summaryrefslogtreecommitdiffstats
path: root/stream
Commit message (Expand)AuthorAgeFilesLines
* stream: remove NULL checks for open callswm42012-10-141-13/+3
* core: show quvi page title in window title, clean up libquvi handlingwm42012-10-142-132/+24
* Rename to "mpv"wm42012-10-121-1/+1
* core, timeline: cache external ordered chapter files tooStefano Pigozzi2012-09-184-7/+17
* bluray: add bd:// as stream prefixwm42012-09-181-1/+1
* core: fix DVD subtitle selectionwm42012-09-183-10/+5
* libaf: rename af_format.h to format.hwm42012-08-293-3/+3
* Adjust ffmpeg/libav #includes to work with recent upstream changesUoti Urpala2012-08-211-3/+4
* Remove support for libnemesi RTSP streamingwm42012-08-202-83/+0
* Remove support for LIVE555 RTSP streamingwm42012-08-204-146/+0
* libmpdemux: remove demux_real, demux_viv, demux_audiowm42012-08-202-2/+2
* Remove dvdnav support (DVD menus)wm42012-08-164-1085/+0
* Remove win32/qt/xanim/real binary codecs loadingwm42012-08-162-4242/+0
* stream_file: print strerror() when failing to open a fileUoti Urpala2012-08-161-1/+3
* win32: fix compilation on MinGWwm42012-08-071-9/+9
* options: get rid of ambiguous option parsingwm42012-08-051-1/+1
* mplayer, stream_tv: move variable initializationwm42012-08-031-1/+1
* tv: reduce code duplicationmplayer-svn2012-08-031-21/+14
* stream_pvr: fix buffer overflowmplayer-svn2012-08-031-16/+13
* stream: detect prematurely closed connectionmplayer-svn2012-08-031-1/+2
* stream: retry reconnecting several timesmplayer-svn2012-08-031-8/+22
* commands, dvd, dvdnav, bluray: cleanup sub/audio track language displaymplayer-svn2012-08-037-23/+99
* cache2: allow cache sizes up to 4 TBmplayer-svn2012-08-032-29/+30
* stream: add new stream control command STREAM_CTRL_GET_NUM_TITLESmplayer-svn2012-08-034-0/+12
* cache2: flush cache and sync stream position/eof after seeking STREAM_CTRLsmplayer-svn2012-08-031-10/+33
* stream/http: add a test file for ultravox in commentmplayer-svn2012-08-031-0/+3
* cache2: make cache process exit when main process diesmplayer-svn2012-08-031-0/+13
* Replace 'q' printf length modifier by 'll'mplayer-svn2012-08-031-1/+1
* cache2: make warnings easier to understandmplayer-svn2012-08-031-2/+2
* Remove teletext supportwm42012-08-035-128/+18
* stream: remove V4L TV input and V4L radio supportwm42012-08-023-2072/+0
* mplayer: rip out --capture supportwm42012-08-023-20/+0
* stream: remove stream_cuewm42012-08-022-643/+0
* stream: remove native RTSP/RTP/PNM supportwm42012-08-0130-10376/+2
* Change <endian.h> include to <sys/types.h>wm42012-07-311-1/+1
* Remove some demuxers and decoderswm42012-07-301-21/+0
* Remove compile time/runtime CPU detection, and drop some platformswm42012-07-301-1/+2
* bstr: rename bstr() function to bstr0(), and typedef bstr to struct bstrwm42012-07-281-1/+1
* Add support for playing video from streaming sites with libquviwm42012-07-281-2/+69
* Merge remote-tracking branch 'origin/master'wm42012-07-281-2/+2
|\
| * demux, vd_ffmpeg: fix demux keyframe flag, set AV_PKT_FLAG_KEYUoti Urpala2012-07-251-2/+2
* | Merge remote-tracking branch 'origin/master'wm42012-04-291-1/+1
|\ \ | |/
| * stream_cdda: print CDTEXT if availablewm42012-04-281-17/+51
| * configure, stream_cdda: remove libcdparanoia supportwm42012-04-281-59/+11
| * cosmetics: stream_cdda.c: reformatwm42012-04-281-359/+368
| * stream_cdda: various fixesreimar2012-04-281-10/+28
| * stream_ffmpeg: fix broken line from 30afc64532ff61Uoti Urpala2012-04-181-1/+1
* | Merge remote-tracking branch 'origin/master'wm42012-04-281-1/+1
|\ \ | |/
| * stream_pvr: fix field size / snprintf size mismatchUoti Urpala2012-04-111-1/+1
* | Merge remote-tracking branch 'origin/master'wm42012-04-134-340/+1
|\ \ | |/
| * build: remove OS/2 supportUoti Urpala2012-04-064-340/+1
* | stream_cdda: print CDTEXT if availablewm42012-04-011-17/+51
* | configure, stream_cdda: remove libcdparanoia supportwm42012-04-011-59/+11
* | stream_cdda: reformatwm42012-04-011-359/+368
* | stream_cdda: various fixesreimar2012-04-011-10/+28
* | Merge remote-tracking branch 'origin/master'wm42012-04-011-2/+3
|\ \ | |/
| * stream_vstream: fix vstream_error format stringUoti Urpala2012-04-011-2/+3
* | Merge remote-tracking branch 'origin/master' into my_masterwm42012-03-164-7/+9
|\ \ | |/
| * windows support: unicode filenameswm42012-03-093-7/+7
| * cleanup: Silence compilation warnings on MinGW-w64wm42012-03-011-0/+2
* | Merge remote-tracking branch 'origin/master' into my_masterwm42012-03-0510-207/+31
|\ \ | |/
| * configure, ao_alsa: drop support for obsolete ALSA versionsUoti Urpala2012-02-271-184/+0
| * build: switch to libavutil bswap.h and intreadwrite.hUoti Urpala2012-02-018-21/+29
| * Update Libav API usesUoti Urpala2012-02-011-2/+2
* | stream: refuse to open directorieswm42012-02-191-0/+9
|/
* stream_vcd: fix option value allocated with strdupUoti Urpala2012-01-161-2/+4
* stream_ffmpeg: switch to libavformat avio APIUoti Urpala2012-01-021-19/+31
* configure, build: require at least Libav 0.7Uoti Urpala2011-12-222-6/+0
