summaryrefslogtreecommitdiffstats
path: root/stream
Commit message (Expand)AuthorAgeFilesLines
...
| * stream_check_interrupt should sleep even if no callback is set.reimar2010-05-281-1/+4
| * 100l, stream_check_for_interrupt argument is not in usec,reimar2010-05-281-3/+3
| * Document time scale for stream_check_interrupt argument.reimar2010-05-281-1/+2
| * Improve handling of cache process/thread hanging/being killed.reimar2010-05-281-3/+23
| * Fix cache process accidentally being killed by SIGUSR1.reimar2010-05-281-0/+7
* | Merge svn changes up to r31244Uoti Urpala2010-05-301-6/+6
|\|
| * Fix a bunch of typos in the stream cache code.diego2010-05-271-6/+6
| * Drop pointless _st suffix from 'struct stream'.diego2010-05-276-29/+29
* | Merge svn changes up to r31226Uoti Urpala2010-05-302-4/+15
|\|
| * Retry reading even if we hit eof before.reimar2010-05-262-3/+6
| * Re-enable wakeup-on-signal for cache process.reimar2010-05-261-5/+10
| * Disable waking the cache process up via a signal, itreimar2010-05-261-1/+4
| * Add support for STREAM_CTRL_SEEK_TO_TIME in ffmpeg streamshyc2010-05-251-1/+10
* | Merge svn changes up to r31211Uoti Urpala2010-05-301-45/+78
|\|
| * Slightly reduce number of #ifsreimar2010-05-231-22/+20
| * Use an extra define to simplify ifdefsreimar2010-05-231-14/+20
| * Try reducing the #ifdef mess for the different cache variants.reimar2010-05-231-15/+13
| * Extract the cache main loop into a separate function.reimar2010-05-231-14/+19
| * Optimize cache behaviour for the many-consecutive-seeks case.reimar2010-05-231-1/+13
| * Add code to wake up cache process when e.g. a seek is needed.reimar2010-05-231-0/+14
* | cosmetics: "struct vf_instance* vf" -> "struct vf_instance *vf"Uoti Urpala2010-05-293-7/+13
* | stream.h: remove bad EOF check in stream_seek()Uoti Urpala2010-05-221-2/+0
* | Merge svn changes up to r31033Uoti Urpala2010-04-267-3/+26
|\|
| * Do not print the "Loading cookie file" message twice.reimar2010-04-051-2/+0
| * Try to fix VCD compilation on non-Linux systems.reimar2010-04-056-1/+26
* | Merge svn changes up to r31020Uoti Urpala2010-04-261-0/+35
|\|
| * Export VCD tracks as chapters, just like for cue:// URLs.reimar2010-04-051-0/+35
* | Merge svn changes up to r31004Uoti Urpala2010-04-262-3/+6
|\|
| * Remove commented-out #include of a non-existing file.diego2010-04-031-2/+0
| * Change type to uint8_t to avoid checks depending on char signedness.reimar2010-04-021-1/+1
| * Sanitize ICY metadata a bit before printing it.reimar2010-03-311-0/+5
* | Merge svn changes up to r30967Uoti Urpala2010-04-262-2/+5
|\|
| * Make http_read_response fail if parsing the response failed.reimar2010-03-231-1/+4
| * Rename get_path.[ch] --> path.[ch].diego2010-03-201-1/+1
* | options: move -chapter values to option structUoti Urpala2010-04-255-45/+3
* | demux_lavf, stream_ffmpeg: support librtmp seeksUoti Urpala2010-04-231-1/+10
* | stream_ffmpeg, demux_lavf: Use flv demuxer for rtmp streamsUoti Urpala2010-04-232-0/+8
* | stream_ffmpeg.c: change reads back to url_read_complete()Uoti Urpala2010-04-231-1/+1
* | Delete things related to old translation systemUoti Urpala2010-03-1034-35/+0
* | Merge svn changes up to r30876Uoti Urpala2010-03-104-10/+5
|\|
| * Define O_BINARY in stream/stream.h unless it is defined yet, and use itkomh2010-03-064-10/+5
* | Merge svn changes up to r30848Uoti Urpala2010-03-106-324/+263
|\|
| * Define HAVE_SETMODE conditionally, and use it in stream/stream_file.c insteadkomh2010-03-041-4/+4
| * Add a VCD support for OS/2komh2010-03-032-0/+254
| * Drop support for old-style DVB code.diego2010-03-023-320/+5
* | Merge svn changes up to r30815Uoti Urpala2010-03-103-102/+217
|\|
| * Remove unused and useless define.reimar2010-03-011-1/+0
| * Fix memleak due to strdup'd filename not being freed.reimar2010-03-011-0/+2
| * Move functions into proper order to avoid extra declarations.reimar2010-03-011-15/+12
| * Deduplicate code to set stream start_pos/end_pos.reimar2010-03-011-12/+15
| * Set stream->pos correctly after seeking to a VCD title.reimar2010-03-011-0/+1
| * Ensure that cue_current_pos.track is not set to an invalid value afterreimar2010-03-011-8/+5
| * Fix off-by-one error in chapter<->VCD track conversion.reimar2010-03-011-2/+2
| * Fix cue_read_toc_entry to also reject negative track numbersreimar2010-03-011-1/+1
| * Implement cue:// track switching via chapter forward/backward like for audio ...reimar2010-03-011-0/+28
| * Fix cue_vcd_get_track_end to not change the current position.reimar2010-03-011-4/+3
| * Avoid fd_bin and fd_cue global variables.reimar2010-03-011-9/+9
| * Avoid a global variable and a strcpy.reimar2010-03-011-6/+2
| * Reindent.reimar2010-03-011-19/+19
| * Avoid code duplication and excessively deep nesting in cue_find_binreimar2010-03-011-37/+32
| * Use sizeof instead of hardcoded size.reimar2010-03-011-2/+2
| * Extend stream_read_line to support reading lines from UTF-16 encoded filesreimar2010-02-282-6/+102
