stray .TP.diego2008-05-111-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26739 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard license header.diego2008-05-112-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26738 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26732gpoirier2008-05-111-1/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26737 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add license headers to av_optsreimar2008-05-112-0/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26736 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize "int i".michael2008-05-111-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26735 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: wording/spelling fixesdiego2008-05-111-18/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26734 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix unknow vs. unknowN typo.diego2008-05-111-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26733 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark new options Michael committed as undocumented.diego2008-05-111-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26732 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add newlines at end of file, this is required for text files and gccreimar2008-05-112-2/+2
| | | | | | | also complains that they are missing. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26731 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26729Gabrov2008-05-114-20/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26730 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPlayer uses Subversion, not GIT, 10L to me, and thanks to Mizda for ↵gpoirier2008-05-111-1/+1
| | | | | | spotting this git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26729 b3059339-0415-0410-9bf9-f77b7e298cf2
* AVOption support for lavf demuxingmichael2008-05-101-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26728 b3059339-0415-0410-9bf9-f77b7e298cf2
* AVOptions support for lavf muxing.michael2008-05-101-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26727 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reformat very ugly code.michael2008-05-101-15/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26726 b3059339-0415-0410-9bf9-f77b7e298cf2
* AVOption support for video encoders.michael2008-05-101-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26725 b3059339-0415-0410-9bf9-f77b7e298cf2
* AVOptions support for libavcodec based video decoders.michael2008-05-101-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26724 b3059339-0415-0410-9bf9-f77b7e298cf2
* AVOptions support.michael2008-05-103-1/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26723 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace a really ugly hack by a clean but not thread safe solution.michael2008-05-101-2/+7
| | | | | | | | (no threads so no problem anyway ...) This fixes the segfault with lavf muxing. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26722 b3059339-0415-0410-9bf9-f77b7e298cf2
* Request a timer resolution of 1 ms on Windows, the default ofreimar2008-05-101-0/+5
| | | | | | | between 10 and 55 ms (depending on OS version) is too inaccurate for our needs. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26721 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prefer FSF-style AltiVec flags over Apple-style.diego2008-05-101-4/+2
| | | | | | | FSF gcc is better than Apple gcc. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26720 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify AltiVec compiler flag test.diego2008-05-102-14/+7
| | | | | | | Add a note about the new build system to the AUTHORS file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26719 b3059339-0415-0410-9bf9-f77b7e298cf2
* usec_sleep(0) is not the same as not sleeping at all.reimar2008-05-101-1/+1
| | | | | | Fixes massive slowdown on Windows. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26718 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify AltiVec CFLAG test.diego2008-05-101-13/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26717 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace some if constructs with && in the AltiVec test.diego2008-05-101-9/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26716 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: whitespace changes, spelling, code moving in AltiVec test.diego2008-05-101-17/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26715 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add . to windres include path (otherwise version.h is not found).reimar2008-05-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26714 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add force-pbo suboption for faster OpenGL output.reimar2008-05-101-2/+22
| | | | | | | | Based on a patch by Sven Gothel sgothel-jausoftcom. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26713 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only check for and set AltiVec flags if AltiVec or runtime CPU detection isdiego2008-05-101-1/+1
| | | | | | | enabled. Fixes Bugzilla #1073. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26712 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistency fix: all DVD encoding examples had ":aspect=16/9" option, so putgpoirier2008-05-101-4/+4
| | | | | | | it everywhere else. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26711 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove outdated FIXME comment.diego2008-05-101-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26710 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add ati-hack suboption that aligns the lines to 32/64 bytes for PBO transfersreimar2008-05-101-0/+7
| | | | | | | to avoid what is probably a bug in the driver. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26709 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some comment headings to divide the Makefile into logical chapters.diego2008-05-091-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26708 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move some stuff around for more logical grouping.diego2008-05-091-71/+71
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26707 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove in_asm_used_var_warning_killer()superdump2008-05-091-10/+0
| | | | | | | Patch by Keiji Costantini ( strites gmail com ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26706 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26674gpoirier2008-05-091-12/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26705 b3059339-0415-0410-9bf9-f77b7e298cf2
* FFmpeg parts no longer require extra -I CFLAGS.diego2008-05-092-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26704 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest FFmpeg changes.diego2008-05-091-9/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26703 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use full path for #includes from another directory.diego2008-05-094-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26702 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: indentationdiego2008-05-091-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26701 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add options to handle the external libraries in libavcodec, which requirediego2008-05-081-17/+39
| | | | | | | extra linker flags etc. individually. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26700 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add option to disable mp3lame.diego2008-05-081-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26699 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Rename _lavc_* variables to _*_lavc.diego2008-05-081-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26698 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Rename _def_lavc_* variables to _def_*_lavc.diego2008-05-081-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26697 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless output.diego2008-05-081-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26696 b3059339-0415-0410-9bf9-f77b7e298cf2
* add h264 speedupscompn2008-05-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26695 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindent for last commit.ulion2008-05-081-16/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26694 b3059339-0415-0410-9bf9-f77b7e298cf2
* Distinguish between ac3 and dts by format tag.ulion2008-05-081-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26693 b3059339-0415-0410-9bf9-f77b7e298cf2
* Define FC_FULLNAME and FC_EMBOLDEN to fix compilation with ancient fontconfig.eugeni2008-05-081-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26692 b3059339-0415-0410-9bf9-f77b7e298cf2
* If both full name and family are available, use the former in inexact match ↵eugeni2008-05-081-1/+1
| | | | | | warning. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26691 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove extra family names from the search pattern after FcFontSort andeugeni2008-05-081-6/+18
| | | | | | | | | | | call FcFontRenderPrepare to select the best family name for the font in case there are several of them. This does not affect font matching results, but helps to avoid warning about inexact match. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26690 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add paragraph about homepage translation.diego2008-05-081-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26689 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify order of importance for translations.diego2008-05-081-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26688 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move some blocks around for better text structuring.diego2008-05-081-35/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26687 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add paragraph headings.diego2008-05-081-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26686 b3059339-0415-0410-9bf9-f77b7e298cf2
* small wording fixdiego2008-05-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26685 b3059339-0415-0410-9bf9-f77b7e298cf2
* more complete mphelp_check.py command lines, typo, clarificationsdiego2008-05-071-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26684 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obscure comment about libmp3lame depending on Vorbis.diego2008-05-071-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26683 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l: Remove leftover _lavc_x264 variable.diego2008-05-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26682 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid dependency on newer pulseaudio version.reimar2008-05-071-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26681 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mike Baker agreed to relicense his parts of the code as GPL v2+ on IRC.diego2008-05-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26680 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense file as GPL v2+; bero granted permission on IRC.diego2008-05-071-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26679 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always enable x264 in libavcodec if x264 is enabled.diego2008-05-061-8/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26678 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26649ptt2008-05-061-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26677 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26674ptt2008-05-061-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26676 b3059339-0415-0410-9bf9-f77b7e298cf2
* update paragraphs related to x264, and update its checkout commandgpoirier2008-05-061-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26675 b3059339-0415-0410-9bf9-f77b7e298cf2
* add h264 to list of supported codecscompn2008-05-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26674 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: sort lines (correctly)diego2008-05-051-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26673 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless variable startup_time, since we do not need it any more.ulion2008-05-051-5/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26672 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Shuffle lines around and add empty lines.lu_zero2008-05-041-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26671 b3059339-0415-0410-9bf9-f77b7e298cf2
* Build sparc arch specific code using the Makefilelu_zero2008-05-042-8/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26670 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: alphabetical orderdiego2008-05-041-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26669 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rewrite (gcc) compiler check to default to enabling compilation and not setdiego2008-05-041-19/+8
| | | | | | | gcc-specific variables before the compiler is confirmed to be gcc. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26668 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove trailing whitespace.diego2008-05-031-33/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26667 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove unused argc/argv parameters from test programs.diego2008-05-031-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26666 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Consistently compactify and reformat test programs.diego2008-05-031-84/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26665 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore generated header object files.diego2008-05-030-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26664 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #includes to fix 'make checkheaders'.diego2008-05-032-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26663 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the checkheaders target work non-recursively.diego2008-05-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26662 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix one misindented line.diego2008-05-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26661 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a regular expression to filter out all external library parts from FFmpeg.diego2008-05-031-14/+11
| | | | | | | | In the rare cases we use some of those external libraries, add them explicitly instead of removing them if the library is disabled. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26660 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove dead code; LIBVORBIS_ENCODER is deleted from _libavencoders elsewhere.diego2008-05-031-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26659 b3059339-0415-0410-9bf9-f77b7e298cf2
* External libraries used by FFmpeg now have a lib prefix in their name.diego2008-05-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26658 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only compile and use libmpeg2 AltiVec code when AltiVec is available. Thediego2008-05-034-3/+27
| | | | | | | | | | AltiVec code needs -maltivec to compile, but then AltiVec instructions appear in other places of the code causing MPlayer to sigill. Somehow upstream libmpeg2 manages not to sigill under what appear to be the same circumstances. Enlightenment welcome. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26657 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_gl -dr actually works fine with non-readable MP_IMGTYPE_IP and ↵reimar2008-05-031-2/+0
| | | | | | MP_IMGTYPE_IPB. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26656 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation: disable libdirac and libschroedinger FFmpeg de- and encoders.reimar2008-05-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26655 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 100l: mpi->height must be used to calculate required memory, not mpi->h.reimar2008-05-031-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26654 b3059339-0415-0410-9bf9-f77b7e298cf2
* VLB audio is quite similar to AAC, and faad decodes somewhat usably (thoughreimar2008-05-031-0/+1
| | | | | | | | clearly wrong and playing at twice the speed), so add it to codecs.conf - it is better than no output at all. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26653 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the second fontconfig_init function as the declaration in the .h file.ulion2008-05-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26652 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove modification notes from unmodified files.diego2008-05-033-12/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26651 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update documentation for the gl2 driver to make clear gl is usually preferred.reimar2008-05-031-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26650 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some not entirely correct and misleading messages.eugeni2008-05-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26649 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print more info about selected font.eugeni2008-05-021-2/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26648 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rewrite font family check in a simpler way.eugeni2008-05-021-8/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26647 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move font family check to the end of the list.eugeni2008-05-021-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26646 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: rename local variables to better reflect their contents.eugeni2008-05-021-17/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26645 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check ASF packet size before calling demux_asf_read_packet. Fixes segfaulteugeni2008-05-021-1/+5
| | | | | | | with damaged ASF files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26644 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Reindent after last commit and reformat comment.diego2008-05-011-25/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26643 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always run the GCC AltiVec test so that the correct AltiVec CFLAGS get pickeddiego2008-05-011-2/+0
| | | | | | | up. They are needed even on machines without AltiVec for the altivec.h check. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26642 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix indentation after last commits.diego2008-05-011-35/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26641 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete gcc 2.96 warning message. This was also used for e.g. icc,diego2008-05-011-21/+1
| | | | | | | which makes no sense at all. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26640 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove --disable-gcc-check option and related code.diego2008-05-011-30/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26639 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename cc_verc_fail variable to cc_fail.diego2008-05-011-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26638 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a comment that makes no longer sense (since quite some time actually)reimar2008-05-011-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26637 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support 32 bit float and integer formats in ao_pcm.creimar2008-05-011-1/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26636 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for 32 bit format to ao_pulse.reimar2008-05-011-0/+2
| | | | | | | Based on patch by James Warden [warjamy yahoo com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26635 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make ao_pulse fall back to s16le format instead of just failing.reimar2008-05-011-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26634 b3059339-0415-0410-9bf9-f77b7e298cf2
* realrtsp depends on librtsp/rtsp.creimar2008-05-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26633 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove recurse target. Instead, make FFmpeg parts depend on the phony recursediego2008-05-011-5/+2
| | | | | | | target so that their directories will be recursed unconditionally. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26632 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Simplify altivec.h test.diego2008-05-011-8/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26631 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix indentation after last commit.diego2008-05-011-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26630 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for altivec.h always, not just when AltiVec is enabled.diego2008-05-011-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26629 b3059339-0415-0410-9bf9-f77b7e298cf2
* Build libmpeg2 AltiVec code on PPC always, not just when AltiVec is available.diego2008-05-011-1/+1
| | | | | | | libmpeg2 decides on the correct functions to use at runtime. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26628 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation on PPC without AltiVec.diego2008-05-012-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26627 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable Alpha/ARM optimizations in libmpeg2.diego2008-05-011-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26626 b3059339-0415-0410-9bf9-f77b7e298cf2
* Skip '@' at the beginning of the font name.eugeni2008-05-011-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26625 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only warn if both font family and it's full name are different from requested.eugeni2008-05-011-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26624 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow inexact font family matching.eugeni2008-05-011-0/+20
| | | | | | | | | | | | | | | In SSA/ASS fonts are sometimes referenced by their "full name", which is usually a concatenation of family name and font style (ex. Ottawa Bold). Full name is available from FontConfig pattern element FC_FULLNAME, but it is never used for font matching. Therefore, I'm removing words from the end of the name one by one, and adding shortened names to the pattern. It seems that the first value (full name in this case) has precedence in matching. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26623 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove tools on distclean, not on clean.diego2008-04-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26622 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add testclean target and make distclean depend upon it.diego2008-04-301-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26621 b3059339-0415-0410-9bf9-f77b7e298cf2
* Introduce TEST_OBJS variable for objects to link all test files againstdiego2008-04-301-10/+9
| | | | | | | and share it with the tools. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26620 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set libdvdcss CFLAGS for dvdread from configure.diego2008-04-302-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26619 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmeticsdiego2008-04-301-22/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26618 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add new tests target to build all test programs and remove them on distclean.diego2008-04-301-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26617 b3059339-0415-0410-9bf9-f77b7e298cf2
* Link loader test files against mp_msg-mencoder.o instead of mp_msg.o.diego2008-04-301-1/+1
| | | | | | | The former does not pick up GUI dependencies. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26616 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add compilation rule for libvo/aspecttest and (hackishly) fix linking.diego2008-04-302-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26615 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove libass dependency on global font_fontconfig variable.eugeni2008-04-305-9/+26
| | | | | | | | | A new function (ass_set_fonts_nofc) is introduced instead of an extra argument to existing ass_set_fonts to keep binary compatibility with older versions of the library. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26614 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add $(EXESUF) to test rules.diego2008-04-301-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26613 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove loader/wine/avifmt.h #include, the AVI types declared there conflictdiego2008-04-301-1/+0
| | | | | | | with the ones from libmpdemux/aviheader.h, which is #included below. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26612 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing string.h #include to fix a bunch of implicit declaration warnings.diego2008-04-301-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26611 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused fast_memcpy() function and link against the object thatdiego2008-04-302-7/+2
| | | | | | | contains fast_memcpy() instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26610 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move some variable declarations to better places.diego2008-04-301-16/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26609 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable unused function.diego2008-04-301-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26608 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark all functions that are only used within the file as static.diego2008-04-308-18/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26607 b3059339-0415-0410-9bf9-f77b7e298cf2
* The recurse target does not depend on help_mp.h.diego2008-04-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26606 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the default target depend on the recurse target again so that thediego2008-04-301-3/+1
| | | | | | | all necessary subdirectories are recursed by default. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26605 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explicitly declare which dependency files need generated headers.diego2008-04-301-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26604 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use consistent include paths, we always build from the top level now.diego2008-04-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26603 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary version.h #includes.diego2008-04-305-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26602 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rebuild version.h only when the working directory was updated.diego2008-04-301-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26601 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync codec short name changes from FFmpeg.diego2008-04-301-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26600 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move CFLAGS setting to configure.diego2008-04-292-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26599 b3059339-0415-0410-9bf9-f77b7e298cf2
* change cvs > svncompn2008-04-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26598 b3059339-0415-0410-9bf9-f77b7e298cf2
* add info lines to ffmimic, ffkmvc. fixes codec-status table.compn2008-04-291-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26597 b3059339-0415-0410-9bf9-f77b7e298cf2
* Link tools against mp_msg-mencoder.o instead of mp_msg.o.diego2008-04-291-1/+1
| | | | | | | The latter may depend on the GUI and cause link failures. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26596 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge mpcommon.mak into Makefile.diego2008-04-292-30/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26595 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move version.h/help_mp.h generation rules to a better place.diego2008-04-291-22/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26594 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Add missing \ for line continuation.diego2008-04-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26593 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not rebuild version.h at every Makefile change.diego2008-04-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26592 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert clean/distclean into non-recursive targets.diego2008-04-291-3/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26591 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove generated headers and generated helper binaries only on distclean.diego2008-04-291-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26590 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary dependency declaration.diego2008-04-291-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26589 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge nearly identical SRCS_COMMON lines.diego2008-04-291-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26588 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of now obsolete library rules and variables.diego2008-04-282-17/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26587 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Reorder commands in (dist)clean targets.diego2008-04-281-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26586 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove '-' prefix from 'rm -f' commands for consistency.diego2008-04-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26585 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark phony checkheaders target as such.diego2008-04-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26584 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge now redundant clean and distclean rules into the top-level Makefile.diego2008-04-282-9/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26583 b3059339-0415-0410-9bf9-f77b7e298cf2
* Force to uint64_t first to avoid direct conversion from double to unsigned int.ulion2008-04-281-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26582 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove code for .depend generation, inclusion and related hacks.diego2008-04-282-13/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26581 b3059339-0415-0410-9bf9-f77b7e298cf2
* .depend should no longer be ignored.diego2008-04-280-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26580 b3059339-0415-0410-9bf9-f77b7e298cf2
* Run 'make depend', not 'make .depend' in FFmpeg subdirectories.diego2008-04-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26579 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary CFLAGS hack.diego2008-04-281-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26578 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary -I.. from CFLAGS, change -I../libavutil to -Ilibavutil.diego2008-04-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26577 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use consistent #include paths without "../".diego2008-04-289-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26576 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use full path for libavutil #includes.diego2008-04-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26575 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently #include mpbswap.h instead of bswap.h everywhere.diego2008-04-284-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26574 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge loader/Makefile into top-level Makefile.diego2008-04-282-54/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26573 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore line mistakenly commented out in the last commit.diego2008-04-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26572 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure all autogenerated .h and .c files exist in the vidix subdirectorydiego2008-04-281-2/+5
| | | | | | | before trying to create object or dependency files there. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26571 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove calls to Restore_LDT_Keeper, exit() is called immediately afterwardsdiego2008-04-282-4/+2
| | | | | | | anyway. The calls were missing parameters and caused compilation failures. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26570 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing ldt_keeper.h #include; this fixes a bunch of implicit declarationdiego2008-04-282-0/+2
| | | | | | | of function warnings. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26569 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge TEST_OBJS and TEST_LDFLAGS.diego2008-04-281-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26568 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add -g to CFLAGS, not to LDFLAGS.diego2008-04-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26567 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge test program compilation rules using patterns.diego2008-04-281-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26566 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add CFLAGS to test program compilation commands.diego2008-04-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26565 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing ../osdep/mmap_anon.o to TEST_OBJS.diego2008-04-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26564 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary linker flags.diego2008-04-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26563 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include, fixes the warning:diego2008-04-281-0/+1
| | | | | | | qtx/qtxload.c:50: warning: implicit declaration of function 'mp_msg_init' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26562 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adjust printf length modifier, fixes the warning:diego2008-04-281-1/+1
| | | | | | | qtx/list.c:54: warning: format '%d' expects type 'int', but argument 2 has type 'long int' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26561 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment out variables only used in commented-out code, fixes the warnings:diego2008-04-281-2/+2
| | | | | | | | qtx/qtxload.c:46: warning: unused variable 'i' qtx/qtxload.c:45: warning: unused variable 'esp' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26560 b3059339-0415-0410-9bf9-f77b7e298cf2
* Link against individual objects, the osdep library is not generated anymore.diego2008-04-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26559 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete and non-working test program.diego2008-04-283-74/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26558 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make OBJS depend on the recurse target instead of just the all target.diego2008-04-281-1/+3
| | | | | | | This fixes 'make mplayer' and 'make mencoder'. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26557 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove .S files from list of files to generate dependencies for.diego2008-04-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26556 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge mp3lib/Makefile into top-level Makefile.diego2008-04-273-22/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26555 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge liba52/Makefile into top-level Makefile.diego2008-04-272-19/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26554 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary compilation command that shadows GNU Make builtin command.diego2008-04-271-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26553 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary -lm linker flag from test program compilation command.diego2008-04-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26552 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge libmpeg2/Makefile into top-level Makefile.diego2008-04-262-23/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26551 b3059339-0415-0410-9bf9-f77b7e298cf2
* clean and distclean rules do the same thing.diego2008-04-261-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26550 b3059339-0415-0410-9bf9-f77b7e298cf2
* clean and distclean rules do the same thing.diego2008-04-261-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26549 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge vidix/Makefile into top-level Makefile.diego2008-04-263-58/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26548 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge clean and distclean rules.diego2008-04-261-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26547 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark alltools target as phony.diego2008-04-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26546 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only compile libmpcodecs/ve_qtvideo.c on Windows.diego2008-04-263-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26545 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add alltools target and variable to build non-linking tools.diego2008-04-261-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26544 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only add vidix to parts when VIDIX is enabled.diego2008-04-261-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26543 b3059339-0415-0410-9bf9-f77b7e298cf2
* Take Objective C files into account when generating dependencies.diego2008-04-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26542 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add rule for generating dependency files from Objective C files.diego2008-04-261-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26541 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert accidentally committed changes.diego2008-04-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26540 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only add loader to parts if WIN32DLL is enabled.diego2008-04-252-2/+2
| | | | | | | Plus, some unrelated changes to mp3lib/Makefile committed by accident. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26539 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore test program.diego2008-04-250-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26538 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only compile decode_i586.c on x86_32.diego2008-04-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26537 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless comments with compilation commands.diego2008-04-252-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26536 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix test program linking.diego2008-04-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26535 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add return statement, fixes the warning:diego2008-04-251-1/+1
| | | | | | | test.c:75: warning: control reaches end of non-void function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26534 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant declaration, fixes the warning:diego2008-04-251-1/+0
| | | | | | | | test.c:15: warning: redundant redeclaration of 'gCpuCaps' ../cpudetect.h:53: warning: previous declaration of 'gCpuCaps' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26533 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add return statement, fixes the warning:diego2008-04-251-1/+1
| | | | | | | test2.c:72: warning: control reaches end of non-void function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26532 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable.diego2008-04-251-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26531 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include, fixes the warning:diego2008-04-251-0/+1
| | | | | | | test2.c:65: warning: implicit declaration of function 'memcpy' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26530 b3059339-0415-0410-9bf9-f77b7e298cf2
* Take name of getch file to link against from config.mak.diego2008-04-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26529 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge dvdread/Makefile into top-level Makefile.diego2008-04-252-25/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26528 b3059339-0415-0410-9bf9-f77b7e298cf2
* DVDCSS_INTERNAL has been renamed to LIBDVDCSS_INTERNAL.diego2008-04-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26527 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge libfaad2/Makefile into top-level Makefile.diego2008-04-242-48/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26526 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename make variable DVDCSS_INTERNAL --> LIBDVDCSS_INTERNAL.diego2008-04-242-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26525 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge libdvdcss/Makefile into top-level Makefile.diego2008-04-242-17/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26524 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge libmpdemux/Makefile into top-level Makefile.diego2008-04-242-89/+73
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26523 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explicitly include dependency information in top-level Makefile.diego2008-04-241-0/+2
| | | | | | | The inclusion is skipped in mpcommon.mak. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26522 b3059339-0415-0410-9bf9-f77b7e298cf2
* dependency generation infrastructure for C++ filesdiego2008-04-243-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26521 b3059339-0415-0410-9bf9-f77b7e298cf2
* Include mpcommon.mak before declaring dependencies, which require mpcommon.mak.diego2008-04-241-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26520 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure necessary header files are created before recursing.diego2008-04-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26519 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include base64.h with full path.diego2008-04-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26518 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move libfaad2 fixed-point CFLAGS setting to configure.diego2008-04-242-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26517 b3059339-0415-0410-9bf9-f77b7e298cf2
* Expand conditional addition of elements to variables with a form that permitsdiego2008-04-243-10/+7
| | | | | | | using two conditions. This allows getting rid of some ifeqs in Makefiles. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26516 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge stream/Makefile into top-level Makefile.diego2008-04-242-75/+68
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26515 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge libmpcodecs/Makefile into top-level Makefile.diego2008-04-242-165/+163
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26514 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: alphabetical orderdiego2008-04-241-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26513 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistently print fps with three digits of precisioncorey2008-04-2316-24/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26512 b3059339-0415-0410-9bf9-f77b7e298cf2
* use existing MSGTR_FilefmtFourccSizeFpsFtime translatable string macrocorey2008-04-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26511 b3059339-0415-0410-9bf9-f77b7e298cf2
* There is no need to remove .a files from subdirectories, they are onlydiego2008-04-231-1/+1
| | | | | | | created in the directories using recursive make. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26510 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge libvo/Makefile into top-level Makefile.diego2008-04-233-34/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26509 b3059339-0415-0410-9bf9-f77b7e298cf2
* EXTRAXX_INC flags should now be added to .depend compilation,diego2008-04-231-1/+1
| | | | | | | not to the phony depend target. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26508 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge libao2/Makefile into top-level Makefile.diego2008-04-232-13/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26507 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless 0 flag from s printf conversion specifier, fixes the warning:diego2008-04-231-1/+1
| | | | | | | TOOLS/movinfo.c:332: warning: '0' flag used with '%s' printf format git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26506 b3059339-0415-0410-9bf9-f77b7e298cf2
* Take audio delay into account when seeking in avisynth demuxer.reimar2008-04-231-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26505 b3059339-0415-0410-9bf9-f77b7e298cf2
* Calculate fps as double-precision to make switching to double-precision fps ↵reimar2008-04-231-1/+1
| | | | | | values easier. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26504 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge tremor/Makefile into top-level Makefile.diego2008-04-222-22/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26503 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move Tremor low accuracy CFLAGS handling to configure.diego2008-04-222-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26502 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only add loader to PARTS on x86.diego2008-04-221-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26501 b3059339-0415-0410-9bf9-f77b7e298cf2
* .depend has to get all the CFLAGS that the files it contains dependencydiego2008-04-221-1/+1
| | | | | | | information for need. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26500 b3059339-0415-0410-9bf9-f77b7e298cf2
* Create standard recursive rules from a template.diego2008-04-221-55/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26499 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use directory name as library name template.diego2008-04-226-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26498 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for dvdread-config (from our svn), called as fallback when ↵nicodvb2008-04-221-0/+17
| | | | | | dvdread isn't detected git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26497 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify phony target declaration.diego2008-04-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26496 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an unconditional phony recurse rule and make the binaries depend on it.diego2008-04-221-24/+27
| | | | | | | | | This assures that all directories that use recursive make are descended into. This way cross-directory dependencies are taken into account through the .depend files that record them. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26495 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert commits 26437-26439 the right way[tm]attila2008-04-220-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26494 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only add available CPU extensions to config.mak.diego2008-04-221-11/+1
| | | | | | | Fixes compilation on non-x86 after latest FFmpeg changes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26493 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move phony target declaration to the bottom of the file; add distclean target.diego2008-04-221-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26492 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add BFI video support through FFmpeg.diego2008-04-223-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26491 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add standard GPL header to individual files.diego2008-04-2251-21/+910
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26490 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard GPL header.diego2008-04-2212-36/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26489 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant definitions that are already present on the command line.diego2008-04-221-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26488 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge TOOLS/Makefile into the top-level Makefile.diego2008-04-222-77/+70
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26487 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix potential segfault in debug printf in expSetFilePointerrtogni2008-04-211-1/+1
| | | | | | | Patch by Gianluigi Tiesi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26486 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26484Gabrov2008-04-212-20/+63
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26485 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26460, patch by JRaSH %jrash06 A 163 P com%gpoirier2008-04-211-17/+54
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26484 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26067, patch by mehmet köse % voltrem A gmail P com %gpoirier2008-04-211-67/+407
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26483 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26460gpoirier2008-04-211-8/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26482 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless '0' flag from fprintf call, fixes the warning:diego2008-04-218-8/+8
| | | | | | | warning: '0' flag ignored with precision and '%d' printf format git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26481 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add $(EXESUF) to netstream rule.diego2008-04-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26480 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only build modify_reg on x86.diego2008-04-201-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26479 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify list of files to remove on make clean.diego2008-04-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26478 b3059339-0415-0410-9bf9-f77b7e298cf2
* fastmemcpybench is a phony target. Do not try to remove a file by that name.diego2008-04-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26477 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for MSU SCLS (Screen Capture Lossless Codec) with SCLS.DLLrtogni2008-04-202-0/+30
| | | | | | | | codecs.conf patch by AsSlowAsHell |asslowashell | g m a i l| win32.c patch by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26476 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add status to mimic and kmvc codecsrtogni2008-04-201-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26475 b3059339-0415-0410-9bf9-f77b7e298cf2
* add better information about inverse-telecining with vf_filmdintcorey2008-04-201-12/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26474 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for msn siren audio coced via binary dll sirenacm.dllrtogni2008-04-202-0/+37
| | | | | | | | Based on a patch by Ruuds "roadrunnerswife" "users sourceforge net" Closes bugzilla #963 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26473 b3059339-0415-0410-9bf9-f77b7e298cf2
* Canopus HQ tries to load the auxiliary dlls with lowercase filenamertogni2008-04-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26472 b3059339-0415-0410-9bf9-f77b7e298cf2
* add canopus codecs, patch by Gianluigi Tiesicompn2008-04-191-0/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26471 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert r26412: policy violationrtogni2008-04-191-8/+7
| | | | | | | Mixes cosmetics and functional changes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26470 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert r26411: policy violationrtogni2008-04-191-963/+812
| | | | | | | | | Reindent of the file is not allowed Controversial cosmetics changes with no previous discussion Mix cosmetics and non-cosmetic changes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26469 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert commits 26437-26439attila2008-04-191-11/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26468 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add dependency information to recursive rules. While more eager than strictlydiego2008-04-191-22/+22
| | | | | | | | necessary, this should err on the side of unneeded recursion instead of missing a necessary rebuild. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26467 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing recursive rule for libmpcodecs/libmpencoders.a.diego2008-04-191-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26466 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Sort recursive rules alphabetically.diego2008-04-191-27/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26465 b3059339-0415-0410-9bf9-f77b7e298cf2
* per-file dependencies (for the non-recursive parts)diego2008-04-182-5/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26464 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adjust dependency generation prerequisites to new structure.diego2008-04-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26463 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always generate dependency information. This also allows dropping thediego2008-04-182-52/+4
| | | | | | | hackish list of incorrect pseudo-dependencies. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26462 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26460ptt2008-04-181-2/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26461 b3059339-0415-0410-9bf9-f77b7e298cf2
* restore options alphabetical orderptt2008-04-181-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26460 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark phony targets as such.diego2008-04-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26459 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify phony target declaration.diego2008-04-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26458 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Rename remaining instances of $i to $lang.diego2008-04-181-2/+2
| | | | | | | patch by Andrew Savchenko, Bircoph list ru git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26457 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: __asm__ __volatile__ --> asm volatilediego2008-04-171-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26456 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prefer libavformat musepack demuxer over internal one (which does not even ↵reimar2008-04-161-0/+2
| | | | | | support v8). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26455 b3059339-0415-0410-9bf9-f77b7e298cf2
* noconfig fix, disable_gui_conf was not defined when compiling mencoder.albeu2008-04-152-2/+4
| | | | | | | | Fix mencoder linking when the GUI is enabled. Patch by Norman Yarvin (yarvin -at- yarchive -dot- net). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26454 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo: crahes --> crashescorey2008-04-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26453 b3059339-0415-0410-9bf9-f77b7e298cf2
* Refer to where encoding quality is described.corey2008-04-151-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26452 b3059339-0415-0410-9bf9-f77b7e298cf2
* As of r19025, the "above link" refers to an article, not a guide.corey2008-04-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26451 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the indentation after the noconfig patch.albeu2008-04-141-7/+7
| | | | | | | Patch by Andrew Savchenko (Bircoph -at- list -dot- ru). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26450 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10L, forgot to commit the documentation for the -noconfig options.albeu2008-04-141-0/+22
| | | | | | | Patch by Andrew Savchenko (Bircoph -at- list -dot- ru). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26449 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add options to disable some or all config files.albeu2008-04-147-4/+42
| | | | | | | Patch by Andrew Savchenko (Bircoph -at- list -dot- ru). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26448 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for system wide config file in mencoder.albeu2008-04-141-0/+3
| | | | | | | Patch by Andrew Savchenko (Bircoph -at- list -dot- ru). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26447 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux_asf: Fix operator precedence in packet length checkuau2008-04-131-1/+1
| | | | | | | | Change (len & 3-1) to correct ((len & 3) - 1) in packet length check. Also change "a - 1 < b" to simpler "a <= b". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26446 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add libpostproc to list of pseudo-dependencies.diego2008-04-131-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26445 b3059339-0415-0410-9bf9-f77b7e298cf2
* Declare all clean targets phony in mpcommon.mak.diego2008-04-132-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26444 b3059339-0415-0410-9bf9-f77b7e298cf2
* The TAGS and tags targets are not phony.diego2008-04-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26443 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add gui subdirectories to DIRS instead of manually cleaning them.diego2008-04-131-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26442 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace shell for loop by proper make foreach construct.diego2008-04-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26441 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace the trivial command line preparser with a more robust versionalbeu2008-04-137-13/+67
| | | | | | | allowing all kind of options to be used. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26440 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: fix indentationattila2008-04-131-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26439 b3059339-0415-0410-9bf9-f77b7e298cf2
* move the #ifdef HAVE_XINERAMA to enclose the whole functionattila2008-04-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26438 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always calculate the xinerama screen mplayer is on.attila2008-04-131-6/+3
| | | | | | | | Bug reported by thomas.lindroth(<at>)gmail.com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26437 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix DEPEND_CMD, there was one level of variable indirection too much.diego2008-04-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26436 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest FFmpeg changes.diego2008-04-132-11/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26435 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add Makefile variable for DVB OSD menu, saves one ifeq.diego2008-04-132-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26434 b3059339-0415-0410-9bf9-f77b7e298cf2
* in preparation for multi-frontend patch replaced file-static device names ↵nicodvb2008-04-131-17/+28
| | | | | | with sprintf() calls in 2 functions git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26433 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace "all rights reserved" statement with standard GPL license header.diego2008-04-131-5/+16
| | | | | | | Done with the permission of Andreas Ackermann, the author of the file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26432 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore compilation of osdep/mplayer-rc.o.diego2008-04-132-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26431 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set dll_type and rv_handle for drvc.dllzuxy2008-04-131-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26430 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense test/example files as LGPL with Michael's permission.diego2008-04-132-16/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26429 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add Chinese commentzuxy2008-04-131-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26428 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore grayscale decoding support with FFmpeg.diego2008-04-134-2/+15
| | | | | | | Removing support was done due to a silly misunderstanding. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26427 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix MPDEPEND_CMD to work with more than one subdirectory level.diego2008-04-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26426 b3059339-0415-0410-9bf9-f77b7e298cf2
* Backport SSE2-optimized IDCT routines from upstream libmpeg2.diego2008-04-125-4/+530
| | | | | | | Thanks to Alexander Strange for finding and fixing some bugs. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26425 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording improvements suggested by the Wandererdiego2008-04-121-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26424 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed useless parameter :type from -dvbin (the frontend type is reported ↵nicodvb2008-04-121-6/+3
| | | | | | by the card) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26423 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed defunct options :vid and :aid from -dvbin (they were useless from ↵nicodvb2008-04-121-10/+5
| | | | | | the start) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26422 b3059339-0415-0410-9bf9-f77b7e298cf2
* Oops...should be "drv43260.dll" instead of "drv34260.dll"zuxy2008-04-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26421 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetic fix for r26419zuxy2008-04-121-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26420 b3059339-0415-0410-9bf9-f77b7e298cf2
* Dlls can be relocated when loading so rely on filename instead of absolutezuxy2008-04-121-3/+2
| | | | | | | address to check if it's drv43260.dll and hence needs patching. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26419 b3059339-0415-0410-9bf9-f77b7e298cf2
* Indentation fix for r26417zuxy2008-04-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26418 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't print "Could not patch" messages when we haven't actually tried to patch.zuxy2008-04-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26417 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for drvc.dll entries for mingw32zuxy2008-04-121-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26416 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore dependency files.diego2008-04-120-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26415 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make include paths consistent; do not use ../ in them.diego2008-04-1223-88/+89
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26414 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux_real.c: Always use MP_NOPTS_VALUE for unknown ptsuau2008-04-121-1/+1
| | | | | | | | | | demux_real.c still had code that used either 0 or MP_NOPTS_VALUE for unknown timestamps depending on correct_pts setting. It should have been removed in svn commit 25988 "Change to always use MP_NOPTS_VALUE (instead of sometimes 0) for unknown pts.". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26413 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux_mkv.c: Mark some static tables constuau2008-04-121-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26412 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reformat demuxer.cuau2008-04-121-812/+963
| | | | | | | | Indent with "indent -kr -l79 -nut" and fix various suboptimal results by hand. Also remove some commented-out cruft and one unnecessary case of parentheses as in "return (r)". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26411 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove global demuxer_typeuau2008-04-123-3/+1
| | | | | | | It was only used inside one function. Change it to a local variable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26410 b3059339-0415-0410-9bf9-f77b7e298cf2
* subreader.c: remove unused codeuau2008-04-121-25/+0
| | | | | | | Remove code under "#ifdef DUMPSUBS". This code hasn't worked in years. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26409 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove another two useless special-case from flac metadata reading functionreimar2008-04-121-20/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26408 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify: use AV_RB24reimar2008-04-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26407 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless checksreimar2008-04-121-8/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26406 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify (currently disabled) get_flac_metadatareimar2008-04-121-11/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26405 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update include paths to account for build system changes.diego2008-04-127-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26404 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fixesdiego2008-04-121-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26403 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable runtime control for colorful and/or module name outputzuxy2008-04-125-96/+104
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26402 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused function demux_read_data_packuau2008-04-112-18/+0
| | | | | | | | According to VCS history this function has never been used since it was added in 2001... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26401 b3059339-0415-0410-9bf9-f77b7e298cf2
* Makefile: Fix compilation on systems with dvb supportuau2008-04-111-0/+2
| | | | | | | | | | | libmenu/menu_dvbin.c was added to sources if HAVE_DVBIN was defined, even if LIBMENU was not defined. This caused a compilation failure on systems with dvb support unless you ran configure with --enable-menu. Fix by making compilation of menu_dvbin conditional on both HAVE_DVBIN and LIBMENU. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26400 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused make variable.diego2008-04-111-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26399 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge ./gui/Makefile into ./Makefile, one less instance of recursive make.diego2008-04-112-60/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26398 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add gui/ prefix to some #include paths so that compilation from thediego2008-04-1122-54/+53
| | | | | | | top-level source directory does not fail. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26397 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add GUI_GTK make variable.diego2008-04-111-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26396 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo in filenamediego2008-04-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26395 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicate #include.diego2008-04-111-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26394 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update comment to account for renamed header file.diego2008-04-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26393 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split cfg-common.h into two separate header files. It was being included twicediego2008-04-114-350/+348