* configure, build: remove --disable-libav supportUoti Urpala2011-12-112-4/+0
* stream_cdda: fix incorrectly allocated option fieldUoti Urpala2011-07-301-3/+5
* options: change option parsing to use bstrUoti Urpala2011-07-291-1/+1
* options: indicate ambiguous option parameters explicitlyUoti Urpala2011-07-291-1/+1
* cleanup: do libav* initialization on startupUoti Urpala2011-07-181-1/+0
* stream_bluray: switch to new libbluray APIRico Tzschichholz2011-07-101-7/+7
* cleanup: silence most of the clang warningsClément Bœsch2011-07-091-3/+4
* stream.c: make reconnect checks more robustreimar2011-07-061-14/+21
* stream.c: Pass streaming_ctrl eof on to struct stream fieldreimar2011-07-061-0/+2
* stream/network: don't clobber buffer byte counts on errorreimar2011-07-061-0/+1
* stream/network: distinguish EOF/error in streaming control APIreimar2011-07-061-1/+2
* cache: don't modify argument when stream control failsreimar2011-07-061-2/+3
* stream/tvi_v4l[2]: fix calculation of free RAM for buffersiive2011-07-062-16/+10
* cleanup: tvi_dshow: add "static", fix printf formatdiego2011-07-061-9/+16
* cache: allow STREAM_CTRL_GET_CURRENT_TIME with cachereimar2011-07-061-3/+12
* cosmetics: cache2.c: Fix commentreimar2011-07-061-2/+2
* cosmetics: stream_dvdnav.c: Remove pointless ()reimar2011-07-061-9/+9
* stream_dvd: fix dvd_get_current_time()reimar2011-07-061-5/+5
* stream_pvr: Replace <sys/fcntl.h> include by <fcntl.h>reimar2011-07-061-1/+1
* stream_cdda: work around libcdparanoia caching issuesreimar2011-07-061-0/+3
* stream: show negative seek position value in error messagereimar2011-07-061-1/+2
* stream_cue: Avoid probing empty filename in cue_find_bin()iive2011-07-061-0/+3
* stream_cue: fix multiple bugsreimar2011-07-061-24/+25
* Merge branch 'mplayer1_changes'Uoti Urpala2011-06-297-14/+22
|\
| * stream.c: make some stream messages translatableib2011-06-291-6/+7
| * Windows: stream_cddb.c: include <path.h> for MinGWvayne2011-06-291-0/+1
| * cleanup: Make vcd_seek_to_track() static in more filesreimar2011-06-294-4/+4
| * cache2.c: Avoid warnings about discarding volatilereimar2011-06-291-4/+10
* | stream/tvi_v4l2: Add V4L2 support for OpenBSD (and NetBSD)Uoti Urpala2011-06-291-0/+4
|/
* cleanup: shut up more warningsClément Bœsch2011-05-067-18/+15
* cleanup: remove more warningsClément Bœsch2011-05-026-7/+6
* Merge branch 'mplayer1_changes'Uoti Urpala2011-05-028-9/+76
|\
| * cache: call stream read with at least sector size spacereimar2011-05-011-2/+18
| * stream: http: Allow setting custom http headercehoyos2011-04-132-0/+9
| * stream_dvdnav: output ID_DVD_VOLUME_ID also for dvdnav://cehoyos2011-04-131-1/+1
| * stream_dvdnav: identify: show more title informationcehoyos2011-04-121-0/+3
| * stream: try to reset stream once if read failsreimar2011-04-121-1/+21
| * stream_dvdnav: don't skip last title for dvdnav:// -identifycehoyos2011-04-121-1/+1
| * stream: Make stream_write_buffer() check for short writesranma2011-04-124-4/+23
* | cleanup: avoid various GCC warningsClément Bœsch2011-04-202-2/+1
* | options: change -alang and -slang to use string list typeClément Bœsch2011-04-204-28/+19
* | stream.[ch], ass_mp: new stream function for whole-file readsUoti Urpala2011-03-032-0/+44
* | cleanup: demuxer.[ch]: remove unused code, make functions staticUoti Urpala2011-02-221-0/+3
|/
* stream/url.c: escape characters >= 127 in URLsreimar2011-02-151-2/+1
* terminal output: show cache fill changes in "PAUSED" messagereimar2011-02-152-5/+9
* fix compilation with old FFmpeg versionsUoti Urpala2011-02-082-0/+11
* cache: suggest increasing cache size in the "not filling!" messagereimar2011-01-311-1/+1
* stream/http: assume MakeMKV webservers always support rangesreimar2011-01-311-2/+6
* stream/tvi_v4l2.c: simplify by using getfps helper functionreimar2011-01-311-9/+2
* cleanup: Replace two malloc+memset with calloc.cboesch2011-01-292-6/+2
* stream/http: support 307 (Temporary Redirect) responsescboesch2011-01-291-0/+2
* Merge branch 'sub'Uoti Urpala2011-01-261-1/+1
|\
| * sub/OSD: move some related files to sub/Uoti Urpala2011-01-261-1/+1
* | cleanup: remove unused MEncoder-related codeClément Bœsch2011-01-251-1/+0
|/
* stream.h: check against huge negative values in stream_seek()reimar2010-12-161-0/+4
* stream/http: Add support for login/password in http_proxy env variablecboesch2010-12-163-3/+19
* stream/: delete base64_encode(), use libavutil av_base64_encode()cboesch2010-12-163-74/+13
* stream/network.c, stream/http.c: cleanupcboesch2010-12-162-13/+4
* stream/http: Do not keep authentication in URL when proxiedcboesch2010-12-163-2/+24
* stream/http: Add Proxy-Authorization header to authenticate on proxiescboesch2010-12-163-4/+19
* stream/http: don't use proxy values for "Authorization" headercboesch2010-12-161-1/+1
* cleanup: remove NULL checks before free() all over the codecboesch2010-11-147-35/+23
* stream/url.c: Unescape username/password when parsing URLsreimar2010-11-141-1/+4