* | Merge svn changes up to r30798Uoti Urpala2010-03-109-104/+114
|\|
| * Move stream_read_line implementation from stream.h to stream.c,reimar2010-02-282-26/+27
| * Simplify handling of 0-termination in stream_read_linereimar2010-02-281-3/+5
| * Remove useless cast.reimar2010-02-281-1/+1
| * Add cddb:// support for OS/2komh2010-02-281-0/+74
| * Fix warning "missing braces around initializer".cehoyos2010-02-271-0/+2
| * Remove unused functions.cehoyos2010-02-271-60/+0
| * Fix cd_info_new() prototype.cehoyos2010-02-271-1/+1
| * Threaded cache fixes: do not free the stream_t struct twice on windowsreimar2010-02-271-8/+6
| * Remove unused static function streaming_stop().cehoyos2010-02-271-6/+0
| * Restructure #ifs to be clearer, also ensures that we return from the threadreimar2010-02-271-3/+3
* | Merge svn changes up to r30748Uoti Urpala2010-03-108-47/+47
|\|
| * Do not cast the results of malloc/calloc/realloc.diego2010-02-264-18/+16
| * Mark stream open filename parameter as const, the filename string is notreimar2010-02-253-7/+7
| * Remove unused function declaration.reimar2010-02-251-2/+0
| * Make local-only cddb functions static.reimar2010-02-251-19/+19
| * Remove declarations of functions now already declared in stream.hreimar2010-02-251-3/+0
* | Merge svn changes up to r30732Uoti Urpala2010-03-105-13/+13
|\|
| * Define O_BINARY if it is undefined.komh2010-02-251-5/+5
| * Mark vcd_get_track_end () and vcd_read_toc() as static.diego2010-02-224-8/+8
* | Merge svn changes up to r30702Uoti Urpala2010-03-103-29/+30
|\|
| * Declare functions from network.c in network.h.diego2010-02-223-3/+3
| * Move struct streaming_control from network.h to stream.h, where it is used.diego2010-02-222-22/+24
| * Remove commented-out declaration of non-existing function streaming_start.diego2010-02-221-1/+0
* | Merge svn changes up to r30694Uoti Urpala2010-03-106-138/+187
|\|
| * Declare stream_fill_buffer() and stream_seek_long() unconditionally.diego2010-02-211-2/+3
| * Add header for asf_mmst_streaming_start() instead of forward declaring it.diego2010-02-213-3/+28
| * Add header for exported DVB-related functions.diego2010-02-212-0/+38
| * cosmetics: Move functions around to avoid forward declarations and #ifdefs.diego2010-02-211-134/+119
| * cosmetics: Remove pointless empty lines at EOF.diego2010-02-205-5/+0
* | Merge svn changes up to r30672Uoti Urpala2010-03-105-741/+780
|\|
| * cosmetics: K&R coding style, indent with 4 spaces, no tabsdiego2010-02-201-733/+776
| * Print response headers as debugging output also for HTTP seeks.reimar2010-02-201-0/+3
| * 10l, fix a close() that should be a closesocket()reimar2010-02-201-1/+1
| * Do not discard stream buffer on eof, instead reuse it to slightly improvereimar2010-02-202-4/+6
| * Replace misuse of stream_reset to set stream pos to 0 by more appropriate code.reimar2010-02-201-3/+3
* | Merge svn changes up to r30663Uoti Urpala2010-03-107-9/+17
|\|
| * Fix mov reference files: for video/quicktime mime do not force a demuxerreimar2010-02-201-1/+5
| * Make sure we do not try to use IPv6 with winsock2, we end up connectingreimar2010-02-201-0/+8
| * Add dvd_parse_chapter_range() to stream_dvd.h instead of forward declaring it.diego2010-02-191-0/+2
| * Add missing 'defined' for __bsdi__.komh2010-02-191-1/+1
| * Remove pointless '#if 1' preprocessor directives.diego2010-02-191-2/+0
| * Replace platform preprocessor check by HAVE_DOS_PATHS.komh2010-02-191-1/+1
| * Remove useless CONFIG_SETLOCALEkomh2010-02-191-4/+0
| * stream: Mark functions not used outside of their files as static.diego2010-02-165-11/+18
* | Merge svn changes up to r30529Uoti Urpala2010-03-091-4/+5
|\|
| * Prefer libavformat over our own mov demuxer also for video/quicktimereimar2010-02-051-4/+5
* | Merge svn changes up to r30502Uoti Urpala2010-03-092-8/+12
|\|
| * Reindentreimar2010-02-031-4/+4
| * Add support for FFmpeg's rtsp dummy URL-with-pseudo-demuxer scheme.reimar2010-02-031-3/+7
| * Fix argument order for lseek, fixes cookie loading in Windows and in generalreimar2010-02-031-1/+1
* | Merge svn changes up to r30475Uoti Urpala2010-03-0955-66/+995
|\|
| * Add license header to all files missing it in the stream subdirectory.diego2010-01-3054-62/+980
| * stream/rtp.h appears not to originate from dvbstream.diego2010-01-301-4/+15
* | translations: tweak cases that relied on concatenating adjacent stringsUoti Urpala2010-03-072-3/+6
* | Restore collapsed whitespace in output messagesUoti Urpala2010-03-073-4/+4
* | Merge svn changes up to r30419Uoti Urpala2010-01-254-17/+42
|\|
| * Fix ftp support to properly support large files > 2GB.reimar2010-01-241-3/+4
| * Always call cache_uninit to immediately free everything cache-related if wereimar2010-01-231-3/+10
| * Call cache-uninit unconditionally, it should always be safe to call.reimar2010-01-231-2/+0
| * Change code to allow playing a stream even if enabling the cache failedreimar2010-01-231-2/+5
| * Make cache_init static, it is not used outside this filereimar2010-01-231-1/+1