| | | | | | | | | with different definitions set that activated either the lower or the upper half of the header. The effectively simulated using two different header files. It is more straightforward to split the header instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26392 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ahem, libmenu objects should only be compiled when OSD menu is enabled.diego2008-04-111-10/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26391 b3059339-0415-0410-9bf9-f77b7e298cf2
* vf_pp7 does not depend on libavcodec.diego2008-04-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26390 b3059339-0415-0410-9bf9-f77b7e298cf2
* vf_screenshot depends on libavcodec.diego2008-04-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26389 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused TARGET_WIN32 setting.diego2008-04-111-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26388 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove Win32 linker option for netstream. Other winsock using code does notdiego2008-04-111-4/+0
| | | | | | | | need it, it should be set from configure and the reason why it was set in the first place has been lost in the mists of time. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26387 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a config.mak variable to control compilation of the Win32 GUI.diego2008-04-112-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26386 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused definition.diego2008-04-111-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26385 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for vorbis.acm decoder (used for some implementations of vorbis rtogni2008-04-101-3/+13
| | | | | | | | | in avi) Patch by Zuxy Meng ||| zuxy meng gmail ||| git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26384 b3059339-0415-0410-9bf9-f77b7e298cf2
* if it's 'for lang in...' it's better off to use $$lang as a variable next ;)ptt2008-04-101-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26383 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix illegal identifier: Rename _ftype_t macro to FLOAT_TYPE.diego2008-04-105-73/+92
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26382 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l fix linking after r26378rtogni2008-04-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26381 b3059339-0415-0410-9bf9-f77b7e298cf2
* document ignore optioncompn2008-04-091-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26380 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: libass compilation should be conditional.diego2008-04-091-9/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26379 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename ASS make variable to LIBASS.diego2008-04-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26378 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless #include.diego2008-04-091-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26377 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge libaf/Makefile into Makefile, one less instance of recursive make.diego2008-04-092-43/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26376 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some useless quotes from #error preprocessor directives.diego2008-04-092-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26375 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use quotes instead of angular brackets for local includes.diego2008-04-094-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26374 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle af_ladspa conditional compilation in the usual way.diego2008-04-092-9/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26373 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove -I CFLAGS hack, -I../libavcodec is no longer in CFLAGS.diego2008-04-091-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26372 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not build subrip with debugging symbols.diego2008-04-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26371 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Group dependency declarations together.diego2008-04-091-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26370 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant compilation commands that shadow builtin rules.diego2008-04-091-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26369 b3059339-0415-0410-9bf9-f77b7e298cf2
* List libraries to link to in dependency list.diego2008-04-091-10/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26368 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Add CFLAGS to compilation commands everywhere.diego2008-04-091-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26367 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary ../libmpcodecs/img_format.o from list subrip objects.diego2008-04-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26366 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for latest changes to linking dependencies.diego2008-04-091-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26365 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #includes to pass 'make checkheaders' to codecs.conf.h.diego2008-04-091-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26364 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore osdep/mmap-os2.c compilation, which was accidentally removed.diego2008-04-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26363 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Align columns.diego2008-04-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26362 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix nonsensical license header, mpeg2dec is not GNU Make.diego2008-04-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26361 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split the lavf taglists out of the lavf muxer to allow using libmpmuxalbeu2008-04-095-62/+115
| | | | | | | without libmpdemux. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26360 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split the aac header parsing out of aac demuxer to allow using libmpmuxalbeu2008-04-093-20/+51
| | | | | | | without libmpdemux. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26359 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove the need for code using stream to export an mp_input_check_interrupt()albeu2008-04-095-4/+20
| | | | | | | function. It also removes the compile-time dependency on input. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26358 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make stream independent of libmpdemux, the asf demuxer and streamingalbeu2008-04-093-82/+105
| | | | | | | code share a function and a few definitions. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26357 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge libass/Makefile into Makefile, one less recursive make directory.diego2008-04-082-22/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26356 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Rename some shell variables to give them more descriptive names.diego2008-04-081-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26355 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Merge shell commands into one line.diego2008-04-081-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26354 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not suppress command output.diego2008-04-081-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26353 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge osdep/Makefile into the top-level Makefile, thus getting riddiego2008-04-082-37/+16
| | | | | | | of recursive make in the osdep/ subdirectory. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26352 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move decision about which getch2 and timer file to compile to configure.diego2008-04-082-17/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26351 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move decision about whether or not to compile osdep/mmap_os2.c to configure.diego2008-04-082-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26350 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge simplifications from FFmpeg r12764.diego2008-04-082-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26349 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix FFmpeg DEPEND_CMD to account for latest changes and add MPDEPEND_CMD.diego2008-04-072-3/+5
| | | | | | | | MPlayer needs a slightly modified incantation due to different levels of Makefile indirection. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26348 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with FFmpeg's shiny new non-recursive build system.diego2008-04-072-86/+116
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26347 b3059339-0415-0410-9bf9-f77b7e298cf2
* non-recursive makefilesmru2008-04-071-7/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26346 b3059339-0415-0410-9bf9-f77b7e298cf2
* reset() should not senselessly close and reopenreimar2008-04-071-23/+1
| | | | | | | the device but instead just call flush_audio() git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26345 b3059339-0415-0410-9bf9-f77b7e298cf2
* AUDIO_DRAIN makes no sense directly after openingreimar2008-04-071-2/+2
| | | | | | | the device, but it should be done in uninit. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26344 b3059339-0415-0410-9bf9-f77b7e298cf2
* Build all parts in the libmenu subdirectory nonrecursively.diego2008-04-072-24/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26343 b3059339-0415-0410-9bf9-f77b7e298cf2
* There is no more need to ignore .depend and libinput.a.diego2008-04-070-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26342 b3059339-0415-0410-9bf9-f77b7e298cf2
* According to the Icon Theme Specification icon names should have no extension.diego2008-04-071-1/+1
| | | | | | | | Compare the output of new versions of desktop-file-validate. pointed out by giggz, giggzounet gmail com, in Debian bug #472833. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26341 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of recursive make for the input/ subdirectory.diego2008-04-062-16/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26340 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update Makefile to account for native/RTjpegN.c --> native/rtjpegn.c renaming.diego2008-04-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26339 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use DEPEND_CMD as set by configure to generate dependency information insteaddiego2008-04-061-2/+2
| | | | | | | | of hardcoding a gcc-specific command. This also fixes dependency generation for files in subdirectories. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26338 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l: Revert previous accidental commit.diego2008-04-061-11/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26337 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename RTJPEG files so that filenames consist of lowercase name only.diego2008-04-065-11/+14
| | | | | | | Parts of the build system assume lowercase-only filenames. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26336 b3059339-0415-0410-9bf9-f77b7e298cf2
* add dvcpro 50 in mov fourcc, patch by j _ta_ v2v.cc compn2008-04-061-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26335 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26333Gabrov2008-04-053-8/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26334 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add multiple inclusion guards to help_mp.h.diego2008-04-051-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26333 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the more natural ">" instead of "1>" for stdout redirection.diego2008-04-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26332 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix lots and lots of other demuxers broken by r26301reimar2008-04-059-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26331 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove another useless castreimar2008-04-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26330 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless castreimar2008-04-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26329 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do proper parsing for DVR-MS files, this fixes playback with ffmpeg decoderreimar2008-04-051-0/+6
| | | | | | | and also will create proper files when remuxing into e.g. AVI. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26328 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set demuxer->audio->id to avoid breakage due to r26301reimar2008-04-051-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26327 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set correct codec tag for raw rgb in mov, fixesreimar2008-04-051-0/+6
| | | | | | | http://samples.mplayerhq.hu/mov/rawbgr24.mov git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26326 b3059339-0415-0410-9bf9-f77b7e298cf2
* Export some more information for FFmpeg's buid system.diego2008-04-041-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26325 b3059339-0415-0410-9bf9-f77b7e298cf2
* add switch_aspect cycle wishcompn2008-04-041-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26324 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change I_TYPE -> FF_I_TYPE to fix compilation.iive2008-04-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26323 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change I_TYPE -> FF_I_TYPE to fix compilation.reimar2008-04-031-1/+1
| | | | | | | The whole functionality should probably be used to libavcodec though. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26322 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better mark variables that are changed by the signal handler as volatilereimar2008-04-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26321 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some const qualifiers to reduce warningsuau2008-04-022-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26320 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove now useless PARTS-yes line.diego2008-04-011-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26319 b3059339-0415-0410-9bf9-f77b7e298cf2
* Darwin and Win32 DVD support libs are handled separately, take them backdiego2008-04-011-3/+4
| | | | | | | out of the combined system and DVD header test in the dvdread check. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26318 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialize _dvdread variable to "no" in the dvdread check.diego2008-04-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26317 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless comments from local diff.diego2008-04-012-6/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26316 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix some typos and trailing whitespace in local changes.diego2008-04-013-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26315 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert local changes that pointlessly add #ifdefs all over libmpeg2 to disablediego2008-04-015-117/+27
| | | | | | | | code depending on CPU capabilities. Instead, rely on libmpeg2's builtin CPU capability handling. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26314 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary includesuau2008-04-013-8/+0
| | | | | | | | | | command.c: Don't include libmpcodecs/mp_image.h, libmpdemux/matroska.h mplayer.c: Don't include libmpdemux/matroska.h matroska.h: Remove declaration of already removed function demux_mkv_change_subs and stop including demuxer.h git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26313 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not #include libavutil/common.h. It is not used directly and mpbswap.hdiego2008-04-017-7/+0
| | | | | | | now #includes all required headers on its own. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26312 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ahem, fix quoting of $ in DEPEND_CMD.diego2008-03-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26311 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add DEPEND_CMD to config.mak (sync with FFmpeg).diego2008-03-311-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26310 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename HAVE_XVMC_ACCEL to HAVE_XVMC for consistency and to sync with FFmpeg.diego2008-03-311-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26309 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Group all FFmpeg settings together in config.mak.diego2008-03-311-43/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26308 b3059339-0415-0410-9bf9-f77b7e298cf2
* HAVE_MLIB was renamed to CONFIG_MLIB in FFmpeg.diego2008-03-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26307 b3059339-0415-0410-9bf9-f77b7e298cf2
* We currently use %U as argument to the Exec entry to indicate that gmplayerdiego2008-03-311-1/+1
| | | | | | | | | | | | handles URLs. However, gmplayer fails to open files with spaces in the filename when launched from a file manager in this way. Changing %U to %F works around this issue successfully while still working with URLs. While this may not be a completely satisfactory solution, it is already deployed in distributions and a better solution is unlikely to appear. patch by Andrew Strong, andrew.david.45 gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26306 b3059339-0415-0410-9bf9-f77b7e298cf2
* command.h: Remove unnecessary includesuau2008-03-311-3/+3
| | | | | | | | | | Remove #include of "mp_core.h" and "input/input.h". Their only use was that functions declared in command.h took pointers to structs defined in those headers. Declare the structs directly as incomplete types instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26305 b3059339-0415-0410-9bf9-f77b7e298cf2
* mp_core.h: Fix use of 'mp_image_t' without definitionuau2008-03-311-1/+1
| | | | | | | | | | | | | A field under #ifdef USE_DVDNAV had type "mp_image_t *', but a definition of the type was not included. Fix by changing the type to "struct mp_image_s *". This probably started causing visible compilation failures after '#include "command.h"' was added to command.c, as that led to mp_core.h being included earlier. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26304 b3059339-0415-0410-9bf9-f77b7e298cf2
* Case insensitive parsing of SSA/ASS section headers.eugeni2008-03-301-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26303 b3059339-0415-0410-9bf9-f77b7e298cf2
* Skip BOM at the beginning of text in ASS parser.eugeni2008-03-301-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26302 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support 'default' attribute for audio and subtitle tracks.eugeni2008-03-308-0/+49
| | | | | | | | | The first default track is chosen for playback if language-based selection failes. Additionally, for audio tracks, the first one is chosen if there are no default tracks at all. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26301 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix wrong #endif comment.diego2008-03-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26300 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix possible integer overflow in malloc by using calloc instead.reimar2008-03-291-1/+2
| | | | | | | Should fix CVE-2008-0073 as far as MPlayer is affected by this problem. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26299 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26297ptt2008-03-281-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26298 b3059339-0415-0410-9bf9-f77b7e298cf2
* compacted new libavformat's 'ipod' descriptionptt2008-03-281-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26297 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle property commands in idle mode.reimar2008-03-281-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26296 b3059339-0415-0410-9bf9-f77b7e298cf2
* Include some .h files in corresponding .c filesuau2008-03-283-0/+3
| | | | | | | | | Include the corresponding .h file in command.c, parser-cfg.c and parser-mpcmd.c. This allows the compiler to check that the declarations in the .h file match the actual defition. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26295 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26073ptt2008-03-271-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26294 b3059339-0415-0410-9bf9-f77b7e298cf2
* it's synced with r23520ptt2008-03-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26293 b3059339-0415-0410-9bf9-f77b7e298cf2
* it's synced with r26258ptt2008-03-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26292 b3059339-0415-0410-9bf9-f77b7e298cf2
* it's synced with r24035ptt2008-03-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26291 b3059339-0415-0410-9bf9-f77b7e298cf2
* it's synced with r25566ptt2008-03-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26290 b3059339-0415-0410-9bf9-f77b7e298cf2
* it's synced with 26146ptt2008-03-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26289 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 23516 (it was already ok)ptt2008-03-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26288 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove excessive space characterptt2008-03-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26287 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar fixptt2008-03-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26286 b3059339-0415-0410-9bf9-f77b7e298cf2
* 38% synced with r22753ptt2008-03-271-81/+82
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26285 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: prettyprintingdiego2008-03-271-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26284 b3059339-0415-0410-9bf9-f77b7e298cf2
* some more DragonFly BSD changes, patch by Hasso Tepper, hasso estpak eediego2008-03-271-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26283 b3059339-0415-0410-9bf9-f77b7e298cf2
* better explanation and grammar fixptt2008-03-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26282 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar fixptt2008-03-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26281 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for DragonFly BSD, patch by Hasso Tepper, hasso estpak eediego2008-03-271-7/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26280 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove bsd() system check. Lumping different *BSD systems together likediego2008-03-271-7/+7
| | | | | | | | that was not a good idea in the first place. They are too different and constantly diverging. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26279 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with FFmpeg r12599diego2008-03-261-14/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26278 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Reindent X11 header search section after last commit.diego2008-03-261-8/+8
| | | | | | | patch by Guillaume Lecerf, foxcore gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26277 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not look for X11 headers on the host when cross-compiling.diego2008-03-261-0/+2
| | | | | | | patch by Guillaume Lecerf, foxcore gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26276 b3059339-0415-0410-9bf9-f77b7e298cf2
* Classify mlib as a configurable option, not as a hardware feature.diego2008-03-251-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26275 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26271ptt2008-03-251-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26274 b3059339-0415-0410-9bf9-f77b7e298cf2
* add "ipod" to the list of formats handled by lavfgpoirier2008-03-251-0/+3
| | | | | | | Patch by Mark Himsley %mark A mdsh P com% git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26273 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add FFmpeg Mimic decoder.diego2008-03-251-0/+6
| | | | | | | patch by Ramiro Polla, ramiro lisha ufsc br git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26272 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention that '-frames 0' is useful with -identify, closes bug #1046.diego2008-03-241-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26271 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 64 bit shared library compilation with MMX2 by properly using PIC mangling.diego2008-03-221-8/+8
| | | | | | | patch by Alexander Strange, astrange ithinksw com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26270 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: comment typo fixesdiego2008-03-221-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26269 b3059339-0415-0410-9bf9-f77b7e298cf2
* better wordingptt2008-03-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26268 b3059339-0415-0410-9bf9-f77b7e298cf2
* add complete fifo instructions, user didnt know to use mkfifo first.compn2008-03-211-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26267 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore if we fail to get disc key, fixes playback of one of my DVDs whichreimar2008-03-211-4/+2
| | | | | | | | claims to be scrambled but actually is not, and always allows to fallback to cached keys. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26266 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26260ptt2008-03-191-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26265 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant ARCH_POWERPC #ifdef around HAVE_ALTIVEC.diego2008-03-181-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26264 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move sub_utf8_prev declaration out of the DUMPSUBS #ifdef.diego2008-03-181-1/+1
| | | | | | | This helps compilation if DUMPSUBS is defined. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26263 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compilation fix.eugeni2008-03-181-0/+13
| | | | | | | Since FFmpeg r12484, libswscale requires EXTERN_PREFIX defined. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26262 b3059339-0415-0410-9bf9-f77b7e298cf2
* another DCA audio identified (0x86) used in BD; patch by kirill belokurov ↵nicodvb2008-03-171-0/+1
| | | | | | gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26261 b3059339-0415-0410-9bf9-f77b7e298cf2
* Experimental support for -framedrop with -correct-pts.reimar2008-03-172-23/+31
| | | | | | | | The code is not really correct, but it is very little and works "well enough" to be useful in my tests. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26260 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make FFmpeg mpeg1/2 decoder the default over libmpeg2reimar2008-03-171-22/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26259 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix typo: lavcoptc --> lavcoptsdiego2008-03-175-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26258 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a typo that causes an assertion to always fail.zuxy2008-03-171-1/+1
| | | | | | | Reported by Alexander Bokovikov (openworld AT uralweb DOT ru) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26257 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix missed part of previous sync.voroshil2008-03-161-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26256 b3059339-0415-0410-9bf9-f77b7e298cf2
* r26072: removed nonsense in the dvbin sectionvoroshil2008-03-161-3/+5
| | | | | | | r26073: warn to always include PMT and PCR pids in channels.conf (dvb) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26255 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync tag updatevoroshil2008-03-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26254 b3059339-0415-0410-9bf9-f77b7e298cf2
* r25994: typo fix: inited --> initializedvoroshil2008-03-161-1/+2
| | | | | | | r26067: Check glyph bounding box before rasterizing and complain if it is too large. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26253 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26251Gabrov2008-03-162-15/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26252 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2008-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26251 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused MACOSX definition.diego2008-03-151-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26250 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use HAVE_QUICKTIME instead of MACOSX preprocessor condition.diego2008-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26249 b3059339-0415-0410-9bf9-f77b7e298cf2
* Introduce HAVE_QUICKTIME definition and use it where appropriate.diego2008-03-153-12/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26248 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove the unused function roundToInt16. It is a duplicate of the same functiondiego2008-03-151-7/+0
| | | | | | | | in swscale.c. Fixes the warning: yuv2rgb_altivec.c:751: 'roundToInt16' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26247 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use __AMIGAOS4__ instead of AMIGA, like everywhere else.diego2008-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26246 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a separate definition for quartz.diego2008-03-152-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26245 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Really disable coreaudio where intended.diego2008-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26244 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use __APPLE__ instead of MACOSX as preprocessor condition.diego2008-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26243 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not disable all Mac OS X support when pthreads are unavailable.diego2008-03-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26242 b3059339-0415-0410-9bf9-f77b7e298cf2
* MACOSX_COREVIDEO --> corevideodiego2008-03-152-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26241 b3059339-0415-0410-9bf9-f77b7e298cf2
* Introduce a separate definition for Mac OS X coreaudio support.diego2008-03-152-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26240 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix wrong res_comment.diego2008-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26239 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify preprocessor condition for QT codecs, configure already does thediego2008-03-152-2/+2
| | | | | | | necessary checks, no need to duplicate them. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26238 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicate #include of mpbswap.h.diego2008-03-141-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26237 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add FFmpeg DNxHD codec supportreimar2008-03-141-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26236 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include config.h before all other headers.diego2008-03-1430-37/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26235 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26232ptt2008-03-141-13/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26234 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26014ptt2008-03-131-28/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26233 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing escapesptt2008-03-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26232 b3059339-0415-0410-9bf9-f77b7e298cf2
* better syntax for A keyptt2008-03-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26231 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync'ed to r26067ptt2008-03-131-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26230 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed an english line left inptt2008-03-131-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26229 b3059339-0415-0410-9bf9-f77b7e298cf2
* typosdiego2008-03-122-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26228 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix and simplify lscale=2 (bicub_x) scaler, produced funnyreimar2008-03-121-7/+7
| | | | | | | noise on ATI cards due to cdelta.y never being set. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26227 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed redundant wincfg.h.vayne2008-03-111-40/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26226 b3059339-0415-0410-9bf9-f77b7e298cf2
* more header / declaration cleanups; fixes a lot of warnings as well as a ↵vayne2008-03-117-13/+8
| | | | | | preempt to removal of redundant wincfg.h. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26225 b3059339-0415-0410-9bf9-f77b7e298cf2
* 34% synced with r22753ptt2008-03-111-176/+177
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26224 b3059339-0415-0410-9bf9-f77b7e298cf2
* mingw uses windows sockets.vayne2008-03-111-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26223 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix handling of comments in input.c, current code had useless ifs and in ↵reimar2008-03-111-4/+2
| | | | | | | | | addition could treat more data as comments than correct. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26222 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try to fix the description of what mbcmp influences, please fix if I ↵reimar2008-03-111-1/+4
| | | | | | misunderstood the code. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26221 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark Y variable in EPILOG macro as av_unused to avoid unused variable warnings.diego2008-03-111-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26220 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #include.diego2008-03-101-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26219 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-101-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26218 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with FFmpeg r12398diego2008-03-101-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26217 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-1014-0/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26216 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless #include.diego2008-03-101-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26215 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #include to fix 'make checkheaders'.diego2008-03-101-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26214 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_export.c is only compiled if HAVE_SYS_MMAN_H is set, so using thatdiego2008-03-101-2/+0
| | | | | | | #ifdef within the file is pointless git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26213 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2008-03-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26212 b3059339-0415-0410-9bf9-f77b7e298cf2
* CONFIG_SWSCALER --> CONFIG_SWSCALE to match FFmpeg changes.diego2008-03-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26211 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make av_class a pointer to const.benoit2008-03-102-2/+2
| | | | | | | Patch by Takis. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26210 b3059339-0415-0410-9bf9-f77b7e298cf2
* define VOF as double of VOFW.benoit2008-03-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26209 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable QTX emulation on win32; fix builds on cygwin and mingw32.zuxy2008-03-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26208 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant swScaler: output from places where av_log()diego2008-03-101-4/+4
| | | | | | | properly prints the context anyway. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26207 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix wrong check for vidix usage.iive2008-03-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26206 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't use void * arithmetic.iive2008-03-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26205 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle vga_init() error and output error message.iive2008-03-091-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26204 b3059339-0415-0410-9bf9-f77b7e298cf2
* CONFIG_PP --> CONFIG_POSTPROC, sync with FFmpegdiego2008-03-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26203 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move HP-UX SCSI header check from the internal libdvdread check to thediego2008-03-081-2/+2
| | | | | | | internal libdvdcss check, where it is really used. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26202 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove useless empty line.diego2008-03-081-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26201 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Consistently move NAME and FFLIBS to the top of each Makefile.diego2008-03-081-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26200 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove duplicated pci ids in nvidia vidix driverben2008-03-081-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26199 b3059339-0415-0410-9bf9-f77b7e298cf2
* Grayscale encoding/decoding with FFmpeg is no longer enabled, remove referencesdiego2008-03-074-14/+3
| | | | | | | from the documentation and the relevant options from the glue code. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26198 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-071-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26197 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-072-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26196 b3059339-0415-0410-9bf9-f77b7e298cf2
* This header uses parts of stdint.h, so #include it.diego2008-03-071-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26195 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-076-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26194 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplify library version handlingmru2008-03-071-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26193 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary #ifdef nesting.diego2008-03-071-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26192 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Decrapify the indentation of the last few blocks of main().diego2008-03-071-68/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26191 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add parentheses where necessary to fix || conditions to work as intended.diego2008-03-071-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26190 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicate conditions in dvdread check.diego2008-03-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26189 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set ASFLAGS in configure and initialize it as necessary for OS/2.diego2008-03-071-0/+2
| | | | | | | patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26188 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with FFmpeg r12354diego2008-03-071-9/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26187 b3059339-0415-0410-9bf9-f77b7e298cf2
* consolidate CFLAGS, LDFLAGS, EXTRALIBS assignmentmru2008-03-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26186 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26067, patch by JRaSH jrash06 A 163 P comgpoirier2008-03-061-22/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26185 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26057, patch by JRaSH jrash06 A 163 P comgpoirier2008-03-061-7/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26184 b3059339-0415-0410-9bf9-f77b7e298cf2
* change sws_format_name to return const char*, supress many warningsbcoudurier2008-03-063-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26183 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove redundant SwScaler text since av_log uses AVClass contextbcoudurier2008-03-062-39/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26182 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some more paths to find tools on Slackware 12.diego2008-03-061-1/+3
| | | | | | | based on a patch by andrew, andrew.david.45 gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26181 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix printf format string mismatch, eliminates the warning:diego2008-03-061-1/+1
| | | | | | | ve_vfw.c:252: warning: format '%d' expects type 'int', but argument 2 has type 'long int' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26180 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add necessary header #includes to fix 'make checkheaders'.diego2008-03-0610-0/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26179 b3059339-0415-0410-9bf9-f77b7e298cf2
* ve_vfw.c: #include aviheader.h instead of wine avifmt.huau2008-03-061-1/+1
| | | | | | | | | | | | | | | | | | Compilation was broken after libmpdemux/muxer.h started including libmpdemux/aviheader.h. ve_vfw.c included both muxer.h and loader/wine/avifmt.h, and the latter has definitions that conflict with aviheader.h ones. Fix by removing the avifmt.h include. I did not carefully check that changing the includes doesn't break any ve_vfw.c code. However it at least fixes compilation, and if the avifmt.h versions differ in some significant way then the code is fundamentally broken anyway: ve_vfw cannot use different versions of the avi struct definitions when it also uses shared muxer.h types (those must use the standard definitions to keep the type compatible with what's used in other files). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26178 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable S3 VIDIX driver on non-x86 platforms.diego2008-03-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26177 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: ENABLE_GRAY needs to be present for libavcodec to compile.diego2008-03-061-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26176 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-059-0/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26175 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not enable grayscale decoding in FFmpeg, it slows down thediego2008-03-051-3/+0
| | | | | | | default (color) case. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26174 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add ENABLE_DECODERS/ENABLE_DEMUXERS alongside CONFIG_DECODERS/CONFIG_DEMUXERSdiego2008-03-051-0/+2
| | | | | | | in config.h. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26173 b3059339-0415-0410-9bf9-f77b7e298cf2
* Yet another hdv fourccreimar2008-03-051-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26172 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-052-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26171 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-058-0/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26170 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename url.c/url.h to the less generic gtk_url.c/gtk_url.h.diego2008-03-054-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26169 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-053-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26168 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency cosmetics: Use #ifdef everywhere instead of #if defined().diego2008-03-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26167 b3059339-0415-0410-9bf9-f77b7e298cf2
* One more (forgotten) fix for fixing sws_flags.michael2008-03-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26166 b3059339-0415-0410-9bf9-f77b7e298cf2
* Turn ancient V offset numerical constants into named ones.michael2008-03-053-72/+81
| | | | | | | | Add a check that checks that the width is within the chosen constant. This might have been exploitable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26165 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix ffvorbis decoder's output channel order with channel reordering function.ulion2008-03-053-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26164 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add necessary #includes to pass 'make checkheaders'.diego2008-03-0411-1/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26163 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move duplicated extern declarations of mp_msg_levels and mp_msg_level_alldiego2008-03-043-6/+3
| | | | | | | to cfg-common.h where they are really needed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26162 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless extern keyword from function declaration.diego2008-03-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26161 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include parser-cfg.h instead of declaring m_config_parse_config_file extern.diego2008-03-041-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26160 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless extern keyword from function declaration.diego2008-03-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26159 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add comments to #endif preprocessor directives.diego2008-03-043-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26158 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify preprocessor conditionals: USE_LIBAV* is defined when compilingdiego2008-03-042-5/+5
| | | | | | | against both shared and static libraries. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26157 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless #ifdef USE_LIBAVCODEC inside #ifdef USE_LIBAVCODEC.diego2008-03-041-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26156 b3059339-0415-0410-9bf9-f77b7e298cf2
* search channels.conf in mplayer's instdir if all other searches fail; patch ↵nicodvb2008-03-031-0/+6
| | | | | | by foxcore gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26155 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove ugly workaround for conflicting dca.h headers, it is no longerdiego2008-03-031-3/+0
| | | | | | | necessary now that -I../libavcodec is not in CFLAGS anymore. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26154 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only demux_lavf.o explicitly needs -I../libavcodec in CFLAGS.diego2008-03-032-1/+2
| | | | | | | Thus there is no need to use it everywhere. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26153 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add directory names to libavcodec #includes.diego2008-03-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26152 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary addition of -Ilibavformat to CFLAGS.diego2008-03-031-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26151 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: prettyprinting and alphabetical orderdiego2008-03-031-3/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26150 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move decision about whether or not to compile Windows emulationdiego2008-03-032-3/+3
| | | | | | | infrastructure to configure. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26149 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move decision about whether or not to compile wrapper.S to configure.diego2008-03-032-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26148 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add CFLAG_STACKREALIGN unconditionally to win32.o CFLAGS, configure takes carediego2008-03-031-2/+1
| | | | | | | of setting it only when necessary anyway. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26147 b3059339-0415-0410-9bf9-f77b7e298cf2
* replace all occurences of "M$" by "Microsoft" because it's what we really ↵gpoirier2008-03-037-7/+7
| | | | | | meant, and "M$" nickname is quite childish git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26146 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add checkheaders target, ported from FFmpeg.diego2008-03-031-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26145 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add ID_SEEKABLE information to -identify output.diego2008-03-031-0/+1
| | | | | | | patch by Mathieu SCHROETER, mathieu.schroeter gamesover ch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26144 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include osdep/mman.h if sys/mman.h is not available.diego2008-03-034-0/+8
| | | | | | | patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26143 b3059339-0415-0410-9bf9-f77b7e298cf2
* configure: Set CONFIG_ENCODERS=yes in config.mak unconditionallyuau2008-03-031-1/+1
| | | | | | | | | | | | config.h already had "#define CONFIG_ENCODERS 1" unconditionally, but the config.mak value depended on whether MEncoder was enabled. Encoders need to be enabled as some encoder code is used by MPlayer too. The inconsistent values broke compilation with --disable-mencoder after libavcodec Makefile made compilation of i386/dsputilenc_mmx.o depend on the config.mak value. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26142 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert fixing illegal identifiers to fix compilation on MinGW. Unfortunatelydiego2008-03-023-21/+21
| | | | | | | | these identifiers appear in Windows system headers and are thus outside our direct control. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26141 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix comment, qclp fourcc is Qclp not QCLPreimar2008-03-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26140 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26138Gabrov2008-03-013-12/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26139 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix illegal identifiers starting with _ and capital letters.diego2008-03-013-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26138 b3059339-0415-0410-9bf9-f77b7e298cf2
* Wrap '#include <sys/mman.h>' in HAVE_SYS_MMAN_H.diego2008-03-016-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26137 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace __MINGW32__ preprocessor check with proper HAVE_SYS_MMAN_H check.diego2008-03-012-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26136 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove va_start/vsnprintf workaround for OS/2.diego2008-03-011-8/+0
| | | | | | | patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26135 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge two #ifdefs.diego2008-03-011-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26134 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: reindent, detabifydiego2008-03-011-44/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26133 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicate extern declaration.diego2008-03-011-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26132 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix bad function prototypeben2008-02-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26131 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove now deprecated Savage VIDIX driver sourcesben2008-02-292-1650/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26130 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use MPlayer consistent define naming convention for newly introduceben2008-02-291-3/+3
| | | | | | | | S3 registers header file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26129 b3059339-0415-0410-9bf9-f77b7e298cf2
* New S3 VIDIX driver.ben2008-02-295-10/+1153
| | | | | | | | | | Provides support for S3 Trio and S3 Virge chipsets. This deprecates the old Savage driver that worked with latest chips only. (synchronized with vidix.sf.net r326 and r327) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26128 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include.eugeni2008-02-291-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26127 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support switching to/from nosound in demux_lavf.eugeni2008-02-291-14/+8
| | | | | | | | Also fixes a bug when pstreams[-1] could be accessed. It happens when switching audio tracks if mplayer was run with '-nosound'. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26126 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused function.eugeni2008-02-291-20/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26125 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindent.eugeni2008-02-291-18/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26124 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't select audio stream in lavf and mkv demuxers.eugeni2008-02-292-13/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26123 b3059339-0415-0410-9bf9-f77b7e298cf2
* Select audio stream in mplayer and mencoder, overriding demuxer decision.eugeni2008-02-294-0/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26122 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set audio->sh correctly when switching audio tracks. The same for video tracks.eugeni2008-02-291-0/+8
| | | | | | | | | Demuxers almost never update audio->sh or sub->sh when swithing tracks. It is especially bad when switching to no sound, and results in "too many audio packets" error. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26121 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't select subtitle track in lavf and mkv demuxers.eugeni2008-02-293-32/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26120 b3059339-0415-0410-9bf9-f77b7e298cf2
* Demuxer-independent subtitle track selection.eugeni2008-02-292-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26119 b3059339-0415-0410-9bf9-f77b7e298cf2
* Demuxer-independent functions for selecting tracks based on language.eugeni2008-02-292-0/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26118 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove stupid checks of free() argument.eugeni2008-02-292-28/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26117 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fill sh_sub_t.lang in lavf, mkv and ogg demuxers. Use it for printing subtitleeugeni2008-02-296-66/+15
| | | | | | | track language. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26116 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fill sh_audio_t.lang in lavf and mkv demuxers. Use it for printing audio trackeugeni2008-02-294-25/+7
| | | | | | | language when available. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26115 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add language info to sh_sub_t and sh_audio_t.eugeni2008-02-292-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26114 b3059339-0415-0410-9bf9-f77b7e298cf2
* Attempt to fix -chapter broken for mkv in r25987reimar2008-02-282-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26113 b3059339-0415-0410-9bf9-f77b7e298cf2
* joystick.c is only ever compiled on Linux, remove pointless #ifdefdiego2008-02-281-17/+0
| | | | | | | around the whole file and dummy functions. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26112 b3059339-0415-0410-9bf9-f77b7e298cf2
* TARGET_OS2 is never set, use __OS2__ instead.diego2008-02-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26111 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use _res_comment in joystick check.diego2008-02-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26110 b3059339-0415-0410-9bf9-f77b7e298cf2
* cache support for OS/2diego2008-02-281-17/+34
| | | | | | | patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26109 b3059339-0415-0410-9bf9-f77b7e298cf2
* mmap() support for OS/2diego2008-02-273-0/+269
| | | | | | | patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26108 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention nvidia fix for vo gl and especially changed screensaver supportreimar2008-02-261-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26107 b3059339-0415-0410-9bf9-f77b7e298cf2
* Default to disabling VIDIX on platforms where it is not known to work.diego2008-02-261-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26106 b3059339-0415-0410-9bf9-f77b7e298cf2
* less preprocessor magic in version number macrosmru2008-02-261-4/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26105 b3059339-0415-0410-9bf9-f77b7e298cf2
* configure: define ENABLE_ENCODERS for FFmpeguau2008-02-261-0/+1
| | | | | | | | | Compilation was broken as FFmpeg's dsputil_mmx.c now (ab)uses this variable. Fix by adding "#define ENABLE_ENCODERS 1" to generated config.h. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26104 b3059339-0415-0410-9bf9-f77b7e298cf2
* in ds_fill_buffer() disabled the code that demuxes until the arrival of the ↵nicodvb2008-02-251-0/+2
| | | | | | right reference_clock git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26103 b3059339-0415-0410-9bf9-f77b7e298cf2
* sun rasterfile decodercompn2008-02-252-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26102 b3059339-0415-0410-9bf9-f77b7e298cf2
* FFmpeg now uses different (unified) #include paths.diego2008-02-2529-144/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26101 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Revert nonsense commit.diego2008-02-251-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26100 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix outdated comment.diego2008-02-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26099 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove old EMU_OLD cruft.diego2008-02-251-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26098 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include "libavutil/avutil.h" in swscale.hmru2008-02-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26097 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace silly check for config.h inclusion, just include it.diego2008-02-241-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26096 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable internal VIDIX on OS/2, patch by Dave Yeo, dave.r.yeo gmail com.diego2008-02-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26095 b3059339-0415-0410-9bf9-f77b7e298cf2
* Wrap HAVE_XXX macros with RUNTIME_CPUDETECT, because when RUNTIME_CPUDETECT isdiego2008-02-241-0/+2
| | | | | | | | enabled, checking HAVE_XXX and disabling that CPU feature is meaningless. patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26094 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable SSE detection on OS/2.diego2008-02-241-1/+35
| | | | | | | patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26093 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Break one unreadable long line.diego2008-02-241-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26092 b3059339-0415-0410-9bf9-f77b7e298cf2
* __asm __volatile -> asm volatile part 3reimar2008-02-242-85/+85
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26091 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compile codec-cfg binary with -O, avoids problems due to compilersreimar2008-02-241-1/+1
| | | | | | | | not being well tested with optimizations disabled (e.g. ICC 10.1.008 generates a non-existing "rorw $8, %st(7)" instruction). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26090 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add MPLAYER_ prefix to multiple inclusion guard of generated file.diego2008-02-241-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26089 b3059339-0415-0410-9bf9-f77b7e298cf2
* On OS/2, fall back on the directory where MPlayer is installed if both diego2008-02-241-0/+24
| | | | | | | | MPLAYER_HOME and HOME are not set. patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26088 b3059339-0415-0410-9bf9-f77b7e298cf2
* On Win32 and OS/2, 'x:filename' path style without '\' path separatordiego2008-02-241-1/+2
| | | | | | | | | is possible as well as 'x:\dir\filename' style. So we should check ':' unless '\' is found. patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26087 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #includes for Mac OS X, fixes the warningdiego2008-02-241-0/+5
| | | | | | | | ldt_keeper.c:243: warning: implicit declaration of function i386_set_ldt patch by Elias Pipping, elias pipping org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26086 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add #include <sys/sysctl.h> for Mac OS X, fixes the warningdiego2008-02-241-1/+1
| | | | | | | | cpudetect.c:344: warning: implicit declaration of function sysctlbyname patch by Elias Pipping, elias pipping org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26085 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use a global temps variable, this is ugly and does not compile with ICC.reimar2008-02-241-39/+40
| | | | | | | Place them on the stack instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26084 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid a pointless special-case for opening a filereimar2008-02-241-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26083 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of pointless and confusing commentsreimar2008-02-241-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26082 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only icc 10.1 will be supported.cehoyos2008-02-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26081 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for -mno-omit-leaf-frame-pointer (compilation fix for icc 10.1.012).cehoyos2008-02-242-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26080 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove mistakenly committed hunk.diego2008-02-231-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26079 b3059339-0415-0410-9bf9-f77b7e298cf2
* Properly detect ARM mc acceleration.diego2008-02-233-7/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26078 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add MPLAYER_ prefix to multiple inclusion guards.diego2008-02-2360-194/+196
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26077 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge two #ifdefs into one.diego2008-02-232-9/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26076 b3059339-0415-0410-9bf9-f77b7e298cf2
* #define ATTRIBUTE_ALIGNED_MAX in config.h instead of hardcoding it.diego2008-02-233-12/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26075 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move libdca definition to a better place in config.h.diego2008-02-231-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26074 b3059339-0415-0410-9bf9-f77b7e298cf2
* warn to always include PMT and PCR pids in channels.conf (dvb)nicodvb2008-02-231-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26073 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed nonsense in the dvbin sectionnicodvb2008-02-231-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26072 b3059339-0415-0410-9bf9-f77b7e298cf2
* reset_fifos() resets demuxer->reference_clock to MP_NOPTS_VALUEnicodvb2008-02-231-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26071 b3059339-0415-0410-9bf9-f77b7e298cf2
* read the PCR of the currently playing program (if available) in ↵nicodvb2008-02-231-3/+45
| | | | | | demuxer->reference_clock git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26070 b3059339-0415-0410-9bf9-f77b7e298cf2
* New member in demuxer_t: reference_clock.nicodvb2008-02-232-0/+10
| | | | | | | | | | | | | If it's != MP_NOPTS_VALUE ds_fill_buffer() will keep on demuxing until the pts of the next_pts is <= reference_clock. It guarantees the compliance with the buffering model indicated by the transmitter of the multiplex and a long-time stability of playback (at least for me). In any case up to a maximum of 64 packets are accumulated to prevent memory hogging and leaks. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26069 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment out dump_glyph(): it is unused and, as it is now, breaks compilation.eugeni2008-02-222-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26068 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check glyph bounding box before rasterizing and complain if it is too large.eugeni2008-02-222-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26067 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some debugging routines.eugeni2008-02-222-0/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26066 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better handling of behind-the-camera objects.eugeni2008-02-221-2/+3
| | | | | | | | | Every point that is behind the camera is moved to the clipping plane by orthographic projection. It is obviously incorrect, but this is a very rare case, and proper clipping of Bezier curves is not that easy. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26065 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print FreeType version in libass init. Makes error logs slightly more helpful.eugeni2008-02-221-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26064 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add MPLAYER_ prefix to the multiple inclusion guards of generated header files.diego2008-02-221-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26063 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add MPLAYER_ prefix to multiple inclusion guards.diego2008-02-2224-72/+74
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26062 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add MPLAYER_ prefix to multiple inclusion guards.diego2008-02-22194-618/+589
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26061 b3059339-0415-0410-9bf9-f77b7e298cf2
* Discard two symbols from libswscale.cehoyos2008-02-225-23/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26060 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix continuous scrolling on OS/2 due to status line updates unless -quietdiego2008-02-221-1/+1
| | | | | | | | | option is specified. The problem is similar on Windows, so share the same workaround for both systems. patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26059 b3059339-0415-0410-9bf9-f77b7e298cf2
* Create standard multiple inclusion guards.diego2008-02-211-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26058 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix copy&paste typo in rgbtest documentationreimar2008-02-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26057 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove misplaced #endif comment.diego2008-02-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26056 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26052gpoirier2008-02-211-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26055 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/ r26019gpoirier2008-02-211-2/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26054 b3059339-0415-0410-9bf9-f77b7e298cf2
* improve DTD dection of MacPort-install docbook packagegpoirier2008-02-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26053 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document rgbtest argumentsreimar2008-02-211-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26052 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace Alpha MVI compiler workarounds by a proper configure check.diego2008-02-215-76/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26051 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use standard multiple inclusion guard.diego2008-02-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26050 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused #define from config.h.diego2008-02-211-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26049 b3059339-0415-0410-9bf9-f77b7e298cf2