* cache: read up to 64 KiB at once from stream_filereimar2010-11-143-1/+7
* stream/network.c: Replace hardcoded str size with sizeofcboesch2010-11-141-5/+5
* options: move some demux options to option structClément Bœsch2010-11-111-1/+0
* cleanup: don't check for NULL before free()diego2010-11-0817-127/+78
* stream_dvd: fill_buffer(): use given buffer, not stream's defaultreimar2010-11-081-2/+5
* stream_dvd: minor cleanupreimar2010-11-081-7/+4
* cache, stream: avoid extra memcpy when using cachereimar2010-11-073-38/+59
* cosmetics: cache2.c: Remove some irrelevant commented-out codereimar2010-11-071-8/+1
* stream_dvd: millisecond accuracy for chapters in -identify outputcigaes2010-11-071-3/+2
* Add a simple capture feature (-capture)Uoti Urpala2010-11-023-0/+22
* stream_network: Fix possible crash for invalid http_proxy URLsreimar2010-11-021-0/+4
* rtsp_rtp.c: Add missing avstring include for av_strlcpyreimar2010-11-021-0/+1
* rtsp_rtp.c: Replace snprintf by av_strlcpyreimar2010-11-021-1/+1
* Remove #warning preprocessor directivesdiego2010-11-021-1/+0
* Remove remaining %lf printf conversionsreimar2010-11-022-5/+5
* build: enable/disable all FFmpeg libraries togetherUoti Urpala2010-11-022-2/+2
* stream/tv: move new_handle() function from header to tv.cdiego2010-11-028-29/+31
* tvi_def.h: sizeof(type) -> sizeof(*ptr)diego2010-11-021-1/+1
* cosmetics: Remove vim/emacs coding style hints from sourcesdiego2010-11-021-4/+0
* cleanup: malloc+memset->calloc, sizeof(TYPE)->sizeof(*ptr)reimar2010-11-022-3/+3
* stream/tv: move free_handle() from header to tv.cdiego2010-11-026-18/+20
* cache: Remove unused cache_stats functiondiego2010-11-021-10/+0
* cache: Move cache_fill_status extern declaration to cache2.hdiego2010-11-021-0/+2
* stream/http.c: Move mime_type_table extern declaration to network.hdiego2010-11-022-1/+2
* stream: make stream_read_line() terminate line on EOFreimar2010-11-021-1/+1
* stream_file: Simplify and document MinGW stdin hackreimar2010-11-021-3/+4
* stream_dvd[nav]: Add const qualifiers to string argumentsreimar2010-11-024-8/+8
* Simplify code: make open_stream() accept NULL file_format argumentreimar2010-11-021-0/+2
* printf format fixes ("%d" -> "%zd")diego2010-11-022-2/+2
* cache: add sanity-check for sector sizereimar2010-11-022-2/+9
* spelling fixessiretart2010-11-025-9/+9
* cache: Don't mess up current position if time-based seek failsreimar2010-11-021-1/+2
* stream_dvd: Improve seeking by positiondiego2010-11-021-15/+8
* stream_dvd: Improve seeking by chaptersdiego2010-11-021-5/+12
* stream_dvd: fix incorrect assumption about chapter countdiego2010-11-021-10/+38
* stream_dvb.c: avoid compiler warning by adding initializationdiego2010-11-021-0/+1
* configure: Rename "network" variable and option to "networking"diego2010-11-022-6/+6
* cache: Use sigaction() instead of signal()reimar2010-11-021-3/+6
* stream.c: add <libavutil/common.h> include needed for GET_UTF16reimar2010-11-021-0/+2
* stream_bluray: implement slave mode compatible controlsben2010-11-021-6/+119
* stream_bluray: add unencrypted Blu-ray playbackben2010-11-023-0/+244
* Factorize MPlayer/MEncoder version string handling.diego2010-11-022-10/+6
* stream: Use MSG_NOSIGNAL flag if available for send().reimar2010-11-027-8/+15
* stream/dvbin.h: Use angular brackets for system #includes.diego2010-11-021-2/+1
* stream_cddb: move structs to the file they're used indiego2010-11-022-18/+18
* stream_cdda: change printf format for cdda_tracks to %ddiego2010-11-021-1/+1
* stream_cdda.c: Reorder functions to avoid forward declarations.diego2010-11-021-110/+106
* stream_cdd*: Move declarations for stream_cddb.c functions to cdd.hdiego2010-11-022-4/+4
* stream_cddb: Remove unused static functionsdiego2010-11-021-31/+0
* stream_ccda: Move cdda_priv structure to the only place it is useddiego2010-11-022-23/+21
* stream/tcp.c: Prefer the use of inet_ntop over inet_ntoaattila2010-11-021-3/+3
* stream.h: support backswards stream_skip() within bufferreimar2010-11-021-1/+1
* tv.h: Change function pointer types to proper declarationsreimar2010-11-026-13/+16
* cache: Respect -cache-seek-min also for on-disk filesreimar2010-11-021-3/+5
* Merge svn changes up to r31291Uoti Urpala2010-06-021-0/+18
|\
| * Add a referrer option to set the HTTP Referer field.reimar2010-05-301-0/+18
| * misc cosmetics: K&R style nits, #include placement, indentationdiego2010-05-291-1/+1
* | stream_radio.c: fix corrupt line from e3061749Uoti Urpala2010-06-021-1/+1
* | Merge svn changes up to r31256Uoti Urpala2010-05-303-6/+38
|\ \ | |/
| * Fix typo in message.reimar2010-05-281-1/+1
| * stream_check_interrupt should sleep even if no callback is set.reimar2010-05-281-1/+4
| * 100l, stream_check_for_interrupt argument is not in usec,reimar2010-05-281-3/+3
| * Document time scale for stream_check_interrupt argument.reimar2010-05-281-1/+2
| * Improve handling of cache process/thread hanging/being killed.reimar2010-05-281-3/+23
| * Fix cache process accidentally being killed by SIGUSR1.reimar2010-05-281-0/+7