| * Handle Content-Length also when Content-Type is not set.reimar2010-01-231-5/+6
| * Use atoll to parse Content-Length to support http for files > 2GB.reimar2010-01-231-1/+1
| * Add an exit() to silence a gcc warning and ensure forked code will neverreimar2010-01-231-0/+2
| * 100l, shouldn't write to memory after freeing it.reimar2010-01-231-1/+2
| * Reindent.reimar2010-01-231-3/+3
| * Zero freed pointers.reimar2010-01-231-0/+3
| * Check for fork failing and make sure cache_uninit always frees the cache datareimar2010-01-231-1/+10
* | Merge svn changes up to r30375Uoti Urpala2010-01-251-38/+79
|\|
| * Add hack to fix tvi_dshow compilation with 64-bit MinGWreimar2010-01-171-0/+3
| * Change GUID declarations in tvi_dshow so they are not exported and thusreimar2010-01-171-38/+76
* | Merge svn changes up to r30301Uoti Urpala2010-01-251-1/+0
|\|
| * Add support for distinguishing between little- and big-endian SPDIF AC3reimar2010-01-111-1/+0
* | stream: improve EOF handling in seeksUoti Urpala2010-01-182-6/+11
* | Merge svn changes up to r30236Uoti Urpala2010-01-081-30/+4
|\|
| * Support rtmp:// URLs directly instead of requiring ffmpeg://rtmp://reimar2010-01-061-1/+1
| * Simplify ffmpeg stream support, we (so far) do not need any special option pa...reimar2010-01-061-29/+3
* | Merge svn changes up to r30216Uoti Urpala2010-01-088-0/+14
|\|
| * Add a few missing header #includes and #defines.diego2010-01-048-0/+14
* | Merge svn changes up to r30195Uoti Urpala2010-01-083-4/+4
|\|
| * Disambiguate HEADER_SIZE definition in stream/librtsp and stream/realrtsp.diego2010-01-043-4/+4
* | Merge svn changes up to r30173Uoti Urpala2010-01-082-0/+21
|\|
| * Several hacks to fix compilation of tvi_dshow on MinGW64.reimar2010-01-022-0/+21
* | Merge svn changes up to r30165Uoti Urpala2010-01-081-2/+5
|\|
| * Make code slightly more readable.reimar2009-12-311-2/+2
| * Fix crash if http reply contains neither "Accept-Ranges" nor "Server" fields.reimar2009-12-311-1/+2
| * Add a hack for broken youtube servers not returning Accept-Ranges.reimar2009-12-301-0/+2
* | Merge svn changes up to r30055Uoti Urpala2009-12-181-1/+1
|\|
| * 100l, fix check for V4L2 capture capability flag.reimar2009-12-111-1/+1
* | Fix printf format strings with invalid '%lf' conversionUoti Urpala2009-12-151-2/+2
* | Merge svn changes up to r29971Uoti Urpala2009-11-291-0/+1
|\|
| * mime type [video/x-ms-wmv] is not an ASF redirector.compn2009-11-261-0/+1
* | stream_ffmpeg: Fix reads near EOFUoti Urpala2009-11-231-1/+1
* | Merge svn changes up to r29962Uoti Urpala2009-11-2312-24/+173
|\|
| * Finally rename the STREAM_SEEK define to MP_STREAM_SEEK, there are just too manyreimar2009-11-229-16/+16
| * 10l to Reimar: Fix typo.cehoyos2009-11-181-1/+1
| * Deobfuscate the special hack to disable cache for live555.reimar2009-11-173-2/+6
| * Merge malloc+memset -> callocreimar2009-11-171-4/+2
| * Fall back to read-based seeking for ffmpeg:// URLs when is_streamed is setreimar2009-11-171-2/+2
| * Enable the read-based forward seek fallback also when CONFIG_NETWORK isreimar2009-11-171-2/+2
| * Use fill_buffer if available also for STREAMTYPE_STREAMreimar2009-11-171-0/+3
| * Add preliminary support for streaming via FFmpeg's URProtocol functions.reimar2009-11-172-0/+144
* | Merge svn changes up to r29912Uoti Urpala2009-11-1614-2174/+193
|\|
| * Move headers related to setting dvd speed to dvd_common.reimar2009-11-112-14/+19
| * Set the EOF flag when dvdnav reached the end of the requested title.reimar2009-11-111-2/+6
| * Move dvd_speed and dvd_set_speed to dvd_common and implement -dvd-speedreimar2009-11-104-73/+79
| * Move arrays used by both dvd and dvdnav to dvd_common.reimar2009-11-104-5/+6
| * Remove unused extern declarations.reimar2009-11-101-1/+0
| * Share dvd_device extern declaration between dvd and dvdnav.reimar2009-11-103-2/+1
| * Remove an unused variable.reimar2009-11-101-1/+1
| * Set demuxer->teletext to NULL when closing the TV interface,reimar2009-11-101-0/+1
| * The code for the non-networking case is the same whether networkingreimar2009-11-091-5/+2
| * Factor out triplicated break statement.reimar2009-11-091-3/+4
| * Remove unused mp_dvdnav_aid_from_audio_num functionreimar2009-11-091-21/+0
| * Fixup the dvdnav <-> sid mapping, dvdnav_spu_stream_to_lang andreimar2009-11-091-9/+13
| * Remove CONFIG_TV_TELETEXT.cehoyos2009-11-073-35/+0
| * Separate teletext from tv support.cehoyos2009-11-075-17/+31
| * dvdnav: print ID_SID_..._LANG, just like dvd://reimar2009-11-051-0/+2
| * Cosmetics: indentation, merge two consecutive ifs.reimar2009-11-051-6/+4
| * Make dvdnav also print info about audio streams with unknown language, just l...reimar2009-11-051-1/+1
| * Make the dvdnav stream language information output more similar to the dvd one.reimar2009-11-051-10/+6
| * Change the subtitle numbers in the dvdnav subtitle language info to matchreimar2009-11-051-1/+1
| * Replace two more occurences of tvi_vbi with dec_teletext.cehoyos2009-10-311-1/+1