* OS/2 getch2() supportdiego2008-02-214-5/+212
| | | | | | | patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26048 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename mp_input_win32_slave_cmd_func to mp_input_slave_cmd_func.diego2008-02-213-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26047 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix r26032: wrong sub stream id assigned to dvdsub_id.eugeni2008-02-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26046 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add multiple inclusion guard.diego2008-02-211-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26045 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing multiple inclusion guards.diego2008-02-215-0/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26044 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use filename as multiple inclusion guard.diego2008-02-214-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26043 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r25566, patch by mesecam %mesecam A gmail P com%gpoirier2008-02-201-19/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26042 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r25308, patch by mesecam %mesecam A gmail P com %gpoirier2008-02-201-46/+691
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26041 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation with ASS disabledreimar2008-02-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26040 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless #ifdefs around extern declarations.diego2008-02-2012-126/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26039 b3059339-0415-0410-9bf9-f77b7e298cf2
* vf_sab mirrors coefficients past the edge of the picture instead of cropping:diego2008-02-201-3/+3
| | | | | | | | | | | if (iy<0) iy= -iy; if(iy>=h) iy= h-iy-1; This produces -1,-2,-3... as it goes further past the end of an image, which crashes. Change this to h-1,h-2,h-3.. to avoid the crash. patch by Alexander Strange, astrange ithinksw com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26038 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for DOS-style file:///x:/path paths.diego2008-02-201-0/+6
| | | | | | | patch by KO Myung-Hun, komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26037 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move definitions to a more standard place.diego2008-02-191-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26036 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add standard license header and make copyright notices consistent.diego2008-02-1911-79/+206
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26035 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clean up lib* version definitionsmru2008-02-191-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26034 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r24342, patch by jfallah mesecam at gmail dot comgpoirier2008-02-191-84/+105
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26033 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support -slang in lavf demuxer.eugeni2008-02-191-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26032 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fill stream->end_pos if possible, fixing lavf demuxers that need to seek.albeu2008-02-191-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26031 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fixes, port of my patch for upstream libmpeg2diego2008-02-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26030 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix illegal identifiers, port of my patch to upstream libmpeg2.diego2008-02-191-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26029 b3059339-0415-0410-9bf9-f77b7e298cf2
* Refactor AltiVec macros as done for FFmpeg.diego2008-02-181-14/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26028 b3059339-0415-0410-9bf9-f77b7e298cf2
* Refactor AltiVec macros as done for FFmpeg.diego2008-02-182-35/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26027 b3059339-0415-0410-9bf9-f77b7e298cf2
* This header should not have multiple inclusion guards, it is meantdiego2008-02-181-4/+3
| | | | | | | | to be included multiple times. patch by Alexander Stege mplayer a legale-software d com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26026 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: indent, remove trailing whitespacediego2008-02-181-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26025 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge the two conditional definitions of get_current_dir_name.diego2008-02-181-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26024 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r26017gpoirier2008-02-181-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26023 b3059339-0415-0410-9bf9-f77b7e298cf2
* basic support for OS/2 in configurediego2008-02-181-3/+21
| | | | | | | patch by KO Myung-Hun, komh a chollian d net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26022 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set SYS_BEOS for libdvdcss compilation on BeOS.diego2008-02-181-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26021 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow specifying a size for -vf rgbtestreimar2008-02-171-6/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26020 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document af-*, copied from vf-*reimar2008-02-171-0/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26019 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make -af-pre, -af-add, -af-del and -af-clr available.reimar2008-02-171-1/+1
| | | | | | | For this -af-adv must be moved below af* to match first. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26018 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed wrong examplecompn2008-02-171-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26017 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r26015Gabrov2008-02-172-14/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26016 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document that framedrop needs -no-correct-ptsreimar2008-02-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26015 b3059339-0415-0410-9bf9-f77b7e298cf2
* -dumpstream will not dump chapters anymorecompn2008-02-171-6/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26014 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove duplicate AV_STRINGIFY() definitionmru2008-02-171-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26013 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not check for __APPLE_ALTIVEC__, just check for __APPLE_CC__.diego2008-02-164-8/+8
| | | | | | | This should work even when -faltivec is not specified. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26012 b3059339-0415-0410-9bf9-f77b7e298cf2
* Apple gcc defines __APPLE_ALTIVEC__ with -faltivec.diego2008-02-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26011 b3059339-0415-0410-9bf9-f77b7e298cf2
* FLAT objects cannot have multiple sections, so using the L1 attributes breaksdiego2008-02-163-4/+16
| | | | | | | | | linking. The FDPIC relocs also break for any other format. Thus check the compiler environment and select the appropriate sections/relocs. patch by Mike Frysinger, vapier.adi a gmail d com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26010 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid reinit of vo with the exactly same parameters over and over.reimar2008-02-161-6/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26009 b3059339-0415-0410-9bf9-f77b7e298cf2
* when seeking in H264 an SPS *should* be a valid entry point; feel free to ↵nicodvb2008-02-161-1/+1
| | | | | | change it if it's wrong git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26008 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmeticsnicodvb2008-02-161-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26007 b3059339-0415-0410-9bf9-f77b7e298cf2
* in ts_detect_streams() try to identify the program found based on vpid and ↵nicodvb2008-02-161-0/+7
| | | | | | apid if the previous attempts failed for lack of infos git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26006 b3059339-0415-0410-9bf9-f77b7e298cf2
* libvo: change asm syntax to use ASMALIGN and " # nop"uau2008-02-152-5/+5
| | | | | | | | | Change ".balign 16\n\t" to ASMALIGN(4) and "/nop" to " # nop". The new version is what other code in MPlayer uses, and works with old assembler versions like that used on OS X. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26005 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support icyx://.reimar2008-02-151-1/+1
| | | | | | | Patch by Sander Plas [sander oele net]. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26004 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always display Icy-Metadata if available, whether we recognize an ICY-Serverreimar2008-02-151-1/+2
| | | | | | | or not. I can not think of a reason why this should hurt. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26003 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move printing of Icy-Metadata into an extra functionreimar2008-02-151-14/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26002 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless codereimar2008-02-151-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26001 b3059339-0415-0410-9bf9-f77b7e298cf2
* Detect IceCast also by Icy-MetaInt header part in http_streaming_start(),reimar2008-02-151-1/+2
| | | | | | | as in fixup_open() git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@26000 b3059339-0415-0410-9bf9-f77b7e298cf2
* More explicit unsupported pixel format error messages.benoit2008-02-151-2/+2
| | | | | | | Patch by Stefano Sabatini: stefano sabatini (minus) lala % poste it git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25999 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try to make fps float -> AVRational conversion work better.reimar2008-02-141-1/+2
| | | | | | | | Might make sense to change this once we at least use double for fps everywhere. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25998 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change force_fps and force_ofps to doublereimar2008-02-147-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25997 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change mf_fps to doublereimar2008-02-143-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25996 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert accidentially committed line of r25994.cehoyos2008-02-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25995 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fix: inited --> initializeddiego2008-02-1444-198/+198
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25994 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ffpcx decoder, works on my samples.compn2008-02-132-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25993 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo.cehoyos2008-02-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25992 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2008-02-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25991 b3059339-0415-0410-9bf9-f77b7e298cf2
* Translate stray Italian term.diego2008-02-131-1/+1
| | | | | | | patch by Alfredo Pironti, alfredo.pironti a gmail d com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25990 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement test for system byteswap.h header file.iive2008-02-121-0/+18
| | | | | | | | | | | | | | | The result of this check is required by libavutil library. If it is not defined the library would try to implement its own byte swapping routines in bswap.h . As the routines are with same names, if included, the system definition would replace the function names with the macros. The result can not be compiled and looks like this: # 42 "../libavutil/bswap.h" -static av_always_inline uint16_t bswap_16(uint16_t x) +static __attribute__((always_inline)) inline uint16_t (__extension__ ({ register unsigned short int __v, __x = (uint16_t x); if (__builtin_constant_p (__x)) __v = ((((__x) >> 8) & 0xff) | (((__x) & 0xff) << 8)); else __asm__ ("rorw $8, %w0" : "=r" (__v) : "0" (__x) : "cc"); __v; })) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25989 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change to always use MP_NOPTS_VALUE (instead of sometimes 0) for unknown pts.reimar2008-02-122-6/+3
| | | | | | | | I did not see anything obvious that would break, it if it does it should be fixed properly once and for all. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25988 b3059339-0415-0410-9bf9-f77b7e298cf2
* -chapter is now handled uniformly calling demuxer_seek_chapter() insteadnicodvb2008-02-115-40/+24
| | | | | | | of letting individual demuxers and stream readers do their nasty job git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25987 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/ r25984gpoirier2008-02-111-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25986 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try harder to find OpenGL functions on Windows.reimar2008-02-111-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25985 b3059339-0415-0410-9bf9-f77b7e298cf2
* Slightly document alpha for OSD colorreimar2008-02-112-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25984 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support alpha for vo gl osdcolorreimar2008-02-111-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25983 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove an extern for a variable that no longer existsreimar2008-02-111-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25982 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove left-over extern definitions that should not be therereimar2008-02-111-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25981 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include just libavutil/common.h, not all of libavutil/intreadwrite.h.diego2008-02-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25980 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r25973gpoirier2008-02-101-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25979 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make some variables static.reimar2008-02-101-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25978 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid a useless extra pointer variable.reimar2008-02-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25977 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not uselessly erase background, OpenGL will take care of drawing everything.reimar2008-02-101-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25976 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable v4l2 if pthreads are not available, fixes bug #1015.diego2008-02-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25975 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid -wid message processing blocking MPlayer.reimar2008-02-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25974 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hint about possible libmpeg2 problems with -hardframedropreimar2008-02-101-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25973 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forward mouse messages to -wid Window.reimar2008-02-101-1/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25972 b3059339-0415-0410-9bf9-f77b7e298cf2
* r25770: URL updates for contributed win32 stuff.voroshil2008-02-102-11/+6
| | | | | | | | r25771: VIDIX is no longer a shared library. r25772: typo fix git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25971 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync tag update: changes in original text arevoroshil2008-02-101-1/+1
| | | | | | | unnecessary to translation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25970 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync tag updatevoroshil2008-02-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25969 b3059339-0415-0410-9bf9-f77b7e298cf2
* r25605: properties to get and set angle; patch by oattila chello huvoroshil2008-02-101-1/+5
| | | | | | | | r25663: add support for per protocol and per extension playback profile loading r25947: Add windows cp1256 encoding for arabic, fixes bug #1007 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25968 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make dither4 & dither8 const.cehoyos2008-02-092-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25967 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure the -wid window does not get notified when we destroy our attached ↵reimar2008-02-091-1/+1
| | | | | | | | | child window. Previous behaviour seems to cause QT to do something stupid which makes DestroyWindow hang (SMPlayer is an application where this happened). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25966 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hack: Create a child window for Windows OpenGL with -wid, since (esp. nVidia)reimar2008-02-091-8/+10
| | | | | | drivers have problems drawing in other processes' windows. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25965 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic typo fix, geneate > generatecompn2008-02-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25964 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use AV_RB*, reduces x86_64 code size by almost 1kB.reimar2008-02-091-18/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25963 b3059339-0415-0410-9bf9-f77b7e298cf2
* in some still unknown system format 0x82 identifies AUDIO_DTSnicodvb2008-02-081-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25962 b3059339-0415-0410-9bf9-f77b7e298cf2
* example for setting WMP user-agent string, helps when playlistsreimar2008-02-081-0/+4
| | | | | | | | and media (streamed via mms) use the same URL (what an ugly case of user-agent misuse!) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25961 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable http->mmshttp rewriting hack introduced in r25168,reimar2008-02-081-0/+4
| | | | | | | | unfortunately WMP is not the only one using asx. Fixes http://www.fresh80s.de/listen.wax git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25960 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add aspect_fit declaration missing for w32_common.reimar2008-02-071-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25959 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add speex tagreimar2008-02-061-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25958 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check buffer index while reading to avoid sig11rtogni2008-02-051-2/+25
| | | | | | | Fixes bugzilla #956 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25957 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r25955gpoirier2008-02-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25956 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fix, noticed by JRaSHgpoirier2008-02-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25955 b3059339-0415-0410-9bf9-f77b7e298cf2
* It seems that mencoder can not handle correct-pts (lots of "No pts ..." ↵reimar2008-02-051-0/+2
| | | | | | | | | messages), so disable it for now. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25954 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add dv50 fourcc to libdv and ffdv, fixing the following sample:diego2008-02-041-0/+2
| | | | | | | http://samples.mplayerhq.hu/V-codecs/DV50/dvcpro50_aurora.avi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25953 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not reset correct_pts in mp_dvdnav_reset_stream, it does not seem necessaryreimar2008-02-031-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25952 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow demuxers to choose a default value for correct_ptsreimar2008-02-036-9/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25951 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement keepaspect for Windows OpenGL vos.reimar2008-02-021-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25950 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make aspect adjustment calculation simpler and more flexible.reimar2008-02-021-24/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25949 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25947Gabrov2008-02-021-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25948 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add windows cp1256 encoding for arabic, fixes bug #1007reimar2008-02-012-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25947 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update the test for ivtv output driver.iive2008-02-011-2/+8
| | | | | | | | | | Linux kernel 2.6.24 now includes ivtv, but the vo_ivtv.c fails to compile with it. Test for structures and ioctl()s used in the current driver. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25946 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_functions_t should be const, part 1reimar2008-02-015-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25945 b3059339-0415-0410-9bf9-f77b7e298cf2
* Redraw display on toggling borderreimar2008-02-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25944 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always redraw video on resize.reimar2008-01-311-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25943 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable.reimar2008-01-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25942 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix get_space calculation to always leave some space, esp. for the currently ↵reimar2008-01-301-1/+3
| | | | | | playing buffer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25941 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change code to also work with different outburst sizesreimar2008-01-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25940 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce number of UnqueueBuffer callsreimar2008-01-301-3/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25939 b3059339-0415-0410-9bf9-f77b7e298cf2
* alSourceRewindv seems to be broken in particular in Creatives ↵reimar2008-01-301-1/+1
| | | | | | | | Windows-Implementation, use alSourceStopv instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25938 b3059339-0415-0410-9bf9-f77b7e298cf2
* Also accept OpenAL32 as library name for OpenAL, it is used by some ↵reimar2008-01-301-1/+1
| | | | | | Windows-Implementations git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25937 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for security fixesrtogni2008-01-301-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25936 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid a MANGLE, there is no register pressure and the generated codereimar2008-01-302-3/+3
| | | | | | | should be no worse. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25935 b3059339-0415-0410-9bf9-f77b7e298cf2
* mark constants as suchreimar2008-01-301-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25934 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify: use DECLARE_ASM_CONSTreimar2008-01-301-14/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25933 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for attachments in lavf demuxer.eugeni2008-01-301-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25932 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split osd related stuff from mp_core.h into new header file mp_osd.h.ulion2008-01-302-20/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25931 b3059339-0415-0410-9bf9-f77b7e298cf2
* Stream IDs must be written as hex numbers. Fixes rtogni2008-01-291-2/+2
| | | | | | | | | http://wm.streampower.be/ceu/archive/CEU_COUNCIL_DELIBIRATIONS_PUBLIC_DEBATE/ceulive_1443.wmv Patch by Peter Collingbourne pcc03 doc ic ac uk git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25928 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently give all libass multiple inclusion guards a LIBASS_ prefix.diego2008-01-2910-30/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25927 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a comment to the #if 0reimar2008-01-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25926 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ben co-maintains stream_dvdnav.cnicodvb2008-01-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25924 b3059339-0415-0410-9bf9-f77b7e298cf2
* clarification about dvd still menusnicodvb2008-01-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25923 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check that index is still within bounds of samples array.reimar2008-01-291-0/+4
| | | | | | | | Previous check is not enough and the code is not performance critical so do it the easy way. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25922 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure chunkmap values are within bounds when using them.reimar2008-01-291-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25921 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not pointlessly read data, just skip it.reimar2008-01-291-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25920 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable reading of flac metadata, mere metadata is not worth such a mess.reimar2008-01-291-1/+3
| | | | | | | | If you want this, fix the implementation to not crash at least occasionally, or wait till I get bored enough to fix it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25918 b3059339-0415-0410-9bf9-f77b7e298cf2
* Properly check length of flac metadata.reimar2008-01-291-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25917 b3059339-0415-0410-9bf9-f77b7e298cf2
* dvd still menus and latm aacnicodvb2008-01-291-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25916 b3059339-0415-0410-9bf9-f77b7e298cf2
* show dvdnav selection in the OSD only when the osd_level>1; patch by foxcore ↵nicodvb2008-01-291-2/+2
| | | | | | gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25915 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix r25817 to not always destroy codec_tag, this broke playback of e.g. ape ↵reimar2008-01-291-3/+6
| | | | | | files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25914 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow for larger fragment programs.reimar2008-01-291-3/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25913 b3059339-0415-0410-9bf9-f77b7e298cf2
* More places that should use SEEK_ABSOLUTE / SEEK_FACTORreimar2008-01-291-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25912 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use defines to give names to the different seek flags.reimar2008-01-2926-64/+65
| | | | | | | | A better solution should be considered later, esp. for the many broken demuxers that do not treat these flags correctly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25911 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make some assembler constants global instead of declaring them multiple times.reimar2008-01-296-60/+43
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25910 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make mov subtitles work with -assreimar2008-01-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25909 b3059339-0415-0410-9bf9-f77b7e298cf2
* clarify comments/docs about lav* being the preferred place to implement newivo2008-01-285-10/+18
| | | | | | | | codecs and (de)muxers, except for wrappers around external libraries and codecs and (de)muxers requiring binary support. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25908 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support CODEC_ID_MOV_TEXTreimar2008-01-281-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25907 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify a condition that probably is not necessary at allreimar2008-01-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25906 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with r25663 and misc. fixes, patch by JRaSHkraymer2008-01-281-37/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25905 b3059339-0415-0410-9bf9-f77b7e298cf2
* copy note on new demuxers and codecs to the top of the array as well to beivo2008-01-283-0/+9
| | | | | | | extra clear git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25904 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use DECLARE_ASM_CONST where possible in libswscale codereimar2008-01-283-73/+73
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25903 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/ r25821gpoirier2008-01-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25902 b3059339-0415-0410-9bf9-f77b7e298cf2
* vcd_read must read exactly VCD_SECTOR_DATA bytes.reimar2008-01-281-1/+1
| | | | | | | | If NetBSD can not handle this setting, the code must be rewritten to use a temporary buffer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25901 b3059339-0415-0410-9bf9-f77b7e298cf2
* note on new demuxers and codecs, add them to lav* instead of libmp*ivo2008-01-285-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25900 b3059339-0415-0410-9bf9-f77b7e298cf2
* port libmpdemux demuxers to libavformat or rewrite from scratchivo2008-01-281-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25899 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of redundant dbg_printf redefinition. Fixes some warnings:diego2008-01-282-23/+14
| | | | | | | wine/debugtools.h:57: warning: useless type name in empty declaration git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25898 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use uppercase filename as multiple inclusion guard.diego2008-01-2817-51/+51
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25897 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation failure because bitfile was undefined:diego2008-01-281-0/+1
| | | | | | | | In file included from decoder.c:36: mp4.h:46: error: expected ')' before '*' token git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25896 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add multiple inclusion guards.diego2008-01-273-2/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25895 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace with the output of the updated alaw-gen generator program.diego2008-01-271-64/+69
| | | | | | | This adds multiple inclusion guards and reformats the tables. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25894 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add multiple inclusion guards to generated header file.diego2008-01-271-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25893 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change format string so that the table is nicely aligned.diego2008-01-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25892 b3059339-0415-0410-9bf9-f77b7e298cf2
* The alaw tables should be const.diego2008-01-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25891 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename some identifiers to not use leading underscores.diego2008-01-271-14/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25890 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix illegal identifiers, names starting with __ are reserved for the system.diego2008-01-271-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25889 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change #warning to FIXME comments.diego2008-01-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25888 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix illegal identifiers, names starting with __ are reserved for the system.diego2008-01-272-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25887 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove setting of ldconfig, it is unused.diego2008-01-271-6/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25886 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindentreimar2008-01-271-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25885 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify subtitle handling with -assreimar2008-01-271-8/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25884 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support mov subtitle format directly instead of converting to text in the ↵reimar2008-01-272-11/+12
| | | | | | demuxer git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25883 b3059339-0415-0410-9bf9-f77b7e298cf2
* reindent after r25881ben2008-01-271-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25882 b3059339-0415-0410-9bf9-f77b7e298cf2
* sub_scale command can now handle both ass and non-ass subs at a timeben2008-01-271-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25881 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure sub_font is freed.reimar2008-01-271-0/+2
| | | | | | | Patch by Guillaume LECERF (foxcore gmail com). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25880 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow independent scaling of vo_font and sub_font.reimar2008-01-275-16/+16
| | | | | | | Patch by Guillaume LECERF (foxcore gmail com). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25879 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with r25821, patch by JRaSH (jrash06 163 com)kraymer2008-01-271-19/+80
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25878 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove $Id$ tags, they make diffs between different versionsreimar2008-01-2729-29/+0
| | | | | | | harder to read than necessary. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25877 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always use inline instead of _inline, the former is supported by allreimar2008-01-271-4/+0
| | | | | | | compilers we care about, while e.g. ICC does not support the later. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25876 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the standard "static inline" instead of some broken ifdef messreimar2008-01-272-11/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25875 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prefer lavf mov demuxer over our own, it should work better most of the time ↵reimar2008-01-271-0/+1
| | | | | | now. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25874 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify init_vobsub: pass palette via extradata.reimar2008-01-261-8/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25873 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support vobsub palette in extradata, as exported by libavformatreimar2008-01-261-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25872 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, inverted condition for AVSEEK_FLAG_BACKWARDreimar2008-01-261-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25871 b3059339-0415-0410-9bf9-f77b7e298cf2
* Used wrong condition for using AVSEEK_FLAG_BACKWARD, it should depend onreimar2008-01-261-2/+3
| | | | | | | relative vs. absolute, not time- vs. percent-based seek. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25870 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: remove some trailing whitespacereimar2008-01-261-17/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25869 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add QDM2 codec identifierreimar2008-01-261-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25868 b3059339-0415-0410-9bf9-f77b7e298cf2
* Partially support vobsub subtitles from lavf demuxers (palette support missing)reimar2008-01-261-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25867 b3059339-0415-0410-9bf9-f77b7e298cf2
* in the crazy ES probing code return DEMUXER_TYPE_MPEG_ES (mpeg12v) only if ↵nicodvb2008-01-261-1/+4
| | | | | | we have at least a couple of SEQ/GOP startcodes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25866 b3059339-0415-0410-9bf9-f77b7e298cf2
* in the PMT stream_type==0x11 indicates AAC in LATM streams, that now libfaad ↵nicodvb2008-01-261-0/+1
| | | | | | can decode; re-added git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25865 b3059339-0415-0410-9bf9-f77b7e298cf2
* added code to check and handle the presence of LATM streams in the init() ↵nicodvb2008-01-262-2/+69
| | | | | | and decode() functions git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25864 b3059339-0415-0410-9bf9-f77b7e298cf2
* added AudioSpecificConfigFromBitfile() -that reads from an initizializednicodvb2008-01-263-33/+46
| | | | | | | | | | bitstream- and reimplemented AudioSpecificConfig() in terms of the former. Also, introduced a short_form parameter that indicates if the core function must pretend not to know the size of the header (another craziness in AAC) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25863 b3059339-0415-0410-9bf9-f77b7e298cf2
* generic functions and structures to parse and statekeep LATM streamsnicodvb2008-01-264-0/+207
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25862 b3059339-0415-0410-9bf9-f77b7e298cf2
* in GASpecificConfig 1 bit (extensionflag3) wasn't being read and the comment ↵nicodvb2008-01-261-2/+3
| | | | | | was misplaced, too git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25861 b3059339-0415-0410-9bf9-f77b7e298cf2
* factorize 2 testsben2008-01-261-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25860 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for stream change in dvdnav.ben2008-01-261-0/+8
| | | | | | | | Set new aspect ratio if needed (for example in cell change) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25859 b3059339-0415-0410-9bf9-f77b7e298cf2
* add a new state flag to dvdnav in order to notify ifben2008-01-262-0/+21
| | | | | | | | | something has changed in the current stream (being title, chapter, audio layer or SPU one) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25858 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove useless castsben2008-01-261-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25857 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplify by a one-linerben2008-01-261-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25856 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove the spu_set field, replaced by a flagben2008-01-261-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25855 b3059339-0415-0410-9bf9-f77b7e298cf2
* this end brace was not correctly indentedben2008-01-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25854 b3059339-0415-0410-9bf9-f77b7e298cf2
* automatically set spu button highlight when nav cell has changedben2008-01-261-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25853 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for dvdnav still frames playback.ben2008-01-265-33/+345
| | | | | | | | | | | Based on various patches from Otvos Attila and MPlayer'ized by me. N.B. Always use -vc ffmpeg12 with dvdnav:// git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25852 b3059339-0415-0410-9bf9-f77b7e298cf2
* set -vc=ffmpeg12 as dvdnav prefered decoderben2008-01-251-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25851 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling cosmeticsdiego2008-01-251-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25850 b3059339-0415-0410-9bf9-f77b7e298cf2
* add documentation about switch_angle and switch_title slave commandsben2008-01-241-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25849 b3059339-0415-0410-9bf9-f77b7e298cf2
* array was defined for 6 elements while 7 were declaredben2008-01-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25848 b3059339-0415-0410-9bf9-f77b7e298cf2
* type expected by dvdnav_get_title_string() is constben2008-01-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25847 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove some redundant declarationsben2008-01-241-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25846 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add new command to switch between dvdnav titlesben2008-01-245-0/+18
| | | | | | | | Based on parts of dvdnav monster patches from Otvos Attila git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25845 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic: reindent code after r25843ben2008-01-231-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25844 b3059339-0415-0410-9bf9-f77b7e298cf2
* sub_scale command now works with ass subtitles rendererben2008-01-231-0/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25843 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add ass_use_margins command and property to shift subtitles to margins and backeugeni2008-01-233-0/+32
| | | | | | | on the fly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25842 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add global ass_force_reload flag.eugeni2008-01-234-2/+17
| | | | | | | If it is set, renderer is reconfigured before the next frame. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25841 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore compare.diego2008-01-230-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25840 b3059339-0415-0410-9bf9-f77b7e298cf2
* Zero codec_inited in the init() function, so that it's cleared everytime rtogni2008-01-231-0/+1
| | | | | | | | | | the codec is inites (previously was only cleared once at start time). Fixes a crash when -loop n (with n >= 2) is used with a qtvideo codec. Patch by KO Myung-Hun komh chollian net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25839 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a few const attributesreimar2008-01-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25838 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the proper option name for constant quantizer iive2008-01-231-1/+1
| | | | | | | | | in the hint that user gets if there isn't any of the essential options. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25837 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move Zoran video controller check after the libavcodec one.iive2008-01-231-25/+26
| | | | | | | | As _libavcodec_a is set to "auto" the zoran check used to always fail. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25836 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable unused functions find_handle_2, find_handle_by_name, fixes the warning:diego2008-01-231-0/+4
| | | | | | | registry.c:317: warning: 'find_handle_2' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25835 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable unused function test_heap, fixes the warning:diego2008-01-231-2/+4
| | | | | | | win32.c:255: warning: 'test_heap' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25834 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused function exp_ftol_wrong, fixes the warning:diego2008-01-231-6/+0
| | | | | | | win32.c:4273: warning: 'exp_ftol_wrong' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25833 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused function fixup_address, fixes the warning:diego2008-01-231-12/+0
| | | | | | | pe_image.c:957: warning: 'fixup_address' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25832 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused DPRINTF__ macro.diego2008-01-231-9/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25831 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move compare.c to TOOLS, add it to the Makefile and document it.diego2008-01-233-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25830 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in commentreimar2008-01-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25829 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless castsreimar2008-01-211-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25828 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25826Gabrov2008-01-214-32/+88
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25827 b3059339-0415-0410-9bf9-f77b7e298cf2
* Surround variable declarations by preprocessor conditionals to avoid warnings:diego2008-01-211-0/+5
| | | | | | | | module.c:143: warning: unused variable 'typeName' module.c:948: warning: unused variable 'err' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25826 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment out unused variables, fixes the warnings:diego2008-01-211-2/+2
| | | | | | | | resource.c:117: warning: unused variable 'wm' resource.c:140: warning: unused variable 'wm' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25825 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prevent possible buffer overflow on album_title[]rtogni2008-01-201-2/+5
| | | | | | | Based on a patch by Adam Bozanich abozanich musecurity com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25824 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clear tmp between ip6 check and string escape to prevent reuse of the rtogni2008-01-201-0/+1
| | | | | | | | | | buffer, in order to prevent a possible buffer overflow on malformed urls. Based on a patch by Adam Bozanich abozanich musecurity com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25823 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a ton of illegal identifiers. Identifiers starting with __ or _ and adiego2008-01-2044-347/+347
| | | | | | | | capital letter are reserved for the system, those starting with _ are reserved at the file level. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25822 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added missing single quotation mark.cehoyos2008-01-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25821 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation failue:ulion2008-01-201-0/+1
| | | | | | | | | | stream_cddb.c: In function 'cddb_read_cache': stream_cddb.c:341: error: 'UINT_MAX' undeclared (first use in this function) stream_cddb.c:341: error: (Each undeclared identifier is reported only once stream_cddb.c:341: error: for each function it appears in.) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25820 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix vobsub_seek use same reseek method as vobsub_get_packet did.ulion2008-01-201-12/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25819 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix auto-sub code to support filenames with any extension length.ulion2008-01-201-4/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25818 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow overriding the codec_tag for audio codecs, and always override rtogni2008-01-201-3/+13
| | | | | | | | | | codec_tag for PCM codecs (codec_id from lavf is correct, but the codec_tag may be non-zero and wrong). Also fixes bugzilla #983 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25817 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fragment programs must use unix eol.reimar2008-01-200-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25816 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid some pointer conversion warnings (the code is messy but not wrong)reimar2008-01-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25815 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing vo_w32_border prototypereimar2008-01-201-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25814 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some function types from unspecified to empty argument listreimar2008-01-201-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25813 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant declarations (already in video_out.h)reimar2008-01-201-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25812 b3059339-0415-0410-9bf9-f77b7e298cf2
* Extend the precision of rationale conversion soiive2008-01-191-1/+1
| | | | | | | | | | it would give proper result for framerate 60000/1001 . Otherwise framerate restrained encoders like lavc mpeg2video would refuse to encode, even if -ofps 60000/1001 is given. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25811 b3059339-0415-0410-9bf9-f77b7e298cf2
* -panscan should also work for right and left bordersreimar2008-01-191-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25810 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some reindentationreimar2008-01-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25809 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindentreimar2008-01-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25808 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify and keep terminating end-of-linereimar2008-01-191-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25807 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a broken and useless hack to avoid a memcpyreimar2008-01-191-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25806 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cached file must be 0-terminated since we use string processing functions on itreimar2008-01-191-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25805 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure we do not write the terminating 0 out of boundsreimar2008-01-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25804 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include, fixes the warning:diego2008-01-191-0/+1
| | | | | | | dshow/mediatype.c:89: warning: implicit declaration of function 'vo_format_name' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25803 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use ld conversion specifier for long int argument, fixes the warning:diego2008-01-191-1/+1
| | | | | | | dshow/outputpin.c:754: warning: format '%d' expects type 'int', but argument 3 has type 'long int' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25802 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include, fixes the warning:diego2008-01-191-0/+1
| | | | | | | elfdll.c:106: warning: implicit declaration of function 'TRACE' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25801 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix endless loop if nAvgBytesPerSec is 0.reimar2008-01-191-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25800 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid a division by 0 if i_bps is 0.reimar2008-01-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25799 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix usage example commentreimar2008-01-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25798 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a coefficient for lscale=5 OpenGL modereimar2008-01-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25797 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add name to email address.diego2008-01-191-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25796 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid warning:reimar2008-01-191-1/+1
| | | | | | | vf_detc.c:273: warning: ‘dropflag’ may be used uninitialized in this function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25795 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some types to constreimar2008-01-191-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25794 b3059339-0415-0410-9bf9-f77b7e298cf2
* audio_out / video_out structs should be treated as constreimar2008-01-194-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25793 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning:reimar2008-01-191-1/+1
| | | | | | | vo_directfb2.c:553: warning: passing argument 2 of ‘dfb->EnumVideoModes’ from incompatible pointer type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25792 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid void* arithmeticreimar2008-01-191-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25791 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify and silence lots of warningsreimar2008-01-191-29/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25790 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add the edge-enhancement filter based on edgedetect I had lying around.reimar2008-01-191-0/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25789 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix using both lscale and cscale 4reimar2008-01-191-15/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25788 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r25786gpoirier2008-01-181-9/+66
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25787 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a fragment program for 5x5 unsharp maskingreimar2008-01-183-0/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25786 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove leftover backslashreimar2008-01-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25785 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplifyreimar2008-01-181-6/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25784 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the same unsharp filter template for 2D and RECT texturesreimar2008-01-181-32/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25783 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small typo in messagereimar2008-01-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25782 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove broken test program that likely never worked.diego2008-01-181-26/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25781 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change (a == NULL) condition to (!a) and (a != NULL) condition to (a).benoit2008-01-173-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25780 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some useless parentheses.benoit2008-01-173-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25779 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: whitespacesbenoit2008-01-176-69/+69
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25778 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove non cosmetic spaces inside parentheses.benoit2008-01-176-31/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25777 b3059339-0415-0410-9bf9-f77b7e298cf2
* Description: remove superfluous parentheses.benoit2008-01-171-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25776 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check param in sws_getCachedContext().benoit2008-01-171-1/+6
| | | | | | | | | Patch by KO Myung-Hun komh chollian net Original thread: [FFmpeg-devel] [PATCH] param check in sws_getCachedContext() Date: Wed Jan 9 11:15:19 CET 2008 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25775 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix code to prevent from accessing queue->packets[-1].pts that causes a crash.ulion2008-01-171-2/+1
| | | | | | | Found and patched by Reimar. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25774 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix OpenGL unsharp filterreimar2008-01-161-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25773 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fixdiego2008-01-163-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25772 b3059339-0415-0410-9bf9-f77b7e298cf2
* VIDIX is no longer a shared library.diego2008-01-161-5/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25771 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL updates for contributed win32 stuff.diego2008-01-161-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25770 b3059339-0415-0410-9bf9-f77b7e298cf2
* better ao/vo profile examplesdiego2008-01-161-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25769 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc markup fixesdiego2008-01-161-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25768 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc spelling fixesdiego2008-01-161-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25767 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed a english part, left in here, sighptt2008-01-151-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25766 b3059339-0415-0410-9bf9-f77b7e298cf2
* little grammar fixptt2008-01-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25765 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25757ptt2008-01-151-7/+79
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25764 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing "&"ptt2008-01-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25763 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing escapesptt2008-01-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25762 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncet to r25663ptt2008-01-151-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25761 b3059339-0415-0410-9bf9-f77b7e298cf2
* updated my mail addressptt2008-01-152-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25760 b3059339-0415-0410-9bf9-f77b7e298cf2
* add default deinterlace keycompn2008-01-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25759 b3059339-0415-0410-9bf9-f77b7e298cf2
* Create/allocate conversion textures before scaler textures.reimar2008-01-151-2/+2
| | | | | | | Allows overriding gamma ramp texture also when using a non-trivial scaler. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25758 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add experimental unsharp-mask OpenGL scaler. Certainly not yet perfect.reimar2008-01-154-0/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25757 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document vo gl lscale=3reimar2008-01-152-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25756 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a forgotten case to create_scaler_textures, avoids an incorrect warning.reimar2008-01-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25755 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a useless castreimar2008-01-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25754 b3059339-0415-0410-9bf9-f77b7e298cf2
* The GUI requires font support.diego2008-01-141-0/+2
| | | | | | | patch by Guillaume Lecerf, foxcore gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25753 b3059339-0415-0410-9bf9-f77b7e298cf2
* Seems that all - should be escaped in the man pagereimar2008-01-141-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25752 b3059339-0415-0410-9bf9-f77b7e298cf2
* Extend heartbeat-cmd man page entryreimar2008-01-141-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25751 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify/cleanup of real_calc_response_and_checksum()rtogni2008-01-131-8/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25750 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't oversize realchallenge buffersrtogni2008-01-131-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25749 b3059339-0415-0410-9bf9-f77b7e298cf2
* Put bff_mask into muxer context instead of a global variable.reimar2008-01-131-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25748 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the bug where the window would become smaller each time vo_ontop is toggled.reimar2008-01-131-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25747 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make some radeon vidix driver tables static and constreimar2008-01-131-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25746 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make mp_properties constreimar2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25745 b3059339-0415-0410-9bf9-f77b7e298cf2
* All the m_property stuff works fine with constant m_option_treimar2008-01-132-34/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25744 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make xpm arrays really const (I missed that they are not strings butreimar2008-01-1352-52/+52
| | | | | | | array of strings (string pointers)). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25743 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make all gui xpm bitmaps constreimar2008-01-137-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25742 b3059339-0415-0410-9bf9-f77b7e298cf2
* gui_opts should be const for win32 gui as well (why, oh why, was allreimar2008-01-131-1/+1
| | | | | | | this code duplicated??). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25741 b3059339-0415-0410-9bf9-f77b7e298cf2
* Win32 gui has the same m_option_print error handling bugreimar2008-01-131-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25740 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 100l: error check for m_option_print was unreachablereimar2008-01-131-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25739 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make big gui_opts array constreimar2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25738 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make several mapping tables related to input processing const.reimar2008-01-131-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25737 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark qt default palette tables as constreimar2008-01-131-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25736 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make all demuxer_desc_t const, thus moving them to .rodatareimar2008-01-1336-88/+88
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25735 b3059339-0415-0410-9bf9-f77b7e298cf2
* First step towards making all demuxer_desc_t constreimar2008-01-132-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25734 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a useless assignment (there is an if just a few lines abovereimar2008-01-131-1/+1
| | | | | | | that ensures those two are already equal). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25733 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify cue-parsingreimar2008-01-131-13/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25732 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of quite useless inum variablereimar2008-01-131-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25731 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a forgotten #ifdef USE_ASS around ass_free_trackreimar2008-01-131-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25730 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use AV_WB*reimar2008-01-131-10/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25729 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some useless () and {}reimar2008-01-131-16/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25728 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplifyreimar2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25727 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use AV_WB16 instead of ugly memcpy hacksreimar2008-01-131-10/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25726 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use AV_RB* instead of custom variants.reimar2008-01-131-19/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25725 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use sizeof instead of size variables/definesreimar2008-01-131-16/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25724 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make some pnm data constreimar2008-01-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25723 b3059339-0415-0410-9bf9-f77b7e298cf2
* dvb_demuxdev etc. are only used in dvb_tune.c so make them staticreimar2008-01-131-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25722 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make several arrays constreimar2008-01-131-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25721 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some unused extern variablesreimar2008-01-131-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25720 b3059339-0415-0410-9bf9-f77b7e298cf2
* stream_opts should be constreimar2008-01-1313-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25719 b3059339-0415-0410-9bf9-f77b7e298cf2
* stream_info_t opts and protocols point to constant data as well.reimar2008-01-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25718 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make all tvi_info_t constreimar2008-01-136-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25717 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make some tvi_functions_t pointers const that I forgot to change beforereimar2008-01-131-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25716 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless ifdefsreimar2008-01-131-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25715 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add type to extern declarationreimar2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25714 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make dvd_audio_stream_types and dvd_audio_stream_channels constreimar2008-01-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25713 b3059339-0415-0410-9bf9-f77b7e298cf2
* tvi_functions_t should be constreimar2008-01-132-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25712 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add forgotten const for pal_ireland.reimar2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25711 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove another 2 useless castsreimar2008-01-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25710 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of another useless castreimar2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25709 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a cast useless since r24425.reimar2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25708 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move variable declaration into block where it is used.reimar2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25707 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove result from warning string, it has no useful meaning here.reimar2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25706 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a useless castreimar2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25705 b3059339-0415-0410-9bf9-f77b7e298cf2
* moved pes_header from file-static to send_mpeg_pes_packet_ll()nicodvb2008-01-131-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25704 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix bug in error message (found by Diego through a compiler warning)rik2008-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25703 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a transform_color function to reduce code duplicationreimar2008-01-121-28/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25702 b3059339-0415-0410-9bf9-f77b7e298cf2
* Write functions used by send_mpeg_*_packet may _not_ modify datareimar2008-01-124-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25701 b3059339-0415-0410-9bf9-f77b7e298cf2
* ps1_header and ps2_header should be constreimar2008-01-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25700 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a few "const" attributes.reimar2008-01-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25699 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variablereimar2008-01-121-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25698 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move uselessly global variablesreimar2008-01-121-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25697 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adjust list of colourspaces supported by vd_ijpgreimar2008-01-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25696 b3059339-0415-0410-9bf9-f77b7e298cf2