* | Merge svn changes up to r31244Uoti Urpala2010-05-301-6/+6
|\ \ | |/
| * Fix a bunch of typos in the stream cache code.diego2010-05-271-6/+6
| * Drop pointless _st suffix from 'struct stream'.diego2010-05-276-29/+29
* | Merge svn changes up to r31226Uoti Urpala2010-05-302-4/+15
|\ \ | |/
| * Retry reading even if we hit eof before.reimar2010-05-262-3/+6
| * Re-enable wakeup-on-signal for cache process.reimar2010-05-261-5/+10
| * Disable waking the cache process up via a signal, itreimar2010-05-261-1/+4
| * Add support for STREAM_CTRL_SEEK_TO_TIME in ffmpeg streamshyc2010-05-251-1/+10
* | Merge svn changes up to r31211Uoti Urpala2010-05-301-45/+78
|\ \ | |/
| * Slightly reduce number of #ifsreimar2010-05-231-22/+20
| * Use an extra define to simplify ifdefsreimar2010-05-231-14/+20
| * Try reducing the #ifdef mess for the different cache variants.reimar2010-05-231-15/+13
| * Extract the cache main loop into a separate function.reimar2010-05-231-14/+19
| * Optimize cache behaviour for the many-consecutive-seeks case.reimar2010-05-231-1/+13
| * Add code to wake up cache process when e.g. a seek is needed.reimar2010-05-231-0/+14
* | cosmetics: "struct vf_instance* vf" -> "struct vf_instance *vf"Uoti Urpala2010-05-293-7/+13
* | stream.h: remove bad EOF check in stream_seek()Uoti Urpala2010-05-221-2/+0
* | Merge svn changes up to r31033Uoti Urpala2010-04-267-3/+26
|\ \ | |/
| * Do not print the "Loading cookie file" message twice.reimar2010-04-051-2/+0
| * Try to fix VCD compilation on non-Linux systems.reimar2010-04-056-1/+26
* | Merge svn changes up to r31020Uoti Urpala2010-04-261-0/+35
|\ \ | |/
| * Export VCD tracks as chapters, just like for cue:// URLs.reimar2010-04-051-0/+35
* | Merge svn changes up to r31004Uoti Urpala2010-04-262-3/+6
|\ \ | |/
| * Remove commented-out #include of a non-existing file.diego2010-04-031-2/+0
| * Change type to uint8_t to avoid checks depending on char signedness.reimar2010-04-021-1/+1
| * Sanitize ICY metadata a bit before printing it.reimar2010-03-311-0/+5
* | Merge svn changes up to r30967Uoti Urpala2010-04-262-2/+5
|\ \ | |/
| * Make http_read_response fail if parsing the response failed.reimar2010-03-231-1/+4
| * Rename get_path.[ch] --> path.[ch].diego2010-03-201-1/+1
* | options: move -chapter values to option structUoti Urpala2010-04-255-45/+3
* | demux_lavf, stream_ffmpeg: support librtmp seeksUoti Urpala2010-04-231-1/+10
* | stream_ffmpeg, demux_lavf: Use flv demuxer for rtmp streamsUoti Urpala2010-04-232-0/+8
* | stream_ffmpeg.c: change reads back to url_read_complete()Uoti Urpala2010-04-231-1/+1
* | Delete things related to old translation systemUoti Urpala2010-03-1034-35/+0
* | Merge svn changes up to r30876Uoti Urpala2010-03-104-10/+5
|\ \ | |/
| * Define O_BINARY in stream/stream.h unless it is defined yet, and use itkomh2010-03-064-10/+5
* | Merge svn changes up to r30848Uoti Urpala2010-03-106-324/+263
|\ \ | |/
| * Define HAVE_SETMODE conditionally, and use it in stream/stream_file.c insteadkomh2010-03-041-4/+4
| * Add a VCD support for OS/2komh2010-03-032-0/+254
| * Drop support for old-style DVB code.diego2010-03-023-320/+5
* | Merge svn changes up to r30815Uoti Urpala2010-03-103-102/+217
|\ \ | |/
| * Remove unused and useless define.reimar2010-03-011-1/+0
| * Fix memleak due to strdup'd filename not being freed.reimar2010-03-011-0/+2
| * Move functions into proper order to avoid extra declarations.reimar2010-03-011-15/+12
| * Deduplicate code to set stream start_pos/end_pos.reimar2010-03-011-12/+15
| * Set stream->pos correctly after seeking to a VCD title.reimar2010-03-011-0/+1
| * Ensure that cue_current_pos.track is not set to an invalid value afterreimar2010-03-011-8/+5
| * Fix off-by-one error in chapter<->VCD track conversion.reimar2010-03-011-2/+2
| * Fix cue_read_toc_entry to also reject negative track numbersreimar2010-03-011-1/+1
| * Implement cue:// track switching via chapter forward/backward like for audio ...reimar2010-03-011-0/+28
| * Fix cue_vcd_get_track_end to not change the current position.reimar2010-03-011-4/+3
| * Avoid fd_bin and fd_cue global variables.reimar2010-03-011-9/+9
| * Avoid a global variable and a strcpy.reimar2010-03-011-6/+2
| * Reindent.reimar2010-03-011-19/+19
| * Avoid code duplication and excessively deep nesting in cue_find_binreimar2010-03-011-37/+32
| * Use sizeof instead of hardcoded size.reimar2010-03-011-2/+2
| * Extend stream_read_line to support reading lines from UTF-16 encoded filesreimar2010-02-282-6/+102
* | Merge svn changes up to r30798Uoti Urpala2010-03-109-104/+114
|\ \ | |/
| * Move stream_read_line implementation from stream.h to stream.c,reimar2010-02-282-26/+27
| * Simplify handling of 0-termination in stream_read_linereimar2010-02-281-3/+5
| * Remove useless cast.reimar2010-02-281-1/+1
| * Add cddb:// support for OS/2komh2010-02-281-0/+74
| * Fix warning "missing braces around initializer".cehoyos2010-02-271-0/+2
| * Remove unused functions.cehoyos2010-02-271-60/+0