| * Support ISDB-Tb tunning in Brazilcehoyos2009-10-301-3/+7
| * Add MSGT_TELETEXT, rename TVI_CONTROL as VBI_CONTROL and fix some pathscehoyos2009-10-293-3/+3
| * Move teletext specific code from stream into libmpcodecs.cehoyos2009-10-297-1960/+4
| * Fix teletext character set auto-detection.cehoyos2009-10-241-1/+1
| * cosmetics: Remove some pointless parentheses from return calls.diego2009-10-083-8/+8
* | Merge svn changes up to r29644Uoti Urpala2009-09-045-18/+26
|\|
| * Fix possible crashes with invalid SDPs that result in stream descriptionsreimar2009-09-022-1/+4
| * Fix several more rtsp-related memleaks.reimar2009-09-023-1/+4
| * Fix asmrp_dispose to also free the buffer.reimar2009-09-021-0/+1
| * Use calloc to ensure rmff_new_mdpr returns fully initialized data.reimar2009-09-021-1/+1
| * Move variable declaration to where it is used.reimar2009-09-021-2/+1
| * Make sure we do not strdup(NULL), avoids a crash with non-real streams.reimar2009-09-021-1/+4
| * Fix several memleaks in real_setup_and_get_headerreimar2009-09-021-1/+4
| * Change real_setup_and_get_header to use goto a single exit path to simplifyreimar2009-09-021-11/+7
* | Merge svn changes up to r29532Uoti Urpala2009-08-182-10/+30
|\|
| * Fix file information. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-151-1/+1
| * Add missing major contributors to copyright statement.cehoyos2009-08-151-0/+2
| * Fix another typo. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-1/+1
| * Add standard GPL license header. Patch by Francesco Lavra, francescolavra int...cehoyos2009-08-021-0/+22
| * Fix more typos. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-3/+3
| * Remove unused include's. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-4/+0
| * Fix typos. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-2/+2
* | Merge svn changes up to r29455Uoti Urpala2009-07-292-1/+5
|\|
| * stream/realrtsp/real.c: Fix another integer overflowuau2009-07-281-0/+2
| * stream/realrtsp/real.c: Fix integer overflowuau2009-07-271-0/+2
| * Replace WORDS_BIGENDIAN by HAVE_BIGENDIAN in all internal code.diego2009-07-261-1/+1
* | Replace libavutil internal header #includes with MPlayer copiesUoti Urpala2009-07-267-7/+7
* | Remove the internal GUIAnton Khirnov2009-07-071-4/+0
* | Merge svn changes up to r29412Uoti Urpala2009-07-073-12/+6
|\|
| * Replace incorrect use of strncpy by av_strlcpy.reimar2009-06-261-1/+2
| * Files should be opened in binary mode on OS/2.diego2009-06-031-3/+3
| * Using nl_langinfo in the asf mmst implementation makes no sense sincereimar2009-05-311-8/+1
| * whitespace cosmetics: Remove all trailing whitespace.diego2009-05-1380-966/+966
* | Remove trailing whitespace from most filesUoti Urpala2009-07-0781-973/+966
* | Translation system changes part 2: replace macros by stringsAmar Takhar2009-07-0726-421/+434
* | Translation system changes part 1: wrap translated stringsAmar Takhar2009-07-0726-421/+421
* | Merge svn changes up to r29277Uoti Urpala2009-05-082-5/+16
|\|
| * Reemit the ID_AID_x_LANG for the track. This allows the identification of thediego2009-04-111-3/+10
| * Make tvi_v4l2 print -1 as "Current input" if the ioctl to read it failed.reimar2009-04-101-0/+1
| * Add a -indentify message that indicates if the current DVDNAV title isreimar2009-04-091-2/+5
* | Merge svn changes up to r29134Uoti Urpala2009-04-021-1/+0
|\|
| * Remove unused variable along with the related warning.diego2009-04-011-1/+0
* | Merge svn changes up to r29117Uoti Urpala2009-04-015-6/+22
|\|
| * 100l, revert r29082, I missed that the vts comparison should be case-insensit...reimar2009-03-281-1/+5
| * Reindentreimar2009-03-281-2/+2
| * Simplify extracting title number from ifo namereimar2009-03-281-5/+1
| * Simplify detection of .ifo extension.reimar2009-03-271-2/+2
| * change close to closesocket, unifies close streaming codecompn2009-03-261-1/+1
| * Add support for mmsh:// as alias for mmshttp://reimar2009-03-261-2/+3
| * Add TVI_CONTROL_VID_SET_WIDTH_HEIGHT to set width and height together for v4l2,reimar2009-03-163-0/+15
| * 100l fix calculation of dropped frames, number of frames is time * fps, not t...reimar2009-03-151-1/+1
* | Merge svn changes up to r28951Uoti Urpala2009-03-142-2/+3
|\|
| * Ensure the string we're trying to compare is actually not NULL.ben2009-03-091-1/+2
| * The first valid index is total count - 1 (usually 0)ben2009-03-091-1/+1
* | Merge svn changes up to r28755Uoti Urpala2009-02-282-0/+3
|\|
| * Use memset to make sure all parts of struct sockaddr_in are always initialized.reimar2009-02-252-0/+3
* | Merge svn changes up to r28712Uoti Urpala2009-02-231-1/+8
|\|
| * Accept DVB API 5, patch by Steven Brudenell, steven.brudenell gmail com.diego2009-02-221-1/+8
* | Merge svn changes up to r28641Uoti Urpala2009-02-183-3/+3
|\|
| * Replace double semicolon by single semicolon.diego2009-02-163-3/+3
* | Merge svn changes up to r28461Uoti Urpala2009-02-0419-64/+56
|\|