* Colourspace conversions do _not_ belong into a decoder!reimar2008-01-121-42/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25695 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: get rid of huge amounts of trailing whitespacereimar2008-01-121-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25694 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove an unused global variablereimar2008-01-121-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25693 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid uselessly global variablesreimar2008-01-121-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25692 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, free strdup'd stringsreimar2008-01-121-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25691 b3059339-0415-0410-9bf9-f77b7e298cf2
* Builtin codecs array can now be constreimar2008-01-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25690 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace the persistent CODECS_FLAG_SELECTED by a local "stringset" withreimar2008-01-124-47/+49
| | | | | | | | | an almost-trivial implementation. This allows making the builtin codec structs const, and it also makes clearer that this "selected" status is not used outside the init functions. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25689 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not try to guess font metrics based on its bounding box.eugeni2008-01-121-8/+2
| | | | | | | | | It was originally a workaround for fonts with bad ascender/descender values, but it breaks display of some otherwise valid fonts (bugzilla 987), so reverted. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25688 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add libass support to demux_lavf.eugeni2008-01-121-2/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25687 b3059339-0415-0410-9bf9-f77b7e298cf2
* Instead of keeping attachments in mkv demuxer, use demuxer_add_attachment().eugeni2008-01-122-44/+14
| | | | | | | These attachments are passed to libass after demuxer is opened. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25686 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add demuxer interface for attachments.eugeni2008-01-122-0/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25685 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove global_ass_track. Instead create an ass_track for each 't' track.eugeni2008-01-113-6/+6
| | | | | | | | Global_ass_track obviously can not work when there is more than one 't tracks, their lines will be mixed up. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25684 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move all subtitle parsing from mkv demuxer to update_subtitles().eugeni2008-01-112-30/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25683 b3059339-0415-0410-9bf9-f77b7e298cf2
* Init and destroy ass_tracks in demuxer.c based on sh_sub->type value.eugeni2008-01-112-40/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25682 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set extradata for subtitle tracks in mkv demuxer.eugeni2008-01-111-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25681 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add extradata to sh_sub_t.eugeni2008-01-112-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25680 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize private data decoding for subtitle tracks in mkv demuxer.eugeni2008-01-111-20/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25679 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make code slightly less confusing to mereimar2008-01-111-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25678 b3059339-0415-0410-9bf9-f77b7e298cf2
* Slightly deobfuscatereimar2008-01-111-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25677 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another small simplification. Slightly worse performance in the casereimar2008-01-111-3/+3
| | | | | | | where a buffer underrun happens, but this really should not matter. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25676 b3059339-0415-0410-9bf9-f77b7e298cf2
* Slightly simplify read_buffer codereimar2008-01-111-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25675 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify: use memsetreimar2008-01-111-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25674 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix indentationreimar2008-01-111-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25673 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless castreimar2008-01-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25672 b3059339-0415-0410-9bf9-f77b7e298cf2
* document vo.* and ao.* playback profilesben2008-01-111-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25671 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix buffer overflow bug by calculate the buffer size accurately.ulion2008-01-111-3/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25670 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow profile loading per audio/video outputben2008-01-101-0/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25669 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an extra check to avoid a case that cause black lines in scaledreimar2008-01-101-0/+2
| | | | | | | vobsubs due to an overflow in the multiplication. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25668 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clear demuxed data when subtitle track is changed.eugeni2008-01-101-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25667 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use malloc for codecdata. Fixes segfault in free_sh_sub.eugeni2008-01-101-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25666 b3059339-0415-0410-9bf9-f77b7e298cf2
* updated english manpage with protocol/extension profile loading featureben2008-01-101-0/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25665 b3059339-0415-0410-9bf9-f77b7e298cf2
* factorizes variable checkben2008-01-101-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25664 b3059339-0415-0410-9bf9-f77b7e298cf2
* add support for per protocol and per extension playback profile loadingben2008-01-102-0/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25663 b3059339-0415-0410-9bf9-f77b7e298cf2
* export m_config_set_profile()ben2008-01-102-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25662 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow generation of ctags and etagsben2008-01-101-2/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25661 b3059339-0415-0410-9bf9-f77b7e298cf2
* Deny the code using realpath().ulion2008-01-101-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25660 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r25657gpoirier2008-01-091-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25659 b3059339-0415-0410-9bf9-f77b7e298cf2
* Codecdata must always be malloc'd, fixes free being called with anreimar2008-01-091-2/+4
| | | | | | | invalid pointer when freeing codecdata. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25658 b3059339-0415-0410-9bf9-f77b7e298cf2
* dumpstream is NOT a better way to copy a dvd titlecompn2008-01-091-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25657 b3059339-0415-0410-9bf9-f77b7e298cf2
* dvd-device can specify iso files toocompn2008-01-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25656 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set CONFIG_SWSCALER in order to avoid imgresampleuau2008-01-091-0/+2
| | | | | | | | | Set "CONFIG_SWSCALE=yes" in config.mak. This prevents building libavcodec/imgresample.o which has symbols that conflict with swscale ones. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25655 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary <signal.h> includesuau2008-01-097-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25654 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use getppid instead of getpid and move a snprintf to where it is actually ↵reimar2008-01-081-2/+2
| | | | | | needed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25653 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify a needlessly complex use of snprintfreimar2008-01-081-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25652 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use exit_player in the signal handler, this code just can notreimar2008-01-083-2/+10
| | | | | | | | | be called from a signal handler. Instead only make the input system generate quit commands for the first CTRL+C and otherwise do getch2_disable and exit. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25651 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clear fonts when the file is closed.eugeni2008-01-081-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25650 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix ass_clear_fonts not deallocating fontdata.eugeni2008-01-081-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25649 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix illegal identifiers, names starting with __ are reserved for the system.diego2008-01-082-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25648 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix illegal identifier, names starting with _ and uppercase are reserved.diego2008-01-072-44/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25647 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix illegal identifier, names starting with _ and uppercase are reserved.diego2008-01-071-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25646 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix #endif comment, sync with libdvdcss r208.diego2008-01-072-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25645 b3059339-0415-0410-9bf9-f77b7e298cf2
* No need to reinvent strdup...eugeni2008-01-071-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25644 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with r25158, patch by JRaSHkraymer2008-01-071-32/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25643 b3059339-0415-0410-9bf9-f77b7e298cf2
* Deallocate audio track codecdata.eugeni2008-01-071-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25642 b3059339-0415-0410-9bf9-f77b7e298cf2
* Copy font data to ass_library instead of referencing demuxer-owned memory.eugeni2008-01-072-3/+26
| | | | | | | This fixes segfault when fonts are accessed after demuxer has been closed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25641 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set freetype flag in the font_desc_t when using a freetype font.ulion2008-01-071-0/+1
| | | | | | | Patched by Guillaume LECERF <foxcore A gmail P com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25640 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add heartbeat-cmd optionreimar2008-01-073-0/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25639 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some now unused screensaver stuff code.reimar2008-01-071-65/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25638 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove most of the messy screensaver code in favour of only XResetScreenSaverreimar2008-01-071-83/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25637 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a screensaver_off variable to save current state and avoidreimar2008-01-071-0/+7
| | | | | | | | uselessly disabling twice. Also needed for a future patch. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25636 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix illegal identifiers: Names starting with __ or _ and uppercase are reserveddiego2008-01-0616-33/+33
| | | | | | | for the system, names starting with _ are reserved at file level. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25635 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make some functions in mplayer.c staticreimar2008-01-061-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25634 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense to GPL v2 or later with Reimar's permission.diego2008-01-062-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25633 b3059339-0415-0410-9bf9-f77b7e298cf2
* Whitespace-only cosmetics: get rid of tabsreimar2008-01-061-94/+94
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25632 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename common.[ch], there are too many files by that name.diego2008-01-065-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25631 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: alphabetical orderdiego2008-01-061-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25630 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename common.[ch] to gtk_common.[ch], there are too many files by that name.diego2008-01-0611-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25629 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't overread audio datartogni2008-01-061-1/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25628 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't dynamically allocate sub_packet_lengths[] in raac demuxing.rtogni2008-01-061-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25627 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not pass timestamp to realvideo binary decoderrtogni2008-01-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25626 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused definition.diego2008-01-061-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25625 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove changelog from file header, we have revision control for this.diego2008-01-062-156/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25624 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Whitespace changes, add comments to some #endif directives.diego2008-01-062-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25623 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove all test programs with 'make clean'.diego2008-01-061-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25622 b3059339-0415-0410-9bf9-f77b7e298cf2
* /usr/lib/win32 --> /usr/local/lib/codecsdiego2008-01-062-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25621 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove compilation command comments.diego2008-01-062-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25620 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore test programs.diego2008-01-060-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25619 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment out non-existing mp_msg_set_level function to fix linking.diego2008-01-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25618 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation by replacing a broken macro with in-place code.diego2008-01-061-3/+1
| | | | | | | qtx/qtxload.c:16:1: error: pasting "*" and "ComponentDispatch" does not give a valid preprocessing token git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25617 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation due to conflicting type declaration:diego2008-01-061-2/+0
| | | | | | | | qtx/list.c:22: error: conflicting types for 'OSErr' qtx/qtxsdk/components.h:15: error: previous declaration of 'OSErr' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25616 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include so that the header works standalone.diego2008-01-061-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25615 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add proper compilation rules for qtx/list and qtx/qtxload and remove sillydiego2008-01-062-4/+11
| | | | | | | compilation shell script. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25614 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get the dshow test program closer to linking.diego2008-01-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25613 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:diego2008-01-061-0/+1
| | | | | | | | | | dshow/test.c:52: warning: implicit declaration of function 'strcpy' dshow/test.c:52: warning: incompatible implicit declaration of built-in function 'strcpy' dshow/test.c:61: warning: implicit declaration of function 'memset' dshow/test.c:61: warning: incompatible implicit declaration of built-in function 'memset' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25612 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #includes to fix compilation:diego2008-01-061-0/+3
| | | | | | | dshow/test.c:11: error: 'BITMAPINFOHEADER' undeclared (first use in this function) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25611 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow overriding [Script Info] parameters with -ass-force-style option.eugeni2008-01-052-1/+12
| | | | | | | Patch by Anton Khirnov, wyskas gmail com. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25610 b3059339-0415-0410-9bf9-f77b7e298cf2
* Give a sense to this sentenceben2008-01-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25609 b3059339-0415-0410-9bf9-f77b7e298cf2
* angle switching in dvdnicodvb2008-01-051-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25608 b3059339-0415-0410-9bf9-f77b7e298cf2
* documented angle commandsnicodvb2008-01-052-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25607 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo, LIBNAME should be LIBNAME_COMMON.diego2008-01-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25606 b3059339-0415-0410-9bf9-f77b7e298cf2
* properties to get and set angle; patch by oattila chello hunicodvb2008-01-052-0/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25605 b3059339-0415-0410-9bf9-f77b7e298cf2
* properties to change angle; patch by oattila chello hunicodvb2008-01-052-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25604 b3059339-0415-0410-9bf9-f77b7e298cf2
* wrapper functions to get/set angle: the wrapping is needed to RESYNC the ↵nicodvb2008-01-052-0/+55
| | | | | | demuxer; patch by oattila chello hu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25603 b3059339-0415-0410-9bf9-f77b7e298cf2
* implemented _ANGLE STREAM_CTRLs, patch by oattila chello hu nicodvb2008-01-051-0/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25602 b3059339-0415-0410-9bf9-f77b7e298cf2
* implemented _ANGLE STREAM_CTRLs, patch by oattila chello hu nicodvb2008-01-051-0/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25601 b3059339-0415-0410-9bf9-f77b7e298cf2
* NEW STREAM_CTRLs: STREAM_CTRL_GET_NUM_ANGLES STREAM_CTRL_GET_ANGLE ↵nicodvb2008-01-051-0/+3
| | | | | | STREAM_CTRL_SET_ANGLE git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25600 b3059339-0415-0410-9bf9-f77b7e298cf2
* in the PMT stream_type==0x11 identified AAC in LATM-over-LOAS syntax that ↵nicodvb2008-01-051-1/+0
| | | | | | isn't decodable yet, removed git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25599 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove code for colorspaces x264 doesn't supportlorenm2008-01-051-26/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25598 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed bug when playing multi-angle titles: the address field in the agli datanicodvb2008-01-051-1/+2
| | | | | | | | of the current angle must be != 0x7fffffff to be skippable; patch by oattila chello hu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25597 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix artifacts in -vf fspp. regression in r23476.lorenm2008-01-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25596 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix property audio_delay bug when step up/down with arg value NULL.ulion2008-01-051-5/+5
| | | | | | | Original patched by Davide Capodaglio <davidecapod A inwind P it>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25595 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r25587gpoirier2008-01-041-2/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25594 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25592Gabrov2008-01-032-4/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25593 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add HAVE_SOCKLEN_T to config.h for FFmpeguau2008-01-031-0/+2
| | | | | | | | | | | Needed to fix compilation after recent FFmpeg changes. It's now always set to true without any tests. I don't expect this to cause problems as common systems will have the type and the FFmpeg demuxers which would use it are not compiled under MPlayer (compilation was broken because the type was redefined in a header). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25592 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense file to GPL v2 or later with the permission of Rudolf Marek,diego2008-01-021-2/+2
| | | | | | | the author and update his email contact address. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25591 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add proper license header.diego2008-01-021-3/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25590 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of build system hackery to generate mga_crtc2_vid.o and rage128_vid.o.diego2008-01-023-13/+8
| | | | | | | | | Instead, create files that #include mga_vid.c/radeon_vid.c with the proper #defines set. This has the added benefit of fixing dependency generation, which only works for existing .c files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25589 b3059339-0415-0410-9bf9-f77b7e298cf2
* Properly express dependencies for generated .c and .h files.diego2008-01-021-4/+8
| | | | | | | This fixes parallel make runs, compare Bugzilla #967. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25588 b3059339-0415-0410-9bf9-f77b7e298cf2
* when {v|a}_o_mpegpes:card isn't specified by the user mplayer uses the first ↵nicodvb2008-01-021-0/+2
| | | | | | available card git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25587 b3059339-0415-0410-9bf9-f77b7e298cf2
* when :card isn't specified by the user search the first available cardnicodvb2008-01-022-2/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25586 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an example for dvdnav:// usage with path.cehoyos2008-01-021-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25585 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use _ISOC99_SOURCE instead of _GNU_SOURCE.diego2008-01-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25584 b3059339-0415-0410-9bf9-f77b7e298cf2
* Happy New Year!zuxy2008-01-023-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25583 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Replace #define with #endif where I really meant to write #endif.diego2008-01-022-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25582 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add multiple inclusion guards to all header files that lack them.diego2008-01-0160-10/+256
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25581 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a comment that explains why this header has no multiple inclusion guards.diego2008-01-011-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25580 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace multiple inclusion guards with leading underscores by default names.diego2008-01-0110-30/+30
| | | | | | | Leading underscores are reserved for system identifiers. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25579 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use _H in multiple inclusion guard.diego2008-01-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25578 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency cosmetics: Do not #define multiple inclusion guards to 1.diego2008-01-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25577 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use just the name of the #ifdef directive in preprocessor comments.diego2008-01-016-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25576 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency cosmeticsdiego2008-01-016-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25575 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use just the name of the #ifdef directive in #endif comments.diego2008-01-014-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25574 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix wrong #endif comment that does not match the #ifdef directive.diego2008-01-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25573 b3059339-0415-0410-9bf9-f77b7e298cf2
* Port typo fixes from FFmpeg.diego2008-01-011-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25572 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove compilation command from source file, it is already in the Makefile.diego2008-01-011-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25571 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix license header to read Lesser General Public License 2.1,diego2008-01-011-1/+1
| | | | | | | a Lesser General Public License 2 never existed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25570 b3059339-0415-0410-9bf9-f77b7e298cf2
* unrarlib.o no longer exists, link against unrar_exec.o.diego2008-01-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25569 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add explanatory comments to #endif preprocessor directives.diego2008-01-012-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25568 b3059339-0415-0410-9bf9-f77b7e298cf2
* include dvdnav.h from its installation directory rather than appendingnicodvb2008-01-012-2/+2
| | | | | | | | -Idvdnav to the compilation of the whole mplayer (dvdnav-config was just cleaned) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25567 b3059339-0415-0410-9bf9-f77b7e298cf2
* update copyright year to 2008gpoirier2008-01-0119-13/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25566 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed inclusion of unneeded header (forgotten in previous commit)nicodvb2008-01-011-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25565 b3059339-0415-0410-9bf9-f77b7e298cf2
* private structures belong to the C file using them, not to header files ↵nicodvb2008-01-012-11/+11
| | | | | | included somewhere else git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25564 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add explanatory comments to the #endif part of multiple inclusion guards.diego2007-12-31103-122/+107
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25563 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add comments to some #endif directives.diego2007-12-311-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25562 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove superfluous README file, its content is in the Copyright file.diego2007-12-311-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25561 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment out the correct #endif directive.diego2007-12-311-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25560 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense files marked as GPL v2 to GPL v2 or later.diego2007-12-312-2/+2
| | | | | | | Done with permission from Nick Kurshev, the author. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25559 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in multiple inclusion guard comment.diego2007-12-311-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25558 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense GPL v2 files as GPL v2+ and add proper license headers.diego2007-12-312-4/+38
| | | | | | | Done with permission from Michael Niedermayer, the author. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25557 b3059339-0415-0410-9bf9-f77b7e298cf2
* Default use the dir where the current playing file located if path not set.ulion2007-12-311-2/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25556 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense files written by Nick Kurshev and marked as "GPL v2" todiego2007-12-303-3/+3
| | | | | | | "GPL v2 or later" with permission from Nick. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25555 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add proper license header.diego2007-12-301-4/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25554 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include, fixes the warning:diego2007-12-301-0/+1
| | | | | | | | vo_xvr100.c: In function 'draw_osd': vo_xvr100.c:346: warning: implicit declaration of function 'vo_draw_text' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25553 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable, fixes the warning:diego2007-12-301-1/+1
| | | | | | | vo_xvr100.c:139: warning: unused variable 'i' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25552 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant extern declarations, fixes the warnings:diego2007-12-301-4/+0
| | | | | | | | | | | | vo_vesa.c:55: warning: redundant redeclaration of #monitor_hfreq_str# video_out.h:252: warning: previous declaration of #monitor_hfreq_str# was here vo_vesa.c:56: warning: redundant redeclaration of #monitor_vfreq_str# video_out.h:253: warning: previous declaration of #monitor_vfreq_str# was here vo_vesa.c:57: warning: redundant redeclaration of #monitor_dotclock_str# video_out.h:254: warning: previous declaration of #monitor_dotclock_str# was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25551 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r25529, patch by JRaSH: jrash06 A 163 P comgpoirier2007-12-301-16/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25550 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused static variables, fixes the warnings:diego2007-12-301-1/+1
| | | | | | | | | vo_bl.c: At top level: vo_bl.c:64: warning: 'yoff' defined but not used vo_bl.c:64: warning: 'stride' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25549 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variables, fixes the warnings:diego2007-12-301-3/+1
| | | | | | | | | | vo_bl.c: In function 'draw_slice': vo_bl.c:329: warning: unused variable 'src2' vo_bl.c:328: warning: unused variable 'src1' vo_bl.c:325: warning: unused variable 'j' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25548 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable unused code, fixes the warning:diego2007-12-301-0/+2
| | | | | | | | vesa_lvo.c: At top level: vesa_lvo.c:248: warning: 'draw_alpha' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25547 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include for vo_draw_text.diego2007-12-301-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25546 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not duplicate MJpegContext struct, #include the proper header instead.diego2007-12-301-14/+1
| | | | | | | | | | | This also fixes the warnings: jpeg_enc.c:342: warning: implicit declaration of function 'ff_mjpeg_encode_init' jpeg_enc.c:384: warning: implicit declaration of function 'ff_mjpeg_encode_picture_header' jpeg_enc.c:489: warning: implicit declaration of function 'ff_mjpeg_encode_picture_trailer' jpeg_enc.c:500: warning: implicit declaration of function 'ff_mjpeg_encode_close' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25545 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include, fixes the warning:diego2007-12-301-0/+1
| | | | | | | | aspecttest.c: In function 'main': aspecttest.c:19: warning: implicit declaration of function 'atoi' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25544 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2007-12-302-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25543 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improve comments for ass_process_* functions.eugeni2007-12-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25542 b3059339-0415-0410-9bf9-f77b7e298cf2
* Return from ass_start_frame immediately if the track is empty.eugeni2007-12-301-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25541 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25539Gabrov2007-12-292-19/+68
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25540 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use proper length specifiers in mp_msg calls, fixes the warnings:diego2007-12-281-3/+3
| | | | | | | | | | | | | vo_zr.c: In function 'init_zoran': vo_zr.c:228: warning: format '%d' expects type 'int', but argument 4 has type 'long unsigned int' vo_zr.c:228: warning: format '%d' expects type 'int', but argument 5 has type 'long unsigned int' vo_zr.c:237: warning: format '%d' expects type 'int', but argument 4 has type 'long unsigned int' vo_zr.c:237: warning: format '%d' expects type 'int', but argument 5 has type 'long unsigned int' vo_zr.c:241: warning: format '%d' expects type 'int', but argument 4 has type 'long unsigned int' vo_zr.c:241: warning: format '%d' expects type 'int', but argument 5 has type 'long unsigned int' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25539 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings when compiling test application.diego2007-12-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25538 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix update_subtitles() checking subtitle type for the wrong track.eugeni2007-12-281-2/+3
| | | | | | | | | | update_subtitles() uses 'type' field from d_dvdsub even when some other track is active. For this reason, external vobsub is not displayed when there is at least one text track from demuxer (type is always 't' or 'a' in this case). The solution is to check vobsub_id and dvdsub_id instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25537 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25455ptt2007-12-281-2/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25536 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add detection of *lrint* and round* functions to configure.eugeni2007-12-281-9/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25535 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make windres binary name configurable, useful for cross-compiling.diego2007-12-283-2/+8
| | | | | | | patch by sheba, sheba469 yahoo com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25534 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant option 'auto-close' from cmdlist and filesel.ulion2007-12-282-17/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25533 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo in preprocessor conditiondiego2007-12-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25532 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused static variable pass, fixes the warning:diego2007-12-271-2/+0
| | | | | | | ae_lame.c:72: warning: 'pass' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25531 b3059339-0415-0410-9bf9-f77b7e298cf2
* From now on, libmenu does not steal all input keys from input modules.ulion2007-12-268-22/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25530 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support ?(!NAME:TEXT) format for expanding string by property.ulion2007-12-262-3/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25529 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a missing free of the avctxreimar2007-12-251-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25528 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use '-' instead of '_' in option name.ulion2007-12-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25527 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless scope.ulion2007-12-251-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25526 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change the default osd menu command for AR_MENU in comment of input.conf.ulion2007-12-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25525 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify the condition code.ulion2007-12-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25524 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some const/static qualifiers as appropriatereimar2007-12-243-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25523 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use realloc_struct in more places for consistencyreimar2007-12-241-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25522 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of some of the more excessive () and casts.reimar2007-12-241-24/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25521 b3059339-0415-0410-9bf9-f77b7e298cf2
* pci_db2c.awk creates more than just two .c files, add the rest to the rule.diego2007-12-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25520 b3059339-0415-0410-9bf9-f77b7e298cf2
* Skip unnecessary (debug) output; obey the rule of silence.diego2007-12-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25519 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure we have an rtsp sessionlu_zero2007-12-241-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25518 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo: begining --> beginningdiego2007-12-235-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25517 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace LOAD_LE32 etc. by AV_RL32 etc.reimar2007-12-231-28/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25516 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a read_varlen function to reduce some code duplicationreimar2007-12-231-44/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25515 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation of liba52/test.c testing and benchmarking application.iive2007-12-232-12/+12
| | | | | | | | It have been broken since API changes in liba52-0.7.4 that have been introduced with commit r18723. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25514 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set vo_mouse_autohide in gl and gl2 vos, so the mouse hiding behaviourreimar2007-12-222-0/+2
| | | | | | | becomes the same as for the other vos using X11. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25513 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove trailing whitespace, reformat one comment.diego2007-12-223-23/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25512 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add proper copyright/license headers.diego2007-12-224-3/+93
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25511 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing X11/extensions/scrnsaver.h includereimar2007-12-221-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25510 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove wrong and misleading comments.diego2007-12-222-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25509 b3059339-0415-0410-9bf9-f77b7e298cf2
* typosdiego2007-12-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25508 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: grammar/spellingdiego2007-12-221-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25507 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, fix compilation.reimar2007-12-221-2/+2
| | | | | | | Commited old patch that used alloc_put_byte instead of av_alloc_put_byte git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25506 b3059339-0415-0410-9bf9-f77b7e298cf2
* Grammar fix.ulion2007-12-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25505 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add copyright info for s/pdif code from VideoLAN.ulion2007-12-221-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25504 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include, fixesdiego2007-12-221-0/+1
| | | | | | | | compare.c:18: warning: implicit declaration of function ‘exit’ compare.c:18: warning: incompatible implicit declaration of built-in function ‘exit’ git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25503 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove trailing whitespace.diego2007-12-221-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25502 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: spelling fixesdiego2007-12-221-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25501 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set is_streamed correctly, should make network playback work more reliably.reimar2007-12-221-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25500 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of URLProtocol mess (especially problematic since it made usereimar2007-12-221-34/+12
| | | | | | | of a non-constant global variable) and use ByteIOContext directly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25499 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo fix in messagereimar2007-12-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25498 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify int_fastXY_t test in configure.reimar2007-12-221-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25497 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not send mouse movements events in root win mode.ulion2007-12-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25496 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless #ifdefsreimar2007-12-221-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25495 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for XScreenSaverSuspendreimar2007-12-222-1/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25494 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check availability before check argument for getting gamma properties.ulion2007-12-221-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25493 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert to r25490, since the r25491 is not correct.ulion2007-12-221-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25492 b3059339-0415-0410-9bf9-f77b7e298cf2
* Combine code for check availability of property audio(id).ulion2007-12-221-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25491 b3059339-0415-0410-9bf9-f77b7e298cf2
* Combine common code for check whether chapter is available.ulion2007-12-221-12/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25490 b3059339-0415-0410-9bf9-f77b7e298cf2
* OSD menu support mouse selection.ulion2007-12-227-1/+74
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25489 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move two variable to the scope where they are indeed used.ulion2007-12-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25488 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify a little bitreimar2007-12-211-6/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25487 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a check that is never in any way usefulreimar2007-12-211-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25486 b3059339-0415-0410-9bf9-f77b7e298cf2
* comment typo fixesdiego2007-12-212-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25485 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid some le2me_ASF_* stuff operating directly on buffer, shouldreimar2007-12-211-5/+3
| | | | | | | simplify some future changes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25484 b3059339-0415-0410-9bf9-f77b7e298cf2
* The lagarith DLL requires an MMX2 CPU.diego2007-12-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25483 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove another useless castreimar2007-12-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25482 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, buffer bound checks work better when done _before_ access.reimar2007-12-211-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25481 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce some extreme parsing ugliness (mostly cosmetic)reimar2007-12-211-10/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25480 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless alloc castsreimar2007-12-211-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25479 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce code duplication: add a asf_read_wrapper function that never does ↵reimar2007-12-211-34/+23
| | | | | | partial reads git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25478 b3059339-0415-0410-9bf9-f77b7e298cf2
* 30% synced with r22753ptt2007-12-201-209/+215
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25477 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move more variables into the block where they are usedreimar2007-12-201-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25476 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move a variable to where it is usedreimar2007-12-201-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25475 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support send mouse movements commands to mplayer.ulion2007-12-201-2/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25474 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix stream_cache to use sector_size set in stream_t.ulion2007-12-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25473 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move ds->current=NULL; further up to the free_demux_packet.reimar2007-12-201-1/+1
| | | | | | | | This does not change behaviour in the normal case but avoids a double-free if the function is aborted via a signal handler. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25472 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix comment from unrarlib to unrar_execulion2007-12-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25471 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant code since unrarlib was removed.ulion2007-12-201-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25470 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use tv_sec instead of tv_usec to set 1 second timeout, e.g. NetBSDreimar2007-12-201-2/+2
| | | | | | | | does not like the current way (bug #858). Patch by Sergey Svishchev [svs ropnet ru]. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25469 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove internal unrarlib copy, the new unrarexec code is a strict superset.diego2007-12-207-2985/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25468 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure strides have positive values before converting.benoit2007-12-201-1/+1
| | | | | | | Patch by Peter Schlaile: peter schlaile de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25467 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add variable bx, dx to simplify code of function menu_draw_list.ulion2007-12-201-7/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25466 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add local variable 'line_h' to simplify code of function menu_list_draw.ulion2007-12-201-8/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25465 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore mouse pos command when pausing.ulion2007-12-191-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25464 b3059339-0415-0410-9bf9-f77b7e298cf2
* Currently menu title did not align center together with menu items when x>=0.ulion2007-12-191-3/+3
| | | | | | | Now fix it to get a good alignment with menu items. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25463 b3059339-0415-0410-9bf9-f77b7e298cf2
* Calculate and draw osd accurately.ulion2007-12-191-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25462 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make libmenu init and uninit in proper place.ulion2007-12-191-3/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25461 b3059339-0415-0410-9bf9-f77b7e298cf2
* Vobsub support tridx setting in .idx file.ulion2007-12-193-9/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25460 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use calloc instead of malloc when allocate vobsub_t.ulion2007-12-191-11/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25459 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r25455gpoirier2007-12-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25458 b3059339-0415-0410-9bf9-f77b7e298cf2
* Protocol name should be case insensitive.ulion2007-12-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25457 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge 'Jump to ...' with 'Prev/Next' menu item into one item 'Prev/Next ...'.ulion2007-12-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25456 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo noticed by Paul TTdiego2007-12-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25455 b3059339-0415-0410-9bf9-f77b7e298cf2
* change license from GPLv2 to 'GPL v2 or later', requested by Diego, I can do ↵rik2007-12-185-5/+5
| | | | | | that since I wrote the files (based on other stuff from MPlayer (and some external things under GPL v2 or later)) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25454 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/25440gpoirier2007-12-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25453 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use NSMakeRect and NSRect in correct way:ulion2007-12-181-5/+5
| | | | | | | The third parameter is width, the fouth parameter is height. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25452 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix wrong code in last commit.ulion2007-12-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25451 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mouse button mapping:ulion2007-12-182-6/+12
| | | | | | | MOUSE_BTN1 is middle buttion, MOUSE_BTN2 is right button. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25450 b3059339-0415-0410-9bf9-f77b7e298cf2
* Here should add the minb to x when x>=0 because in later codeulion2007-12-181-1/+1
| | | | | | | we use 'x - minb' to draw bg box when x>=0. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25449 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the menu uninit function name.ulion2007-12-182-2/+2
| | | | | | | NOTE: Nobody call this function by now, should be fixed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25448 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace another m_struct_t by 'struct m_struct_st' to remove depedencyulion2007-12-181-1/+1
| | | | | | | on m_struct.h when include libmenu/menu.h. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25447 b3059339-0415-0410-9bf9-f77b7e298cf2
* Stop MPlayer from complaining about bogus AviSynth DLL load failures.diego2007-12-181-1/+1
| | | | | | | | This was causing major confusion and resulting usability problems. patch by Jan Knutar, jknutar nic fi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25446 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove dependency on m_struct.h when include libmenu/menu.h.ulion2007-12-181-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25445 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not operate on vobsub when no video (Bug #312).ulion2007-12-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25444 b3059339-0415-0410-9bf9-f77b7e298cf2
* r25345 patched the wrong line.ben2007-12-171-1/+1
| | | | | | | | | Here's the right fix (100l to me, i deserved them) Patch by Guillaume Lecerf. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25443 b3059339-0415-0410-9bf9-f77b7e298cf2
* Record screen size and display size in vo_ variables.ulion2007-12-171-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25442 b3059339-0415-0410-9bf9-f77b7e298cf2
* screen_frame is only used for fullscreen mode.ulion2007-12-171-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25441 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the expand text's format by the source.ulion2007-12-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25440 b3059339-0415-0410-9bf9-f77b7e298cf2
* Caching toc header in vcd private structure for later use.ulion2007-12-172-12/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25439 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add cdda stream control for chapter commmands.ulion2007-12-171-0/+48
| | | | | | | Now we support seek cdda/cddb tracks by seek_chapter command. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25438 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix indent for last commit.ulion2007-12-171-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25437 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore elements of keybindings other than 'binding'.ulion2007-12-171-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25436 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove NO_REPEAT mask from keycode, fix keycode matching for JOY_BTN0, etc.ulion2007-12-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25435 b3059339-0415-0410-9bf9-f77b7e298cf2
* Display parsed keycode in verbose output.ulion2007-12-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25434 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention that the sync is partialgpoirier2007-12-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25433 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync w/r25389, patch by JRaSH %jrash06 A 163 P com%gpoirier2007-12-171-18/+73
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25432 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove trailing whitespace.diego2007-12-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25431 b3059339-0415-0410-9bf9-f77b7e298cf2
* Modified for using chapter property for $(NAME:TEXT) or ?(NAME:TEXT).ulion2007-12-171-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25430 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix memory leak.ulion2007-12-171-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25429 b3059339-0415-0410-9bf9-f77b7e298cf2
* The function parameter 'preferred_language' should be const char *.ulion2007-12-172-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25428 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use correct #include for waitpid, fixes the warning:diego2007-12-171-1/+1
| | | | | | | unrar_exec.c:127: warning: implicit declaration of function 'waitpid' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25427 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless stray #include.diego2007-12-161-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25426 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace some more broken SYS_DARWIN preprocessor conditionals with __APPLE__.diego2007-12-163-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25425 b3059339-0415-0410-9bf9-f77b7e298cf2
* Should not change stream->pos in fill_buffer function.ulion2007-12-161-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25424 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: reformattingdiego2007-12-161-17/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25423 b3059339-0415-0410-9bf9-f77b7e298cf2
* There are no special rules for commits to the build system.diego2007-12-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25422 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support cddb on darwin.ulion2007-12-162-2/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25421 b3059339-0415-0410-9bf9-f77b7e298cf2
* make libass use sub_font_name whenever it's possibleben2007-12-161-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25420 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/ r25389 (up-to-date!!)gpoirier2007-12-161-1/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25419 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r25315gpoirier2007-12-161-23/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25418 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, in dvb_free_config() channels' names must be free individuallynicodvb2007-12-151-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25417 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic: indent after r25415ben2007-12-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25416 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not override *file_format if already set by asf_streaming_start()ben2007-12-151-0/+1
| | | | | | | | | | | | | ASX files containing a playlist were probably not playable at all. Fixes playback of the following: http://www.impek.com/go/oldcartoontv/wm http://www.impek.tv/go/soul/wm http://www.impek.com/go/tropical2/wm http://www.impek.com/go/mizik/wm git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25415 b3059339-0415-0410-9bf9-f77b7e298cf2
* pa_stream_write reportedly needs locking of the main loopreimar2007-12-151-1/+3
| | | | | | | (could not find official documentation on this subject...) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25414 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix indentationreimar2007-12-151-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25413 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless pa_stream_trigger callreimar2007-12-151-10/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25412 b3059339-0415-0410-9bf9-f77b7e298cf2
* Documentation for waitop functionreimar2007-12-151-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25411 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the end_sector accessable (it should be).ulion2007-12-151-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25410 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add auto-update property for property menu item.ulion2007-12-151-9/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25409 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed the obscene priv->stream entry. Someone must have injected vodka in ↵nicodvb2007-12-152-5/+3
| | | | | | my milk when I wrote it git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25408 b3059339-0415-0410-9bf9-f77b7e298cf2
* get rid of the file-static dvb_config and free the config at close() . ↵nicodvb2007-12-153-10/+24
| | | | | | Patch by Andrew Calkin and me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25407 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only read disc info once and save it for later using.ulion2007-12-151-17/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25406 b3059339-0415-0410-9bf9-f77b7e298cf2
* dvb cleanup: call dvb_(set|step)_channel() without dereferencing ↵nicodvb2007-12-154-28/+14
| | | | | | stream->priv (1000l to me) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25405 b3059339-0415-0410-9bf9-f77b7e298cf2
* The buffer used for pread need be aligned, but currently it got an offset 23ulion2007-12-151-1/+1
| | | | | | | | | | | to the structure head. This will cause the pread always got random data on some machines (such as my iMac G5 PPC with 10.5 os) so can not play vcd. I also tried use DKIOCCDREAD ioctl call, but the result is same -- buffer need be aligned. It could be a bug of os x or its dev lib. Now fix this problem by move the buffer to a good aligned position in structure. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25404 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get end position of last track by adding its starting address with track size.ulion2007-12-151-2/+17
| | | | | | | On some darwin system, we can not get the lead out track info. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25403 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace printf with mp_msg.ulion2007-12-151-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25402 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with some of the latest commitsgpoirier2007-12-141-3/+110
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25401 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always enable largefile support by defaultuau2007-12-141-2/+2
| | | | | | | | | | | The largefile configure option was disabled by default, but the enabled-by-default dvdread and dvdcss options force in on (dvdnav code also tries to enable it, but sets the variable too late so that is has no effect). Change configure to enable largefile support independently of other options unless explicitly disabled. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25400 b3059339-0415-0410-9bf9-f77b7e298cf2
* implemented frame selection for savage driverben2007-12-141-0/+20
| | | | | | | | synchronized with vidix.sf.net r325 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25399 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix frame size calculationben2007-12-141-63/+41
| | | | | | | | synchronized with vidix.sf.net r325 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25398 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove useless code partsben2007-12-141-54/+0
| | | | | | | | synchronized with vidix.sf.net r325 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25397 b3059339-0415-0410-9bf9-f77b7e298cf2
* bgr24 and bgr32 supportben2007-12-141-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25396 b3059339-0415-0410-9bf9-f77b7e298cf2
* rgb -> bgrben2007-12-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25395 b3059339-0415-0410-9bf9-f77b7e298cf2
* register values were already set: simplifyben2007-12-141-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25394 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only print one track info when exactly seeking to the beginning of a track.ulion2007-12-141-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25393 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support chapter in OSD menu.ulion2007-12-146-0/+197
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25392 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support chapter as a property.ulion2007-12-142-35/+80
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25391 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix stream cdda seeks to CD's end and hangs forever bug.ulion2007-12-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25390 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support using unrar executable to access rar-compressed vobsub files.ulion2007-12-147-7/+338
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25389 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: Fix indentation.cehoyos2007-12-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25388 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set correct image format for 24bit "raw " in mov files.cehoyos2007-12-141-1/+7
| | | | | | | Patch by Chas Williams, chas A cmf D nrl D navy D mil git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25387 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add demuxer functions for chapter feature.ulion2007-12-132-0/+81
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25386 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add new audio filter for encoding multi-channel audio into ac3 at runtime.ulion2007-12-135-2/+337
| | | | | | | | And if set first parameter of this filter to 1, it will do ac3 passthrough like hwac3 did. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25385 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: partially reformatted this monstruositynicodvb2007-12-121-33/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25384 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix memleaks; patch by andrew calkin from gmail comnicodvb2007-12-121-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25383 b3059339-0415-0410-9bf9-f77b7e298cf2
* reverted r25323: deprecated by ulion's recent patchesben2007-12-121-8/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25382 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25379ptt2007-12-121-15/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25381 b3059339-0415-0410-9bf9-f77b7e298cf2
* add lagarith codec, someone finally found it in the wild.compn2007-12-121-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25380 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix libass to support -nofontconfig.ulion2007-12-127-9/+31
| | | | | | | | For history reason, fontconfig is auto-enabled when ass is enabled, we keep this behavior and document it clearly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25379 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove ugly and inconsistent uppercasing from filenames.diego2007-12-124-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25378 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move public function declarations together.diego2007-12-121-6/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25377 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing declaration for dct64_altivec, fixes the warning:diego2007-12-121-0/+2
| | | | | | | | | | In file included from layer3.c:1171, from sr1.c:391: decod386.c: In function 'synth_1to1': decod386.c:145: warning: implicit declaration of function 'dct64_altivec' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25376 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix memory leak. I thought asx_get_attrib() return a const char *,ulion2007-12-121-5/+9
| | | | | | | but indeed it return string by strdup. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25375 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix memory leak, reported by Andrew Calkin <andrew P calkin A gmail P com>.ulion2007-12-121-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25374 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove headers not used.ulion2007-12-121-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25373 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add OSD menu keybindings for Apple Remote.ulion2007-12-122-3/+26
| | | | | | | | | Since libmenu is still not enabled by default, we do not change default command of Apple Remote input, only add a comment for using OSD menu with Apple Remote. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25372 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update comment that navigating keys is defined in menu.conf.ulion2007-12-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25371 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace SYS_DARWIN by __APPLE__ and __DARWIN__ where appropriate.diego2007-12-112-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25370 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include <stdio.h>, fixes the warning:diego2007-12-111-0/+1
| | | | | | | | | dct64_altivec.c: In function 'dct64_altivec': dct64_altivec.c:74: warning: implicit declaration of function 'printf' dct64_altivec.c:74: warning: incompatible implicit declaration of built-in function 'printf' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25369 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for xtensa CPU architecturediego2007-12-112-1/+16
| | | | | | | patch by Dan Nicolaescu (dann ics.uci edu), Reimar and me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25368 b3059339-0415-0410-9bf9-f77b7e298cf2
* Slightly simplify preprocessor conditionals.diego2007-12-111-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25367 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ahem, fix breakage of last commit: The AltiVec detection code has threediego2007-12-111-0/+3
| | | | | | | sections, namely OS X, AMIGAOS4 and the rest. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25366 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow osd menu being controlled by joystickben2007-12-112-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25365 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not set SYS_AMIGAOS4, it is unused.diego2007-12-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25364 b3059339-0415-0410-9bf9-f77b7e298cf2
* SYS_AMIGAOS4 --> __AMIGAOS4__diego2007-12-113-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25363 b3059339-0415-0410-9bf9-f77b7e298cf2