| * Fix cd_info_new() prototype.cehoyos2010-02-271-1/+1
| * Threaded cache fixes: do not free the stream_t struct twice on windowsreimar2010-02-271-8/+6
| * Remove unused static function streaming_stop().cehoyos2010-02-271-6/+0
| * Restructure #ifs to be clearer, also ensures that we return from the threadreimar2010-02-271-3/+3
* | Merge svn changes up to r30748Uoti Urpala2010-03-108-47/+47
|\ \ | |/
| * Do not cast the results of malloc/calloc/realloc.diego2010-02-264-18/+16
| * Mark stream open filename parameter as const, the filename string is notreimar2010-02-253-7/+7
| * Remove unused function declaration.reimar2010-02-251-2/+0
| * Make local-only cddb functions static.reimar2010-02-251-19/+19
| * Remove declarations of functions now already declared in stream.hreimar2010-02-251-3/+0
* | Merge svn changes up to r30732Uoti Urpala2010-03-105-13/+13
|\ \ | |/
| * Define O_BINARY if it is undefined.komh2010-02-251-5/+5
| * Mark vcd_get_track_end () and vcd_read_toc() as static.diego2010-02-224-8/+8
* | Merge svn changes up to r30702Uoti Urpala2010-03-103-29/+30
|\ \ | |/
| * Declare functions from network.c in network.h.diego2010-02-223-3/+3
| * Move struct streaming_control from network.h to stream.h, where it is used.diego2010-02-222-22/+24
| * Remove commented-out declaration of non-existing function streaming_start.diego2010-02-221-1/+0
* | Merge svn changes up to r30694Uoti Urpala2010-03-106-138/+187
|\ \ | |/
| * Declare stream_fill_buffer() and stream_seek_long() unconditionally.diego2010-02-211-2/+3
| * Add header for asf_mmst_streaming_start() instead of forward declaring it.diego2010-02-213-3/+28
| * Add header for exported DVB-related functions.diego2010-02-212-0/+38
| * cosmetics: Move functions around to avoid forward declarations and #ifdefs.diego2010-02-211-134/+119
| * cosmetics: Remove pointless empty lines at EOF.diego2010-02-205-5/+0
* | Merge svn changes up to r30672Uoti Urpala2010-03-105-741/+780
|\ \ | |/
| * cosmetics: K&R coding style, indent with 4 spaces, no tabsdiego2010-02-201-733/+776
| * Print response headers as debugging output also for HTTP seeks.reimar2010-02-201-0/+3
| * 10l, fix a close() that should be a closesocket()reimar2010-02-201-1/+1
| * Do not discard stream buffer on eof, instead reuse it to slightly improvereimar2010-02-202-4/+6
| * Replace misuse of stream_reset to set stream pos to 0 by more appropriate code.reimar2010-02-201-3/+3
* | Merge svn changes up to r30663Uoti Urpala2010-03-107-9/+17
|\ \ | |/
| * Fix mov reference files: for video/quicktime mime do not force a demuxerreimar2010-02-201-1/+5
| * Make sure we do not try to use IPv6 with winsock2, we end up connectingreimar2010-02-201-0/+8
| * Add dvd_parse_chapter_range() to stream_dvd.h instead of forward declaring it.diego2010-02-191-0/+2
| * Add missing 'defined' for __bsdi__.komh2010-02-191-1/+1
| * Remove pointless '#if 1' preprocessor directives.diego2010-02-191-2/+0
| * Replace platform preprocessor check by HAVE_DOS_PATHS.komh2010-02-191-1/+1
| * Remove useless CONFIG_SETLOCALEkomh2010-02-191-4/+0
| * stream: Mark functions not used outside of their files as static.diego2010-02-165-11/+18
* | Merge svn changes up to r30529Uoti Urpala2010-03-091-4/+5
|\ \ | |/
| * Prefer libavformat over our own mov demuxer also for video/quicktimereimar2010-02-051-4/+5
* | Merge svn changes up to r30502Uoti Urpala2010-03-092-8/+12
|\ \ | |/
| * Reindentreimar2010-02-031-4/+4
| * Add support for FFmpeg's rtsp dummy URL-with-pseudo-demuxer scheme.reimar2010-02-031-3/+7
| * Fix argument order for lseek, fixes cookie loading in Windows and in generalreimar2010-02-031-1/+1
* | Merge svn changes up to r30475Uoti Urpala2010-03-0955-66/+995
|\ \ | |/
| * Add license header to all files missing it in the stream subdirectory.diego2010-01-3054-62/+980
| * stream/rtp.h appears not to originate from dvbstream.diego2010-01-301-4/+15
* | translations: tweak cases that relied on concatenating adjacent stringsUoti Urpala2010-03-072-3/+6
* | Restore collapsed whitespace in output messagesUoti Urpala2010-03-073-4/+4
* | Merge svn changes up to r30419Uoti Urpala2010-01-254-17/+42
|\ \ | |/
| * Fix ftp support to properly support large files > 2GB.reimar2010-01-241-3/+4
| * Always call cache_uninit to immediately free everything cache-related if wereimar2010-01-231-3/+10
| * Call cache-uninit unconditionally, it should always be safe to call.reimar2010-01-231-2/+0
| * Change code to allow playing a stream even if enabling the cache failedreimar2010-01-231-2/+5
| * Make cache_init static, it is not used outside this filereimar2010-01-231-1/+1
| * Handle Content-Length also when Content-Type is not set.reimar2010-01-231-5/+6
| * Use atoll to parse Content-Length to support http for files > 2GB.reimar2010-01-231-1/+1
| * Add an exit() to silence a gcc warning and ensure forked code will neverreimar2010-01-231-0/+2
| * 100l, shouldn't write to memory after freeing it.reimar2010-01-231-1/+2
| * Reindent.reimar2010-01-231-3/+3