| * Restructure network tests: Always check for both inet_aton and inet_pton.diego2009-02-013-25/+17
| * Convert HAVE_WINSOCK2_H into a 0/1 definition.diego2009-02-0119-40/+40
| * HAVE_ATON --> HAVE_INET_ATON to match FFmpeg and give it a 0/1 value.diego2009-02-013-6/+6
| * Convert HAVE_CLOSESOCKET and HAVE_SOCKLEN_T into 0/1 definitions.diego2009-02-011-2/+2
* | Merge svn changes up to r28366Uoti Urpala2009-01-261-1/+1
|\|
| * Fix a NULL-check that used && instead of || and thus could not avoid crashes.reimar2009-01-251-1/+1
* | Merge svn changes up to r28310Uoti Urpala2009-01-155-17/+12
|\|
| * Switch internal dvdread to libdvdread SVN external.reimar2009-01-083-15/+0
| * Add missing 'void' keyword to parameterless function declarations.diego2009-01-051-1/+1
| * Fix DVD seek_to_chapter: the title number must be converted to a per-VTSreimar2009-01-011-0/+9
| * Work around a dvdread bug where DVDReadBlocks would return values < 0 on read...reimar2008-12-311-1/+2
* | Merge svn changes up to r28204Uoti Urpala2008-12-271-1/+1
|\|
| * Avoid u_ BSD type names.diego2008-12-271-1/+1
* | Merge svn changes up to r28149Uoti Urpala2008-12-141-15/+25
|\|
| * Replace informal GPL notes by standard GPL header.diego2008-12-131-15/+25
* | Merge svn changes up to r28087Uoti Urpala2008-12-046-15/+15
|\|
| * Get rid of pointless 'extern' keywords.diego2008-12-036-15/+15
* | Merge svn changes up to r28065Uoti Urpala2008-12-021-4/+0
|\|
| * Move PTHREAD_CACHE define logic to configure.reimar2008-11-281-4/+0
* | Merge svn changes up to r27949Uoti Urpala2008-11-171-12/+32
|\|
| * 100l, stream->cache_pid can not be used directly in pthread_create,reimar2008-11-151-1/+5
| * Use pthreads for the cache on Cygwin, since _beginthread is not availablereimar2008-11-151-11/+27
| * Include cache2.h in cache2.c, fixes an implicit declaration warning for cache...reimar2008-11-141-0/+1
* | Merge svn changes up to r27899Uoti Urpala2008-11-065-6/+9
|\|
| * set to -1 fds that were closed; handle the sec_fd only if CONFIG_DVB_HEAD isn...nicodvb2008-11-052-3/+3
| * Intialize unused fd variables to -1 (which is actually invalid) insteadreimar2008-11-041-1/+1
| * Fix condition broken in r27401 which incorrectly caused stdin to be closed af...reimar2008-11-041-1/+1
| * Forgotten reindentreimar2008-11-021-1/+1
| * Add a noicyx:// protocol to allow easier testing for misconfigured servers.reimar2008-11-022-1/+2
| * vfw.h needs a windows.h include before on MinGW64.reimar2008-11-021-0/+1
| * Avoid a memleak if allocation of field_name fails, fixes bug #1319.reimar2008-10-311-0/+1
* | Merge svn changes up to 27824Uoti Urpala2008-10-2512-91/+50
|\|
| * Conditionally declare a conditionally used variable, fixes the warning:diego2008-10-241-1/+4
| * Determine default CD/DVD device in configure instead of using an #ifdef jungle.diego2008-10-211-26/+0
| * Replace typeof by __typeof__, the former is a non-portable GNU extension.diego2008-10-201-1/+1
| * Avoid CreateThread and especially TerminateThread since they cause a memleak.reimar2008-10-191-21/+18
| * Remove useless casts.reimar2008-10-191-2/+2
| * Revert declaring ThreadProc as void, it breaks the WINAPI.diego2008-10-161-2/+6
| * Move DEFAULT_CDROM_DEVICE/DEFAULT_DVD_DEVICE to stream.h where it belongs.diego2008-10-161-0/+27
| * Rename stream/netstream.h to stream/stream_netstream.h; netstream.h to make itdiego2008-10-162-1/+1
| * Replace preprocessor check for WIN32 with checks for __MINGW32__ and __CYGWIN__.diego2008-10-134-21/+21
| * Declare ThreadProc as void, it does not return anything, fixes the warning:diego2008-10-131-6/+2
| * Remove unused function, fixes the warning:diego2008-10-131-46/+0
| * Unconditionally #include osdep/shem.h, fixes the warnings on Cygwin:diego2008-10-131-1/+1
| * Move socklen_t typedef from config.h to stream/network.h.diego2008-10-122-0/+4
* | Merge svn changes up to r27682Uoti Urpala2008-10-021-5/+8
|\|
| * Add debug message about loaded frequency tables.voroshil2008-09-241-1/+2
| * Make output messages of frequency selection code more useful byvoroshil2008-09-241-2/+4
| * Fix overflow in frequency conversion code inside tvi_dshow.voroshil2008-09-241-2/+2
* | Merge svn changes up to r27649Uoti Urpala2008-09-201-1/+1
|\|
| * With -identify, ID_DVD_VOLUME_ID is not shown on some systems.diego2008-09-161-1/+1
* | Merge svn changes up to r27514Uoti Urpala2008-09-0331-91/+89
|\|
| * Move '#define closesocket close' preprocessor directive to a common placediego2008-09-0114-23/+17
| * Revert moving closesocket definition and network headers to network.h.diego2008-08-3114-15/+115
| * Rename internal libdvdread fork from dvdread to libdvdreadrathann2008-08-303-12/+12
| * Print DVD volume ID with -identify.reimar2008-08-301-0/+3
| * Move duplicated '#define closesocket close' into network.h along withdiego2008-08-2914-115/+15
| * consistency cosmetics: Avoid using .. in #include paths.diego2008-08-296-12/+12
| * Rename HAVE_WINSOCK preprocessor condition to HAVE_WINSOCK_H.diego2008-08-2920-45/+46