* slight consistency change for default DVD device selectiondiego2007-12-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25362 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant condition from list of CD/DVD-ROM devices.diego2007-12-111-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25361 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not set -DSYS_DARWIN, it is unused.diego2007-12-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25360 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace SYS_DARWIN condition by __APPLE__ || __DARWIN__.diego2007-12-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25359 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant and obfuscating preprocessor conditional.diego2007-12-111-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25358 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace SYS_DARWIN conditional by the more correct __APPLE__.diego2007-12-111-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25357 b3059339-0415-0410-9bf9-f77b7e298cf2
* There is a check for altivec.h in configure so use the preprocessor directivediego2007-12-114-4/+4
| | | | | | | set by configure instead of an OS-specific directive when #including altivec.h. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25356 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace SYS_DARWIN conditional directive around gcc macros by __APPLE_CC__.diego2007-12-113-9/+9
| | | | | | | The macro definition depends on compiler capabilities, not OS features. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25355 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make init_video function in dec_video static, it is not used outside that file.reimar2007-12-112-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25354 b3059339-0415-0410-9bf9-f77b7e298cf2
* Identifiers starting with __ are reserved for the system.diego2007-12-112-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25353 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless HAVE_ALTIVEC around the whole file, it is only compiled whendiego2007-12-111-5/+0
| | | | | | | HAVE_ALTIVEC is set anyway. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25352 b3059339-0415-0410-9bf9-f77b7e298cf2
* Relicense as GPL v2 or later like the rest of liba52.diego2007-12-111-4/+20
| | | | | | | Permission given by Nick Kurshev. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25351 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix spudec to display current vobsub immediately after a seek.ulion2007-12-114-17/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25350 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make up missing changelog for dts wav support.ulion2007-12-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25349 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support to run multiple mplayer commands set in menu.confulion2007-12-113-19/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25348 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add new function for parsing and queueing multi-commands separated by \n or \r.ulion2007-12-112-0/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25347 b3059339-0415-0410-9bf9-f77b7e298cf2
* some changescompn2007-12-101-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25346 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed VIDIX color bug that was introduced when Radeon VIDIX driverben2007-12-101-0/+1
| | | | | | | | | | | | | | was synchronized with vidix.sf.net. The red color was saturating. Corrected value fixes the issue and restore the color to the level it used to have before synchronization. Meaning of the value remains unknow but was retrieved from register's value of a Radeon 9000 card, so it may need further testing. Patch by Guillaume Lecerf (foxcore at gmail dot com) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25345 b3059339-0415-0410-9bf9-f77b7e298cf2
* Dump the ati radeon DISP_MERGE_CNTL register to ease theben2007-12-101-0/+1
| | | | | | | | | debugging of VIDIX color bug. Patch by Guillaume Lecerf (foxcore at gmail dot com) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25344 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix all current known multi-channel wrong order problems by addingulion2007-12-1012-2/+1404
| | | | | | | | | | | common functions for channel reordering. This fixes these modules by adding channel reordering code for 5.0/5.1 audio: ao: pcm ad: dmo, faad, ffmpeg(ac3, dca, libfaad, liba52), pcm ae: faac, lavc(ac3, libfaac), pcm git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25343 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix memory leak that tmp allocated but maybe not used.ulion2007-12-101-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25342 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix printf format string length modifiers, removes about a trillion warnings.diego2007-12-109-355/+355
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25341 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment out unused variable.diego2007-12-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25340 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mylstat() call to parent dir where the subdir has no exec permission.ulion2007-12-101-1/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25339 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused parameters from main(), fixes the warnings:diego2007-12-101-1/+1
| | | | | | | | netstream.c:340: warning: unused parameter 'argc' netstream.c:340: warning: unused parameter 'argv' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25338 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix printf format string length modifiers, removes the warnings:diego2007-12-101-2/+2
| | | | | | | | vivodump.c:213: warning: format '%08X' expects type 'unsigned int', but argument 2 has type 'long int' vivodump.c:220: warning: format '%08X' expects type 'unsigned int', but argument 2 has type 'long int' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25337 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix printf format string length modifiers, removes the warnings:diego2007-12-101-9/+9
| | | | | | | | | | | | | | | | | | asfinfo.c: In function 'print_wave_header': asfinfo.c:114: warning: format '%d' expects type 'int', but argument 2 has type 'long int' asfinfo.c:115: warning: format '%d' expects type 'int', but argument 2 has type 'long int' asfinfo.c: In function 'print_video_header': asfinfo.c:140: warning: format '%d' expects type 'int', but argument 2 has type 'long int' asfinfo.c:141: warning: format '%d' expects type 'int', but argument 2 has type 'long int' asfinfo.c:142: warning: format '%d' expects type 'int', but argument 2 has type 'long int' asfinfo.c:145: warning: format '%d' expects type 'int', but argument 2 has type 'long int' asfinfo.c:146: warning: format '%d' expects type 'int', but argument 2 has type 'long int' asfinfo.c: In function 'main': asfinfo.c:174: warning: format '%X' expects type 'unsigned int', but argument 2 has type 'long int' asfinfo.c:220: warning: format '%d' expects type 'int', but argument 6 has type 'long unsigned int' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25336 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/grammar/wording/formattingdiego2007-12-101-16/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25335 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix my wrong code in r25530.ulion2007-12-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25334 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make up missing header update in r25326.ulion2007-12-101-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25333 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move temp variable declaration into inner loop scope.ulion2007-12-101-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25332 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore heading spaces when parsing command.ulion2007-12-101-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25331 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix missing command line bug by making the input parameter constant.ulion2007-12-101-6/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25330 b3059339-0415-0410-9bf9-f77b7e298cf2
* associate mpeg12 ffourccs to vc_mpegpes (fixes playback with hw mpeg12 ↵nicodvb2007-12-091-0/+2
| | | | | | decoders and demux_lavf) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25329 b3059339-0415-0410-9bf9-f77b7e298cf2
* Combine common code for dealing with file action and dir action.ulion2007-12-091-17/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25328 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use recorded last path only when stat it ok.ulion2007-12-091-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25327 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert vobsub custom colors from rgb to yuv using a common function.ulion2007-12-092-9/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25326 b3059339-0415-0410-9bf9-f77b7e298cf2
* identifiers starting with an underscore are reserved by the C standardben2007-12-081-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25325 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed stupid checksnicodvb2007-12-081-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25324 b3059339-0415-0410-9bf9-f77b7e298cf2
* rework of libmenu open_dir()ben2007-12-081-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25323 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless include added in last commit by mistake.ulion2007-12-081-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25322 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow usage of icc 10.1cehoyos2007-12-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25321 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move vobsub palette->yuv convert code into a common function.ulion2007-12-083-18/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25320 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing declarations for AltiVec functions, fixes the warnings:diego2007-12-081-0/+7
| | | | | | | | | swscale_template.c:1171: warning: implicit declaration of function ‘altivec_yuv2packedX’ swscale.c:1982: warning: implicit declaration of function ‘yuv2rgb_altivec_init_tables’ yuv2rgb.c:652: warning: implicit declaration of function ‘yuv2rgb_init_altivec’ git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25319 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless variable aoIsCreated since we took good care of init failure.ulion2007-12-081-6/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25318 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore y of palette into the same value range as it was in the .ifo file.ulion2007-12-082-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25317 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 'make checkheaders' on AltiVec-enabled systems.diego2007-12-071-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25316 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor spelling/grammar fixesdiego2007-12-061-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25315 b3059339-0415-0410-9bf9-f77b7e298cf2
* cleanup and conformation of values description for -ass-hintingptt2007-12-061-11/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25314 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not PostQuitMessage when destroying a child window.zuxy2007-12-062-16/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25313 b3059339-0415-0410-9bf9-f77b7e298cf2
* suppress silly messages when checktree is not called from the root of the treeivo2007-12-051-1/+1
| | | | | | | | but nevertheless has no specific arguments to work with. it will traverse the tree from there, but obviously cannot find our externals. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25312 b3059339-0415-0410-9bf9-f77b7e298cf2
* only check source code for gnuismsivo2007-12-051-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25311 b3059339-0415-0410-9bf9-f77b7e298cf2
* simpler and more easily expandable test whether we need a shortlist thativo2007-12-051-2/+4
| | | | | | | only contains .[ch] files git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25310 b3059339-0415-0410-9bf9-f77b7e298cf2
* test for presence of .svn directory if we are supposed to traverse the treeivo2007-12-051-0/+7
| | | | | | | | according to svn info .svn might be missing (i.e. after svn export) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25309 b3059339-0415-0410-9bf9-f77b7e298cf2
* three little corrections...ptt2007-12-051-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25308 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial submit for revision... 24% synced with r22753ptt2007-12-051-0/+5326
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25307 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prevent from outputing mass of 'skip' log messages in verbose level.ulion2007-12-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25306 b3059339-0415-0410-9bf9-f77b7e298cf2
* when gathering the list of files to check via svn info, also includeivo2007-12-051-1/+1
| | | | | | | libpostproc. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25305 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync ivtv driver with vidix.sf.net (multiple revisions)ben2007-12-041-402/+472
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25304 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with vidix.sf.net r319: remove useless varsben2007-12-041-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25303 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with vidix.sf.net r317: fixes colorspace issues for vidix savage driverben2007-12-041-18/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25302 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with vidix.sf.net r320: ati radeon >= R5xx do not have overlayben2007-12-041-64/+0
| | | | | | | | engine anymore but use 3D texture mapping instead; hence no chance to be supported by this driver. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25301 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with vidix.sf.net r318: resolve bitfield collision in vidix radeon ↵ben2007-12-041-14/+14
| | | | | | driver (patch by Guillaume Lecerf) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25300 b3059339-0415-0410-9bf9-f77b7e298cf2
* add new configure option to disable VIDIX PCI device name database (saves a ↵ben2007-12-043-4/+22
| | | | | | 300 kB on mplayer binary) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25299 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename demuxer tags to clarifylu_zero2007-12-042-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25298 b3059339-0415-0410-9bf9-f77b7e298cf2
* live555 and libnemesi support coexistslu_zero2007-12-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25297 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l ... the header was used there toolu_zero2007-12-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25296 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove non necessary headerlu_zero2007-12-042-51/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25295 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make libnemesi use specific struct and DEMUXER_TYPElu_zero2007-12-044-5/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25294 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add cleanup codes for init() failure to prevent leak.ulion2007-12-041-20/+61
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25293 b3059339-0415-0410-9bf9-f77b7e298cf2
* When auto loading subs, log warning instead of error for load failure.ulion2007-12-042-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25292 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove hardcoded key->cmd bindings in libmenu, support custom key bindingsulion2007-12-0414-120/+196
| | | | | | | by menu config file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25291 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use correct printf length modifiers, fixes the following warnings:diego2007-12-031-15/+15
| | | | | | | | | | | | | | | | | | | | | | ve_vfw.c: In function 'vfw_start_encoder': ve_vfw.c:182: warning: format '%d' expects type 'int', but argument 2 has type 'long int' ve_vfw.c:183: warning: format '%d' expects type 'int', but argument 2 has type 'long int' ve_vfw.c:184: warning: format '%d' expects type 'int', but argument 2 has type 'long int' ve_vfw.c:187: warning: format '%x' expects type 'unsigned int', but argument 2 has type 'long int' ve_vfw.c:188: warning: format '%d' expects type 'int', but argument 2 has type 'long int' ve_vfw.c:190: warning: format '%d' expects type 'int', but argument 2 has type 'long int' ve_vfw.c:191: warning: format '%d' expects type 'int', but argument 2 has type 'long int' ve_vfw.c:192: warning: format '%d' expects type 'int', but argument 2 has type 'long int' ve_vfw.c:195: warning: format '%x' expects type 'unsigned int', but argument 2 has type 'long int' ve_vfw.c:196: warning: format '%d' expects type 'int', but argument 2 has type 'long int' ve_vfw.c:216: warning: format '%d' expects type 'int', but argument 4 has type 'long int' ve_vfw.c:217: warning: format '%d' expects type 'int', but argument 4 has type 'long int' ve_vfw.c:218: warning: format '%d' expects type 'int', but argument 4 has type 'long int' ve_vfw.c:221: warning: format '%x' expects type 'unsigned int', but argument 4 has type 'long int' ve_vfw.c:222: warning: format '%d' expects type 'int', but argument 4 has type 'long int' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25290 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics/indentationivo2007-12-031-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25289 b3059339-0415-0410-9bf9-f77b7e298cf2
* when gathering the list of files to check via svn info, also includeivo2007-12-031-1/+3
| | | | | | | externals (libav*) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25288 b3059339-0415-0410-9bf9-f77b7e298cf2
* add functions that are not specifically marked as being deprecated or obsolete,ivo2007-12-031-1/+1
| | | | | | | | but which are dangerous to use (possible race conditions, undefined filemode, et cetera; use tmpfile(3) instead). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25287 b3059339-0415-0410-9bf9-f77b7e298cf2
* synchronized with vidix.sf.net r315: remove now useless definesben2007-12-031-24/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25286 b3059339-0415-0410-9bf9-f77b7e298cf2
* synchronized with vidix.sf.net r315: update savage driver pci ids listben2007-12-031-8/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25285 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncd with r25278ptt2007-12-031-3/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25284 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25282Gabrov2007-12-035-20/+64
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25283 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, len may change after initialization timerfelker2007-12-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25282 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix declaration after statement, take 2rfelker2007-12-031-9/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25281 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix declaration after statementrfelker2007-12-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25280 b3059339-0415-0410-9bf9-f77b7e298cf2
* Skip empty vobsub streams when selecting subtitles.ulion2007-12-034-10/+63
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25279 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix typocorey2007-12-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25278 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix custom palette format from rgb to yuv, we use it as yuv in the spudec.ulion2007-12-031-2/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25277 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variables, fixes the warnings:diego2007-12-021-2/+1
| | | | | | | | | mplayer/gtk/fs.c:428: warning: unused variable 'j' mplayer/gtk/fs.c:428: warning: unused variable 'size' mplayer/gtk/fs.c:426: warning: unused variable 'str' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25276 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of some useless extra ()reimar2007-12-021-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25275 b3059339-0415-0410-9bf9-f77b7e298cf2
* mime_type_table is const as wellreimar2007-12-022-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25274 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a few forgotten static/const attributes in tvi_vbi.creimar2007-12-021-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25273 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make wsKeyNames array constreimar2007-12-022-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25272 b3059339-0415-0410-9bf9-f77b7e298cf2
* evNames / evBoxs should be "static const"reimar2007-12-022-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25271 b3059339-0415-0410-9bf9-f77b7e298cf2
* stream_opts arrays should be constreimar2007-12-0213-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25270 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make m_option_t arrays referenced by cfg-common.h constreimar2007-12-028-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25269 b3059339-0415-0410-9bf9-f77b7e298cf2
* Table of ID3 genres should be const as wellreimar2007-12-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25268 b3059339-0415-0410-9bf9-f77b7e298cf2
* Format mapping table should be constreimar2007-12-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25267 b3059339-0415-0410-9bf9-f77b7e298cf2
* Preserve unsv:// protocol specifier over http redirects.reimar2007-12-021-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25266 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix playback of streams with more than one video track (only one supported).cehoyos2007-12-021-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25265 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of fsPressed variable and related code. It does not reallyreimar2007-12-021-24/+0
| | | | | | | | have a function and some of the related code is hopelessly broken (hand-implemented strrchr, writing to a const char* etc). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25264 b3059339-0415-0410-9bf9-f77b7e298cf2
* Parameter of Filter function can be const, removes the warningreimar2007-12-021-1/+1
| | | | | | | mplayer/gtk/fs.c:197: warning: passing argument 1 of 'Filter' discards qualifiers from pointer target type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25263 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix return type of getGtkEntryText, it must be constreimar2007-12-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25262 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the main m_option_t arrays constreimar2007-12-023-20/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25261 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add appropriate const specifiers to some custom parse functions.reimar2007-12-023-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25260 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move fakemono extern to cfg-common.h where it is actually used.reimar2007-12-023-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25259 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless ifdefs around extern declarationsreimar2007-12-023-65/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25258 b3059339-0415-0410-9bf9-f77b7e298cf2
* Option print functions may not and do not modify valuereimar2007-12-022-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25257 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not queue empty cmd.ulion2007-12-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25256 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark more m_option_t uses as constreimar2007-12-022-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25255 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of some "discards qualifiers" warningsreimar2007-12-021-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25254 b3059339-0415-0410-9bf9-f77b7e298cf2
* First try to mark some things in m_config correctly as constreimar2007-12-022-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25253 b3059339-0415-0410-9bf9-f77b7e298cf2
* get/set video colors string is constantreimar2007-12-023-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25252 b3059339-0415-0410-9bf9-f77b7e298cf2
* vf_equalizer_t string is constantreimar2007-12-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25251 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make osd font constreimar2007-12-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25250 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make all vf_info_t structs constreimar2007-12-0270-71/+71
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25249 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark the vo_functions_t definitions as const where possible.reimar2007-12-0238-38/+38
| | | | | | | | This is not possible for xover and anything supporting vidix due to horrible hacks. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25248 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark several uses of vo_functions_t as const to stop some of the currentreimar2007-12-0212-20/+20
| | | | | | | hacks e.g. in vidix code from spreading. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25247 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove completely outdated commented-out codereimar2007-12-021-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25246 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some spelling typosdiego2007-12-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25245 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make vo info structs constreimar2007-12-0246-46/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25244 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove last remains of long-gone VOCTRL_SCREENSHOTreimar2007-12-022-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25243 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove video_out_png extern in vo_vesa (remains of ill-advisedreimar2007-12-021-4/+0
| | | | | | | vo-based screenshot function). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25242 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove casts that are (no longer) necessaryreimar2007-12-021-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25241 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use proper type for vidix_preinit parameter instead of void *reimar2007-12-022-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25240 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark all stream_info_t as constreimar2007-12-0225-53/+53
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25239 b3059339-0415-0410-9bf9-f77b7e298cf2
* When IFO file is opened (detected by extension), set dvd-device to IFO file'svoroshil2007-12-022-0/+45
| | | | | | | | | | | | | | | | | | directory and start dvd:// stream instead of file://. If VTS_<N>_*.IFO is opened, open stream as dvd://<N> As Nico Sabbi said: There is no no guarantie that title N is in titleset N, but there are at least good chances. The main purpose of this patch is ability to load DVDs, stored on HDD, using OSD menu. Modified patch from Benjamin Zores ben at geexbox dot org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25238 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make auto_open_streams array itself constreimar2007-12-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25237 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add type info to menu_t, now we can get the menu name and the type name of menu.ulion2007-12-022-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25236 b3059339-0415-0410-9bf9-f77b7e298cf2
* auto_open_streams should have const type, fix also the places where it is usedreimar2007-12-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25235 b3059339-0415-0410-9bf9-f77b7e298cf2
* Finally replace get_uint?? by AV_RL??reimar2007-12-011-35/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25234 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of annoying, space-wasting sizeof(uint32_t)reimar2007-12-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25233 b3059339-0415-0410-9bf9-f77b7e298cf2
* Bigendian fix for ogg in AVIreimar2007-12-011-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25232 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a loop instead of doing the same thing three timesreimar2007-12-011-14/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25231 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a pointer variable for extradata to simplify init_avi_with_oggreimar2007-12-011-4/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25230 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set sh_video->format when parsing aviheader, otherwise it might neverreimar2007-12-011-0/+1
| | | | | | | be set correctly when using demux_demuxers (like with ogg stream in AVI). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25229 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some pointless castsreimar2007-12-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25228 b3059339-0415-0410-9bf9-f77b7e298cf2
* Create correct extradata for vorbis audio when used as avi sub-demuxerreimar2007-12-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25227 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some typos in comments, grammar is still bad.reimar2007-12-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25226 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typos in comments to stop them hurting my eyesreimar2007-12-011-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25225 b3059339-0415-0410-9bf9-f77b7e298cf2
* at startup show audio and subtitle streams available in the chosen title ↵nicodvb2007-12-011-0/+52
| | | | | | with all their properties git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25224 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix ao_null with float samplesuau2007-12-011-1/+1
| | | | | | | | | | | ao_null accepts float input, but the code calculating ao_data.bps only checked for 1-byte formats and used samplesize 2 for everything else. Because ao_null uses the bps value in its timing calculations this effectively made "playback" advance at half the correct speed. Fixed by calculating samplesize with af_fmt2bits() instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25223 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_null: Make duration of "buffered" audio constantuau2007-12-011-5/+5
| | | | | | | | | Choose the "buffer size" for the amount of audio the driver accepts so that it corresponds to about 0.2 seconds of playback based on the number of channels, sample size and samplerate. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25222 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplifymichael2007-11-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25221 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l for me. I should read my own comments just above it ;)ivo2007-11-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25220 b3059339-0415-0410-9bf9-f77b7e298cf2
* less code for initializing default settingsivo2007-11-301-21/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25219 b3059339-0415-0410-9bf9-f77b7e298cf2
* add test for deprecated and obsolete functionsivo2007-11-301-2/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25218 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make outburst and buffersize depend on channel count.reimar2007-11-301-2/+2
| | | | | | | | This should reduce the number of case where to much audio is buffered ahead thus breaking interleaving. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25217 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, bzero is deprecated, use memset insteadreimar2007-11-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25216 b3059339-0415-0410-9bf9-f77b7e298cf2
* this variable was nothing but a useless memleakben2007-11-301-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25215 b3059339-0415-0410-9bf9-f77b7e298cf2
* this local variable can be staticben2007-11-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25214 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove stray line that slipped through in last commit.ulion2007-11-301-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25213 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:ulion2007-11-301-3/+4
| | | | | | | | | | | spudec.c: In function 'spudec_assemble': spudec.c:353: warning: 'current_nibble[0]' may be used uninitialized in this function spudec.c:353: warning: 'current_nibble[1]' may be used uninitialized in this function spudec.c:352: warning: 'end_pts' may be used uninitialized in this function spudec.c:351: warning: 'start_pts' may be used uninitialized in this function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25212 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment some #endif directives.diego2007-11-301-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25211 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for Apple's yuv2 raw formatreimar2007-11-302-0/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25210 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add the correct format substitutions to make the raw decodersreimar2007-11-301-18/+18
| | | | | | | work with QuickTime files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25209 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support double buffering, fix osd flicker.ulion2007-11-302-5/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25208 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix play window not get actived problem on Leopard.ulion2007-11-301-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25207 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore empty event.ulion2007-11-291-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25206 b3059339-0415-0410-9bf9-f77b7e298cf2
* -identify also shows the duration(s) of the title(s)nicodvb2007-11-291-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25205 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: moved identification code to a separate functionnicodvb2007-11-291-8/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25204 b3059339-0415-0410-9bf9-f77b7e298cf2
* Proper license header.ivo2007-11-291-11/+13
| | | | | | | GPL v2 or later instead of just v2. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25203 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant changelog from commentsivo2007-11-291-9/+17
| | | | | | | | Add proper license header Proper copyright notices git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25202 b3059339-0415-0410-9bf9-f77b7e298cf2
* Proper license header.ivo2007-11-291-2/+14
| | | | | | | Change license from strict version 2 to version 2 or later. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25201 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant changelog comments. There's always svn log.ivo2007-11-291-11/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25200 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant changelog from comments. There's always svn log.ivo2007-11-291-33/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25199 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix multiple inclusion guards, identifiers starting with __ are reserveddiego2007-11-292-6/+6
| | | | | | | for the system. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25198 b3059339-0415-0410-9bf9-f77b7e298cf2
* Even when vobsub is forced, .ifo file is still not necessary,ulion2007-11-291-1/+1
| | | | | | | so change the log level from error to warning. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25197 b3059339-0415-0410-9bf9-f77b7e298cf2
* when no title is chosen -identify all titles present in the dvdnicodvb2007-11-291-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25196 b3059339-0415-0410-9bf9-f77b7e298cf2
* with -identify show the title being describednicodvb2007-11-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25195 b3059339-0415-0410-9bf9-f77b7e298cf2
* -identify shows chapters times when playing dvd streamsnicodvb2007-11-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25194 b3059339-0415-0410-9bf9-f77b7e298cf2
* -identify chapters of chosen titlenicodvb2007-11-281-0/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25193 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24924: Add audio filter scaletempovoroshil2007-11-281-6/+97
| | | | | | | | | | | | | r24950: Explain new ao_pulse option syntax r24952: Escape some more '-' where appropriate. r24953: one more '-' escape, wording fix r24954: another round of '-' escapes r25134: Fix a wrong cmdline example of using -menu-chroot. r25179: Add missing forced linebreak, slight wording improvement. r25189: Add an example for play DTS-CD with passsthrough. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25192 b3059339-0415-0410-9bf9-f77b7e298cf2
* r25011: a couple of tricks to improve playback resistance and usability of ↵voroshil2007-11-283-11/+39
| | | | | | | | | | | | | | dvb streams r25012: small rephrasing r25016: & => &amp; r25017: wording/grammar/spelling/formatting r25119: Put colon inside replaceable tag. r25123: vcd://<n> now works for MinGW32 too, hence the updated doc r25146: Clarify playtree explanation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25191 b3059339-0415-0410-9bf9-f77b7e298cf2
* r25058: Add missed translatable string in my previous commitvoroshil2007-11-281-2/+7
| | | | | | | | r25059: report why the dvd couldn't be opened. Patch by Jan Knutar jknutar+nic+fi r25158: Make up missed update for osd message. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25190 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an example for play DTS-CD with passsthrough.ulion2007-11-281-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25189 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correct VCD track no. calculation on Windows.zuxy2007-11-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25188 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid gcc warning:zuxy2007-11-281-1/+1
| | | | | | | | vcd_read_win32.h:61: warning: format '%u' expects type 'unsigned int', but argument 4 has type 'DWORD' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25187 b3059339-0415-0410-9bf9-f77b7e298cf2
* Return correct length in ID_VCD_TRACK_n_MSFzuxy2007-11-281-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25186 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set protocol for the vo proxy used in shared-buffer mode.ulion2007-11-282-6/+31
| | | | | | | | | | | | | | | | | | | | NOTE: You have to update your mplayerosx to svn r148 or newer to work with it. This change will speed up vo proxy and fix all these warnings: vo_macosx.m: In function 'config': vo_macosx.m:165: warning: 'NSProxy' may not respond to '-startWithWidth:withHeight:withBytes:withAspect:' vo_macosx.m:165: warning: (Messages without a matching method signature vo_macosx.m:165: warning: will be assumed to return 'id' and accept vo_macosx.m:165: warning: '...' as arguments.) vo_macosx.m: In function 'flip_page': vo_macosx.m:183: warning: 'NSProxy' may not respond to '-render' vo_macosx.m: In function 'uninit': vo_macosx.m:235: warning: 'NSProxy' may not respond to '-stop' vo_macosx.m: In function 'control': vo_macosx.m:334: warning: 'NSProxy' may not respond to '-ontop' vo_macosx.m:336: warning: 'NSProxy' may not respond to '-toggleFullscreen' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25185 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable -rtsp-port for nemesilu_zero2007-11-272-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25184 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove stray varlu_zero2007-11-271-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25183 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25179ptt2007-11-271-5/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25182 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added myself, as suggested by Diego.ulion2007-11-271-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25181 b3059339-0415-0410-9bf9-f77b7e298cf2
* Takeover as maintainer of mplayer osx port with Nicolas' blessing.ulion2007-11-271-2/+4
| | | | | | | Nicolas will still take care of the MPlayer OS X frontend. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25180 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing forced linebreak, slight wording improvement.diego2007-11-271-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25179 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use const char * to replace a char * parameter.ulion2007-11-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25178 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:ulion2007-11-271-2/+2
| | | | | | | | | ad_hwac3.c: In function 'decode_audio_dts': ad_hwac3.c:499: warning: passing argument 1 of 'convert_14bits_to_16bits' from incompatible pointer type ad_hwac3.c:499: warning: passing argument 2 of 'convert_14bits_to_16bits' from incompatible pointer type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25177 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24954ptt2007-11-261-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25176 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24604ptt2007-11-261-1/+97
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25175 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24346ptt2007-11-261-12/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25174 b3059339-0415-0410-9bf9-f77b7e298cf2
* was synced to r25017, my fault sorryptt2007-11-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25173 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25011ptt2007-11-261-1/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25172 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r25146ptt2007-11-261-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25171 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 25158ptt2007-11-261-1/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25170 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l in play_tree_parser_get_line, check that there actually isreimar2007-11-261-1/+1
| | | | | | | | a previous character before comparing it against '\r'. Fixes a possible crash on playlist file that is empty or starts with an empty line. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25169 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace http:// URLs in asx files by mmshttp://.reimar2007-11-261-0/+8
| | | | | | | Avoid some infinite-loop problems when stream and playlist have the same URL. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25168 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify convert_14bits_to_16bits function in ad_hwac3reimar2007-11-261-18/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25167 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing '\n' in tv scanner results output.voroshil2007-11-261-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25166 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning on Leopard, tested ok on Tiger:ulion2007-11-261-1/+1
| | | | | | | | vo_macosx.m: In function '-[MPlayerOpenGLView config]': vo_macosx.m:387: warning: passing argument 1 of 'setValues:forParameter:' from incompatible pointer type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25165 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning:ulion2007-11-261-1/+2
| | | | | | | vo_macosx.m:251: warning: ISO C90 forbids mixed declarations and code git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25164 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support stream redirection from http to mms, fix bug #927.ulion2007-11-263-5/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25163 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix code to make sure the browse starting path within the menu-chroot path.ulion2007-11-261-16/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25162 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, removing the conditional bitfields from (audio|sub)_mapping_t requires ↵nicodvb2007-11-251-0/+4
| | | | | | the big->native conversion git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25161 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore copyright/license notices that were stripped off.diego2007-11-2518-0/+603
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25160 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove mapdev.vxd. It is a non-free Win9x/DOS binary and its usage remainsdiego2007-11-253-76/+0
| | | | | | | | | obscure. In the unlikely case that someone should need it, it is archived at http://www1.mplayerhq.hu/MPlayer/contrib/win32/ Blessed by Benjamin. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25159 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make up missed update for osd message.ulion2007-11-251-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25158 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support select subtitle by source, add 4 properties:ulion2007-11-254-2/+228
| | | | | | | | | | | | | 1. sub_source for current sub source (sub file, vobsub, or from demuxer). 2. sub_file for all subtitles from files. 3. sub_vobsub for all subtitles from vobsub. 4. sub_demux for all subtitles from demuxer. Now mplayer can supply a stable and clear interface to external programs using mplayer in slave mode to select a subtitle by its source and its unique id for that source printed by mplayer using -identify parameter. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25157 b3059339-0415-0410-9bf9-f77b7e298cf2
* Since FFmpeg r11077, some muxers/demuxers don't exist in libavformat anymore.cehoyos2007-11-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25156 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert r25089 (Ignore video formats which are supported by devicevoroshil2007-11-241-14/+3
| | | | | | | | | | | | | | but not supported by dshow driver). It prevents code from r25091 (probing undeclared formats) functioning properly: those code is never called if all declared by device formats are unsupported by MPlayer (even if undeclared one is supported). After this revert PVR-150 card should work as expected. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25155 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move requested format at top and shift all oters downvoroshil2007-11-241-8/+11
| | | | | | | | | This method is better with recent negotiation code: requested formats will be checked first. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25154 b3059339-0415-0410-9bf9-f77b7e298cf2
* Сreate empty format arrays in case of error in init_chain_common.voroshil2007-11-241-6/+27
| | | | | | | | | Fixes segfault for cards without audio capture pin in main capture filter. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25153 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support convert 14-bit DTS stream into 16-bit stream if needed,ulion2007-11-241-6/+65
| | | | | | | | so we have space to add the IEC header for it. DTS WAV/CD normally is 14-bit LE format, now we can passthrough it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25152 b3059339-0415-0410-9bf9-f77b7e298cf2
* pgc->subp_control and pgc->audio_control are no more bitfields,nicodvb2007-11-231-20/+0
| | | | | | | | | but plain uint32_t and uint16_t respectively; replaced access to bitfield members with bitmask operations (and removed some ugly macro) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25151 b3059339-0415-0410-9bf9-f77b7e298cf2
* replaced audio_mapping_t and sub_mapping_t with uint16_t and uint32_tnicodvb2007-11-233-55/+6
| | | | | | | | | | respectively: conditional bitfields don't have the slightest chance to be cross-platform, thus they are definitively broken. Fixed the other files to use bitmasks instead of accessing the previous bitfield members git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25150 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix memory leak of image_data.ulion2007-11-231-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25149 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a memory leak when working in shared_buffer mode.ulion2007-11-231-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25148 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check boundary for queue's current_index.ulion2007-11-231-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25147 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify playtree explanation.diego2007-11-231-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25146 b3059339-0415-0410-9bf9-f77b7e298cf2
* Bring (de)muxer_lavf up to date with the libavformat API changes introduced ↵iive2007-11-232-5/+5
| | | | | | | | | | | by FFmpeg commit r11071. Patch for demuxer_lavf.c by Chris Welton - electrostatic_1 at yahoo Patch for muxer_lavf.c by me. Approved by michaelni. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25145 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable Theora supportlu_zero2007-11-231-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25144 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prevent from using data->len when data is NULL (when play() return NULL).ulion2007-11-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25143 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move the setCurrentTexture call into flip_page(), fix osd flicker problem.ulion2007-11-231-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25142 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix half-baked last commit.diego2007-11-221-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25141 b3059339-0415-0410-9bf9-f77b7e298cf2
* don't include anymore the dvdread headers from the dvdnav directorynicodvb2007-11-221-5/+0
| | | | | | | (the right ones are included in the #else). Patch by Rathann git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25140 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove ! operator hack, we require a POSIX-compatible-shell.diego2007-11-221-31/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25139 b3059339-0415-0410-9bf9-f77b7e298cf2
* Invert the logic to check the cmp return value cmp to avoid using the ! ↵diego2007-11-221-1/+1
| | | | | | | | | | | | operator. Useful on non-POSIX shells that do not support the ! operator. We normally require a POSIX-compatible shell, but in this case the change is acceptable since it does not complicate configure nor hurt readability. patch by Ralf Menzel, menzel ls6.cs.uni-dortmund de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25138 b3059339-0415-0410-9bf9-f77b7e298cf2
* comment spelling/grammar fixesdiego2007-11-221-36/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25137 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention VC-1/WMV MMX speed-up in the changeloggpoirier2007-11-221-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25136 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation error.iive2007-11-221-1/+1
| | | | | | | | | FFmpeg commit r11071 removed the static ByteIOContext from AVFormatContext and replaced it with a dynamic one. Thus muxer_lavf.c needs to be modified to reflect the change. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25135 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a wrong cmdline example of using -menu-chroot.ulion2007-11-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25134 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compilation fix (typo)voroshil2007-11-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25133 b3059339-0415-0410-9bf9-f77b7e298cf2
* AAC support (aac-hbr only)lu_zero2007-11-211-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25132 b3059339-0415-0410-9bf9-f77b7e298cf2
* Media Format to fourcc conversion (from amol)lu_zero2007-11-211-22/+42
| | | | | | | Factorize out some if clauses git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25131 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make hwdts support more dts format identification, 14bits or 16bits, LE or BE.ulion2007-11-211-24/+128
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25130 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename timer-lx.c --> timer-linux.c.diego2007-11-212-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25129 b3059339-0415-0410-9bf9-f77b7e298cf2
* main() --> main(void)diego2007-11-216-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25128 b3059339-0415-0410-9bf9-f77b7e298cf2
* main() --> main(void)diego2007-11-211-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25127 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused function write_psm_block(), fixes the warning:diego2007-11-211-19/+0
| | | | | | | muxer_mpeg.c:763: warning: 'write_psm_block' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25126 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support dump AF_FORMAT_AC3 format.ulion2007-11-211-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25125 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sizes of arpmt and arStreamCaps must be equal.voroshil2007-11-211-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25124 b3059339-0415-0410-9bf9-f77b7e298cf2
* vcd://<n> now works for MinGW32 too, hence the updated doczuxy2007-11-211-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25123 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move code related to chain initialization and similarvoroshil2007-11-201-80/+78
| | | | | | | | for different chains to separate routine. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25122 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mplayer crash caused by r25116voroshil2007-11-201-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25121 b3059339-0415-0410-9bf9-f77b7e298cf2
* Musepack SV8 lavc decoder supportkostya2007-11-202-0/+9
| | | | | | | Patch okayed by Diego on IRC git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25120 b3059339-0415-0410-9bf9-f77b7e298cf2
* Put colon inside replaceable tag.diego2007-11-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25119 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove no more needed checkvoroshil2007-11-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25118 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix totally wrong (due to mess of brackets) structures size check.voroshil2007-11-201-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25117 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace several parameters for get_available_formats_streamvoroshil2007-11-201-60/+24
| | | | | | | and get_available_formats_pin with one chain structure. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25116 b3059339-0415-0410-9bf9-f77b7e298cf2
* New routine for reconnecting two pins with new media typevoroshil2007-11-191-23/+68
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25115 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move pointer to SampleGrabber filter into chain structure.voroshil2007-11-191-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25114 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move common chain uninit code into separate routine.voroshil2007-11-191-52/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25113 b3059339-0415-0410-9bf9-f77b7e298cf2
* pass chain structure instead of several variables to build_sub_graphvoroshil2007-11-191-18/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25112 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix missed changevoroshil2007-11-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25111 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add capture filter's pointer to vbi chain structure too.voroshil2007-11-191-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25110 b3059339-0415-0410-9bf9-f77b7e298cf2
* Code unification: get rid of local variable arpmtVBIvoroshil2007-11-191-4/+11
| | | | | | | | and use chain structure's arpmt member. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25109 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add major media type to chain structurevoroshil2007-11-191-6/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25108 b3059339-0415-0410-9bf9-f77b7e298cf2
* One step of code cleanup: move all variables, relatedvoroshil2007-11-191-204/+221
| | | | | | | | | to audio/video/vbi chains of filters into separate structure (will simplify some parts of code in future) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25107 b3059339-0415-0410-9bf9-f77b7e298cf2
* Let NSApp handle events when uninit to fix the delay dealloc bug of mpGLView.ulion2007-11-191-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25106 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l: Fix long standing copy-paste error:voroshil2007-11-191-1/+1
| | | | | | | TUN_SET_NORM should set norm value not get it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25105 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add padding and unroll loop 4x for at least another 10% speedupreimar2007-11-181-4/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25104 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change to a 64 bit accumulation variable instead of shifting.reimar2007-11-181-5/+5
| | | | | | | | Changing the way the loop is done is necessary to reduce register pressure. About 20% speedup even on 32 bit x86. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25103 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, *ppc++ was supposed to be replaced by ppc[i] in r25100, but that is ↵reimar2007-11-181-2/+0
| | | | | | | | | | not any faster. Just removing the += s->samples_overlap - s->num_channels; still provides a ca. 20% speedup on x86 (AThlon X2 64) with gcc 3.4 (compiler stupidity?) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25102 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use "long" instead of "int" for innermost loop variable.reimar2007-11-181-1/+2
| | | | | | | About 12% faster on x86_64 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25101 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rearrange scaletempo inner loop.reimar2007-11-181-2/+5
| | | | | | | Speedup on x86 with gcc 3.4 36%, on x86_64 with gcc 4.1 5% git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25100 b3059339-0415-0410-9bf9-f77b7e298cf2
* warn users to disable dvdread internal (at least for the moment: there'snicodvb2007-11-181-1/+3
| | | | | | | | something that prevents the correct identification of languages that I don't have time to investigate right now) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25099 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, someone mixed up && and ||, so if allocation of only one buffers failedreimar2007-11-181-1/+1
| | | | | | | that would not be detected. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25098 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid some casts by changing int8_t* to void* in af_scaletemporeimar2007-11-181-25/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25097 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add all passed to VID_SET_FORMAT formats to the end ofvoroshil2007-11-181-2/+27
| | | | | | | | | | | | | | | | available format list (but report call as failed, to continue checking formats). This gives small chance to build graph even if device does not report about particular format as supported. This makes mplayer be able to work with PVR-150 card (card's driver does not report about yuy2 format, but accepts connection and works with it). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25096 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ensure that when VID_GET_FORMAT ioctl is called,voroshil2007-11-181-0/+5
| | | | | | | | | | video chain in graph is ready built. Otherwise driver can return one format while graph builder will negotiate another. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25095 b3059339-0415-0410-9bf9-f77b7e298cf2
* (cosmetics) Indentation fix of previous commit.voroshil2007-11-181-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25094 b3059339-0415-0410-9bf9-f77b7e298cf2
* New media format negotiation code:voroshil2007-11-181-2/+14
| | | | | | | | | | | | | | loop through all available formats trying to establish connection between pins. Negotiation stops either when all formats are rejected (error reported in this case) or when connection is established (which can happen only when current media format is accepted by both of the pins). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25093 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move setting media format code voroshil2007-11-181-7/+6
| | | | | | | closer to connection establishment routine. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25092 b3059339-0415-0410-9bf9-f77b7e298cf2
* Pass all available formats to chain building routine andvoroshil2007-11-181-18/+30
| | | | | | | | | | | | | | | | establish connection with first of available formats. This will make further format negotiation patch slightly simpler. To avoid pins connection error due to unsuported format at top of the list, put requested video format to the top of list. This will also useful with upcoming patch - negotiation will be started from requested format. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25091 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, fix uint32_t* instead of uint32_t typo in demux_mf type->fourcc tablereimar2007-11-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25090 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore video formats which are supported by devicevoroshil2007-11-181-3/+14
| | | | | | | | but not supported by dshow driver. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25089 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix crash when pin connection fails.voroshil2007-11-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25088 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prevent chains from building more than once.voroshil2007-11-181-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25087 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle "out of memory" error.voroshil2007-11-181-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25086 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move chains building code into separate routines.voroshil2007-11-181-18/+71
| | | | | | | | | This makes code more readable and will allow building particular chain before start(). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25085 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a wish which is available in some filters and players on win32.ulion2007-11-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25084 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention the new build systemnicodvb2007-11-171-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25083 b3059339-0415-0410-9bf9-f77b7e298cf2
* (cosmetics) Lookup table alignment.voroshil2007-11-171-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25082 b3059339-0415-0410-9bf9-f77b7e298cf2
* Service routine for constructing AM_MEDIA_TYPE structure from voroshil2007-11-171-0/+47
| | | | | | | | given fourcc with help of lookup table. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25081 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable terminating directshow chains with NullRenderer filter,voroshil2007-11-171-0/+7
| | | | | | | | bacause this causes jerky video. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25080 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix bogus bits per pixel values in lookup table.voroshil2007-11-171-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25079 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cleanup sg_io_hdr initialization a bitreimar2007-11-171-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25078 b3059339-0415-0410-9bf9-f77b7e298cf2
* We do not have any use for the sense data, so we don't need a buffer for it.reimar2007-11-171-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25077 b3059339-0415-0410-9bf9-f77b7e298cf2
* (cosmetics) Indentation fixvoroshil2007-11-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25076 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some more cosmeticsreimar2007-11-171-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25075 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move the zeroing directly before the other initialization codereimar2007-11-171-3/+3
| | | | | | | for the array/struct git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25074 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move everything that sets buffer values together.reimar2007-11-171-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25073 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another place that can use AV_WB32reimar2007-11-171-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25072 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some cosmetics in dvd_set_speedreimar2007-11-171-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25071 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move the DVD speed factor -> KB/s conversion into the casereimar2007-11-171-4/+3
| | | | | | | branch where it is actually used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25070 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a missing close() to dvd_set_speed functionreimar2007-11-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25069 b3059339-0415-0410-9bf9-f77b7e298cf2
* Open device file only right before we need it, so we do notreimar2007-11-171-5/+5
| | | | | | | have to add close to all the abort code-paths git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25068 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not print Ok message when setting speed limit failedreimar2007-11-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25067 b3059339-0415-0410-9bf9-f77b7e298cf2
* AV_WB16(..., 1000) more obviously represents one second that assigningreimar2007-11-171-2/+3
| | | | | | | 0x03 and 0xe8 (0x3e8 = 1000). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25066 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use AV_WB32 instead of manual bit-fiddling when setting DVD speedreimar2007-11-171-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25065 b3059339-0415-0410-9bf9-f77b7e298cf2
* GPCMD_SET_STREAMING command is 12 bytes large, not 16reimar2007-11-171-1/+1
| | | | | | | Patch by Sebastian Kemper (sebastian_ml gmx net) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25064 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore stream id when checking rdt packet flagsrtogni2007-11-171-1/+1
| | | | | | | Fixes bugzilla #930 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25063 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a pointless #ifdefreimar2007-11-171-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25062 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace if-else constructs for type -> fourcc mapping by a table in demux_mfreimar2007-11-171-13/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25061 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix pausing_toggle not continue play bug when it follows a pause immediately.ulion2007-11-171-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25060 b3059339-0415-0410-9bf9-f77b7e298cf2
* report why the dvd couldn't be opened. Patch by Jan Knutar jknutar+nic+finicodvb2007-11-163-5/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25059 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missed translatable string in my previous commitvoroshil2007-11-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25058 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure that mplayer will receive actual media typevoroshil2007-11-161-0/+13