| * Zero freed pointers.reimar2010-01-231-0/+3
| * Check for fork failing and make sure cache_uninit always frees the cache datareimar2010-01-231-1/+10
* | Merge svn changes up to r30375Uoti Urpala2010-01-251-38/+79
|\ \ | |/
| * Add hack to fix tvi_dshow compilation with 64-bit MinGWreimar2010-01-171-0/+3
| * Change GUID declarations in tvi_dshow so they are not exported and thusreimar2010-01-171-38/+76
* | Merge svn changes up to r30301Uoti Urpala2010-01-251-1/+0
|\ \ | |/
| * Add support for distinguishing between little- and big-endian SPDIF AC3reimar2010-01-111-1/+0
* | stream: improve EOF handling in seeksUoti Urpala2010-01-182-6/+11
* | Merge svn changes up to r30236Uoti Urpala2010-01-081-30/+4
|\ \ | |/
| * Support rtmp:// URLs directly instead of requiring ffmpeg://rtmp://reimar2010-01-061-1/+1
| * Simplify ffmpeg stream support, we (so far) do not need any special option pa...reimar2010-01-061-29/+3
* | Merge svn changes up to r30216Uoti Urpala2010-01-088-0/+14
|\ \ | |/
| * Add a few missing header #includes and #defines.diego2010-01-048-0/+14
* | Merge svn changes up to r30195Uoti Urpala2010-01-083-4/+4
|\ \ | |/
| * Disambiguate HEADER_SIZE definition in stream/librtsp and stream/realrtsp.diego2010-01-043-4/+4
* | Merge svn changes up to r30173Uoti Urpala2010-01-082-0/+21
|\ \ | |/
| * Several hacks to fix compilation of tvi_dshow on MinGW64.reimar2010-01-022-0/+21
* | Merge svn changes up to r30165Uoti Urpala2010-01-081-2/+5
|\ \ | |/
| * Make code slightly more readable.reimar2009-12-311-2/+2
| * Fix crash if http reply contains neither "Accept-Ranges" nor "Server" fields.reimar2009-12-311-1/+2
| * Add a hack for broken youtube servers not returning Accept-Ranges.reimar2009-12-301-0/+2
* | Merge svn changes up to r30055Uoti Urpala2009-12-181-1/+1
|\ \ | |/
| * 100l, fix check for V4L2 capture capability flag.reimar2009-12-111-1/+1
* | Fix printf format strings with invalid '%lf' conversionUoti Urpala2009-12-151-2/+2
* | Merge svn changes up to r29971Uoti Urpala2009-11-291-0/+1
|\ \ | |/
| * mime type [video/x-ms-wmv] is not an ASF redirector.compn2009-11-261-0/+1
* | stream_ffmpeg: Fix reads near EOFUoti Urpala2009-11-231-1/+1
* | Merge svn changes up to r29962Uoti Urpala2009-11-2312-24/+173
|\ \ | |/
| * Finally rename the STREAM_SEEK define to MP_STREAM_SEEK, there are just too manyreimar2009-11-229-16/+16
| * 10l to Reimar: Fix typo.cehoyos2009-11-181-1/+1
| * Deobfuscate the special hack to disable cache for live555.reimar2009-11-173-2/+6
| * Merge malloc+memset -> callocreimar2009-11-171-4/+2
| * Fall back to read-based seeking for ffmpeg:// URLs when is_streamed is setreimar2009-11-171-2/+2
| * Enable the read-based forward seek fallback also when CONFIG_NETWORK isreimar2009-11-171-2/+2
| * Use fill_buffer if available also for STREAMTYPE_STREAMreimar2009-11-171-0/+3
| * Add preliminary support for streaming via FFmpeg's URProtocol functions.reimar2009-11-172-0/+144
* | Merge svn changes up to r29912Uoti Urpala2009-11-1614-2174/+193
|\ \ | |/
| * Move headers related to setting dvd speed to dvd_common.reimar2009-11-112-14/+19
| * Set the EOF flag when dvdnav reached the end of the requested title.reimar2009-11-111-2/+6
| * Move dvd_speed and dvd_set_speed to dvd_common and implement -dvd-speedreimar2009-11-104-73/+79
| * Move arrays used by both dvd and dvdnav to dvd_common.reimar2009-11-104-5/+6
| * Remove unused extern declarations.reimar2009-11-101-1/+0
| * Share dvd_device extern declaration between dvd and dvdnav.reimar2009-11-103-2/+1
| * Remove an unused variable.reimar2009-11-101-1/+1
| * Set demuxer->teletext to NULL when closing the TV interface,reimar2009-11-101-0/+1
| * The code for the non-networking case is the same whether networkingreimar2009-11-091-5/+2
| * Factor out triplicated break statement.reimar2009-11-091-3/+4
| * Remove unused mp_dvdnav_aid_from_audio_num functionreimar2009-11-091-21/+0
| * Fixup the dvdnav <-> sid mapping, dvdnav_spu_stream_to_lang andreimar2009-11-091-9/+13
| * Remove CONFIG_TV_TELETEXT.cehoyos2009-11-073-35/+0
| * Separate teletext from tv support.cehoyos2009-11-075-17/+31
| * dvdnav: print ID_SID_..._LANG, just like dvd://reimar2009-11-051-0/+2
| * Cosmetics: indentation, merge two consecutive ifs.reimar2009-11-051-6/+4
| * Make dvdnav also print info about audio streams with unknown language, just l...reimar2009-11-051-1/+1
| * Make the dvdnav stream language information output more similar to the dvd one.reimar2009-11-051-10/+6
| * Change the subtitle numbers in the dvdnav subtitle language info to matchreimar2009-11-051-1/+1
| * Replace two more occurences of tvi_vbi with dec_teletext.cehoyos2009-10-311-1/+1
| * Support ISDB-Tb tunning in Brazilcehoyos2009-10-301-3/+7
| * Add MSGT_TELETEXT, rename TVI_CONTROL as VBI_CONTROL and fix some pathscehoyos2009-10-293-3/+3
| * Move teletext specific code from stream into libmpcodecs.cehoyos2009-10-297-1960/+4
| * Fix teletext character set auto-detection.cehoyos2009-10-241-1/+1