| * Use '#include <poll.h>' instead of '#include <sys/poll.h>'.diego2008-08-143-3/+3
* | Make various functions staticUoti Urpala2008-08-122-4/+4
* | Include corresponding .h in some .c filesUoti Urpala2008-08-121-0/+1
* | stream.h: Add 2 prototypes instead of declaring them in cache2.cUoti Urpala2008-08-122-5/+2
* | Merge svn changes up to r27441Uoti Urpala2008-08-0816-114/+114
|\|
| * Give a CONFIG_ prefix to preprocessor directives that lacked one anddiego2008-08-072-8/+8
| * Rename font-related preprocessor directives.diego2008-08-071-7/+7
| * Rename a bunch of miscellaneous preprocessor directives.diego2008-08-073-13/+13
| * Introduce CONFIG_ALSA preprocessor directive for ALSA 0.9 and 1.x.diego2008-08-065-17/+17
| * Rename some audio-output-related preprocessor directives.diego2008-08-055-17/+17
| * Change a bunch of video/audio-output-specific preprocessor directives fromdiego2008-08-0310-69/+69
* | Merge svn changes up to r27399Uoti Urpala2008-08-025-16/+16
|\|
| * Rename some preprocessor directives from CONFIG_* to HAVE_* where appropriate;diego2008-08-014-15/+15
| * Rename two GUI-related preprocessor directives:diego2008-07-301-1/+1
* | Merge svn changes up to r27374Uoti Urpala2008-07-3015-55/+56
|\|
| * Start unifying names of internal preprocessor directives.diego2008-07-3014-54/+54
| * Do not include sys/socket.h when using winsock2, it is pointlessreimar2008-07-261-1/+2
* | Merge svn changes up to r27332Uoti Urpala2008-07-214-5/+7
|\|
| * Our ALSA code needs alloca, so check for it in configure and include alloca.hreimar2008-07-172-0/+2
| * Replace S_IREAD|S_IWRITE by POSIX-compatible S_IRUSR|S_IWUSR (not exactly the...reimar2008-07-151-1/+1
| * Remove -std=gnu99/gnu89/default dialect linux define, as it violates themichael2008-07-151-4/+4
* | Merge svn changes up to r27281Uoti Urpala2008-07-152-2/+2
|\|
| * in dvd streams the title part ranges from 1 to 99nicodvb2008-07-122-2/+2
* | Merge svn changes up to r27242Uoti Urpala2008-07-095-1/+15
|\|
| * Add missing #include <sys/socket.h>, fixes the warnings:diego2008-07-081-0/+1
| * avoid unnecessary strdup(); patch by Aurelnicodvb2008-07-061-1/+1
| * Surround stream cache specific code by an appropriate #ifdef; fixes linkingdiego2008-07-051-0/+2
| * Add some more -identify information for CDDB.diego2008-07-051-0/+9
| * Add disc ID to -identify output.diego2008-07-051-0/+2
* | Merge svn changes up to r27202Uoti Urpala2008-07-052-18/+25
|\|
| * Rename stream_livedotcom.c to stream_live555.c, the name is used everywhere.diego2008-07-041-0/+0
| * cosmetics: in ifo_stream_oped() aligned the prototype to the stylenicodvb2008-07-041-9/+8
| * in ifo_stream_open() propagate the device based on the dirname of stream->url...nicodvb2008-07-041-0/+1
| * dvd_device must be handled exclusively by the option parser; it can't be chan...nicodvb2008-07-041-2/+0
| * added support for the device part in the url; patch bynicodvb2008-07-041-8/+17
* | Merge svn changes up to r27184Uoti Urpala2008-07-015-106/+122
|\|
| * Try to get frame rate information through VIDIOC_G_PARM ifvoroshil2008-06-301-0/+12
| * Fix division by zero in tvi_v4l2 which occures when capture devicevoroshil2008-06-301-8/+18
| * removed struct dvdnav_event_t that is 1) unused; 2) has an improper name. You...nicodvb2008-06-291-6/+0
| * mingw uses Windows sockets.vayne2008-06-281-1/+3
| * Fix the issue instead of revertinglu_zero2008-06-253-58/+56
| * Move rtsp_close away by simplification - avoids symbol clash with libnemesilu_zero2008-06-253-33/+33
* | Merge svn changes up to r27123Uoti Urpala2008-06-231-27/+28
|\|
| * Reorder some functions to avoid implicit declaration warnings.diego2008-06-191-27/+28
* | Merge svn changes up to r27092Uoti Urpala2008-06-174-6/+34
|\|
| * Add missing #includes to fix 'make checkheaders'.diego2008-06-162-0/+2
| * Ability for specifying TV standard individually for each TV channel.voroshil2008-06-142-6/+32
* | Merge svn changes up to r27025Uoti Urpala2008-06-072-36/+118
|\|
| * Factorizes dvdnav aid retrieval code.ben2008-06-071-30/+27
| * Add routine that provides audio ID corresponding to logical numberben2008-06-072-0/+33
| * Rename some functions as they are mplayer related and notben2008-06-072-15/+15
| * rename for consistencyben2008-06-071-5/+5
| * Add routine to determine if SPU has changed in dvdnav stream.ben2008-06-072-0/+25
| * Add routine to determine if audio has changed in dvdnav stream.ben2008-06-072-0/+25
| * Save DVDNAV palette info.ben2008-06-072-0/+2
* | Merge svn changes up to r26979Uoti Urpala2008-06-0419-209/+312
|\|
| * 100l, fix wrong order of cases in cache_do_controlreimar2008-06-011-3/+3
| * Fix compilation with internal dvdnavrtogni2008-05-311-0/+1
| * adapted to the dvdread->libdvdread transition in dvdnav's repositorynicodvb2008-05-313-4/+12
| * Handle NULL control function in cache_execute_control, fixes crash with http ...reimar2008-05-301-0/+7
| * Emulate STREAM_CTRL_GET_TIME_LENGTH if cache is used.reimar2008-05-261-2/+13