| | | | | | | instead of requested value. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25057 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix FPS from bitrate calculation (was 8 times larger than real value).voroshil2007-11-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25056 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print warning about encrypted audio tracksrtogni2007-11-151-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25055 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove the pause filter and the cmd queue hack, to know the mplayer going toulion2007-11-153-29/+16
| | | | | | | | pause by checking mpctx directly. If there's any video update before the pause then capture the frame or fallback to use last captured frame as pausing frame. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25054 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed forgotten and out of date commentnicodvb2007-11-141-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25053 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed unneeded checks on MP_DVDNAV and DVDNAV_FORMAT_AC3 (we need and ↵nicodvb2007-11-141-4/+0
| | | | | | assume our fork) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25052 b3059339-0415-0410-9bf9-f77b7e298cf2
* reindentationnicodvb2007-11-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25051 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed unneeded checks on the version of dvdnav (the acceptance ofnicodvb2007-11-141-6/+0
| | | | | | | --minilibs guarantees it's ok) and unneeded assignments git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25050 b3059339-0415-0410-9bf9-f77b7e298cf2
* change fftiff from untested to workingcompn2007-11-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25049 b3059339-0415-0410-9bf9-f77b7e298cf2
* add tif support to demux_mfcompn2007-11-141-0/+2
| | | | | | | ok'd by diego and reimar git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25048 b3059339-0415-0410-9bf9-f77b7e298cf2
* Not all cards supports changing country code.voroshil2007-11-141-1/+0
| | | | | | | | This patch makes failed call to put_CountryCode non-fatal. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25047 b3059339-0415-0410-9bf9-f77b7e298cf2
* libogg muxer no longer exists in FFmpeg.diego2007-11-141-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25046 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove technical changes as pointed out by uau and diego, another updatecompn2007-11-141-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25045 b3059339-0415-0410-9bf9-f77b7e298cf2
* mencoder has mkv nut and mxf output using lavfcompn2007-11-141-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25044 b3059339-0415-0410-9bf9-f77b7e298cf2
* some updatescompn2007-11-141-8/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25043 b3059339-0415-0410-9bf9-f77b7e298cf2
* The FFmpeg WMV2 decoder is no longer buggy now that J-frames are supported.diego2007-11-131-1/+1
| | | | | | | This change makes it the preferred decoder. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25042 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for second stream presence, fixes single stream playback (from amol)lu_zero2007-11-131-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25041 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l video != audiolu_zero2007-11-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25040 b3059339-0415-0410-9bf9-f77b7e298cf2
* support extradata for audio streamslu_zero2007-11-131-4/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25039 b3059339-0415-0410-9bf9-f77b7e298cf2
* fetch metadata for audio (from amol)lu_zero2007-11-131-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25038 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert stray commit r25027lu_zero2007-11-131-22/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25037 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix typo spotted by coreycompn2007-11-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25036 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove an useless conditional suggested by Emanuele Giaquinta.ulion2007-11-131-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25035 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for second stream presence, fixes single stream playback (from amol)lu_zero2007-11-131-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25034 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing call to audio_in_uninit in v4l2 tv driver.voroshil2007-11-131-0/+2
| | | | | | | | | | Without it, tv does not start on the second run when using mplayer in slave or idle mode. Patch by Stanislaw Jesmanowicz stan at jesmanowicz dot com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25033 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace stupid "unsigned long" by the correct uint32_t.reimar2007-11-121-21/+21
| | | | | | | | Makes 2xsai work on 64 bit architectures (displayed video doubled horizontally before). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25032 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use proper inttypes.h types instead of broken uint32 etc. definesreimar2007-11-121-13/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25031 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l video != audiolu_zero2007-11-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25030 b3059339-0415-0410-9bf9-f77b7e298cf2
* support extradata for audio streamslu_zero2007-11-121-5/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25029 b3059339-0415-0410-9bf9-f77b7e298cf2
* fetch metadata for audio (from amol)lu_zero2007-11-121-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25028 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for mpeg4video-es (from dario)lu_zero2007-11-121-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25027 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix forcefps (from amol)lu_zero2007-11-121-4/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25026 b3059339-0415-0410-9bf9-f77b7e298cf2
* Refactor demux_nemesi (from amol)lu_zero2007-11-121-61/+71
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25025 b3059339-0415-0410-9bf9-f77b7e298cf2
* unaligned store, should fix bug #893lu_zero2007-11-111-3/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25024 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prefer DMO Windows Media codecs over the DShow ones. They are considerablydiego2007-11-111-21/+21
| | | | | | | faster and can play 703.wmv where the DShow codecs fail. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25023 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless definition.ulion2007-11-111-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25022 b3059339-0415-0410-9bf9-f77b7e298cf2
* OGG_MUXER was renamed to LIBOGG_MUXER in FFmpeg.diego2007-11-111-1/+1
| | | | | | | patch by Glen Nakamura, glen imodulo com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25021 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better handling of win32 GUI thread:zuxy2007-11-111-6/+8
| | | | | | | | | | | 1. Use _beginthreadex to create the GUI thread to avoid possible memory leak when linked to MS CRT. 2. Terminate the GUI thread in an cleaner way using PostThreadMessage() rather than the unrecommended TerminateThread(). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25020 b3059339-0415-0410-9bf9-f77b7e298cf2
* Indent fix for last change.ulion2007-11-111-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25019 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support mute when passthrough to digital output.ulion2007-11-111-3/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25018 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording/grammar/spelling/formattingdiego2007-11-101-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25017 b3059339-0415-0410-9bf9-f77b7e298cf2
* & => &amp;nicodvb2007-11-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25016 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of M$ silliness.diego2007-11-101-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25015 b3059339-0415-0410-9bf9-f77b7e298cf2
* at the end of open() warn users that seeking won't work correctly if the ↵nicodvb2007-11-101-0/+2
| | | | | | cache is enabled git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25014 b3059339-0415-0410-9bf9-f77b7e298cf2
* switch_audio works with many other formats than describednicodvb2007-11-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25013 b3059339-0415-0410-9bf9-f77b7e298cf2
* small rephrasingnicodvb2007-11-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25012 b3059339-0415-0410-9bf9-f77b7e298cf2
* a couple of tricks to improve playback resistance and usability of dvb streamsnicodvb2007-11-101-0/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25011 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make crash-debug gdb auto-execute "bt"reimar2007-11-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25010 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore terminal for gdb with -crash-debug by calling getch2_disable()reimar2007-11-101-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25009 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix dead lock when changing and restoring stream format for digital output,ulion2007-11-101-31/+14
| | | | | | | replaced with lockless code. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25008 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make page up and down with proper page size instead of always 10 rows.ulion2007-11-102-12/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25007 b3059339-0415-0410-9bf9-f77b7e298cf2
* J/X8-Frames in WMV2 are finally supported!reimar2007-11-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25006 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header files, fixes the warnings:diego2007-11-092-0/+2
| | | | | | | | | | | | | | | | | | | | In file included from vf_mcdeint.c:59: ../libavcodec/dsputil.h: In function 'copy_block2': ../libavcodec/dsputil.h:675: warning: implicit declaration of function 'AV_WN16' ../libavcodec/dsputil.h:675: warning: implicit declaration of function 'AV_RN16' ../libavcodec/dsputil.h: In function 'copy_block4': ../libavcodec/dsputil.h:686: warning: implicit declaration of function 'AV_WN32' ../libavcodec/dsputil.h:686: warning: implicit declaration of function 'AV_RN32' In file included from vf_spp.c:40: ../libavcodec/dsputil.h: In function 'copy_block2': ../libavcodec/dsputil.h:675: warning: implicit declaration of function 'AV_WN16' ../libavcodec/dsputil.h:675: warning: implicit declaration of function 'AV_RN16' ../libavcodec/dsputil.h: In function 'copy_block4': ../libavcodec/dsputil.h:686: warning: implicit declaration of function 'AV_WN32' ../libavcodec/dsputil.h:686: warning: implicit declaration of function 'AV_RN32' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25005 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing header file, fixes the warnings:diego2007-11-091-0/+1
| | | | | | | | | | | | | In file included from vf_fspp.c:46: ../libavcodec/dsputil.h: In function 'copy_block2': ../libavcodec/dsputil.h:675: warning: implicit declaration of function 'AV_WN16' ../libavcodec/dsputil.h:675: warning: implicit declaration of function 'AV_RN16' ../libavcodec/dsputil.h: In function 'copy_block4': ../libavcodec/dsputil.h:686: warning: implicit declaration of function 'AV_WN32' ../libavcodec/dsputil.h:686: warning: implicit declaration of function 'AV_RN32' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25004 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove misleading comment and remove unnecessary #includes.diego2007-11-091-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25003 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rearrange headers to get rid of an #undef and remove unnecessary headers.diego2007-11-091-13/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25002 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary dsputil.h #include, fixes the warnings:diego2007-11-091-1/+0
| | | | | | | | | | | | | In file included from vf_uspp.c:33: ../libavcodec/dsputil.h: In function 'copy_block2': ../libavcodec/dsputil.h:675: warning: implicit declaration of function 'AV_WN16' ../libavcodec/dsputil.h:675: warning: implicit declaration of function 'AV_RN16' ../libavcodec/dsputil.h: In function 'copy_block4': ../libavcodec/dsputil.h:686: warning: implicit declaration of function 'AV_WN32' ../libavcodec/dsputil.h:686: warning: implicit declaration of function 'AV_RN32' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25001 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include libavcodec/eval.h instead of manually declaring ff_eval.diego2007-11-091-7/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@25000 b3059339-0415-0410-9bf9-f77b7e298cf2
* const fixrfelker2007-11-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24999 b3059339-0415-0410-9bf9-f77b7e298cf2
* ack, can't believe i wrote this crap with void pointer arithmeticrfelker2007-11-091-38/+0
| | | | | | | | | | gimme some cola!!! since the code was disabled and tests had shown it was slower, i'm just removing it rather than fixing it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24998 b3059339-0415-0410-9bf9-f77b7e298cf2
* begin moving const filter data to .text/.rodata sectionsrfelker2007-11-096-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24997 b3059339-0415-0410-9bf9-f77b7e298cf2
* stage 1 of applying const to vf structsrfelker2007-11-092-86/+86
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24996 b3059339-0415-0410-9bf9-f77b7e298cf2
* vf_screenshot does not depend on libpng; it uses libavcodec nowrfelker2007-11-091-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24995 b3059339-0415-0410-9bf9-f77b7e298cf2
* correct const usage in the option handling code so that tables can berfelker2007-11-094-138/+138
| | | | | | | declared const and moved from .data to .text/rodata sections. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24994 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable ontop command from mplayer to be sent to mplayer osx.ulion2007-11-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24993 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with Linux kernel with some latest feature bits.zuxy2007-11-091-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24992 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix possible null-pointer-dereference in stream_fill_buffer().cehoyos2007-11-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24991 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix possible null-pointer-dereference in parse_smil().cehoyos2007-11-081-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24990 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify decode_audio function a bit.reimar2007-11-081-16/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24989 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix pause key problem in correct way, only handle pause cmd when showing menu.ulion2007-11-081-7/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24988 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix cmd filter memory leak, free the cmd after filter ate it.ulion2007-11-081-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24987 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle mouse up event to get double click support from mp_fifo.ulion2007-11-071-6/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24986 b3059339-0415-0410-9bf9-f77b7e298cf2
* add support for newer libdcarathann2007-11-061-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24985 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mouse right button and middle button incorrect identifications.ulion2007-11-061-3/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24984 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix KPENTER keycode value.ulion2007-11-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24983 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the prevent system idle code. Original code also works, but not as expected.ulion2007-11-061-3/+2
| | | | | | | | The update function was always called, but it should only be called every 30 seconds. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24982 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the prevent system idle code. Original code also works, but not as expected.ulion2007-11-061-2/+1
| | | | | | | | The update function was always called, but it should only be called every 30 seconds. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24981 b3059339-0415-0410-9bf9-f77b7e298cf2
* Warning fixes:ulion2007-11-061-26/+27
| | | | | | | | | | | | | | | | vo_quartz.c:537: warning: passing argument 4 of 'AppendMenuItemTextWithCFString' makes integer from pointer without a cast vo_quartz.c:539: warning: passing argument 4 of 'AppendMenuItemTextWithCFString' makes integer from pointer without a cast vo_quartz.c:551: warning: passing argument 4 of 'AppendMenuItemTextWithCFString' makes integer from pointer without a cast vo_quartz.c:578: warning: ISO C90 forbids mixed declarations and code vo_quartz.c:1126: warning: ISO C90 forbids mixed declarations and code vo_quartz.c:1363: warning: passing argument 7 of 'BeginFullScreen' makes integer from pointer without a cast vo_quartz.c:1393: warning: passing argument 2 of 'EndFullScreen' makes integer from pointer without a cast vo_quartz.c:1402: warning: passing argument 2 of 'SetSystemUIMode' makes integer from pointer without a cast git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24980 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: output grammar/spelling fixesdiego2007-11-061-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24979 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Comment grammar and spelling fixes.diego2007-11-061-17/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24978 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce excessive verbosity: Move debug messages to the appropriate MSGLdiego2007-11-061-46/+46
| | | | | | | and comment out the silliest ones. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24977 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in error messagereimar2007-11-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24976 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix memory leak caused by after calling mp_input_get_cmd didn't free the cmd.ulion2007-11-061-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24975 b3059339-0415-0410-9bf9-f77b7e298cf2
* reindentednicodvb2007-11-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24974 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, setting a non-existent timestamp (default 0.0) when the pts flag isn't ↵nicodvb2007-11-051-0/+1
| | | | | | | | | set in the PES header is just wrong; leave the default MP_NOPTS_VALUE instead git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24973 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix memory leak.voroshil2007-11-051-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24972 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix segmentation fault after audio initialization failure in tv driver.voroshil2007-11-051-2/+5
| | | | | | | | Error was caused by double call to driver's uninit() routine. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24971 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add include to fix warning:ulion2007-11-051-0/+1
| | | | | | | ao_macosx.c:899: warning: implicit declaration of function 'gettimeofday' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24970 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r24954, patch by JRaSH %jrash06 A 163 P com%gpoirier2007-11-051-45/+191
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24969 b3059339-0415-0410-9bf9-f77b7e298cf2
* Warning fixes:ulion2007-11-051-8/+8
| | | | | | | | | | | | | | | menu.c:303: warning: passing argument 1 of 'utf8_get_char' from incompatible pointer type menu.c:370: warning: passing argument 1 of 'utf8_get_char' from incompatible pointer type menu.c:463: warning: passing argument 1 of 'utf8_get_char' from incompatible pointer type menu.c:537: warning: passing argument 1 of 'utf8_get_char' from incompatible pointer type menu.c:565: warning: passing argument 1 of 'utf8_get_char' from incompatible pointer type menu.c:577: warning: passing argument 1 of 'utf8_get_char' from incompatible pointer type menu.c:597: warning: passing argument 1 of 'utf8_get_char' from incompatible pointer type menu.c:612: warning: passing argument 1 of 'utf8_get_char' from incompatible pointer type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24968 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l Diego, revert commit 24966.iive2007-11-041-2/+2
| | | | | | | We do not have policy of restoring bugs when bug is fixed by accident. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24967 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix previous incorrect commit, +/- has higher precedence than shifts.diego2007-11-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24966 b3059339-0415-0410-9bf9-f77b7e298cf2
* The function names of [rgb|bgr]1[56]to[UV|Y] had rgb<->bgr flipped.diego2007-11-041-8/+8
| | | | | | | Rename them to match the actual implementation. Fixes issue 162. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24965 b3059339-0415-0410-9bf9-f77b7e298cf2
* Escape some more '-'.diego2007-11-048-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24964 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24954Gabrov2007-11-041-8/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24963 b3059339-0415-0410-9bf9-f77b7e298cf2
* Old code for dvdsub_id fix assume the global_sub_indices[SUB_SOURCE_DEMUX]ulion2007-11-041-1/+3
| | | | | | | | must be zero when use a dvdsub_id greater than max sub id from demux. To remove the implicit assumption, make it up here. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24962 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid short forms; has the added benefit of allowing compilation with gcc 2.95diego2007-11-031-1/+1
| | | | | | | which complains about 'unterminated string or character constant'. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24961 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an example on how to use slave mode with a fiforeimar2007-11-031-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24960 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some parentheses to fix the following warnings:diego2007-11-031-2/+2
| | | | | | | | vo_directfb2.c:1189: warning: suggest parentheses around + or - inside shift vo_directfb2.c:1190: warning: suggest parentheses around + or - inside shift git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24959 b3059339-0415-0410-9bf9-f77b7e298cf2
* add some updatescompn2007-11-031-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24958 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix link to email explaining the paused vf_menu behaviour changereimar2007-11-031-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24957 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace some Hungarian comments, thanks to Denes Balatoni for the translation.diego2007-11-031-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24956 b3059339-0415-0410-9bf9-f77b7e298cf2
* Escape a ton of '-'. Note that this is likely not complete.diego2007-11-039-1748/+1748
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24955 b3059339-0415-0410-9bf9-f77b7e298cf2
* another round of '-' escapesdiego2007-11-031-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24954 b3059339-0415-0410-9bf9-f77b7e298cf2
* one more '-' escape, wording fixdiego2007-11-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24953 b3059339-0415-0410-9bf9-f77b7e298cf2
* Escape some more '-' where appropriate.diego2007-11-031-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24952 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove idiotic check that would always be falsereimar2007-11-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24951 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain new ao_pulse option syntaxreimar2007-11-031-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24950 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change parsing to allow host == NULL and sink != NULLreimar2007-11-031-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24949 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify argument "parsing"reimar2007-11-031-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24948 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sink variable local, it is only used in one placereimar2007-11-031-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24947 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a check+abort, this case should never happen anyway, and if it doesreimar2007-11-031-3/+0
| | | | | | | the most likely result is a NULL dereference which isn't much worse. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24946 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r24924, patch by JRaSH %jrash06 A 163 P com%gpoirier2007-11-031-1/+75
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24945 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24875: program switching in demux_lavfvoroshil2007-11-031-227/+227
| | | | | | | | r24897: Consistently use \- in option names. r24909: Escape some more '-' where appropriate. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24944 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24892: move errors and a warning to help_mp-en.hvoroshil2007-11-031-1/+13
| | | | | | | r24924: Add audio filter scaletempo git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24943 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24907: Remove paragraph that no long applies: runtime SSE detection on Windows.voroshil2007-11-031-8/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24942 b3059339-0415-0410-9bf9-f77b7e298cf2
* We support gcc 2.95 (fixes r24928).cehoyos2007-11-021-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24941 b3059339-0415-0410-9bf9-f77b7e298cf2
* in video_read_frame() set the keyframe flag in demuxer->video when dealing withnicodvb2007-11-021-0/+2
| | | | | | | VIDEO_MPEG12 and picture_coding_type==I_FRAME; fixes seeking in avi streams with MPEG1/2 video git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24940 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24938Gabrov2007-11-023-239/+318
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24939 b3059339-0415-0410-9bf9-f77b7e298cf2
* prevent unlikely memleaknicodvb2007-11-021-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24938 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, priv->use_psm can be 1 only if the format is genmpeg2nicodvb2007-11-021-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24937 b3059339-0415-0410-9bf9-f77b7e298cf2
* add streams to the PSM only if priv->use_psm is set, otherwise the muxer wouldnicodvb2007-11-021-1/+1
| | | | | | | write the map also for ordinary mpeg audio and video streams (wasting space) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24936 b3059339-0415-0410-9bf9-f77b7e298cf2
* moved to fix_parameters() the decision of the necessity of the PSM based on ↵nicodvb2007-11-021-2/+3
| | | | | | the format of the video stream git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24935 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed no more needed variablenicodvb2007-11-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24934 b3059339-0415-0410-9bf9-f77b7e298cf2
* moved to fix_parameters() the code that decides if the PSM is needednicodvb2007-11-021-11/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24933 b3059339-0415-0410-9bf9-f77b7e298cf2
* repeat the PSM once every second (in terms of delta_scr) otherwise playing ↵nicodvb2007-11-021-0/+23
| | | | | | the file from the middle would miss the first instance git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24932 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove the registration descriptor from the PSM: writing the fourcc in it ↵nicodvb2007-11-021-7/+2
| | | | | | makes it total crap git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24931 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100% cosmetics: reformatted with tabs and symmetric braces and removed ↵nicodvb2007-11-021-319/+324
| | | | | | useless braces and trailing tabs git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24930 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include to fix GNU/kFreeBSD compilation, see Debian bug #448791.diego2007-11-011-0/+1
| | | | | | | patch by Petr Salinger, Petr.Salinger seznam cz git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24929 b3059339-0415-0410-9bf9-f77b7e298cf2
* A/V sync: take audio filter buffers into accountuau2007-11-017-7/+21
| | | | | | | | | | | | | | | | | | Substract the delay caused by filter buffering when calculating currently playing audio position. This matters for af_scaletempo which buffers significant and varying amounts of data. For other current filters the effect is normally insignificant. Instead of the old time-based filter delay field (which was ignored) this version stores the per-filter delay in units of bytes input read without corresponding output. This allows the current scaletempo behavior where other filters before and after it can see the same nominal samplerate even though the real duration of the data varies; in this case the other filters can not know the delay they're causing in terms of real time. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24928 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_scaletempo: code cleanupuau2007-11-011-10/+17
| | | | | | | | | Make internal functions static and remove leading '_' from some function names. Cast pointers to compatible 8-bit pointer types instead of ints when calculating their difference. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24927 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_scaletempo: Fix crash in option parsinguau2007-11-011-1/+1
| | | | | | | | | | The value of the "speed" suboption was not initialized before calling subopt_parse(). If the command line had suboptions but "speed" was not one of them then the code accessed an uninitialized pointer and possibly crashed. Fixed by initializing the option value. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24926 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_scaletempo: Fix audio copy positionuau2007-11-011-2/+2
| | | | | | | | | Because of a missing *num_channels factor the filter copied audio from an incorrect position. This mixed up the channel order and hurt audio quality even if the channels had identical content. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24925 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add audio filter scaletempouau2007-11-018-9/+642
| | | | | | | Patch by Robert Juliano, juliano.1 osu edu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24924 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make output samplerate independent of -speeduau2007-11-011-1/+1
| | | | | | | | | | | | | | | | | The samplerate requested from the audio out depended on the initial value of playback speed on startup. Changing speed later at runtime does not affect output samplerate; audio is always resampled instead. Change the init code so that speed does not affect the samplerate requested and behavior matches what you'd get by starting the file with speed 1 and then changing it. The previous behavior could be desirable when using a constant speed value. However it means that if you start with a low speed and later switch to normal speed then audio will be resampled to a low output frequency. You can still use -srate to explicitly select the frequency. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24923 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify init_audio_filters() argumentsuau2007-11-014-36/+13
| | | | | | | | | | | | | | | Remove the following arguments as redundant: in_channels, in_format, out_minsize, out_maxsize. The first two always equal fields of the sh_audio_t struct given as the first argument to the function. The last two are unused after the allocation of sh_audio->a_out_buffer was changed to be done on demand. After the out_minsize and out_maxsize arguments are removed the function preinit_audio_filters() is identical to init_audio_filters(), so remove it and use the latter instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24922 b3059339-0415-0410-9bf9-f77b7e298cf2
* audio: simplify buffer allocation codeuau2007-11-011-13/+2
| | | | | | | | | Remove the code allocating sh_audio->a_out_buffer from init_audio_filters() and let the buffer be allocated by the new dynamic allocation code. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24921 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change decode_audio() interfaceuau2007-11-016-133/+115
| | | | | | | | | | | | Rewrite decode_audio to better deal with filters that handle input in large blocks. It now always places output in sh_audio->a_out_buffer (which was always given as a parameter before) and reallocates the buffer if needed. After the changes filters can return arbitrarily large blocks of data without some of it being lost. The new version also allows simplifying some code. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24920 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clean up some fields in stheader.h structsuau2007-11-013-5/+2
| | | | | | | | | | | | | | sh_video_t: void *video_out: only assigned to, never read. Remove. sh_video_t: void *vfilter: change type to struct vf_instance_s * sh_audio_t: void *afilter: change type to struct af_stream_s * The latter two never hold different types so there's no reason to use void *. Maybe they were originally defined that way because the option of using pointers to incomplete struct types was missed (the typedefs vf_instance_t and af_stream_t would require extra headers)? git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24919 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some pointless 'inline' qualifiersuau2007-11-015-12/+12
| | | | | | | Most of these functions aren't even used in the same translation unit. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24918 b3059339-0415-0410-9bf9-f77b7e298cf2
* libaf: Remove rational number implementationuau2007-11-013-59/+3
| | | | | | | | Remove the mul/cancel/gcd functions and some related code. Use ff_gcd instead of the removed af_gcd in af_resample.c. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24917 b3059339-0415-0410-9bf9-f77b7e298cf2
* libaf: change filter input/output ratio calculationsuau2007-11-0124-99/+54
| | | | | | | | | | Change the audio filters to use a double instead of rationals for the ratio of output to input size. The rationals could overflow when calculating the overall ratio of a filter chain and gave no real advantage compared to doubles. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24916 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused functions in af.cuau2007-11-012-51/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24915 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace hopefully unreachable code with abort()uau2007-11-011-7/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24914 b3059339-0415-0410-9bf9-f77b7e298cf2
* dec_audio.c: Make some functions staticuau2007-11-012-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24913 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify audio buffer allocation logicuau2007-11-011-7/+5
| | | | | | | | | Remove code that set sh_audio->a_out_buffer to equal sh_audio->a_buffer between the calls to init_best_audio_codec and init_audio_filters. Nothing uses the buffer between those calls. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24912 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reindent dec_audio.cuau2007-11-011-332/+373
| | | | | | | Also remove some commented out code git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24911 b3059339-0415-0410-9bf9-f77b7e298cf2
* typovoroshil2007-11-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24910 b3059339-0415-0410-9bf9-f77b7e298cf2
* Escape some more '-' where appropriate.diego2007-10-311-125/+125
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24909 b3059339-0415-0410-9bf9-f77b7e298cf2
* corrected vqscale indentationptt2007-10-311-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24908 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove paragraph that no long applies: runtime SSE detection on Windows.zuxy2007-10-311-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24907 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix input.conf parse bug when comment follows key binding in the same line.ulion2007-10-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24906 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove outdated Hungarian translation of the playtree documentation.diego2007-10-301-120/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24905 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a backslash.cehoyos2007-10-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24904 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed unused variables and parametersnicodvb2007-10-302-8/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24903 b3059339-0415-0410-9bf9-f77b7e298cf2
* spellingcompn2007-10-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24902 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove thankscompn2007-10-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24901 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain the difference between '-' and '\-', correctly now.diego2007-10-301-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24900 b3059339-0415-0410-9bf9-f77b7e298cf2
* movie player for Linux --> movie playerdiego2007-10-302-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24899 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add some missing escapes for '-'.diego2007-10-301-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24898 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use \- in option names.diego2007-10-301-105/+105
| | | | | | | In roff '-' is used for hyphens while '\-' is used for minus and en/em-dashes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24897 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variable:diego2007-10-301-1/+1
| | | | | | | demux_lavf.c:441: warning: unused variable 'g' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24896 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment out uninit function, its use is commented out. Fixes warning:diego2007-10-301-0/+2
| | | | | | | vf_yuvcsp.c:66: warning: 'uninit' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24895 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove commented-out and unused fmt_list array.diego2007-10-301-17/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24894 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused fmt_list array, fixes the warnings:diego2007-10-303-39/+0
| | | | | | | | | vf_ow.c:296: warning: 'fmt_list' defined but not used vf_spp.c:544: warning: 'fmt_list' defined but not used vf_uspp.c:334: warning: 'fmt_list' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24893 b3059339-0415-0410-9bf9-f77b7e298cf2
* move errors and a warning to help_mp-en.hcompn2007-10-302-8/+20
| | | | | | | so they can be translated. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24892 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused functions, fixes the warnings:diego2007-10-301-41/+0
| | | | | | | | vf_2xsai.c:80: warning: 'GetResult1' defined but not used vf_2xsai.c:100: warning: 'GetResult2' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24891 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable clear_screen function, the call to the function is commented outdiego2007-10-301-0/+2
| | | | | | | | due to buggyness. Fixes the warning: vo_tdfx_vid.c:78: warning: 'clear_screen' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24890 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment out unused variable, fixes the warning:diego2007-10-301-1/+1
| | | | | | | dvb_tune.c:43: warning: 'dvb_secdev' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24889 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused functions, fixes the warnings:diego2007-10-302-16/+0
| | | | | | | | pnm.c:853: warning: 'pnm_peek_header' defined but not used pnm.c:859: warning: 'pnm_close' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24888 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable function that is only used in disabled code, fixes warning:diego2007-10-301-0/+2
| | | | | | | yuv4mpeg.c:147: warning: 'y4m_snprint_xtags' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24887 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with FFmpeg r10874diego2007-10-301-11/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24886 b3059339-0415-0410-9bf9-f77b7e298cf2
* Detect IPv6 support on Windowszuxy2007-10-301-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24885 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix fps guessinglu_zero2007-10-291-3/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24884 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update to use newer libnemesi, should fix desync, fps guessing may fail nowlu_zero2007-10-292-11/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24883 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change the frame format passed to lavc realvideo decoders to adapt for rtogni2007-10-281-15/+12
| | | | | | | | the changes in r10825. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24882 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r24875gpoirier2007-10-281-10/+64
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24881 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cleanup guess_buffer_cp() a bit, remove tmp variable, break the loop on success.iive2007-10-281-7/+6
| | | | | | | Requested by ulion. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24880 b3059339-0415-0410-9bf9-f77b7e298cf2
* Our enca code uses strdup() on the input encoding name, as we don't modify ↵iive2007-10-283-18/+10
| | | | | | | | | | it we can use the original constant string. Uses less memory, code is simpler and faster. Fixes memory leak (noticed by ulion). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24879 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed silly #if 1nicodvb2007-10-271-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24878 b3059339-0415-0410-9bf9-f77b7e298cf2
* DEMUXER_TYPE_TV is always defined, thus removed corresponding #ifdef USE_TV.nicodvb2007-10-271-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24877 b3059339-0415-0410-9bf9-f77b7e298cf2
* reindented previously modified codenicodvb2007-10-271-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24876 b3059339-0415-0410-9bf9-f77b7e298cf2
* program switching in demux_lavfnicodvb2007-10-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24875 b3059339-0415-0410-9bf9-f77b7e298cf2
* program switching in demux_lavfnicodvb2007-10-271-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24874 b3059339-0415-0410-9bf9-f77b7e298cf2
* implemented DEMUXER_CTRL_IDENTIFY_PROGRAM to permit program switchingnicodvb2007-10-271-0/+54
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24873 b3059339-0415-0410-9bf9-f77b7e298cf2
* permit identification and selection of programsnicodvb2007-10-271-0/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24872 b3059339-0415-0410-9bf9-f77b7e298cf2
* permit the transititions no stream <-> some streams and viceversa (needed ↵nicodvb2007-10-271-3/+11
| | | | | | for forthcoming program switching patch) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24871 b3059339-0415-0410-9bf9-f77b7e298cf2
* moved to a new function handle_stream() the code to parse the streams and ↵nicodvb2007-10-271-111/+115
| | | | | | assign the demuxer_streams git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24870 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make functions static if they aren't referenced externally.zuxy2007-10-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24869 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variables.zuxy2007-10-271-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24868 b3059339-0415-0410-9bf9-f77b7e298cf2
* in process_userdata() move debugging messages from stdout to stderrnicodvb2007-10-271-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24867 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed funny calls to fflush(stdout) after mp_msg()nicodvb2007-10-271-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24866 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed more empty spaces and empty linesnicodvb2007-10-271-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24865 b3059339-0415-0410-9bf9-f77b7e298cf2
* replaced giant if() with if(pre-calculated variable) (there was even a bug: ↵nicodvb2007-10-271-5/+1
| | | | | | PS doesn't necessarily contain mpeg12) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24864 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetic fix for r24861zuxy2007-10-271-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24863 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: removed tabs/empty lines/trailing spaces and done a partial ↵nicodvb2007-10-271-82/+72
| | | | | | reformatting where desperately needed git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24862 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid crash after recovering from screensaverzuxy2007-10-271-4/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24861 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: moved to function find_video_codec() and reused in video_read_*() ↵nicodvb2007-10-271-45/+42
| | | | | | the code that identifies the various mpeg* formats git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24860 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove assert. Not only are they no help at all and proper checks shouldreimar2007-10-271-5/+0
| | | | | | | be added if desired, also assert.h is not included so compilation may fail. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24859 b3059339-0415-0410-9bf9-f77b7e298cf2
* Basic support for Closed Captioning Roll-up mode.voroshil2007-10-271-0/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24858 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reset two static variables for nosub range when subdata changed/switched.ulion2007-10-271-0/+8
| | | | | | | This fix some subtitle disappear bug when switch between subtitle streams. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24857 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: fix indentation after last commit.eugeni2007-10-251-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24856 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check return value of add_face.eugeni2007-10-251-0/+2
| | | | | | | | | This fixes segfault when reselecting fonts and the new font could not be loaded (because of a bad font file, or too many font faces already loaded). Patch by Glen Nakamura, glen at imodulo dot com. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24855 b3059339-0415-0410-9bf9-f77b7e298cf2
* demuxer.c: Remove useless codeuau2007-10-251-21/+17
| | | | | | | | Remove "while(1) { }" around two instances of code that always do "return" in the loop body. No functionality changes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24854 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed osd on maccompn2007-10-251-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24853 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24740: misc roff fixesvoroshil2007-10-251-6/+55
| | | | | | | | | | | | | | | | | r24746: document filter -vf ow: Overcomplete Wavelet denoiser. r24772: DirectShow based tv:// driver for win32 r24783: Consistently set NOTE: in italics. r24784: small grammar fix r24785: Add -lavfdopts cryptokey r24807: Docs update: -ao openal handles more than one channels since some time already r24808: Add a space behind openal to get minimum length of 7 r24809: Replace Polyp- by PulseAudio output. r24820: Clarify that -vo gl bicubic filtering is B-spline, not polynomial r24837: Spelling, vf_ow parameters are optional. r24841: type fix: there was a 'not' too much git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24852 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24745: libavcodec now supports dnxhd encoding.voroshil2007-10-251-4/+8
| | | | | | | | r24751: Fix Zip Motion Blocks Video codec name. r24795: better vfw encoding workaround for vp7 fourcc git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24851 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24772: DirectShow based tv:// driver for win32voroshil2007-10-251-1/+48
| | | | | | | r24790: Disable channel scanner when no tuner is present. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24850 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't wait for filling entire audio ringbuffer at each call to grab_audio_frame.voroshil2007-10-251-1/+1
| | | | | | | | | Fixes 2 minutes delay before starting playback and audio clicks in sound (at least for my SAA7134 based card while capturing radio through saa7134-alsa module). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24849 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing call to audio_in_start_capture.voroshil2007-10-251-0/+1
| | | | | | | | | Fixes capturing sound from ALSA devices (repeated xrun errors, buffer underruns and son on). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24848 b3059339-0415-0410-9bf9-f77b7e298cf2
* add missing include (errno.h). fix compilation on openbsdivo2007-10-241-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24847 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24841Gabrov2007-10-241-6/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24846 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of void pointer arithmetic.zuxy2007-10-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24845 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix input command parser for using only tab to separate the arguments.ulion2007-10-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24844 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix GetTimerMS() discontinuous return value bug caused by GetTimer() overflowulion2007-10-231-1/+2
| | | | | | | on darwin. This bug will cause osd stuck on darwin. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24843 b3059339-0415-0410-9bf9-f77b7e298cf2
* A missing break statement caused SDLK_PLUS to be triggered twice on one press.diego2007-10-221-2/+2
| | | | | | | | | patch by Michael Mauch, michael.mauch gmx de Subject: [MPlayer-dev-eng] [PATCH] Add two breaks in the key handling of vo_sdl Date: Tue, 23 Oct 2007 00:04:20 +0200 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24842 b3059339-0415-0410-9bf9-f77b7e298cf2
* type fix: there was a 'not' too muchptt2007-10-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24841 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24837ptt2007-10-221-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24840 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24820ptt2007-10-221-9/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24839 b3059339-0415-0410-9bf9-f77b7e298cf2
* sunc with r24790ptt2007-10-221-1/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24838 b3059339-0415-0410-9bf9-f77b7e298cf2
* Spelling, vf_ow parameters are optional.diego2007-10-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24837 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix warning:diego2007-10-221-1/+1
| | | | | | | | vf_ow.c: In function 'filter': vf_ow.c:168: warning: unused variable 'sum' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24836 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar fixptt2007-10-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24835 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for wavpack in matroskacompn2007-10-221-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24834 b3059339-0415-0410-9bf9-f77b7e298cf2
* add support for wavpack into matroskaaurel2007-10-212-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24833 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning:diego2007-10-211-1/+0
| | | | | | | | | In file included from mplayer.c:794: cfg-mplayer.h:64: warning: redundant redeclaration of 'enqueue' mplayer.c:230: warning: previous definition of 'enqueue' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24832 b3059339-0415-0410-9bf9-f77b7e298cf2
* vp6vfw can decode vp6f toocompn2007-10-211-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24831 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace hardcoded 0 by equivalent O_RDONLYreimar2007-10-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24830 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check ICDecompressGetFormatSize to avoid crashes.reimar2007-10-211-0/+5
| | | | | | | Based on patch by Gianluigi Tiesi (mplayer netfarm it). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24829 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some unused code, fixes the following warnings:diego2007-10-211-65/+0
| | | | | | | | | | | | | | | vosub_vidix.c: At top level: vosub_vidix.c:199: warning: 'vidix_draw_slice_410_fast' defined but not used vosub_vidix.c:211: warning: 'vidix_draw_slice_400' defined but not used vosub_vidix.c:365: warning: 'vidix_get_video_eq' defined but not used vosub_vidix.c:371: warning: 'vidix_set_video_eq' defined but not used vosub_vidix.c:377: warning: 'vidix_get_num_fx' defined but not used vosub_vidix.c:383: warning: 'vidix_get_oem_fx' defined but not used vosub_vidix.c:389: warning: 'vidix_set_oem_fx' defined but not used vosub_vidix.c:395: warning: 'vidix_set_deint' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24828 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused code and fix warning:diego2007-10-211-14/+0
| | | | | | | demux_real.c:147: warning: 'skip_str' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24827 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_openal is mine as well (however someone else developing it further would ↵reimar2007-10-211-0/+1
| | | | | | be welcome) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24826 b3059339-0415-0410-9bf9-f77b7e298cf2
* I'll be maintaining ao_pulse for nowreimar2007-10-211-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24825 b3059339-0415-0410-9bf9-f77b7e298cf2
* _vorbis_block_alloc() is used w/o prototype, this will crash on ia64.diego2007-10-207-0/+106
| | | | | | | | | | | Add a header file with the function prototype to address this issue. This has the positive side effect of fixing a couple of implicit declaration warnings. The problem was originally reported as Debian bug 447278. patch by Dann Frazier and Andrea Mennucci, mennucc1 debian org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24824 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary lines from patch headers.diego2007-10-201-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24823 b3059339-0415-0410-9bf9-f77b7e298cf2
* Certain VIDIX drivers only work on x86, disable for other arches.diego2007-10-201-2/+2
| | | | | | | This patch was coproduced by Reimar, Andrea Menucci and myself. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24822 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable libavcodec libvorbis encoderuau2007-10-201-1/+1
| | | | | | | | | | | | | MPlayer's configure does not test and set variables required by the encoder properly (never links with -lvorbisenc for example). Disable it completely to fix broken compilation in cases where it was enabled. Support for the libvorbis encoder could be a desirable feature as it can produce better quality audio than libavcodec's own encoder, but implementing that properly would require more work. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24821 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify that -vo gl bicubic filtering is B-spline, not polynomialreimar2007-10-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24820 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set CONFIG_LIBVORBIS correctlyreimar2007-10-201-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24819 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add ASF/MXF decryption support to Changelogreimar2007-10-201-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24818 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify handling SET_NORM for V4l1: replace several if-else-if and switchvoroshil2007-10-201-67/+34
| | | | | | | | statements with one lookup table; git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24817 b3059339-0415-0410-9bf9-f77b7e298cf2
* czech/slovak character set fixes:voroshil2007-10-201-2/+2
| | | | | | | | | | | | plain latin characters instead of native were wrongly used in several places of charset table. patch from Oldrich Jedlicka oldium dot pro at seznam dot cz git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24816 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid text deformation and subtitles moving outside the screen in pan-and-scaneugeni2007-10-192-9/+22
| | | | | | | | | | | | mode. For this, crop amounts are passed from vo_gl as negative margins sizes. They are used to calculate aspect ratio. They are ignored when calculating subtitle positions, so subtitles will stay on screen most of the time. Based on a patch by Jindrich Makovicka [makovick gmail com]. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24815 b3059339-0415-0410-9bf9-f77b7e298cf2
* indentation fix+typo fixptt2007-10-191-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24814 b3059339-0415-0410-9bf9-f77b7e298cf2
* reminder that this filter has broken global varsrfelker2007-10-191-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24813 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark constant argument of mp_header_process_sequence_header as such.diego2007-10-192-2/+2
| | | | | | | | | fixes warning: vd_mpegpes.c: In function 'decode': vd_mpegpes.c:49: warning: passing argument 2 of 'mp_header_process_sequence_header' discards qualifiers from pointer target type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24812 b3059339-0415-0410-9bf9-f77b7e298cf2
* -ao pulse in changelogreimar2007-10-181-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24811 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing ao_pulse.creimar2007-10-181-0/+382
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24810 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace Polyp- by PulseAudio output.reimar2007-10-185-351/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24809 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a space behind openal to get minimum length of 7reimar2007-10-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24808 b3059339-0415-0410-9bf9-f77b7e298cf2
* Docs update: -ao openal handles more than one channels since some time alreadyreimar2007-10-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24807 b3059339-0415-0410-9bf9-f77b7e298cf2
* add comment to endifcompn2007-10-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24806 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in commentreimar2007-10-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24805 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with latest FFmpeg changes.diego2007-10-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24804 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with FFmpeg r10774.diego2007-10-181-25/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24803 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename LIB to LIBNAME for consistency.diego2007-10-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24802 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l: Update wrong #endif comment.diego2007-10-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24801 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add FFMPEG_ prefix to all multiple inclusion guards.diego2007-10-183-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24800 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused static function get_image().zuxy2007-10-171-17/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24799 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add Coinitialize function to vfw encoder and win32 loader.compn2007-10-173-2/+71
| | | | | | | | | | Fixes crash when trying to load vp7vfw.dll in vfw2menc. Patch by Gianluigi Tiesi mplayer___netfarm.it http://lists.mplayerhq.hu/pipermail/mplayer-dev-eng/2007-September/054136.html git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24798 b3059339-0415-0410-9bf9-f77b7e298cf2
* simple avoid wine complaints fix by sherpyacompn2007-10-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24797 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24795Gabrov2007-10-162-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24796 b3059339-0415-0410-9bf9-f77b7e298cf2
* better vfw encoding workaround for vp7 fourcccompn2007-10-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24795 b3059339-0415-0410-9bf9-f77b7e298cf2
* add some changescompn2007-10-161-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24794 b3059339-0415-0410-9bf9-f77b7e298cf2
* add nellymoser to changelogcompn2007-10-161-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24793 b3059339-0415-0410-9bf9-f77b7e298cf2
* add nellymoser codec to mplayer with internal fourcc NELLcompn2007-10-162-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24792 b3059339-0415-0410-9bf9-f77b7e298cf2
* After receiving EINTR 'read' syscall should be restarted.voroshil2007-10-162-0/+4
| | | | | | | | | | Fixes receiving teletext on some systems. Modified patch from Oldrich Jedlicka oldium dot pro at aenam dot cz git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24791 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable channel scanner when no tuner is present.voroshil2007-10-152-0/+9
| | | | | | | | | | TV channel scanner is useless without tuner and causes mplayer crash due to uninitialized chanlist_s variable (e.g when dummy driver and tvscan are used together). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24790 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24788Gabrov2007-10-153-10/+97
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24789 b3059339-0415-0410-9bf9-f77b7e298cf2
* now italian DOCS are there to be referenced...ptt2007-10-151-9/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24788 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mplayer segfault when v4l driver initialization (at setting normvoroshil2007-10-141-1/+3
| | | | | | | | stage) failed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24787 b3059339-0415-0410-9bf9-f77b7e298cf2
* #ifdef's in tv.c and tv.h becomes more and more hard to maintain.voroshil2007-10-142-26/+0
| | | | | | | | I've decided to remove all of them and control options only through cfg-common.h git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24786 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add -lavfdopts cryptokeyreimar2007-10-142-0/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24785 b3059339-0415-0410-9bf9-f77b7e298cf2
* small grammar fixdiego2007-10-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24784 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently set NOTE: in italics.diego2007-10-141-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24783 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary curly braces.voroshil2007-10-141-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24782 b3059339-0415-0410-9bf9-f77b7e298cf2
* 8 bytes buffer is not enough for at least SECAM-DK.voroshil2007-10-141-1/+1
| | | | | | | | Increase it to 20. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24781 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace duplicated code with call to routinevoroshil2007-10-141-7/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24780 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: routine sets norm from parameter, but prints value of tv norm optionvoroshil2007-10-141-1/+1
| | | | | | | | (which can be not equal to parameter). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24779 b3059339-0415-0410-9bf9-f77b7e298cf2
* (cosmetics) indentation fix of my previous commit and small readabilityvoroshil2007-10-141-22/+25
| | | | | | | improvement. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24778 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove driver-dependent #ifdef from norm_from_string routine.voroshil2007-10-141-22/+14
| | | | | | | | | | It will use TVI_CONTROL_SPC_GET_NORMID if supported by driver and fallback to hardcoded norms otherwise. This will not change current behaviour because hardcoded norms were used with drivers which do not support above ioctl. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24777 b3059339-0415-0410-9bf9-f77b7e298cf2
* (cosmetics) remove trailing whitespacevoroshil2007-10-141-37/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24776 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l fix compilation with v4l2iive2007-10-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24775 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add me as author of dshow tv:// drivervoroshil2007-10-131-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24774 b3059339-0415-0410-9bf9-f77b7e298cf2
* Changelog entry for dshow tv:// drivervoroshil2007-10-131-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24773 b3059339-0415-0410-9bf9-f77b7e298cf2
* DirectShow based tv:// driver for win32voroshil2007-10-1310-13/+4175
| | | | | | | | | | | Teletext is also supported (but 625 system parameters are hardcoded). pthreads is required for teletext. Code is still experimental. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24772 b3059339-0415-0410-9bf9-f77b7e298cf2
* add more warning fixes changecompn2007-10-131-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24771 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix deallocate bug which sometimes causes a crash when reinitializing.nplourde2007-10-131-0/+1
| | | | | | | patch by Ulion, ulion2002 gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24770 b3059339-0415-0410-9bf9-f77b7e298cf2
* bugfix for ao_macosx last dts passthrough patch, patch by Ulion, ulion2002 ↵nplourde2007-10-131-1/+1
| | | | | | gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24769 b3059339-0415-0410-9bf9-f77b7e298cf2
* support Y800 in raw videodiego2007-10-131-0/+1
| | | | | | | patch by Attila Ötvös, oattila chello hu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24768 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed useless inclusion of error.hnicodvb2007-10-131-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24767 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reorder #includes to get rid of the FIXMEzuxy2007-10-121-10/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24766 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary #include <malloc.h>zuxy2007-10-121-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24765 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: typodiego2007-10-111-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24764 b3059339-0415-0410-9bf9-f77b7e298cf2