| * cosmetics: Remove some pointless parentheses from return calls.diego2009-10-083-8/+8
* | Merge svn changes up to r29644Uoti Urpala2009-09-045-18/+26
|\ \ | |/
| * Fix possible crashes with invalid SDPs that result in stream descriptionsreimar2009-09-022-1/+4
| * Fix several more rtsp-related memleaks.reimar2009-09-023-1/+4
| * Fix asmrp_dispose to also free the buffer.reimar2009-09-021-0/+1
| * Use calloc to ensure rmff_new_mdpr returns fully initialized data.reimar2009-09-021-1/+1
| * Move variable declaration to where it is used.reimar2009-09-021-2/+1
| * Make sure we do not strdup(NULL), avoids a crash with non-real streams.reimar2009-09-021-1/+4
| * Fix several memleaks in real_setup_and_get_headerreimar2009-09-021-1/+4
| * Change real_setup_and_get_header to use goto a single exit path to simplifyreimar2009-09-021-11/+7
* | Merge svn changes up to r29532Uoti Urpala2009-08-182-10/+30
|\ \ | |/
| * Fix file information. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-151-1/+1
| * Add missing major contributors to copyright statement.cehoyos2009-08-151-0/+2
| * Fix another typo. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-1/+1
| * Add standard GPL license header. Patch by Francesco Lavra, francescolavra int...cehoyos2009-08-021-0/+22
| * Fix more typos. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-3/+3
| * Remove unused include's. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-4/+0
| * Fix typos. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-2/+2
* | Merge svn changes up to r29455Uoti Urpala2009-07-292-1/+5
|\ \ | |/
| * stream/realrtsp/real.c: Fix another integer overflowuau2009-07-281-0/+2
| * stream/realrtsp/real.c: Fix integer overflowuau2009-07-271-0/+2
| * Replace WORDS_BIGENDIAN by HAVE_BIGENDIAN in all internal code.diego2009-07-261-1/+1
* | Replace libavutil internal header #includes with MPlayer copiesUoti Urpala2009-07-267-7/+7
* | Remove the internal GUIAnton Khirnov2009-07-071-4/+0
* | Merge svn changes up to r29412Uoti Urpala2009-07-073-12/+6
|\ \ | |/
| * Replace incorrect use of strncpy by av_strlcpy.reimar2009-06-261-1/+2
| * Files should be opened in binary mode on OS/2.diego2009-06-031-3/+3
| * Using nl_langinfo in the asf mmst implementation makes no sense sincereimar2009-05-311-8/+1
| * whitespace cosmetics: Remove all trailing whitespace.diego2009-05-1380-966/+966
* | Remove trailing whitespace from most filesUoti Urpala2009-07-0781-973/+966
* | Translation system changes part 2: replace macros by stringsAmar Takhar2009-07-0726-421/+434
* | Translation system changes part 1: wrap translated stringsAmar Takhar2009-07-0726-421/+421
* | Merge svn changes up to r29277Uoti Urpala2009-05-082-5/+16
|\ \ | |/
| * Reemit the ID_AID_x_LANG for the track. This allows the identification of thediego2009-04-111-3/+10
| * Make tvi_v4l2 print -1 as "Current input" if the ioctl to read it failed.reimar2009-04-101-0/+1
| * Add a -indentify message that indicates if the current DVDNAV title isreimar2009-04-091-2/+5
* | Merge svn changes up to r29134Uoti Urpala2009-04-021-1/+0
|\ \ | |/
| * Remove unused variable along with the related warning.diego2009-04-011-1/+0
* | Merge svn changes up to r29117Uoti Urpala2009-04-015-6/+22
|\ \ | |/
| * 100l, revert r29082, I missed that the vts comparison should be case-insensit...reimar2009-03-281-1/+5
| * Reindentreimar2009-03-281-2/+2
| * Simplify extracting title number from ifo namereimar2009-03-281-5/+1
| * Simplify detection of .ifo extension.reimar2009-03-271-2/+2
| * change close to closesocket, unifies close streaming codecompn2009-03-261-1/+1
| * Add support for mmsh:// as alias for mmshttp://reimar2009-03-261-2/+3
| * Add TVI_CONTROL_VID_SET_WIDTH_HEIGHT to set width and height together for v4l2,reimar2009-03-163-0/+15
| * 100l fix calculation of dropped frames, number of frames is time * fps, not t...reimar2009-03-151-1/+1
* | Merge svn changes up to r28951Uoti Urpala2009-03-142-2/+3
|\ \ | |/
| * Ensure the string we're trying to compare is actually not NULL.ben2009-03-091-1/+2
| * The first valid index is total count - 1 (usually 0)ben2009-03-091-1/+1
* | Merge svn changes up to r28755Uoti Urpala2009-02-282-0/+3
|\ \ | |/
| * Use memset to make sure all parts of struct sockaddr_in are always initialized.reimar2009-02-252-0/+3
* | Merge svn changes up to r28712Uoti Urpala2009-02-231-1/+8
|\ \ | |/
| * Accept DVB API 5, patch by Steven Brudenell, steven.brudenell gmail com.diego2009-02-221-1/+8
* | Merge svn changes up to r28641Uoti Urpala2009-02-183-3/+3
|\ \ | |/
| * Replace double semicolon by single semicolon.diego2009-02-163-3/+3
* | Merge svn changes up to r28461Uoti Urpala2009-02-0419-64/+56
|\ \ | |/
| * Restructure network tests: Always check for both inet_aton and inet_pton.diego2009-02-013-25/+17
| * Convert HAVE_WINSOCK2_H into a 0/1 definition.diego2009-02-0119-40/+40
| * HAVE_ATON --> HAVE_INET_ATON to match FFmpeg and give it a 0/1 value.diego2009-02-013-6/+6