| * Add basic support for stream controls with cache enabled.reimar2008-05-244-7/+83
| * cosmetics: Remove useless parentheses from return statements.diego2008-05-1612-198/+198
* | Merge svn changes up to r26783Uoti Urpala2008-05-1518-233/+263
|\|
| * Add missing stream.h #include, fixes the warning:diego2008-05-151-0/+1
| * Use standard license headers with standard formatting.diego2008-05-1417-233/+262
* | Merge svn changes up to r26680Uoti Urpala2008-05-072-0/+3
|\|
| * Add missing header #includes to fix 'make checkheaders'.diego2008-05-032-0/+3
* | Create a context for input.c stateUoti Urpala2008-04-302-4/+11
* | Merge svn changes up to r26587Uoti Urpala2008-04-291-1/+1
|\|
| * Use consistent #include paths without "../".diego2008-04-281-1/+1
* | Merge svn changes up to r26540Uoti Urpala2008-04-261-73/+0
|\|
| * Merge stream/Makefile into top-level Makefile.diego2008-04-241-72/+0
| * cosmetics: alphabetical orderdiego2008-04-241-2/+1
* | Remove _s/_st suffix from some struct namesUoti Urpala2008-04-256-29/+29
* | Move audio_id and video_id to options structUoti Urpala2008-04-233-10/+14
* | Add option pointer to stream struct (at least temporarily)Uoti Urpala2008-04-233-19/+18
* | Mark some functions staticUoti Urpala2008-04-232-5/+5
|/
* in preparation for multi-frontend patch replaced file-static device names wit...nicodvb2008-04-131-17/+28
* removed useless parameter :type from -dvbin (the frontend type is reported by...nicodvb2008-04-121-6/+3
* removed defunct options :vid and :aid from -dvbin (they were useless from the...nicodvb2008-04-121-10/+5
* Remove the need for code using stream to export an mp_input_check_interrupt()albeu2008-04-094-4/+18
* Make stream independent of libmpdemux, the asf demuxer and streamingalbeu2008-04-091-10/+1
* Fix possible integer overflow in malloc by using calloc instead.reimar2008-03-291-1/+2
* mingw uses windows sockets.vayne2008-03-111-0/+2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-101-0/+3
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-1014-0/+39
* Remove useless #include.diego2008-03-101-1/+0
* search channels.conf in mplayer's instdir if all other searches fail; patch b...nicodvb2008-03-031-0/+6
* cache support for OS/2diego2008-02-281-17/+34
* FFmpeg now uses different (unified) #include paths.diego2008-02-251-4/+0
* Avoid a pointless special-case for opening a filereimar2008-02-241-4/+0
* Add MPLAYER_ prefix to multiple inclusion guards.diego2008-02-2234-106/+104
* Add multiple inclusion guard.diego2008-02-211-0/+5
* Add missing multiple inclusion guards.diego2008-02-214-0/+18
* Remove pointless #ifdefs around extern declarations.diego2008-02-201-26/+0
* Add support for DOS-style file:///x:/path paths.diego2008-02-201-0/+6
* Fill stream->end_pos if possible, fixing lavf demuxers that need to seek.albeu2008-02-191-1/+3
* Support icyx://.reimar2008-02-151-1/+1
* Always display Icy-Metadata if available, whether we recognize an ICY-Serverreimar2008-02-151-1/+2
* Move printing of Icy-Metadata into an extra functionreimar2008-02-151-14/+18
* Remove useless codereimar2008-02-151-6/+6
* Detect IceCast also by Icy-MetaInt header part in http_streaming_start(),reimar2008-02-151-1/+2
* typo fix: inited --> initializeddiego2008-02-142-12/+12
* -chapter is now handled uniformly calling demuxer_seek_chapter() insteadnicodvb2008-02-112-29/+2
* #include just libavutil/common.h, not all of libavutil/intreadwrite.h.diego2008-02-111-1/+1
* Stream IDs must be written as hex numbers. Fixes rtogni2008-01-291-2/+2
* vcd_read must read exactly VCD_SECTOR_DATA bytes.reimar2008-01-281-1/+1
* Consistently use uppercase filename as multiple inclusion guard.diego2008-01-285-15/+15
* factorize 2 testsben2008-01-261-2/+3
* add a new state flag to dvdnav in order to notify ifben2008-01-262-0/+21
* remove useless castsben2008-01-261-10/+10
* simplify by a one-linerben2008-01-261-2/+1
* remove the spu_set field, replaced by a flagben2008-01-261-3/+4
* this end brace was not correctly indentedben2008-01-261-1/+1
* automatically set spu button highlight when nav cell has changedben2008-01-261-0/+3
* Add support for dvdnav still frames playback.ben2008-01-262-26/+166
* array was defined for 6 elements while 7 were declaredben2008-01-241-1/+1
* type expected by dvdnav_get_title_string() is constben2008-01-241-1/+1
* remove some redundant declarationsben2008-01-241-3/+0
* Add new command to switch between dvdnav titlesben2008-01-242-0/+10
* Prevent possible buffer overflow on album_title[]rtogni2008-01-201-2/+5
* Clear tmp between ip6 check and string escape to prevent reuse of the rtogni2008-01-201-0/+1
* Fix compilation failue:ulion2008-01-201-0/+1
* Reindentreimar2008-01-191-2/+2
* Simplify and keep terminating end-of-linereimar2008-01-191-4/+4
* Remove a broken and useless hack to avoid a memcpyreimar2008-01-191-3/+1
* Cached file must be 0-terminated since we use string processing functions on itreimar2008-01-191-2/+3