* Silence a gcc warning: "wrong type argument to increment".zuxy2007-10-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24763 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for AC-3/DTS passthrough.nplourde2007-10-111-48/+778
| | | | | | | patch by Ulion, ulion2002 gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24762 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with FFmpeg changes, NO_DCBZL was renamed to HAVE_DCBZL.diego2007-10-101-2/+2
| | | | | | | patch by Emanuele Giaquinta, emanuele.giaquinta gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24761 b3059339-0415-0410-9bf9-f77b7e298cf2
* my fault, left a wrong line, correctedptt2007-10-091-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24760 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make vf_screenshot use the libavcodec PNG encoderreimar2007-10-092-44/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24759 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24344ptt2007-10-091-47/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24758 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24342ptt2007-10-091-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24757 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24710ptt2007-10-091-4/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24756 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24087ptt2007-10-091-17/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24755 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24082ptt2007-10-091-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24754 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced up to r24293ptt2007-10-091-9/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24753 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added PAFF decodingcehoyos2007-10-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24752 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix Zip Motion Blocks Video codec name.diego2007-10-091-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24751 b3059339-0415-0410-9bf9-f77b7e298cf2
* add DNxHD (SMPTE VC-3) encodercompn2007-10-091-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24750 b3059339-0415-0410-9bf9-f77b7e298cf2
* add vf ow filter for rc3compn2007-10-081-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24749 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove Makefile changes from upstream diff. They are strictly local.diego2007-10-081-13/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24748 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Align some lines.diego2007-10-081-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24747 b3059339-0415-0410-9bf9-f77b7e298cf2
* document filter -vf ow: Overcomplete Wavelet denoiser.gpoirier2007-10-081-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24746 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavcodec now supports dnxhd encoding.diego2007-10-081-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24745 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix inconsistent indentation in directfb test.diego2007-10-081-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24744 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify directfb/dfbmga test.diego2007-10-081-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24743 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix indentation after previous commit.diego2007-10-081-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24742 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless code, the same check is performed a few lines above.diego2007-10-081-4/+0
| | | | | | | patch by A Mennucc, mennucc1 debian org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24741 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc roff fixesdiego2007-10-081-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24740 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove the check for specific gcc versions, because:diego2007-10-081-1/+1
| | | | | | | | | - It was never updated to check for more recent gcc versions and - using specific gcc versions is likely not a good idea in the first place, it effectively changes the user's choice of default compiler. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24739 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to r24573jheryan2007-10-081-92/+270
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24738 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to 21.9.2007jheryan2007-10-0815-404/+511
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24737 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to r24423jheryan2007-10-081-9/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24736 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync tag updatevoroshil2007-10-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24735 b3059339-0415-0410-9bf9-f77b7e298cf2
* rc2 was released in 2007, not 2006rtogni2007-10-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24733 b3059339-0415-0410-9bf9-f77b7e298cf2
* rc2rtogni2007-10-071-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24730 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24727Gabrov2007-10-071-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24728 b3059339-0415-0410-9bf9-f77b7e298cf2
* H.264 content can also be decoded with multiple threadsgpoirier2007-10-072-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24727 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add rc1try2 and rc1try3rtogni2007-10-071-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24722 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix output channle orderingrtogni2007-10-071-25/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24721 b3059339-0415-0410-9bf9-f77b7e298cf2
* I have mostly taken over maintaining x11_common stuff as wellreimar2007-10-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24720 b3059339-0415-0410-9bf9-f77b7e298cf2
* Changed proposed monitorpixelaspect value for -vo aa to 0.5 as asked by Rich.cehoyos2007-10-074-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24719 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable fullscreen command from mplayer to be sent to mplayer osxnplourde2007-10-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24718 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure forked code does not try to display a GTK message box (and thus ↵reimar2007-10-072-0/+5
| | | | | | crashes) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24717 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24706: Add hint to monitorpixelaspect for -vo aa.voroshil2007-10-071-2/+9
| | | | | | | | r24708: Default monitorpixelaspect is 1. r24711: rtsp-stream-over-tcp also works with NEMESI. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24716 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24709: Documentation follows implementation: Encrytped DVB channels are nevervoroshil2007-10-071-4/+2
| | | | | | | r24710: Fix typo. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24715 b3059339-0415-0410-9bf9-f77b7e298cf2
* import cleaned-up RPM spec filesrathann2007-10-062-0/+605
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24714 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typortogni2007-10-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24713 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24711Gabrov2007-10-052-7/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24712 b3059339-0415-0410-9bf9-f77b7e298cf2
* rtsp-stream-over-tcp also works with NEMESI.cehoyos2007-10-053-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24711 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo.cehoyos2007-10-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24710 b3059339-0415-0410-9bf9-f77b7e298cf2
* Documentation follows implementation: Encrytped DVB channels are nevercehoyos2007-10-052-5/+3
| | | | | | | | skipped. (German was wrong anyway) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24709 b3059339-0415-0410-9bf9-f77b7e298cf2
* Default monitorpixelaspect is 1.cehoyos2007-10-057-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24708 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo.cehoyos2007-10-051-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24707 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add hint to monitorpixelaspect for -vo aa.cehoyos2007-10-052-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24706 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24656ptt2007-10-051-38/+77
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24705 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync'ed with r24136ptt2007-10-041-52/+104
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24704 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync'd up to r24056ptt2007-10-044-29/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24703 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync'd up to r24423ptt2007-10-041-4/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24702 b3059339-0415-0410-9bf9-f77b7e298cf2
* in update_stats() removed a wrong 'else' that would prevent h264 headers to ↵nicodvb2007-10-041-1/+1
| | | | | | | | | | be recognized: all 0x12x headers were accounted for only in num_elementary_packets12x. Fixes detection of certain H264 in ES/PS streams git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24701 b3059339-0415-0410-9bf9-f77b7e298cf2
* change double arrays to float (this should be accurate enough)michael2007-10-041-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24700 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix infinite loopmichael2007-10-041-3/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24699 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix missing subtitles after seeking backuau2007-10-041-0/+1
| | | | | | | | | | | | | | Subtitle packets that had been demuxed but whose start time had not yet been reached were left in the demuxer stream after seeking. When using the default (non-libass) subtitle rendering this could block subtitles from appearing as long as the playback position stayed below the original one before seek. External subtitle files were not affected. Fixed by making seek code free all packets from the subtitle stream. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24698 b3059339-0415-0410-9bf9-f77b7e298cf2
* overcomplete wavelet denoisermichael2007-10-033-0/+341
| | | | | | | not optimized at all but much cleaner than uspp git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24697 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for DTS as specified in DVB (untested)nicodvb2007-10-031-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24696 b3059339-0415-0410-9bf9-f77b7e298cf2
* The combination _vis=yes and proc=v9 makes no sense and will not even compile.reimar2007-10-031-1/+1
| | | | | | | Change it to proc=ultrasparc, that may not be right, but it can not get any worse... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24695 b3059339-0415-0410-9bf9-f77b7e298cf2
* Format 0x01 cannot be used with "AMV IMA ADPCM", because it belongs to ↵voroshil2007-10-031-0/+2
| | | | | | | | | | normal PCM. Make lavf demuxer set codec tag to AMVA in this case. No need to use -ac +ffadpcmimaamva anymore. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24694 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not uselessly set _x264 to the value it already hasreimar2007-10-031-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24693 b3059339-0415-0410-9bf9-f77b7e298cf2
* "AMV IMA ADPCM" can not use 0x1 as tag, it breaks normal PCM.reimar2007-10-031-1/+1
| | | | | | | | Set it to AMVA. You will have to use -ac +ffadpcmimaamv until the demuxer is fixed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24692 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of mp_msg_test in vo_png, only reason to use it is performance andreimar2007-10-031-20/+10
| | | | | | | | that is not critical here and the way it was used probably would not improve performance anyway git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24691 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use IMGFMT_IS_BGR instead of mpi->flags&MP_IMGFLAG_SWAPPED, this is easierreimar2007-10-031-1/+1
| | | | | | | to understand and in this case more accurate git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24690 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make a local-only variable static in vo_pngreimar2007-10-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24689 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set biWidth/biHeight in fli demuxerreimar2007-10-021-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24688 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure there is no uninitialized data in BITMAPINFOHEADER created by fli ↵reimar2007-10-021-1/+1
| | | | | | demuxer git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24687 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove ugly unused struct name from typedefreimar2007-10-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24686 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix AltiVec spelling.diego2007-10-024-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24685 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning:diego2007-10-011-1/+0
| | | | | | | | cpudetect.c: In function 'check_os_katmai_support': cpudetect.c:395: warning: unused variable 'saved_sigfpe' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24684 b3059339-0415-0410-9bf9-f77b7e298cf2
* Detect support of and add necessary CFLAGS to avoid crashes when loadingdiego2007-10-012-0/+22
| | | | | | | | Win32 DLLs on Mac OS X / Intel. based on patch by Ulion, ulion2002 gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24683 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move misplaced paragraph to the right question and fix the wording.diego2007-10-011-6/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24682 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove stray XML tags that broke compilation.diego2007-10-011-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24681 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless quotes.diego2007-10-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24680 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added EOF detection for RTSP via live555cehoyos2007-09-301-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24679 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify some RTSP changescehoyos2007-09-301-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24678 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention the recent telecining bugfix in muxer_mpegnicodvb2007-09-301-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24677 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable direct rendering for ROQ video, the buffer management used by rtogni2007-09-301-1/+1
| | | | | | | the codec is not compatible with MPlayer idea of reget_buffer git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24676 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert changes r23805, r23819 and r23866 to restore the mga_vid checkattila2007-09-301-4/+4
| | | | | | | to the "autodetection" from r2944 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24675 b3059339-0415-0410-9bf9-f77b7e298cf2
* Require atleast libnemesi 0.6.2 (range api and h263 supportlu_zero2007-09-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24674 b3059339-0415-0410-9bf9-f77b7e298cf2
* AMV demuxer and audio/video decodervoroshil2007-09-303-1/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24673 b3059339-0415-0410-9bf9-f77b7e298cf2
* Gentoo patches for Xextlu_zero2007-09-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24672 b3059339-0415-0410-9bf9-f77b7e298cf2
* Give temporary executable file the system-specific executable extension.diego2007-09-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24671 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move declaration of temporary file variables to after the system-specificdiego2007-09-291-14/+17
| | | | | | | variable declarations (preparation for next patch). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24670 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix Theora check without pkgconfig, -ltheora will not link on its own,diego2007-09-291-2/+2
| | | | | | | | -logg is needed as well. patch by Gianluigi Tiesi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24669 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nuke some more outdated and confusing comments.diego2007-09-291-9/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24668 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant comment.diego2007-09-291-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24667 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless comment.diego2007-09-291-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24666 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Move the command to remove configure.log out of a block of variablediego2007-09-291-1/+1
| | | | | | | declarations to just before the configure.log is first written to. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24665 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/24656gpoirier2007-09-291-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24664 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling cosmeticsdiego2007-09-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24663 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable SSE on MinGW, many builds out there seem to use it without ill effect.diego2007-09-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24662 b3059339-0415-0410-9bf9-f77b7e298cf2
* add flac speedupscompn2007-09-291-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24661 b3059339-0415-0410-9bf9-f77b7e298cf2
* compile fix for faq.xmlkraymer2007-09-294-23/+125
| | | | | | | | | | | | r24082: Explicitly mention the need to rebuild MPlayer after installing AMR libs. r24087: Reorder installation requirements list, wording/spelling. r24604: Teletext documentation r24646: add -lavfdopts format option r24655: analyzeduration option for lavf demuxer r24656: AVI can do video stream switching, too git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24660 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24655: analyzeduration option for lavf demuxervoroshil2007-09-291-2/+7
| | | | | | | r24656: AVI can do video stream switching, too git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24659 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24656Gabrov2007-09-291-3/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24658 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24030: Document special A-V sync issues with FLV fileskraymer2007-09-293-14/+223
| | | | | | | | | | r24035: Add <application> tag around MEncoder r24045: Change "object type complexity" parameter of FAAC r24089: Complete the list of libavcodec audio encoders. r24049: i_certify is no longer an option git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24657 b3059339-0415-0410-9bf9-f77b7e298cf2
* AVI can do video stream switching, tooreimar2007-09-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24656 b3059339-0415-0410-9bf9-f77b7e298cf2
* analyzeduration option for lavf demuxerhenry2007-09-292-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24655 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove useless int->double conversionhenry2007-09-291-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24654 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix warningshenry2007-09-291-1/+1
| | | | | | | | | demux_lavf.c: In function ‘demux_open_lavf’: demux_lavf.c:276: warning: assignment discards qualifiers from pointer target type demux_lavf.c:280: warning: assignment discards qualifiers from pointer target type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24653 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24646: add -lavfdopts format optionvoroshil2007-09-291-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24652 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed bug introduced with previous commit: patch_panscan() must work in the ↵nicodvb2007-09-281-1/+1
| | | | | | sequence_display_extension, not on se_ptr git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24651 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l, the tff flag was never cleared before being overwritten with the ↵nicodvb2007-09-281-2/+4
| | | | | | | | | | | value on bff_mask; also, the sequence extension pointer was set to point to the sequence_display_extension, so the progressive_sequence was never set and the sde was being corrupted patch by Christopher Montgomery (xhiphmont xiph org) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24650 b3059339-0415-0410-9bf9-f77b7e298cf2
* Define profiles_t as const to fix a warning. Prevent profiles[] from been ↵iive2007-09-281-2/+2
| | | | | | exported. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24649 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r24646gpoirier2007-09-281-14/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24648 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update translations to not recommend -vc dummy (it is too crash-happy)reimar2007-09-285-5/+5
| | | | | | | but -vc null like the English variant does. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24647 b3059339-0415-0410-9bf9-f77b7e298cf2
* add -lavfdopts format optionhenry2007-09-281-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24646 b3059339-0415-0410-9bf9-f77b7e298cf2
* h263 exposedlu_zero2007-09-281-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24645 b3059339-0415-0410-9bf9-f77b7e298cf2
* r23578: Fix license header.kraymer2007-09-284-14/+10
| | | | | | | | | | r23579: Activate license notice. r23594: added some carriage returns and full stops, plus a missing 'option' r23608: Nico claims to never have had any problems with X11 compilation on Mandrake. r23983: i_certify_that_my_video_stream_does_not_use_b_frames is gone. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24644 b3059339-0415-0410-9bf9-f77b7e298cf2
* version bumps for codecs.xml and tvinput.xmlkraymer2007-09-287-19/+21
| | | | | | | | | | | r23271: libdha is no more. r23272: 10l syntax error r23342: Add ID to example. r23517: small indentation and tags fixes r23538: capital char and relative dot at end of phrase removed git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24643 b3059339-0415-0410-9bf9-f77b7e298cf2
* some whitespace cosmeticskraymer2007-09-286-287/+230
| | | | | | | | | | | | r22854: Remove empty section. r22951: Move netstream documentation into TOOLS/README. r23100: Update AMR instructions. r23161: Remove outdated and wrong references to codecs.conf. r23225: The GUI no longer depends on libpng. r23226: MJPEG decoding does not depend on libjpeg. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24642 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing sync tag updatevoroshil2007-09-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24641 b3059339-0415-0410-9bf9-f77b7e298cf2
* r22718: add new audio and video codecs to libavcodec listkraymer2007-09-281-2/+51
| | | | | | | | | | | r22748: add png and gif encoders, how to use them with mencoder is another question r22749: split sonic into sonic/sonicls and wma into wmav1/wmav2 r22750: add rest of lavc encoders to list (vcr1, cljr, jpegls, ffvhuff, msmpeg4v1) r22751: gsm requires libgsm so remove it r22752: aiff isnt there as well, TEST FIRST, THEN DOCUMENT COMPN! git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24640 b3059339-0415-0410-9bf9-f77b7e298cf2
* r22679: Some more details for the mga_vid section taken from drivers/README.kraymer2007-09-271-29/+31
| | | | | | | | | | r22686: tdfx_vid compilation has been simplified. r22695: Add a link to Attila's mga_vid port to Linux 2.6.x. r22704: 'make install' now takes care of most manual installation steps for *_vid.o. r22800: Get rid of useless conditional git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24639 b3059339-0415-0410-9bf9-f77b7e298cf2
* some whitespace cosmeticskraymer2007-09-273-150/+206
| | | | | | | | | | | | | rename "BENUTZUNG" -> "GEBRAUCH" for consistency r22201: some clarification about dvb-out playback r22402: Explain how to select all DVB channels on a frequency. r22413: add xvfwopts compdata and vfw2menc documentation and change to better mencoder example r22499: Improve MPlayerOSX building process r22547: use suggestion from Diego r22570: dont start newline with a space and readd subdirectory git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24638 b3059339-0415-0410-9bf9-f77b7e298cf2
* r22141: Move all "Encoding with the XXX codec family" sections together.kraymer2007-09-271-155/+153
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24637 b3059339-0415-0410-9bf9-f77b7e298cf2
* r21897: Rephrase mga_vid section.kraymer2007-09-274-22/+17
| | | | | | | | | r21930: gcc_bug++; r22129: Link to the mencoder-users list for mencoder stuff r22140: vp6vfw.dll appears to no longer crash under Linux. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24636 b3059339-0415-0410-9bf9-f77b7e298cf2
* r21896: Document vo_tdfx_vid.kraymer2007-09-271-1/+51
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24635 b3059339-0415-0410-9bf9-f77b7e298cf2
* r21861: explain how to use MEncoder to create QuickTime-compatible fileskraymer2007-09-271-11/+367
| | | | | | | | | | | | r21875: fix wrong option names r21917: typo fixes r21931: update x264's subq otion description r21932: update and factorize information about x264's multi-threading mode r21933: fixes suggested by Diego r21934: get rid of two spaces after a period (instead of one) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24634 b3059339-0415-0410-9bf9-f77b7e298cf2
* r21748: Reformatting round continuedkraymer2007-09-273-10/+9
| | | | | | | | | | r21760: Directly point to the Subversion instructions. r21791: avoid a possible confusion, as suggested by Wanderer r21802: x264 is MPEG-4 AVC, not ASP r21849: fix typo git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24633 b3059339-0415-0410-9bf9-f77b7e298cf2
* r21744: Mention that you can use different image formats with mf://kraymer2007-09-271-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24632 b3059339-0415-0410-9bf9-f77b7e298cf2
* r21705: remove stray propmt from examplekraymer2007-09-274-22/+29
| | | | | | | | r21736: Add <keycombo> barkup for key combinations r21737: Add <menuchoice> <guimenu> <guisubmenu> <guimenuitem> markup for menus. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24631 b3059339-0415-0410-9bf9-f77b7e298cf2
* r21612: replace &quot; with ", better readabilitykraymer2007-09-2712-102/+102
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24630 b3059339-0415-0410-9bf9-f77b7e298cf2
* r21599: vstrict=0 is required to create DVDs decodable by standalone dvd playerskraymer2007-09-271-7/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24629 b3059339-0415-0410-9bf9-f77b7e298cf2
* "fake" commit (postpone cosmetics from r21537 for now)kraymer2007-09-2717-22/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24628 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert wrong ARCH_BFIN --> HAVE_BFIN change.diego2007-09-273-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24627 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixing uau's GNUisms... 100lrfelker2007-09-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24626 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable unused query_format functions for now until they arediego2007-09-263-0/+6
| | | | | | | | | | | | investigated and properly used/fixed. Fixes warnings: vf_softskip.c:50: warning: 'query_format' defined but not used vf_tfields.c:433: warning: 'query_format' defined but not used vf_telecine.c:91: warning: 'query_format' defined but not used vf_telecine.c:105: warning: 'config' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24625 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after FFmpegs r10594.cehoyos2007-09-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24624 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable buggy unused function via #if 0, blessed by Rich.diego2007-09-261-0/+2
| | | | | | | | | Fixes warning: vf_pullup.c: At top level: vf_pullup.c:82: warning: 'get_image' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24623 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused crappy hash_pic function, blessed by Rich.diego2007-09-261-19/+0
| | | | | | | | Fixes warning: vf_detc.c:57: warning: 'hash_pic' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24622 b3059339-0415-0410-9bf9-f77b7e298cf2
* BFIN is an architecture not a CPU extension, so move it from _cpuexts_all to ↵reimar2007-09-261-2/+2
| | | | | | _arch_all git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24621 b3059339-0415-0410-9bf9-f77b7e298cf2
* have ChangeLog a bit more generic about vidix ati drivers upgradeben2007-09-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24620 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-261-2/+0
| | | | | | | | | vo_directfb2.c: In function 'config': vo_directfb2.c:499: warning: unused variable 'flip' vo_directfb2.c:498: warning: unused variable 'zoom' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24619 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix playback of streams with more than one audio track (only one supported).cehoyos2007-09-251-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24618 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24550: msglevel 5 is the default.kraymer2007-09-251-9/+16
| | | | | | | | | | | r24551: Clarify description of MPLAYER_VERBOSE. r24558: Clarify the relationship between -msglevel and MPLAYER_VERBOSE. r24573: Implement setting gain control for video devices (usually webcams) in v4l2 tv:// driver. r24592: Change outdated note for -subfps git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24617 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc updates and spelling fixesdiego2007-09-251-3/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24616 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: misc typo fixesdiego2007-09-2512-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24615 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add IRC nick for Gianluigi Tiesi.diego2007-09-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24614 b3059339-0415-0410-9bf9-f77b7e298cf2
* The FFmpeg RoQ video decoder now uses 444P colorspace.diego2007-09-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24613 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify: initialize at declaration at the start of the functionreimar2007-09-241-10/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24612 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of rather pointless assertsreimar2007-09-241-12/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24611 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_alsa: Fix get_space() return values larger than buffersizeuau2007-09-241-2/+2
| | | | | | | | | | | | | | | | | After a buffer underrun the ALSA get_space() function sometimes returned values larger than the ao had set in ao_data.buffersize. Fix this by replacing the old check against MAX_OUTBURST by one against ao_data.buffersize. There should be no need for the MAX_OUTBURST check; the current MPlayer side should no longer have any constant limit on the amount of data an ao can buffer or request at once. The get_space() values larger than ao_data.buffersize triggered errors in audio decoding causing the current attempt to fill audio buffers to be aborted. I'm not sure how often that caused behavior noticeably worse then an underrun already is. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24610 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux_audio.c: Fix timestamp handlinguau2007-09-241-14/+15
| | | | | | | | | | | | | | | | | | The code calculated the pts values of audio packets by adding the length of the current packet to the pts of the previous one. The length of the previous packet should be added instead. This broke WAV timestamps near the end of the stream where a short packet occurs. Change the code to store the pts of the next packet instead of the last one. This fixes the WAV timestamps and allows some simplifications. MP3 timestamps are not affected as packets are always treated as constant decoded length, and FLAC timestamps still have worse problems (FLAC is treated as as if it was constant bitrate even though it isn't). Also store the timestamps as double instead of float. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24609 b3059339-0415-0410-9bf9-f77b7e298cf2
* codecs.conf: Change Monkey's Audio decoder status to "working"uau2007-09-241-1/+1
| | | | | | | | | The FFmpeg issue that broke decoding of some files has been fixed and no other problems are known, so there's no need to mark it "buggy" any more. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24608 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24606Gabrov2007-09-242-4/+98
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24607 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24604: Teletext documentationvoroshil2007-09-241-0/+94
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24606 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24558: Clarify the relationship between -msglevel and MPLAYER_VERBOSE.voroshil2007-09-241-4/+13
| | | | | | | | r24573: Implement setting gain control for video devices (usually webcams) r24592: Change outdated note for -subfps git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24605 b3059339-0415-0410-9bf9-f77b7e298cf2
* Teletext documentationvoroshil2007-09-241-0/+91
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24604 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation with enabled radio capture and disabled OSS audio.voroshil2007-09-241-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24603 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-241-1/+2
| | | | | | | | sub.c: In function 'vo_update_osd': sub.c:1104: warning: suggest explicit braces to avoid ambiguous 'else' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24602 b3059339-0415-0410-9bf9-f77b7e298cf2
* add support for yuva420p colorspace (yuv420p + alpha)aurel2007-09-241-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24601 b3059339-0415-0410-9bf9-f77b7e298cf2
* Pass URLs to gmplayer when executing, it accepts URLs on the command line.diego2007-09-241-1/+1
| | | | | | | patch by Chidambar 'ilLogict' Zinnoury, illogict online fr git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24600 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove Application from list of Categories, it is not a valid category.diego2007-09-241-1/+1
| | | | | | | patch by Chidambar 'ilLogict' Zinnoury, illogict online fr git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24599 b3059339-0415-0410-9bf9-f77b7e298cf2
* French typodiego2007-09-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24598 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic (get rid of _ at the start of local variable names)michael2007-09-241-24/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24597 b3059339-0415-0410-9bf9-f77b7e298cf2
* According to MSDN a thread must call CoUninitialize once for each successfuldiego2007-09-231-1/+1
| | | | | | | | | | call it has made to CoInitialize or CoInitializeEx, including any call that returns S_FALSE. Only the CoUninitialize call corresponding to the CoInitialize or CoInitializeEx call that initialized the library can close it. patch by Gianluigi Tiesi, mplayer netfarm it git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24596 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add new features, implemented in tv://voroshil2007-09-231-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24595 b3059339-0415-0410-9bf9-f77b7e298cf2
* add functions for the vga register access patch by Guillaume LECERF <foxcore ↵faust32007-09-231-31/+26
| | | | | | at gmail.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24594 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix building without network.iive2007-09-221-2/+4
| | | | | | | | | When _network=='no' then _nemesi, _live and _native_rtsp would keep their default values, in the the case of _native_rtsp this happens to be 'yes'. Clearing them also produces nicer output. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24593 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change outdated note for -subfpsreimar2007-09-221-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24592 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert r24103, it was nonsense and add a comment that explains the codereimar2007-09-221-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24591 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed unused function parametersnicodvb2007-09-221-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24590 b3059339-0415-0410-9bf9-f77b7e298cf2
* in ts_detect_streams() moved the iteration condition inside the loopnicodvb2007-09-221-1/+4
| | | | | | | | because it depends on the updated value of stream_tell(); (fixes infinite wait on enctrypted TS streams) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24589 b3059339-0415-0410-9bf9-f77b7e298cf2
* add some commented register dumping codefaust32007-09-201-0/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24588 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24573Gabrov2007-09-201-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24587 b3059339-0415-0410-9bf9-f77b7e298cf2
* libnemesi changelog itemlu_zero2007-09-201-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24586 b3059339-0415-0410-9bf9-f77b7e298cf2
* rivatv_lock_nv04 is actually an extended version of rivatv_lock_nv03 (patch ↵faust32007-09-191-2/+1
| | | | | | by Guillaume LECERF <foxcore at gmail.com>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24585 b3059339-0415-0410-9bf9-f77b7e298cf2
* libnemesi support, yet another rtsp/rtp library...lu_zero2007-09-198-9/+612
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24584 b3059339-0415-0410-9bf9-f77b7e298cf2
* I have overhauled the build system.diego2007-09-191-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24583 b3059339-0415-0410-9bf9-f77b7e298cf2
* I don't maintain any Windows ports, but the Debian package.diego2007-09-191-3/+3
| | | | | | | Michael maintains all of FFmpeg. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24582 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix loads of typosreimar2007-09-191-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24581 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add myself as Debian package maintainer, Dariush has not been active in years.diego2007-09-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24580 b3059339-0415-0410-9bf9-f77b7e298cf2
* (Re)move idiotic checks, ret can't be < 0 or > 0 if the loop conditionreimar2007-09-191-3/+2
| | | | | | | is that it is == 0! git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24579 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a few typosreimar2007-09-192-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24578 b3059339-0415-0410-9bf9-f77b7e298cf2
* More precise line spacing.eugeni2007-09-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24577 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix text height calculation. It depends on line spacing.eugeni2007-09-181-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24576 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix an obviously incorrect comment.eugeni2007-09-181-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24575 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable ass_line_spacing option.eugeni2007-09-183-0/+7
| | | | | | | Patch by Thomas Reitmayr (treitmayr devbase at). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24574 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement setting gain control for video devices (usually webcams)voroshil2007-09-186-1/+48
| | | | | | | in v4l2 tv:// driver. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24573 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPEG-2 blocks at qp 1 get overfiltered by spp, apparently because "qp>>1" turnsdiego2007-09-181-1/+1
| | | | | | | | it into 0, which causes an integer overflow later. Clip qp at 1 to avoid this. patch by Alexander Strange, astrange ithinksw com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24572 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention that libavc png decoder depends on zlibreimar2007-09-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24571 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add comment that clears up what _WINGDI_H is for.diego2007-09-181-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24570 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark phony targets as such.diego2007-09-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24569 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify commands with automatic variables.diego2007-09-181-13/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24568 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix indentation after the last change (patch by Guillaume LECERF <foxcore at ↵faust32007-09-181-6/+6
| | | | | | gmail.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24567 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24565Gabrov2007-09-182-11/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24566 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace stdint.h #include by functionally equivalent inttypes.h.diego2007-09-181-1/+1
| | | | | | | | The use of inttypes.h is more common throughout MPlayer and stdint.h can create problems on obscure systems like HP-UX, see Bugzilla #831. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24565 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace x-dev dependency with x11proto-core-dev.diego2007-09-181-1/+1
| | | | | | | | x-dev is now only a dummy package for transition. patch by Ansgar Burchardt, ansgar 2007.43-1 org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24564 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain how to use diff -uwbBE with svn directlyreimar2007-09-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24563 b3059339-0415-0410-9bf9-f77b7e298cf2
* it is no longer necessary to reboot the system after the dhahelperwin ↵faust32007-09-171-4/+30
| | | | | | installation (based on code by Romain Lievin from the tilp project) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24562 b3059339-0415-0410-9bf9-f77b7e298cf2
* - make dhahelperwin compile with mingwfaust32007-09-176-13/+459
| | | | | | | | | | - add dhahelper.rc based on code by Kevin Kofler and Romain Liévin <roms at lievin.net> from the tilp project http://svn.tilp.info/cgi-bin/viewcvs.cgi/libticables/trunk/src/win32/dha/ git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24561 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make dhasetup more verbose based on code byfaust32007-09-171-7/+32
| | | | | | | | Romain Lievin from the tilp project http://svn.tilp.info/cgi-bin/viewcvs.cgi/libticables/trunk/src/win32/dha/ git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24560 b3059339-0415-0410-9bf9-f77b7e298cf2
* rename windows ddk makefile to nmakefile so that a makefile for mingw can be ↵faust32007-09-171-0/+0
| | | | | | added git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24559 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify the relationship between -msglevel and MPLAYER_VERBOSE.diego2007-09-171-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24558 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix resolution detection for NV03 and NV04 cards, patch by Guillaume LECERF ↵faust32007-09-171-0/+3
| | | | | | <foxcore at gmail.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24557 b3059339-0415-0410-9bf9-f77b7e298cf2
* Upstream committed both of my libdvdcss patches.diego2007-09-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24556 b3059339-0415-0410-9bf9-f77b7e298cf2
* Leading underscores in identifiers are reserved in C.diego2007-09-173-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24555 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-171-1/+0
| | | | | | | | libdvdcss.c:145: warning: redundant redeclaration of 'dvdcss_interface_2' dvdcss/dvdcss.h:70: warning: previous declaration of 'dvdcss_interface_2' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24554 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24550: msglevel 5 is the default.voroshil2007-09-171-5/+5
| | | | | | | r24551: Clarify description of MPLAYER_VERBOSE. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24553 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24549: i_certify is no longer an optionvoroshil2007-09-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24552 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify description of MPLAYER_VERBOSE.diego2007-09-161-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24551 b3059339-0415-0410-9bf9-f77b7e298cf2
* msglevel 5 is the default.diego2007-09-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24550 b3059339-0415-0410-9bf9-f77b7e298cf2
* i_certify is no longer an optioncompn2007-09-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24549 b3059339-0415-0410-9bf9-f77b7e298cf2
* reimar cleaned up tivo demuxercompn2007-09-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24548 b3059339-0415-0410-9bf9-f77b7e298cf2
* vfw2menc works on linux/windowscompn2007-09-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24547 b3059339-0415-0410-9bf9-f77b7e298cf2
* Merge three sed invocations into one.diego2007-09-161-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24546 b3059339-0415-0410-9bf9-f77b7e298cf2
* Install man pages in $(PREFIX)/share/man instead of $(PREFIX)/mandiego2007-09-161-2/+2
| | | | | | | in order to better comply with the FHS. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24545 b3059339-0415-0410-9bf9-f77b7e298cf2
* vfw2menc works on linux and windows x86 onlycompn2007-09-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24544 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make vd_ffmpeg work with lavf demuxer also for RealVideo.reimar2007-09-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24543 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_mpegpes does not support S16_LE format, do not claim it does!reimar2007-09-161-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24542 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in commentreimar2007-09-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24541 b3059339-0415-0410-9bf9-f77b7e298cf2
* reverted useless r24539ben2007-09-151-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24540 b3059339-0415-0410-9bf9-f77b7e298cf2
* added monkey audio fourcc in wave headerben2007-09-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24539 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for cook audio (though most .rm files don't work with lavfreimar2007-09-151-0/+1
| | | | | | | demuxer anyway) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24538 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid rivatv_lock_nv40() from trashing the screen (patch by Guillaume Lecerf ↵ben2007-09-151-2/+2
| | | | | | <fox at geexbox dot org>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24537 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix screen width and height calculation on nvidia vidix (patch by Guillaume ↵ben2007-09-151-1/+11
| | | | | | Lecerf (fox at geexbox dot org) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24536 b3059339-0415-0410-9bf9-f77b7e298cf2
* getch2: Fix incorrect testuau2007-09-151-1/+1
| | | | | | | | | | | Keycode length wasn't checked in one case because of missing parentheses. This was accidentally broken in my previous commit to the file. Most likely the error had no practical effect; the length checks are unreliable in any case as they can be satisfied by unrelated data corresponding to other keypresses. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24535 b3059339-0415-0410-9bf9-f77b7e298cf2
* prevent some vidix drivers to get compiled on powerpc, they are not intended ↵ben2007-09-151-0/+5
| | | | | | to work git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24534 b3059339-0415-0410-9bf9-f77b7e298cf2
* restored vidix build on powerpcben2007-09-151-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24533 b3059339-0415-0410-9bf9-f77b7e298cf2
* the IN/OUT PORT 8/16/32 functions rely on inb/inw/inl/outb/outw/outl that ↵ben2007-09-151-0/+2
| | | | | | are not available on alpha and powerpc architectures git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24532 b3059339-0415-0410-9bf9-f77b7e298cf2
* this flag needs to be defined for pread() on powerpcben2007-09-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24531 b3059339-0415-0410-9bf9-f77b7e298cf2
* ifdef one variable that is not used with alpha and powerpc architecturesben2007-09-151-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24530 b3059339-0415-0410-9bf9-f77b7e298cf2
* Copy AC-3 bsmod field into IEC data-type field as required by the specsreimar2007-09-151-0/+1
| | | | | | | | | Is not known to make any difference in practice (yet?). Patch by Ulion (ulion2002 gmail com) minus a cast that seemed unnecessary (beat me if I was wrong ;-) ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24529 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle swab when input length is odd (treat it as if there was an additionalreimar2007-09-151-2/+10
| | | | | | | 0 byte) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24528 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid one more code duplicationreimar2007-09-151-17/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24527 b3059339-0415-0410-9bf9-f77b7e298cf2
* get rid of pointless size parameter for tmf_load_chunkreimar2007-09-151-8/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24526 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid using demux->stream->end_pos, it rarely does any good.reimar2007-09-151-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24525 b3059339-0415-0410-9bf9-f77b7e298cf2
* Slightly simplify IsValidAudioPacketreimar2007-09-151-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24524 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify another two ifs into onereimar2007-09-151-7/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24523 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make one mp_msg call out of 3reimar2007-09-151-17/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24522 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simpler and more robust tar parsingreimar2007-09-151-26/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24521 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of bloated ty_extension functionreimar2007-09-151-11/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24520 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not uselessly name structsreimar2007-09-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24519 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove another variable and reorder to avoid wasting space due to alignmentreimar2007-09-151-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24518 b3059339-0415-0410-9bf9-f77b7e298cf2
* PTS should be passed as int64_t to demux_ty_CopyToDemuxPacketreimar2007-09-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24517 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove now useless parameters from demux_ty_CopyToDemuxPacketreimar2007-09-151-6/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24516 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove more unused code and variablesreimar2007-09-151-10/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24515 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix typo in function name.diego2007-09-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24514 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed unused members from dvdnav_priv_tnicodvb2007-09-151-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24513 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed dead code related to stills.nicodvb2007-09-151-8/+0
| | | | | | | patch by Attila Ötvös (oattila chellu hu) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24512 b3059339-0415-0410-9bf9-f77b7e298cf2
* updated changelog with recent monkey audio decoder supportben2007-09-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24511 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert r24446 since it breaks mingw32 build: _WINGDI_H is defined in wingdi.hzuxy2007-09-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24510 b3059339-0415-0410-9bf9-f77b7e298cf2
* live recordings can contain 0-size type 0 chunks, ignore them insteadreimar2007-09-141-1/+1
| | | | | | | of erroring out. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24509 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move some more variable declarationsreimar2007-09-141-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24508 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove tabs and trailing whitespacereimar2007-09-141-124/+124
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24507 b3059339-0415-0410-9bf9-f77b7e298cf2
* A few more useless ()reimar2007-09-141-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24506 b3059339-0415-0410-9bf9-f77b7e298cf2
* Minor simplificationsreimar2007-09-141-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24505 b3059339-0415-0410-9bf9-f77b7e298cf2
* Further simplify demux_ty_FindESHeaderreimar2007-09-141-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24504 b3059339-0415-0410-9bf9-f77b7e298cf2
* Optimize demux_ty_FindESHeaderreimar2007-09-141-8/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24503 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some commented-out debugging codereimar2007-09-141-29/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24502 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix demux_ty_FindESHeader so it won't overreadreimar2007-09-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24501 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify demux_ty_FindESPacket by reusing demux_ty_FindESHeaderreimar2007-09-141-32/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24500 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused demux_ty_FindESPacket parameterreimar2007-09-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24499 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify demux_ty_FindESHeaderreimar2007-09-141-12/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24498 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move variable declarations into the block where they are usedreimar2007-09-141-19/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24497 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another piece of duplicate codereimar2007-09-141-13/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24496 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid a big piece of duplicated codereimar2007-09-141-52/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24495 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of more code duplicationreimar2007-09-141-35/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24494 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify XDS handlingreimar2007-09-141-12/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24493 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce code duplicationreimar2007-09-141-21/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24492 b3059339-0415-0410-9bf9-f77b7e298cf2
* Greatly simplify IsValidAudioPacket, though this might break somethingreimar2007-09-141-30/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24491 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify IsValidAudioPacketreimar2007-09-141-9/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24490 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not misuse a_streams for private info, demuxer->priv is for that!reimar2007-09-141-22/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24489 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use AV_RB24reimar2007-09-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24488 b3059339-0415-0410-9bf9-f77b7e298cf2
* get rid of pointless pesFileId variablesreimar2007-09-141-19/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24487 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify AV_RB32 / 256 -> AV_RB24reimar2007-09-141-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24486 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use AV_RB32 instead of tivobuffer2hostlongreimar2007-09-141-12/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24485 b3059339-0415-0410-9bf9-f77b7e298cf2
* Yet more cosmeticsreimar2007-09-141-23/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24484 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move timestamps to int64_t and use MP_NOPTS_VALUEreimar2007-09-141-29/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24483 b3059339-0415-0410-9bf9-f77b7e298cf2
* Demuxers are _not_ supposed to set ds->pts!reimar2007-09-141-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24482 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix completely broken get_ty_pts (it's an ordinary MPEG timestamp)reimar2007-09-141-15/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24481 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another ty simplificationreimar2007-09-141-8/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24480 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused variablereimar2007-09-141-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24479 b3059339-0415-0410-9bf9-f77b7e298cf2
* tmf_totalsize is not used either, remove itreimar2007-09-141-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24478 b3059339-0415-0410-9bf9-f77b7e298cf2
* More simplificationsreimar2007-09-141-13/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24477 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of some quite pointless variablesreimar2007-09-141-18/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24476 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move boundary check before use!reimar2007-09-141-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24475 b3059339-0415-0410-9bf9-f77b7e298cf2
* pthreads support is required for teletextvoroshil2007-09-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24474 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused tmf_totalchunksreimar2007-09-141-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24473 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify EOF handlingreimar2007-09-141-10/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24472 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify tmf_filetooffsetreimar2007-09-141-21/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24471 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small simplificationsreimar2007-09-141-7/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24470 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, placed terminating 0 at the wrong place.reimar2007-09-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24469 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid strlcpy, tar headers already have space to ensure 0-terminationreimar2007-09-141-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24468 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not ignore last chunk in .tmf files, it will cause part of the file to bereimar2007-09-141-3/+1
| | | | | | | missing during playback. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24467 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: remove lots of useless () and {}.reimar2007-09-141-151/+85
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24466 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use CHUNKSIZE define in a few more placesreimar2007-09-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24465 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify ty_extensionisreimar2007-09-141-8/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24464 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make demux_ty internal functions staticreimar2007-09-141-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24463 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use strtol instead of horribly suboptimal ty_octaltodecimalreimar2007-09-141-21/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24462 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix ESD check: use an ESD function to actually check linking and doreimar2007-09-141-2/+2
| | | | | | | not uselessly run resulting binary. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24461 b3059339-0415-0410-9bf9-f77b7e298cf2
* sigill_handler_sse is not needed and can not compile on 64 bit systemsreimar2007-09-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24460 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not check for X86_FXSR_MAGIC define, it is missing in newerreimar2007-09-141-5/+4
| | | | | | | distribution/kernel headers. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24459 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused sigfpe handlerreimar2007-09-141-22/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24458 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove test for SSE exception support that has been commented out since ages.reimar2007-09-141-25/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24457 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix off-by-one error if fsize is odd (does handling that case even make sense?)reimar2007-09-141-2/+1
| | | | | | | and remove a TODO comment that no longer applies. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24456 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark DTS tables as constreimar2007-09-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24455 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 10l typo in syncwordreimar2007-09-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24454 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improved comments, based on patches by Ulion [ulion2002 gmail com]reimar2007-09-141-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24453 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify and fix big-endian hwac3 header generation code.reimar2007-09-141-17/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24452 b3059339-0415-0410-9bf9-f77b7e298cf2
* Deobfuscate: use IMGFMT_RGB_DEPTH and IMGFMT_IS_BGRreimar2007-09-131-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24451 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix missing reset/initialization (with tv parameters) ofvoroshil2007-09-131-0/+2
| | | | | | | | vbi subsystem after tv initialization. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24450 b3059339-0415-0410-9bf9-f77b7e298cf2
* added monkey audio file extensions to extension tableben2007-09-131-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24449 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move AM_MEDIA_TYPE structure definition to mediatype.h.voroshil2007-09-133-13/+26
| | | | | | | | | Make inclusion of com.h and wine/*.h conditional, this will allow reusing of mediatype.c code under MinGW without requirement to include all remaining wine/* stuff. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24448 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check wLongsPerEntry before using it.reimar2007-09-131-5/+5
| | | | | | | | | | This fixes a potential crash for some values of it. As a side effect it works around broken callocs with an integer overflow vulnerability, but using MPlayer on such systems should never be assumed to be safe! git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24447 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless preprocessor check, _WINGDI_H is never defined.diego2007-09-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24446 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for FFmpeg Monkey's Audio decoderuau2007-09-131-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24445 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-134-5/+5
| | | | | | | | | | | | | | | | | input.c: In function 'mp_input_set_section': input.c:1640: warning: suggest parentheses around assignment used as truth value input.c:1643: warning: suggest parentheses around assignment used as truth value mga_common.c: In function 'mga_init': mga_common.c:394: warning: suggest parentheses around assignment used as truth value playtreeparser.c: In function 'parse_smil': playtreeparser.c:523: warning: suggest parentheses around assignment used as truth value libmpdemux/demux_ts.c: In function 'ts_parse': libmpdemux/demux_ts.c:2795: warning: suggest parentheses around assignment used as truth value libmpdemux/demux_ts.c: In function 'demux_open_ts': libmpdemux/demux_ts.c:591: warning: 'frame_length' may be used uninitialized in this function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24444 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace constant by appropriate definereimar2007-09-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24443 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove leading underscores from multiple inclusion guards,diego2007-09-1331-103/+98
| | | | | | | leading underscores are reserved in the C standard. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24442 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix include path.diego2007-09-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24441 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant #ifndef, __WINE_MMSYSTEM_H is never defined.diego2007-09-121-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24440 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Use uppercase for multiple inclusion guards and comment #endifs.diego2007-09-122-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24439 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless #ifndef, __WINE_WINGDI_H is never defined.diego2007-09-121-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24438 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant multiple inclusion guard.diego2007-09-121-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24437 b3059339-0415-0410-9bf9-f77b7e298cf2
* DOCS/tech/colorspaces.txt says I420 and IYUV are the same, so add IYUV at thereimar2007-09-121-0/+1
| | | | | | | | same place. It can't break anything worse than it is now (i.e. not working/supported at all) and hopefully triggers a bug report so it gets fixed if it's wrong ;-) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24436 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24423: Implementation of tv:// driver autodetection.voroshil2007-09-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24435 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24423: Implementation of tv:// driver autodetection.voroshil2007-09-121-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24434 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use path as multiple inclusion guard.diego2007-09-123-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24433 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24423Gabrov2007-09-122-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24432 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing #include to fix compilation.diego2007-09-121-0/+1
| | | | | | | patch by Bernd Ernesti, mplayer-dev-eng lists.veego de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24431 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not replace _ by - if x86_64 is given in --target.reimar2007-09-121-1/+4