| * Convert HAVE_CLOSESOCKET and HAVE_SOCKLEN_T into 0/1 definitions.diego2009-02-011-2/+2
* | Merge svn changes up to r28366Uoti Urpala2009-01-261-1/+1
|\ \ | |/
| * Fix a NULL-check that used && instead of || and thus could not avoid crashes.reimar2009-01-251-1/+1
* | Merge svn changes up to r28310Uoti Urpala2009-01-155-17/+12
|\ \ | |/
| * Switch internal dvdread to libdvdread SVN external.reimar2009-01-083-15/+0
| * Add missing 'void' keyword to parameterless function declarations.diego2009-01-051-1/+1
| * Fix DVD seek_to_chapter: the title number must be converted to a per-VTSreimar2009-01-011-0/+9
| * Work around a dvdread bug where DVDReadBlocks would return values < 0 on read...reimar2008-12-311-1/+2
* | Merge svn changes up to r28204Uoti Urpala2008-12-271-1/+1
|\ \ | |/
| * Avoid u_ BSD type names.diego2008-12-271-1/+1
* | Merge svn changes up to r28149Uoti Urpala2008-12-141-15/+25
|\ \ | |/
| * Replace informal GPL notes by standard GPL header.diego2008-12-131-15/+25
* | Merge svn changes up to r28087Uoti Urpala2008-12-046-15/+15
|\ \ | |/
| * Get rid of pointless 'extern' keywords.diego2008-12-036-15/+15
* | Merge svn changes up to r28065Uoti Urpala2008-12-021-4/+0
|\ \ | |/
| * Move PTHREAD_CACHE define logic to configure.reimar2008-11-281-4/+0
* | Merge svn changes up to r27949Uoti Urpala2008-11-171-12/+32
|\ \ | |/
| * 100l, stream->cache_pid can not be used directly in pthread_create,reimar2008-11-151-1/+5
| * Use pthreads for the cache on Cygwin, since _beginthread is not availablereimar2008-11-151-11/+27
| * Include cache2.h in cache2.c, fixes an implicit declaration warning for cache...reimar2008-11-141-0/+1
* | Merge svn changes up to r27899Uoti Urpala2008-11-065-6/+9
|\ \ | |/
| * set to -1 fds that were closed; handle the sec_fd only if CONFIG_DVB_HEAD isn...nicodvb2008-11-052-3/+3
| * Intialize unused fd variables to -1 (which is actually invalid) insteadreimar2008-11-041-1/+1
| * Fix condition broken in r27401 which incorrectly caused stdin to be closed af...reimar2008-11-041-1/+1
| * Forgotten reindentreimar2008-11-021-1/+1
| * Add a noicyx:// protocol to allow easier testing for misconfigured servers.reimar2008-11-022-1/+2
| * vfw.h needs a windows.h include before on MinGW64.reimar2008-11-021-0/+1
| * Avoid a memleak if allocation of field_name fails, fixes bug #1319.reimar2008-10-311-0/+1
* | Merge svn changes up to 27824Uoti Urpala2008-10-2512-91/+50
|\ \ | |/
| * Conditionally declare a conditionally used variable, fixes the warning:diego2008-10-241-1/+4
| * Determine default CD/DVD device in configure instead of using an #ifdef jungle.diego2008-10-211-26/+0
| * Replace typeof by __typeof__, the former is a non-portable GNU extension.diego2008-10-201-1/+1
| * Avoid CreateThread and especially TerminateThread since they cause a memleak.reimar2008-10-191-21/+18
| * Remove useless casts.reimar2008-10-191-2/+2
| * Revert declaring ThreadProc as void, it breaks the WINAPI.diego2008-10-161-2/+6
| * Move DEFAULT_CDROM_DEVICE/DEFAULT_DVD_DEVICE to stream.h where it belongs.diego2008-10-161-0/+27
| * Rename stream/netstream.h to stream/stream_netstream.h; netstream.h to make itdiego2008-10-162-1/+1
| * Replace preprocessor check for WIN32 with checks for __MINGW32__ and __CYGWIN__.diego2008-10-134-21/+21
| * Declare ThreadProc as void, it does not return anything, fixes the warning:diego2008-10-131-6/+2
| * Remove unused function, fixes the warning:diego2008-10-131-46/+0
| * Unconditionally #include osdep/shem.h, fixes the warnings on Cygwin:diego2008-10-131-1/+1
| * Move socklen_t typedef from config.h to stream/network.h.diego2008-10-122-0/+4
* | Merge svn changes up to r27682Uoti Urpala2008-10-021-5/+8
|\ \ | |/
| * Add debug message about loaded frequency tables.voroshil2008-09-241-1/+2
| * Make output messages of frequency selection code more useful byvoroshil2008-09-241-2/+4
| * Fix overflow in frequency conversion code inside tvi_dshow.voroshil2008-09-241-2/+2
* | Merge svn changes up to r27649Uoti Urpala2008-09-201-1/+1
|\ \ | |/
| * With -identify, ID_DVD_VOLUME_ID is not shown on some systems.diego2008-09-161-1/+1
* | Merge svn changes up to r27514Uoti Urpala2008-09-0331-91/+89
|\ \ | |/
| * Move '#define closesocket close' preprocessor directive to a common placediego2008-09-0114-23/+17
| * Revert moving closesocket definition and network headers to network.h.diego2008-08-3114-15/+115
| * Rename internal libdvdread fork from dvdread to libdvdreadrathann2008-08-303-12/+12
| * Print DVD volume ID with -identify.reimar2008-08-301-0/+3
| * Move duplicated '#define closesocket close' into network.h along withdiego2008-08-2914-115/+15
| * consistency cosmetics: Avoid using .. in #include paths.diego2008-08-296-12/+12
| * Rename HAVE_WINSOCK preprocessor condition to HAVE_WINSOCK_H.diego2008-08-2920-45/+46
| * Use '#include <poll.h>' instead of '#include <sys/poll.h>'.diego2008-08-143-3/+3
* | Make various functions staticUoti Urpala2008-08-122-4/+4
* | Include corresponding .h in some .c filesUoti Urpala2008-08-121-0/+1