* Make sure we do not write the terminating 0 out of boundsreimar2008-01-191-1/+1
* Simplify/cleanup of real_calc_response_and_checksum()rtogni2008-01-131-8/+2
* Don't oversize realchallenge buffersrtogni2008-01-131-6/+6
* Simplify cue-parsingreimar2008-01-131-13/+12
* Get rid of quite useless inum variablereimar2008-01-131-3/+2
* Use AV_WB*reimar2008-01-131-10/+3
* Remove some useless () and {}reimar2008-01-131-16/+13
* Simplifyreimar2008-01-131-1/+1
* Use AV_WB16 instead of ugly memcpy hacksreimar2008-01-131-10/+3
* Use AV_RB* instead of custom variants.reimar2008-01-131-19/+11
* Use sizeof instead of size variables/definesreimar2008-01-131-16/+10
* Make some pnm data constreimar2008-01-131-2/+2
* dvb_demuxdev etc. are only used in dvb_tune.c so make them staticreimar2008-01-131-6/+6
* Make several arrays constreimar2008-01-131-7/+7
* Remove some unused extern variablesreimar2008-01-131-1/+0
* stream_opts should be constreimar2008-01-1313-13/+13
* stream_info_t opts and protocols point to constant data as well.reimar2008-01-131-2/+2
* Make all tvi_info_t constreimar2008-01-136-10/+10
* Make some tvi_functions_t pointers const that I forgot to change beforereimar2008-01-131-5/+5
* Remove useless ifdefsreimar2008-01-131-8/+0
* Add type to extern declarationreimar2008-01-131-1/+1
* Make dvd_audio_stream_types and dvd_audio_stream_channels constreimar2008-01-131-2/+2
* tvi_functions_t should be constreimar2008-01-132-2/+2
* Add forgotten const for pal_ireland.reimar2008-01-131-1/+1
* Remove unnecessary <signal.h> includesuau2008-01-092-2/+0
* Fix illegal identifiers, names starting with __ are reserved for the system.diego2008-01-081-2/+2
* Fix illegal identifiers: Names starting with __ or _ and uppercase are reserveddiego2008-01-061-4/+4
* implemented _ANGLE STREAM_CTRLs, patch by oattila chello hu nicodvb2008-01-051-0/+27
* implemented _ANGLE STREAM_CTRLs, patch by oattila chello hu nicodvb2008-01-051-0/+19
* NEW STREAM_CTRLs: STREAM_CTRL_GET_NUM_ANGLES STREAM_CTRL_GET_ANGLE STREAM_CTR...nicodvb2008-01-051-0/+3
* fixed bug when playing multi-angle titles: the address field in the agli datanicodvb2008-01-051-1/+2
* Add multiple inclusion guards to all header files that lack them.diego2008-01-014-0/+21
* consistency cosmeticsdiego2008-01-011-1/+1
* Add explanatory comments to #endif preprocessor directives.diego2008-01-011-2/+1
* include dvdnav.h from its installation directory rather than appendingnicodvb2008-01-011-1/+1
* removed inclusion of unneeded header (forgotten in previous commit)nicodvb2008-01-011-2/+0
* private structures belong to the C file using them, not to header files inclu...nicodvb2008-01-012-11/+11
* Add explanatory comments to the #endif part of multiple inclusion guards.diego2007-12-3114-17/+14
* Simplify a little bitreimar2007-12-211-6/+4
* Remove a check that is never in any way usefulreimar2007-12-211-5/+0
* Avoid some le2me_ASF_* stuff operating directly on buffer, shouldreimar2007-12-211-5/+3
* Remove another useless castreimar2007-12-211-1/+1
* 100l, buffer bound checks work better when done _before_ access.reimar2007-12-211-3/+2
* Reduce some extreme parsing ugliness (mostly cosmetic)reimar2007-12-211-10/+12
* Remove useless alloc castsreimar2007-12-211-3/+3
* Reduce code duplication: add a asf_read_wrapper function that never does part...reimar2007-12-211-34/+23
* Fix stream_cache to use sector_size set in stream_t.ulion2007-12-201-1/+1
* Use tv_sec instead of tv_usec to set 1 second timeout, e.g. NetBSDreimar2007-12-201-2/+2
* Protocol name should be case insensitive.ulion2007-12-191-1/+1
* Caching toc header in vcd private structure for later use.ulion2007-12-172-12/+6
* Add cdda stream control for chapter commmands.ulion2007-12-171-0/+48
* Should not change stream->pos in fill_buffer function.ulion2007-12-161-1/+0
* Support cddb on darwin.ulion2007-12-161-1/+51
* 10l, in dvb_free_config() channels' names must be free individuallynicodvb2007-12-151-3/+6
* cosmetic: indent after r25415ben2007-12-151-1/+1
* do not override *file_format if already set by asf_streaming_start()ben2007-12-151-0/+1
* Make the end_sector accessable (it should be).ulion2007-12-151-7/+7
* removed the obscene priv->stream entry. Someone must have injected vodka in m...nicodvb2007-12-152-5/+3
* get rid of the file-static dvb_config and free the config at close() . Patch...nicodvb2007-12-152-10/+23
* Only read disc info once and save it for later using.ulion2007-12-151-17/+6
* dvb cleanup: call dvb_(set|step)_channel() without dereferencing stream->priv...nicodvb2007-12-152-7/+8
* The buffer used for pread need be aligned, but currently it got an offset 23ulion2007-12-151-1/+1
* Get end position of last track by adding its starting address with track size.ulion2007-12-151-2/+17
* Replace printf with mp_msg.ulion2007-12-151-9/+9
* Only print one track info when exactly seeking to the beginning of a track.ulion2007-12-141-1/+3
* Fix stream cdda seeks to CD's end and hangs forever bug.ulion2007-12-141-2/+2