| | | | | | | Patch by Andrew Calkin (andrew calkin gmail com) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24430 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r24423gpoirier2007-09-111-6/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24429 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix indentation after r24367.cehoyos2007-09-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24428 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24294: suboption consistency, add fixme document -vivo suboptionskraymer2007-09-102-5/+21
| | | | | | | | | | | | | r24310: Support for selecting language via packet 28. r24329: manpage fix: escape '\' in -vf geq description r24349: Support lowdelay flag r24356: spelling fixes, pointed by Diego r24357: Clarify teletext tlang option. r24386: move lavc option out of XviD section, to lavc section r24423: Implementation of tv:// driver autodetection. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24427 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert r24424.voroshil2007-09-105-48/+48
| | | | | | | | Fix is wrong, because 'packed' attribute can be placed before structure definition only when all members have this attribute. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24426 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for:voroshil2007-09-102-13/+13
| | | | | | | | | | | | | | | | | | | dshow/DS_Filter.c: In function 'DS_Filter_CopySample': dshow/DS_Filter.c:103: warning: dereferencing type-punned pointer will break strict-aliasing rules dshow/DS_Filter.c:185: warning: dereferencing type-punned pointer will break strict-aliasing rules dshow/DS_Filter.c:191: warning: dereferencing type-punned pointer will break strict-aliasing rules dshow/DS_Filter.c:198: warning: dereferencing type-punned pointer will break strict-aliasing rules dshow/DS_Filter.c:220: warning: dereferencing type-punned pointer will break strict-aliasing rules dshow/DS_Filter.c:245: warning: dereferencing type-punned pointer will break strict-aliasing rules dmo/dmo.c: In function 'DMO_FilterCreate': dmo/dmo.c:73: warning: dereferencing type-punned pointer will break strict-aliasing rules dmo/dmo.c:79: warning: dereferencing type-punned pointer will break strict-aliasing rules dmo/dmo.c:86: warning: dereferencing type-punned pointer will break strict-aliasing rules dmo/dmo.c:90: warning: dereferencing type-punned pointer will break strict-aliasing rules dmo/dmo.c:93: warning: dereferencing type-punned pointer will break strict-aliasing rules git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24425 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for a lot ofvoroshil2007-09-105-48/+48
| | | | | | | | "'packed' attribute ignored for field of type 'BYTE'" warnings. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24424 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implementation of tv:// driver autodetection.voroshil2007-09-104-10/+21
| | | | | | | | | | | | If user did not specify driver directly, all available drivers will be probed (in order: v4l2,v4l1,bsdbt848,dummy). In most cases first probed driver will be successfully autodetected and used. Autodetection will be disabled if user specified driver directly (in command line or config). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24423 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Add comments to some #endif preprocessor directives.diego2007-09-104-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24422 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-2/+0
| | | | | | | | | | win32.c:2102: warning: redundant redeclaration of 'LoadResource' wine/winbase.h:1678: warning: previous declaration of 'LoadResource' was here win32.c:2247: warning: redundant redeclaration of 'MODULE32_LookupHMODULE' wine/module.h:143: warning: previous declaration of 'MODULE32_LookupHMODULE' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24421 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-101-1/+0
| | | | | | | | win32.c: In function 'expGetSystemInfo': win32.c:935: warning: unused variable 'regs' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24420 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-101-1/+0
| | | | | | | | win32.c:960: warning: redundant redeclaration of 'gCpuCaps' ../cpudetect.h:53: warning: previous declaration of 'gCpuCaps' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24419 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-3/+0
| | | | | | | | | | pe_image.c:70: warning: redundant redeclaration of 'LookupExternal' win32.h:41: warning: previous declaration of 'LookupExternal' was here pe_image.c:71: warning: redundant redeclaration of 'LookupExternalByName' win32.h:42: warning: previous declaration of 'LookupExternalByName' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24418 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for:voroshil2007-09-101-2/+2
| | | | | | | dshow/mediatype.c:37: warning: suggest explicit braces to avoid ambiguous 'else' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24417 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for:voroshil2007-09-101-6/+6
| | | | | | | | | | | dshow/mediatype.c:47: warning: format '%02d' expects type 'int', but argument 5 has type 'long unsigned int' dshow/mediatype.c:74: warning: format '%d' expects type 'int', but argument 4 has type 'DWORD' dshow/mediatype.c:77: warning: format '%d' expects type 'int', but argument 4 has type 'DWORD' dshow/mediatype.c:84: warning: format '%d' expects type 'int', but argument 4 has type 'long int' dshow/mediatype.c:85: warning: format '%d' expects type 'int', but argument 4 has type 'long int' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24416 b3059339-0415-0410-9bf9-f77b7e298cf2
* Proper fix for:voroshil2007-09-101-2/+1
| | | | | | | | dshow/mediatype.c:52: warning: implicit declaration of function 'printf' dshow/mediatype.c:52: warning: incompatible implicit declaration of built-in function 'printf' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24415 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix silly typo.diego2007-09-101-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24414 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-101-1/+1
| | | | | | | dmo/dmo.c:118: warning: unused variable 'vi' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24413 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-2/+0
| | | | | | | | | | dmo/DMO_VideoDecoder.c: In function 'DMO_VideoDecoder_DecodeInternal': dmo/DMO_VideoDecoder.c:299: warning: unused variable 'ptr' dmo/DMO_VideoDecoder.c: In function 'DMO_VideoDecoder_SetDestFmt': dmo/DMO_VideoDecoder.c:366: warning: unused variable 'stoped' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24412 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-101-0/+1
| | | | | | | | dshow/mediatype.c:46: warning: implicit declaration of function 'printf' dshow/mediatype.c:46: warning: incompatible implicit declaration of built-in function 'printf' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24411 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-1/+0
| | | | | | | | | dshow/DS_VideoDecoder.c: In function 'DS_VideoDecoder_StartInternal': dshow/DS_VideoDecoder.c:268: warning: unused variable 'props1' dshow/DS_VideoDecoder.c:268: warning: unused variable 'props' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24410 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-1/+0
| | | | | | | | | dshow/DS_AudioDecoder.c: In function 'DS_AudioDecoder_Open': dshow/DS_AudioDecoder.c:98: warning: unused variable 'props1' dshow/DS_AudioDecoder.c:98: warning: unused variable 'props' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24409 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-4/+4
| | | | | | | | | | | | elfdll.c: In function 'ELFDLL_CreateModref': elfdll.c:177: warning: unused variable 'len' elfdll.c:175: warning: unused variable 'pe_import' elfdll.c:174: warning: unused variable 'dir' elfdll.c: In function 'ELFDLL_LoadLibraryExA': elfdll.c:244: warning: unused variable 'image' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24408 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-2/+0
| | | | | | | | | | registry.c: In function 'insert_reg_value': registry.c:266: warning: unused variable 't' registry.c: In function 'RegSetValueExA': registry.c:491: warning: unused variable 't' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24407 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-2/+2
| | | | | | | | | | resource.c: In function 'RES_SizeofResource': resource.c:111: warning: unused variable 'hRsrc32' resource.c: In function 'RES_LoadResource': resource.c:157: warning: unused variable 'hRsrc32' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24406 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-7/+2
| | | | | | | | | | | | | | | | | | | | win32.c: In function 'expCreateSemaphoreA': win32.c:1751: warning: unused variable 'pp' win32.c: In function 'expGetStartupInfoA': win32.c:2187: warning: unused variable 'i' win32.c: In function 'expLoadLibraryA': win32.c:2298: warning: unused variable 'i' win32.c: In function 'expWritePrivateProfileStringA': win32.c:2786: warning: unused variable 'size' win32.c: In function 'expGetSystemTimeAsFileTime': win32.c:3136: warning: unused variable 'local_tm' win32.c: In function 'expGetEnvironmentVariableA': win32.c:3150: warning: unused variable 'p' win32.c: In function 'LookupExternalByName': win32.c:5371: warning: unused variable 'answ' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24405 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-101-1/+0
| | | | | | | | ext.c: At top level: ext.c:316: warning: 'mapping_size' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24404 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-2/+1
| | | | | | | | | | ext.c: In function 'HeapAlloc': ext.c:86: warning: unused variable 'i' ext.c: In function 'VirtualAlloc': ext.c:440: warning: unused variable 'fd' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24403 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-4/+3
| | | | | | | | | | | | | | module.c: In function 'MODULE_DllProcessAttach': module.c:217: warning: unused variable 'i' module.c: In function 'MODULE_DllProcessDetach': module.c:278: warning: unused variable 'l' module.c: In function 'MODULE_LoadLibraryExA': module.c:305: warning: unused variable 'i' module.c: In function 'report_func_ret': module.c:948: warning: unused variable 'i' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24402 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-3/+1
| | | | | | | | | | | | pe_image.c: In function 'fixup_imports': pe_image.c:290: warning: unused variable 'wmImp' pe_image.c: In function 'PE_LoadImage': pe_image.c:445: warning: unused variable 'bhfi' pe_image.c: In function 'PE_CreateModule': pe_image.c:706: warning: unused variable 'result' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24401 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-09-101-2/+1
| | | | | | | | | | afl.c: In function 'acmDriverOpen': afl.c:196: warning: unused variable 'hdrv' afl.c: In function 'acmStreamOpen': afl.c:441: warning: unused variable 'drv_tag' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24400 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-101-1/+0
| | | | | | | | driver.c: In function 'DrvOpen': driver.c:152: warning: unused variable 'i' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24399 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-101-0/+1
| | | | | | | | sub.c: In function 'vo_update_text_teletext': sub.c:293: warning: implicit declaration of function 'GetTimer' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24398 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-102-1/+1
| | | | | | | | cfg-common.h:347: warning: redundant redeclaration of 'vd_use_slices' libmpcodecs/vd.h:19: warning: previous declaration of 'vd_use_slices' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24397 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert the part of r24389 that broke compilation of mencoder.cehoyos2007-09-101-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24396 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24386: move lavc option out of XviD section, to lavc sectionvoroshil2007-09-101-6/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24395 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:voroshil2007-09-101-1/+0
| | | | | | | | cfg-common.h:386: warning: redundant redeclaration of 'audio_stream' stream/stream.h:301: warning: previous declaration of 'audio_stream' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24394 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:voroshil2007-09-101-2/+0
| | | | | | | | | | cfg-mplayer.h:43: warning: redundant redeclaration of 'mDisplayName' libvo/x11_common.h:30: warning: previous declaration of 'mDisplayName' was here cfg-mplayer.h:46: warning: redundant redeclaration of 'vo_fstype_list' libvo/x11_common.h:28: warning: previous declaration of 'vo_fstype_list' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24393 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:voroshil2007-09-101-5/+0
| | | | | | | | | | cfg-common.h:509: warning: redundant redeclaration of 'fribidi_charset' subreader.h:64: warning: previous declaration of 'fribidi_charset' was here cfg-common.h:510: warning: redundant redeclaration of 'flip_hebrew' subreader.h:65: warning: previous declaration of 'flip_hebrew' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24392 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:voroshil2007-09-101-2/+0
| | | | | | | | | | cfg-common.h:340: warning: redundant redeclaration of 'quiet' mplayer.c:85: warning: previous definition of 'quiet' was here cfg-common.h:341: warning: redundant redeclaration of 'verbose' mp_msg.h:6: warning: previous declaration of 'verbose' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24391 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix warnings:voroshil2007-09-101-2/+0
| | | | | | | | | | cfg-common.h:399: warning: redundant redeclaration of 'edl_filename' edl.h:23: warning: previous declaration of 'edl_filename' was here cfg-common.h:400: warning: redundant redeclaration of 'edl_output_filename' edl.h:24: warning: previous declaration of 'edl_output_filename' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24390 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:voroshil2007-09-101-2/+0
| | | | | | | | | | cfg-common.h:349: warning: redundant redeclaration of 'vd_use_slices' libmpcodecs/vd.h:19: warning: previous declaration of 'vd_use_slices' was here cfg-common.h:350: warning: redundant redeclaration of 'divx_quality' libmpcodecs/dec_video.h:23: warning: previous declaration of 'divx_quality' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24389 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:voroshil2007-09-101-6/+0
| | | | | | | | | | | | | | cfg-mplayer.h:9: warning: redundant redeclaration of 'noconsolecontrols' mplayer.c:191: warning: previous definition of 'noconsolecontrols' was here cfg-mplayer.h:22: warning: redundant redeclaration of 'volstep' mplayer.c:566: warning: previous definition of 'volstep' was here cfg-mplayer.h:37: warning: redundant redeclaration of 'osd_level' mplayer.c:235: warning: previous definition of 'osd_level' was here cfg-mplayer.h:82: warning: redundant redeclaration of 'use_filedir_conf' mplayer.c:370: warning: previous declaration of 'use_filedir_conf' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24388 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24386Gabrov2007-09-091-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24387 b3059339-0415-0410-9bf9-f77b7e298cf2
* move lavc option out of XviD section, to lavc sectiongpoirier2007-09-091-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24386 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix redundant declaration warnings for variables already definedvoroshil2007-09-091-26/+0
| | | | | | | | in libvo/video_out.h git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24385 b3059339-0415-0410-9bf9-f77b7e298cf2
* Option adevice is implemented for all tv:// drivers.voroshil2007-09-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24384 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add comments to some #endif preprocessor directives.diego2007-09-092-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24383 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24381Gabrov2007-09-094-60/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24382 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move vo_3dfx check after vo_dga check, vo_3dfx needs -lXxf86dga to link.diego2007-09-091-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24381 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-091-2/+0
| | | | | | | libmpcodecs/vf_divtc.c:206: warning: 'cmp' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24380 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-091-0/+2
| | | | | | | libmpcodecs/ae_lavc.c:135: warning: 'lavc_find_atag' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24379 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-091-1/+1
| | | | | | | | demux_mov.c: In function 'mov_check_file': demux_mov.c:504: warning: label 'skip_chunk' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24378 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-091-1/+1
| | | | | | | | demux_lmlm4.c: In function 'demux_lmlm4_fill_buffer': demux_lmlm4.c:215: warning: label 'hdr' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24377 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-09-091-2/+1
| | | | | | | | ao_mpegpes.c: In function 'init': ao_mpegpes.c:230: warning: label 'retry' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24376 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add nuv codec tag mappingreimar2007-09-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24375 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark lavfpref demuxer as safe, so it that it is actually used for e.g.reimar2007-09-091-1/+1
| | | | | | | nuv as it was planned. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24374 b3059339-0415-0410-9bf9-f77b7e298cf2
* add instruction how to use parallel h264 deodingcompn2007-09-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24373 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix fast_cmov detection broken by r24371zuxy2007-09-081-5/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24372 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use -march=native (avail. since gcc 4.2) when possiblezuxy2007-09-081-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24371 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a check for c->head being NULL in pullup_free_context().gpoirier2007-09-081-0/+1
| | | | | | | | | | | This fixes crashes when an invalid filter chain is built Patch by Alexander Strange % astrange A ithinksw P com % Original thread: date: Sep 7, 2007 8:47 PM subject: [MPlayer-dev-eng] [PATCH] crash in pullup with invalid filters git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24370 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add "teletext patches" string to Otvos Attila's listvoroshil2007-09-081-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24369 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix borders for xmga broken by r23675. Tested by Diego.reimar2007-09-081-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24368 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid releasing of unallocated memory.voroshil2007-09-081-0/+2
| | | | | | | | | Patch is made from coreavc-for-linux project source code http://code.google.com/p/coreavc-for-linux/ git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24367 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for:voroshil2007-09-081-1/+1
| | | | | | | | tvi_v4l2.c: In function 'start': tvi_v4l2.c:1453: warning: comparison between signed and unsigned git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24366 b3059339-0415-0410-9bf9-f77b7e298cf2
* More accurate calculating of teletextvoroshil2007-09-081-1/+3
| | | | | | | | page update intervals git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24365 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement boxes for subtitle teletext pages.voroshil2007-09-083-8/+27
| | | | | | | | | | Text is shown in opaque boxes inside transparent teletext page. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24364 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always initialize pUnk pointer with zero.voroshil2007-09-081-0/+1
| | | | | | | | Should fix accidental crashes in various dshow/vfm binary codecs, caused by attempting to release unallocated data. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24363 b3059339-0415-0410-9bf9-f77b7e298cf2
* Decrease teletext page rendering frequency from 1/frame to about 4/sec.voroshil2007-09-083-1/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24362 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typo in r24360cehoyos2007-09-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24361 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after FFmpeg AUDIO_(DE)MUXER splituau2007-09-071-2/+2
| | | | | | | | | | The FFmpeg build system split AUDIO_(DE)MUXER into two parts: AUDIO_BEOS_(DE)MUXER and OSS_(DE)MUXER. cehoyos's earlier fix only changed the code from AUDIO_(DE)MUXER to AUDIO_BEOS_(DE)MUXER ignoring the other half of the split. Fix it to also disable OSS_(DE)MUXER. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24360 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24356: spelling fixes, pointed by Diegovoroshil2007-09-071-3/+3
| | | | | | | r24357: Clarify teletext tlang option. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24359 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after FFmpeg r10426.cehoyos2007-09-071-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24358 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify teletext tlang option.diego2007-09-061-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24357 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling fixes, pointed by Diegovoroshil2007-09-061-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24356 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24294: suboption consistency, add fixme document -vivo suboptionsvoroshil2007-09-061-3/+16
| | | | | | | | | | r24301: replace deleted line r24310: Support for selecting language via packet 28. r24329: manpage fix: escape '\' in -vf geq description r24349: Support lowdelay flag git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24355 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24216: Add missed in r24212 strings definitionsvoroshil2007-09-064-64/+34
| | | | | | | | | | | | | r24327: fix broken MinGW-Howto link r24293: remove planned features, ok by diego r24310: Support for selecting language via packet 28. r24341: Move debug message to verbose output level. r24342: Matroska muxer now available in libavformat. r24344: Remove technical description of DVDs and libdvdread implementation. r24346: Replace short region code explanation by more detailed section. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24354 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24216: Add missed in r24212 strings definitionsvoroshil2007-09-061-1/+15
| | | | | | | | r24310: Support for selecting language via packet 28. r24341: Move debug message to verbose output level. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24353 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ; at the end of the sed commands. this fixes operation under cygwin.ivo2007-09-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24352 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove cut&paste from ffmpeg mistake. cd "$1" does not make any sense here,ivo2007-09-061-2/+2
| | | | | | | as $1 is (g)cc's version number git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24351 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix AltiVec autodetection: The autodetection was overriding configurediego2007-09-061-4/+5
| | | | | | | command line options. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24350 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support lowdelay flagreimar2007-09-062-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24349 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention Slice-based parallel H.264 decoding in changeloggpoirier2007-09-051-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24348 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/ r24329gpoirier2007-09-051-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24347 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace short region code explanation by more detailed section.diego2007-09-051-10/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24346 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after FFmpeg r10411.cehoyos2007-09-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24345 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove technical description of DVDs and libdvdread implementation.diego2007-09-051-44/+0
| | | | | | | | It is out of place in the user-level documentation and there are more exhaustive sources elsewhere. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24344 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow XF86AudioLowerVolume/XF86AudioRaiseVolume keys to be handled by MPlayer.diego2007-09-051-0/+6
| | | | | | | patch by Michael Mauch, michael.mauch gmx de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24343 b3059339-0415-0410-9bf9-f77b7e298cf2
* Matroska muxer now available in libavformat.diego2007-09-051-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24342 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move debug message to verbose output level.diego2007-09-0413-13/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24341 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete libac3 entry.diego2007-09-041-9/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24340 b3059339-0415-0410-9bf9-f77b7e298cf2
* warnig fix (blessed by Rich):diego2007-09-041-1/+1
| | | | | | | pullup.c:223: warning: 'qpcomb_y' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24339 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a bicubic scaler that needs a lot more instruction but noreimar2007-09-042-0/+42
| | | | | | | extra texture lookup git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24338 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not reset user-enabled mute on EOF, but only on exit.reimar2007-09-031-1/+2
| | | | | | | Make behaviour more consistent with general volume control. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24337 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for:voroshil2007-09-031-0/+4
| | | | | | | tvi_vbi.c:1392: warning: 'decode_raw_line_sine' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24336 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation after patch to remove global vo_hdcreimar2007-09-033-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24335 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove global vo_hdc, since it is recommended to release a DC as soon as ↵reimar2007-09-032-9/+15
| | | | | | possible. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24334 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove checks that in the worst case will completely break fullscreenreimar2007-09-031-6/+0
| | | | | | | | switching. If they are needed for something they must be done in a more robust way. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24333 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure aspect hint is adjusted on aspect changereimar2007-09-031-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24332 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: set vo_hint.flags at more consistent places (directly beforereimar2007-09-021-3/+5
| | | | | | | setting the corresponding values) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24331 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24329Gabrov2007-09-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24330 b3059339-0415-0410-9bf9-f77b7e298cf2
* manpage fix: escape '\' in -vf geq descriptionuau2007-09-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24329 b3059339-0415-0410-9bf9-f77b7e298cf2
* decerebrated-proof guide to the instalation of dvdnavnicodvb2007-09-021-0/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24328 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix broken MinGW-Howto linkkraymer2007-09-027-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24327 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24310Gabrov2007-09-022-2/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24326 b3059339-0415-0410-9bf9-f77b7e298cf2
* Increase number of skipped buffers to 5 to avoid mixing teletext pages fromvoroshil2007-09-021-2/+6
| | | | | | | | different channels during channel switch. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24325 b3059339-0415-0410-9bf9-f77b7e298cf2
* a mouse selection may require at least a video codec reinitnicodvb2007-09-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24324 b3059339-0415-0410-9bf9-f77b7e298cf2
* implemented STREAM_CTRL_GET_ASPECT_RATIOnicodvb2007-09-011-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24323 b3059339-0415-0410-9bf9-f77b7e298cf2
* moved to reinit_video_chain() the assignment of sh_video->stream_aspect, ↵nicodvb2007-09-011-3/+3
| | | | | | where it makes more sense git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24322 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure that no pages will left in cache duringvoroshil2007-09-011-1/+9
| | | | | | | | channel switch (immediately stop decoding of vbi buffer when clear_cache is called). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24321 b3059339-0415-0410-9bf9-f77b7e298cf2
* if the stream reader supports it assign to the video the stream aspect rationicodvb2007-09-011-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24320 b3059339-0415-0410-9bf9-f77b7e298cf2
* added .stream_aspect to st_video_t: if non-zero and if not specified otherwisenicodvb2007-09-012-0/+2
| | | | | | | by the user the video pipeline will use it as current aspect ratio git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24319 b3059339-0415-0410-9bf9-f77b7e298cf2
* implemented STREAM_CTRL_GET_ASPECT_RATIOnicodvb2007-09-011-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24318 b3059339-0415-0410-9bf9-f77b7e298cf2
* introduced STREAM_CTRL_GET_ASPECT_RATIO to report the aspect ratio read from ↵nicodvb2007-09-011-0/+1
| | | | | | the stream layer (if supported) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24317 b3059339-0415-0410-9bf9-f77b7e298cf2
* Drop out control chars from page header in time position.voroshil2007-09-011-3/+7
| | | | | | | | | Expand time line if necessary. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24316 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove imported rational calculation code and use the original one from avutil.iive2007-09-011-83/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24315 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix missed -1 -> 0x3f7f changes for subpage number.voroshil2007-09-011-2/+2
| | | | | | | | Patch from Otvos Attila oattila at chello dot hu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24314 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix displaying start page when it has subpages.voroshil2007-09-011-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24313 b3059339-0415-0410-9bf9-f77b7e298cf2
* Proper support for flashing chars in teletext pages.voroshil2007-09-013-3/+9
| | | | | | | | Patch from Otvos Attila oattila at chello dot hu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24312 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r24310gpoirier2007-08-311-51/+93
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24311 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for selecting language via packet 28.voroshil2007-08-316-21/+216
| | | | | | | | | | Also allows to select default teletext language. It will be used if language is not specified by network provider via packet 28. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24310 b3059339-0415-0410-9bf9-f77b7e298cf2
* renaming ARCH_BFIN to HAVE_BFINmhoffman2007-08-313-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24309 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make DGA 1 and DGA 2 separately selectable.diego2007-08-311-25/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24308 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-312-2/+2
| | | | | | | | | | | | mga_vid_test.c: In function ‘main’: mga_vid_test.c:157: warning: unused parameter ‘argc’ mga_vid_test.c:157: warning: unused parameter ‘argv’ tdfx_vid_test.c: In function ‘main’: tdfx_vid_test.c:26: warning: unused parameter ‘argc’ tdfx_vid_test.c:26: warning: unused parameter ‘argv’ git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24307 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless forward declarations.diego2007-08-311-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24306 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Sort some lines, whitespace changes.diego2007-08-301-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24305 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added Sun VO driver for Denes Balatonicehoyos2007-08-301-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24304 b3059339-0415-0410-9bf9-f77b7e298cf2
* ignore some symlinked fileskraymer2007-08-300-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24303 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24301Gabrov2007-08-292-12/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24302 b3059339-0415-0410-9bf9-f77b7e298cf2
* replace deleted linecompn2007-08-291-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24301 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small code simplification as suggested by Reimar:voroshil2007-08-291-18/+10
| | | | | | | | | | declare variables used only inside loop in those loop. Hope this will make code a bit easy to understand. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24300 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify code by using FFSWAPvoroshil2007-08-291-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24299 b3059339-0415-0410-9bf9-f77b7e298cf2
* (cosmetics) replace tabs with spacesvoroshil2007-08-291-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24298 b3059339-0415-0410-9bf9-f77b7e298cf2
* (cosmetics) fix indentation of previous commitvoroshil2007-08-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24297 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement Hold/Release graphics (showing control chars asvoroshil2007-08-291-0/+13
| | | | | | | | graphics instead of spaces). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24296 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement Flash/Steady (swapping foreground/background colors)voroshil2007-08-291-3/+19
| | | | | | | | and Conceal (filling following chars with spaces) control characters. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24295 b3059339-0415-0410-9bf9-f77b7e298cf2
* suboption consistency, add fixme document -vivo suboptionscompn2007-08-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24294 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove planned features, ok by diegocompn2007-08-291-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24293 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with r24137, patch by JRaSHkraymer2007-08-291-66/+113
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24292 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make charset constants naming consistantvoroshil2007-08-291-4/+4
| | | | | | | | (renamed according to specification). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24291 b3059339-0415-0410-9bf9-f77b7e298cf2
* Purge looooong obsolete remnants of vo_fsdga.diego2007-08-291-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24290 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused extern int declaration.diego2007-08-291-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24289 b3059339-0415-0410-9bf9-f77b7e298cf2
* Silence make's 'Please run configure again' if it was already run.cehoyos2007-08-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24288 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Fix up whitespace, indentation and similar things.diego2007-08-291-28/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24287 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix linking on Windows.diego2007-08-291-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24286 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-291-2/+4
| | | | | | | | | tdfx_vid_test.c: In function ‘main’: tdfx_vid_test.c:28: warning: unused variable ‘ptr’ tdfx_vid_test.c:27: warning: unused variable ‘i’ git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24285 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-291-1/+0
| | | | | | | tdfx_vid.c:61: warning: ‘map_base’ defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24284 b3059339-0415-0410-9bf9-f77b7e298cf2
* Build test programs with standard CFLAGS and use implicit rules.diego2007-08-291-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24283 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-291-0/+1
| | | | | | | | tdfx_vid_test.c: In function ‘main’: tdfx_vid_test.c:61: warning: incompatible implicit declaration of built-in function ‘memset’ git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24282 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add FFmpeg AC-3 decoder.diego2007-08-291-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24281 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-281-3/+3
| | | | | | | | pci_dev_ids.c:2404:18: warning: trigraph ??) ignored, use -trigraphs to enable pci_names.c:1733:23: warning: trigraph ??) ignored, use -trigraphs to enable git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24280 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with r24216Gabrov2007-08-282-2/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24279 b3059339-0415-0410-9bf9-f77b7e298cf2
* typosdiego2007-08-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24278 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: typo fix UNSUPORTED --> UNSUPPORTEDdiego2007-08-2825-62/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24277 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation by adding forgotten comma.iive2007-08-281-1/+1
| | | | | | | Noticed by Evrim Furuncu on irc. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24276 b3059339-0415-0410-9bf9-f77b7e298cf2
* Conversion tables for Serbian/Croatian, Ukrainian and Greek charsets.voroshil2007-08-281-1/+49
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24275 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless #ifdef HAVE_XVMC within get_format(), all of the functiondiego2007-08-281-2/+0
| | | | | | | is protected by that #ifdef. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24274 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-3/+3
| | | | | | | | vd_ffmpeg.c: At top level: vd_ffmpeg.c:915: warning: 'get_format' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24273 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-1/+0
| | | | | | | | vo_tdfx_vid.c: In function 'draw_image': vo_tdfx_vid.c:497: warning: unused variable 'stride' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24272 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-0/+1
| | | | | | | | vo_3dfx.c: In function 'create_window': vo_3dfx.c:189: warning: implicit declaration of function 'vo_x11_classhint' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24271 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-0/+1
| | | | | | | | vo_s3fb.c: In function 'enable': vo_s3fb.c:131: warning: control reaches end of non-void function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24270 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-1/+1
| | | | | | | vf_scale.c:359:92: warning: trigraph ??) ignored, use -trigraphs to enable git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24269 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Add some explanatory comments to #endif directives.diego2007-08-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24268 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-1/+0
| | | | | | | | ve_qtvideo.c: At top level: ve_qtvideo.c:109: warning: 'decompressor' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24267 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move channels option parsing code into separate routine.voroshil2007-08-281-67/+72
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24266 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-1/+1
| | | | | | | | font_load.c: In function 'read_font_desc': font_load.c:56: warning: unused variable 'fstate' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24265 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement X/27/0 packet decoding.voroshil2007-08-285-1/+81
| | | | | | | | | It contains information about navigation links. Modified patch from Otvos Attila oattila at chello dot hu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24264 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add code to clear left and right borders not only top and bottom.reimar2007-08-281-2/+20
| | | | | | | Patch by Tomas Janousek (tomi nomi cz) with small modifications by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24263 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clean up the way get_path is handled: Compile get_path.c to an object to linkdiego2007-08-2819-27/+45
| | | | | | | | against instead of directly #including the C file and replace the many extern declarations by a proper header file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24262 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-0/+2
| | | | | | | | vo_xmga.c: At top level: mga_common.c:212: warning: 'mga_fullscreen' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24261 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-2/+0
| | | | | | | vo_directfb2.c:111: warning: 'tvnorm' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24260 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-2/+0
| | | | | | | | vo_xv.c:63: warning: redundant redeclaration of 'XShmGetEventBase' /usr/include/X11/extensions/XShm.h:80: warning: previous declaration of 'XShmGetEventBase' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24259 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-1/+0
| | | | | | | | vo_svga.c:57: warning: redundant redeclaration of 'query_format' video_out_internal.h:38: warning: previous declaration of 'query_format' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24258 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-1/+0
| | | | | | | | vo_aa.c: In function 'preinit': vo_aa.c:664: warning: redundant redeclaration of 'aa_displayrecommended' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24257 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-281-1/+1
| | | | | | | | mplayer/common.c: In function 'PutImage': mplayer/common.c:188: warning: unused variable 'yc' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24256 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark xx function as returning char, fixes:diego2007-08-281-1/+1
| | | | | | | avi-fix.c:18: warning: return type defaults to 'int' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24255 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove nonsensical #ifdef.diego2007-08-281-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24254 b3059339-0415-0410-9bf9-f77b7e298cf2
* Assume first xinerama screen, in case xmga couldattila2007-08-281-0/+9
| | | | | | | never figure out on which screen it is. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24253 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement 8/30 format 1 teletext packet decodingvoroshil2007-08-282-0/+85
| | | | | | | | | | It contains network id, network name, current date and time. patch from Otvos Attila oattila at chello dot hu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24252 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typokraymer2007-08-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24251 b3059339-0415-0410-9bf9-f77b7e298cf2
* BGR15 is also a valid format for 4xm videortogni2007-08-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24250 b3059339-0415-0410-9bf9-f77b7e298cf2
* in stream_control() remove redefinition of d in a case block, previously ↵nicodvb2007-08-271-1/+0
| | | | | | assigned in the same function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24249 b3059339-0415-0410-9bf9-f77b7e298cf2
* in open_s() unified failure code in fail:nicodvb2007-08-271-20/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24248 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix wrong calculation of nbooleans that causes a crash on 64 bit systemsreimar2007-08-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24247 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set sample_rate and bit_rate from sh_audio as fallback in case sh_audio->wfreimar2007-08-271-0/+2
| | | | | | | is not available. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24246 b3059339-0415-0410-9bf9-f77b7e298cf2
* Process any waiting commands (got_cmd set). Should fix e.g. smplayer.reimar2007-08-271-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24245 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify the addition of -g to some CFLAGS.diego2007-08-271-10/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24244 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move common link libs/objects into a variable.diego2007-08-271-9/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24243 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistent linking orderdiego2007-08-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24242 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not overwrite config.h unless it was changed. Mostly taken from FFmpeg.diego2007-08-271-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24241 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify linkage parameters.diego2007-08-271-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24240 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-271-4/+6
| | | | | | | | | | | | | | | realcodecs/drv4.c: In function 'RV20toYUV420CustomMessage': realcodecs/drv4.c:151: warning: unused variable 'temp' realcodecs/drv4.c:150: warning: unused variable 'pp1' realcodecs/drv4.c: In function 'build_crc': realcodecs/drv4.c:263: warning: unused variable 'b' realcodecs/drv4.c: In function 'RV20toYUV420Transform': realcodecs/drv4.c:295: warning: unused variable 'crc2' realcodecs/drv4.c:295: warning: unused variable 'crc1' realcodecs/drv4.c:295: warning: unused variable 'len' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24239 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-271-2/+4
| | | | | | | | | | | | realcodecs/drv3.c: In function 'build_crc': realcodecs/drv3.c:291: warning: unused variable 'b' realcodecs/drv3.c: In function 'RV20toYUV420Transform': realcodecs/drv3.c:323: warning: unused variable 'crc2' realcodecs/drv3.c:323: warning: unused variable 'crc1' realcodecs/drv3.c:323: warning: unused variable 'len' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24238 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-271-3/+5
| | | | | | | | | | | | realcodecs/drv2.c: In function 'build_crc': realcodecs/drv2.c:316: warning: unused variable 'b' realcodecs/drv2.c: In function 'RV20toYUV420Transform': realcodecs/drv2.c:348: warning: unused variable 'crc2' realcodecs/drv2.c:348: warning: unused variable 'crc1' realcodecs/drv2.c:348: warning: unused variable 'len' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24237 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-271-2/+2
| | | | | | | | | realcodecs/sipr.c: In function 'RAInitDecoder': realcodecs/sipr.c:348: warning: unused variable 'temp2' realcodecs/sipr.c:347: warning: unused variable 'temp' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24236 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-271-3/+3
| | | | | | | | | | | | realcodecs/ra.c: In function 'RASetFlavor': realcodecs/ra.c:344: warning: unused variable 'property' realcodecs/ra.c:343: warning: unused variable 'flavor' realcodecs/ra.c:343: warning: unused variable 'numflavors' realcodecs/ra.c:342: warning: unused variable 'result1' realcodecs/ra.c:342: warning: unused variable 'numprop' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24235 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-271-5/+5
| | | | | | | | | | | | | | | realcodecs/28_8.c: In function 'RAInitDecoder': realcodecs/28_8.c:238: warning: unused variable 'temp2' realcodecs/28_8.c:237: warning: unused variable 'temp' realcodecs/28_8.c: In function 'RASetFlavor': realcodecs/28_8.c:273: warning: unused variable 'property' realcodecs/28_8.c:272: warning: unused variable 'flavor' realcodecs/28_8.c:272: warning: unused variable 'numflavors' realcodecs/28_8.c:271: warning: unused variable 'result1' realcodecs/28_8.c:271: warning: unused variable 'numprop' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24234 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-271-5/+5
| | | | | | | | | | | | | | | realcodecs/14_4.c: In function 'RAInitDecoder': realcodecs/14_4.c:238: warning: unused variable 'temp2' realcodecs/14_4.c:237: warning: unused variable 'temp' realcodecs/14_4.c: In function 'RASetFlavor': realcodecs/14_4.c:273: warning: unused variable 'property' realcodecs/14_4.c:272: warning: unused variable 'flavor' realcodecs/14_4.c:272: warning: unused variable 'numflavors' realcodecs/14_4.c:271: warning: unused variable 'result1' realcodecs/14_4.c:271: warning: unused variable 'numprop' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24233 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary fastmemcpybench prerequisite.diego2007-08-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24232 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused #include.diego2007-08-271-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24231 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a ton of warnings:diego2007-08-275-0/+5
| | | | | | | | warning: incompatible implicit declaration of built-in function 'memset' warning: incompatible implicit declaration of built-in function 'memcpy' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24230 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify bmovl-test compilation call.diego2007-08-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24229 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix "incompatible implicit declaration of built-in function 'exit'" warnings.diego2007-08-279-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24228 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark phony targets as such.diego2007-08-271-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24227 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move fastmemcpybench objects to link against into prerequisites.diego2007-08-271-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24226 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-271-2/+0
| | | | | | | | fastmemcpybench.c: At top level: fastmemcpybench.c:29: warning: 'mga_next_frame' defined but not used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24225 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-271-1/+0
| | | | | | | | fastmemcpybench.c: In function 'mga_init': fastmemcpybench.c:36: warning: unused variable 'frame_mem' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24224 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-271-0/+1
| | | | | | | | vivodump.c: In function 'main': vivodump.c:293: warning: control reaches end of non-void function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24223 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes:diego2007-08-271-3/+3
| | | | | | | | | | | | movinfo.c: In function 'video_stream_info': movinfo.c:80: warning: control reaches end of non-void function movinfo.c: In function 'audio_stream_info': movinfo.c:99: warning: control reaches end of non-void function movinfo.c: In function 'userdata_info': movinfo.c:152: warning: control reaches end of non-void function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24222 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert last commit, -mstackrealign was added in gcc 4.2 and should notdiego2007-08-271-2/+0
| | | | | | | be used unconditionally. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24221 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better handling of Alpha MVI CPU extensions (untested).diego2007-08-271-10/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24220 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:diego2007-08-261-2/+0
| | | | | | | | | | demux_mkv.c: In function 'demux_mkv_read_chapters': demux_mkv.c:1299: warning: unused variable 'mkv_d' demux_mkv.c: In function 'handle_subtitles': demux_mkv.c:2740: warning: unused variable 'mkv_d' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24219 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24050: MP3 audio encoder was renamed to libmp3lame in FFmpeg.kraymer2007-08-262-66/+131
| | | | | | | | | | | | | | | | | | r24055: Document how to encode with some libavcodec audio codecs. r24056: AC3 --> AC-3 r24063: Document how to encode with some more libavcodec audio codecs. r24084: small libavcodec audio codec clarifications r24109: Sort libavcodec encoders. r24110: Add some missing libavcodec video encoders. r24125: Automatic TV channels scanning ability for MPlayer. r24136: Wording and markup improvements for the -tvscan option. r24137: misc markup fixes r24216: Add missed in r24212 strings definitions git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24218 b3059339-0415-0410-9bf9-f77b7e298cf2
* (cosmetics) remove unnecessary ';'voroshil2007-08-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24217 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missed in r24212 strings definitionsvoroshil2007-08-261-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24216 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24125: Automatic TV channels scanning ability for MPlayer.voroshil2007-08-261-21/+44
| | | | | | | | r24136: Wording and markup improvements for the -tvscan option. r24137: misc markup fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24215 b3059339-0415-0410-9bf9-f77b7e298cf2
* r24180: Document xorg.conf option needed for Xv playback on Intel cards.voroshil2007-08-261-1/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24214 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace perror() with mp_msg()voroshil2007-08-261-31/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24213 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement TVI_CONTROL_TUN_GET_SIGNAL in *BSD BT848 driver.voroshil2007-08-261-0/+11
| | | | | | | | This will enable TV channels scanning feature under *BSD. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24212 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Move #endif upper to reflect changes in r24054.voroshil2007-08-261-1/+1
| | | | | | | | | | This fixes wrong tvscan suboptions initialization under *BSD. patch from Bernd Ernesti mplayer-dev-eng at lists dot veego dot de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24211 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typovoroshil2007-08-261-1/+1
| | | | | | | | Patch from Otvos Attila oattila at chello dot hu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24210 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused _def_altivecreimar2007-08-261-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24209 b3059339-0415-0410-9bf9-f77b7e298cf2
* Suboptions structure should be passed as array not as address of array.voroshil2007-08-261-1/+1
| | | | | | | | | patch from Bernd Ernesti mplayer-dev-eng at lists dot veego dot de git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24208 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify VIS detection. Also adds ENABLE_VIS define and changes "#define ↵reimar2007-08-261-5/+3
| | | | | | | | | HAVE_VIS = yes" to something more sane... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24207 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add teletext specification referencevoroshil2007-08-261-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24206 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove ugly Russian language support hack.voroshil2007-08-261-11/+1
| | | | | | | | | Currently support for only Latin-1 languages is left. Proper solution for another languages will be added later. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24205 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for Latin National Option Sub-Setsvoroshil2007-08-261-2/+46
| | | | | | | | Modified Otvos Attila's patch oattila at chello dot hu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24204 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable decoding of packet X/24, it is usual teletext linevoroshil2007-08-261-2/+2
| | | | | | | | | | | and contains labels for navigation links. 10l: fix comments for constants. patch from Otvos Attila oattila at chello dot hu git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24203 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split lschunks function further, it is simply too huge to do any useful ↵reimar2007-08-251-62/+72
| | | | | | | | | changes (e.g. for more proper support for multi-codec tracks). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24202 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get netstream closer to linking.diego2007-08-252-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24201 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-251-1/+1
| | | | | | | | | modify_reg.c: In function 'remove_key': modify_reg.c:39: warning: unused variable 'tmp_name' modify_reg.c:39: warning: unused variable 'tmp_val' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24200 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix subrip and vivodump linking.diego2007-08-251-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24199 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore modify_reg.diego2007-08-250-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24198 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark vfw2menc as Windows-only.diego2007-08-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24197 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-251-1/+0
| | | | | | | | pullup.c: In function 'decide_frame_length': pullup.c:569: warning: unused variable 'f3' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24196 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-251-3/+0
| | | | | | | | | | vo_aa.c:89: warning: redundant redeclaration of 'aa_defparams' /usr/include/aalib.h:371: warning: previous declaration of 'aa_defparams' was here vo_aa.c:90: warning: redundant redeclaration of 'aa_defrenderparams' /usr/include/aalib.h:377: warning: previous declaration of 'aa_defrenderparams' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24195 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-251-1/+1
| | | | | | | | mmap_anon.c: In function 'mmap_anon': mmap_anon.c:37: warning: unused variable 'fd' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24194 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning:diego2007-08-251-4/+0
| | | | | | | | | | In file included from layer3.c:1171, from sr1.c:391: decod386.c:106: warning: redundant redeclaration of 'synth_1to1_MMX' mpg123.h:120: warning: previous declaration of 'synth_1to1_MMX' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24193 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fix:diego2007-08-251-1/+0
| | | | | | | | demux_mov.c:44: warning: redundant redeclaration of 'vo_sub' ../libvo/sub.h:64: warning: previous declaration of 'vo_sub' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24192 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning:diego2007-08-251-1/+1
| | | | | | | af_sinesuppress.c:34: warning: 'play_float' declared 'static' but never defined git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24191 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless variable declaration, the code that sets it is long-gone.diego2007-08-251-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24190 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: "&" should be done after ">>"voroshil2007-08-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24189 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove stray comment, the code it commented is long-gone.diego2007-08-251-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24188 b3059339-0415-0410-9bf9-f77b7e298cf2
* Language bits in teletext page header arevoroshil2007-08-251-1/+1
| | | | | | | | control bits C12-C14 (bits 2-4 of d[7]), not C11-C13 (bits 1-3). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24187 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:diego2007-08-251-3/+3
| | | | | | | | | vo_directfb2.c:1296: warning: unused variable 'rect' vo_directfb2.c:1295: warning: unused variable 'dsc' vo_directfb2.c:1294: warning: unused variable 'tmp' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24186 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning:diego2007-08-251-0/+1
| | | | | | | | mplayer.c: In function 'generate_video_frame': mplayer.c:1631: warning: implicit declaration of function 'update_teletext' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24185 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:diego2007-08-251-6/+0
| | | | | | | | | | | | mplayer.c:316: warning: redundant redeclaration of 'vo_subdevice' libvo/video_out.h:237: warning: previous declaration of 'vo_subdevice' was here mplayer.c:317: warning: redundant redeclaration of 'ao_subdevice' libao2/audio_out.h:44: warning: previous declaration of 'ao_subdevice' was here mplayer.c:320: warning: redundant redeclaration of 'vo_flags' libvo/video_out.h:189: warning: previous declaration of 'vo_flags' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24184 b3059339-0415-0410-9bf9-f77b7e298cf2
* Extract a poor int declaration from within the uncouth grip of an if statementdiego2007-08-251-1/+1
| | | | | | | where it lay stranded in violation of both syntax and decency. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24183 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:diego2007-08-252-1/+1
| | | | | | | | | | | | In file included from mplayer.c:191: mp_fifo.h:5: warning: redundant redeclaration of 'mplayer_put_key' mp_core.h:129: warning: previous declaration of 'mplayer_put_key' was here In file included from command.c:59: mp_fifo.h:5: warning: redundant redeclaration of 'mplayer_put_key' mp_core.h:129: warning: previous declaration of 'mplayer_put_key' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24182 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning:diego2007-08-251-1/+0
| | | | | | | | mencoder.c:137: warning: redundant redeclaration of 'verbose' mp_msg.h:6: warning: previous declaration of 'verbose' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24181 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document xorg.conf option needed for Xv playback on Intel cards.rathann2007-08-251-0/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24180 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning:diego2007-08-251-3/+0
| | | | | | | | vo_xvidix.c:75: warning: redundant redeclaration of 'xinerama_screen' video_out.h:193: warning: previous declaration of 'xinerama_screen' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24179 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:diego2007-08-251-1/+0
| | | | | | | | | | | | In file included from mplayer.c:341: libass/ass_mp.h:27: warning: redundant redeclaration of 'ass_enabled' mp_core.h:115: warning: previous declaration of 'ass_enabled' was here In file included from command.c:58: mp_core.h:115: warning: redundant redeclaration of 'ass_enabled' libass/ass_mp.h:27: warning: previous declaration of 'ass_enabled' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24178 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warnings:diego2007-08-251-1/+0
| | | | | | | | | | | | | | | In file included from mplayer.c:380: mpcommon.h:5: warning: redundant redeclaration of 'subdata' libvo/sub.h:63: warning: previous declaration of 'subdata' was here In file included from command.c:26: mpcommon.h:5: warning: redundant redeclaration of 'subdata' libvo/sub.h:63: warning: previous declaration of 'subdata' was here In file included from mencoder.c:239: mpcommon.h:5: warning: redundant redeclaration of 'subdata' libvo/sub.h:63: warning: previous declaration of 'subdata' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24177 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add multiple inclusion guards.diego2007-08-251-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24176 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning:diego2007-08-251-2/+0
| | | | | | | | vo_dfbmga.c:231: warning: redundant redeclaration of 'uninit' video_out_internal.h:37: warning: previous declaration of 'uninit' was here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24175 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move button variable into the if () where it is actually used.diego2007-08-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24174 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant extern declarations, #include the right headers instead.diego2007-08-253-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24173 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/r24084gpoirier2007-08-251-10/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24172 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix redundant redeclaration warnings.diego2007-08-251-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24171 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix unused variable warning when USE_DVDNAV is not defined.diego2007-08-251-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24170 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant extern variable declarations, include proper headers instead.diego2007-08-254-9/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24169 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant variable declaration.diego2007-08-251-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24168 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant variable declarations.diego2007-08-251-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24167 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant variable declaration.diego2007-08-252-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24166 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant variable declarations.diego2007-08-251-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24165 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant variable declaration.diego2007-08-251-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24164 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant variable declaration.diego2007-08-251-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24163 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some unused variable warnings.diego2007-08-251-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24162 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert r24158, it is not necessary with unsigned bitfieldreimar2007-08-251-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@24161 b3059339-0415-0410-9bf9-f77b7e298cf2
generated by cgit v1.2.3 (git 2.25.1) at 2024-06-12 12:11:40 +0000