summaryrefslogtreecommitdiffstats
path: root/stream
Commit message (Expand)AuthorAgeFilesLines
* stream/url.c: escape characters >= 127 in URLsreimar2011-02-151-2/+1
* terminal output: show cache fill changes in "PAUSED" messagereimar2011-02-152-5/+9
* fix compilation with old FFmpeg versionsUoti Urpala2011-02-082-0/+11
* cache: suggest increasing cache size in the "not filling!" messagereimar2011-01-311-1/+1
* stream/http: assume MakeMKV webservers always support rangesreimar2011-01-311-2/+6
* stream/tvi_v4l2.c: simplify by using getfps helper functionreimar2011-01-311-9/+2
* cleanup: Replace two malloc+memset with calloc.cboesch2011-01-292-6/+2
* stream/http: support 307 (Temporary Redirect) responsescboesch2011-01-291-0/+2
* Merge branch 'sub'Uoti Urpala2011-01-261-1/+1
|\
| * sub/OSD: move some related files to sub/Uoti Urpala2011-01-261-1/+1
* | cleanup: remove unused MEncoder-related codeClément Bœsch2011-01-251-1/+0
|/
* stream.h: check against huge negative values in stream_seek()reimar2010-12-161-0/+4
* stream/http: Add support for login/password in http_proxy env variablecboesch2010-12-163-3/+19
* stream/: delete base64_encode(), use libavutil av_base64_encode()cboesch2010-12-163-74/+13
* stream/network.c, stream/http.c: cleanupcboesch2010-12-162-13/+4
* stream/http: Do not keep authentication in URL when proxiedcboesch2010-12-163-2/+24
* stream/http: Add Proxy-Authorization header to authenticate on proxiescboesch2010-12-163-4/+19
* stream/http: don't use proxy values for "Authorization" headercboesch2010-12-161-1/+1
* cleanup: remove NULL checks before free() all over the codecboesch2010-11-147-35/+23
* stream/url.c: Unescape username/password when parsing URLsreimar2010-11-141-1/+4
* cache: read up to 64 KiB at once from stream_filereimar2010-11-143-1/+7
* stream/network.c: Replace hardcoded str size with sizeofcboesch2010-11-141-5/+5
* options: move some demux options to option structClément Bœsch2010-11-111-1/+0
* cleanup: don't check for NULL before free()diego2010-11-0817-127/+78
* stream_dvd: fill_buffer(): use given buffer, not stream's defaultreimar2010-11-081-2/+5
* stream_dvd: minor cleanupreimar2010-11-081-7/+4
* cache, stream: avoid extra memcpy when using cachereimar2010-11-073-38/+59
* cosmetics: cache2.c: Remove some irrelevant commented-out codereimar2010-11-071-8/+1
* stream_dvd: millisecond accuracy for chapters in -identify outputcigaes2010-11-071-3/+2
* Add a simple capture feature (-capture)Uoti Urpala2010-11-023-0/+22
* stream_network: Fix possible crash for invalid http_proxy URLsreimar2010-11-021-0/+4
* rtsp_rtp.c: Add missing avstring include for av_strlcpyreimar2010-11-021-0/+1
* rtsp_rtp.c: Replace snprintf by av_strlcpyreimar2010-11-021-1/+1
* Remove #warning preprocessor directivesdiego2010-11-021-1/+0
* Remove remaining %lf printf conversionsreimar2010-11-022-5/+5
* build: enable/disable all FFmpeg libraries togetherUoti Urpala2010-11-022-2/+2
* stream/tv: move new_handle() function from header to tv.cdiego2010-11-028-29/+31
* tvi_def.h: sizeof(type) -> sizeof(*ptr)diego2010-11-021-1/+1
* cosmetics: Remove vim/emacs coding style hints from sourcesdiego2010-11-021-4/+0
* cleanup: malloc+memset->calloc, sizeof(TYPE)->sizeof(*ptr)reimar2010-11-022-3/+3
* stream/tv: move free_handle() from header to tv.cdiego2010-11-026-18/+20
* cache: Remove unused cache_stats functiondiego2010-11-021-10/+0
* cache: Move cache_fill_status extern declaration to cache2.hdiego2010-11-021-0/+2
* stream/http.c: Move mime_type_table extern declaration to network.hdiego2010-11-022-1/+2
* stream: make stream_read_line() terminate line on EOFreimar2010-11-021-1/+1
* stream_file: Simplify and document MinGW stdin hackreimar2010-11-021-3/+4
* stream_dvd[nav]: Add const qualifiers to string argumentsreimar2010-11-024-8/+8
* Simplify code: make open_stream() accept NULL file_format argumentreimar2010-11-021-0/+2
* printf format fixes ("%d" -> "%zd")diego2010-11-022-2/+2
* cache: add sanity-check for sector sizereimar2010-11-022-2/+9
* spelling fixessiretart2010-11-025-9/+9
* cache: Don't mess up current position if time-based seek failsreimar2010-11-021-1/+2
* stream_dvd: Improve seeking by positiondiego2010-11-021-15/+8
* stream_dvd: Improve seeking by chaptersdiego2010-11-021-5/+12
* stream_dvd: fix incorrect assumption about chapter countdiego2010-11-021-10/+38
* stream_dvb.c: avoid compiler warning by adding initializationdiego2010-11-021-0/+1
* configure: Rename "network" variable and option to "networking"diego2010-11-022-6/+6
* cache: Use sigaction() instead of signal()reimar2010-11-021-3/+6
* stream.c: add <libavutil/common.h> include needed for GET_UTF16reimar2010-11-021-0/+2
* stream_bluray: implement slave mode compatible controlsben2010-11-021-6/+119
* stream_bluray: add unencrypted Blu-ray playbackben2010-11-023-0/+244
* Factorize MPlayer/MEncoder version string handling.diego2010-11-022-10/+6
* stream: Use MSG_NOSIGNAL flag if available for send().reimar2010-11-027-8/+15
* stream/dvbin.h: Use angular brackets for system #includes.diego2010-11-021-2/+1
* stream_cddb: move structs to the file they're used indiego2010-11-022-18/+18
* stream_cdda: change printf format for cdda_tracks to %ddiego2010-11-021-1/+1
* stream_cdda.c: Reorder functions to avoid forward declarations.diego2010-11-021-110/+106
* stream_cdd*: Move declarations for stream_cddb.c functions to cdd.hdiego2010-11-022-4/+4
* stream_cddb: Remove unused static functionsdiego2010-11-021-31/+0
* stream_ccda: Move cdda_priv structure to the only place it is useddiego2010-11-022-23/+21
* stream/tcp.c: Prefer the use of inet_ntop over inet_ntoaattila2010-11-021-3/+3
* stream.h: support backswards stream_skip() within bufferreimar2010-11-021-1/+1
* tv.h: Change function pointer types to proper declarationsreimar2010-11-026-13/+16
* cache: Respect -cache-seek-min also for on-disk filesreimar2010-11-021-3/+5
* Merge svn changes up to r31291Uoti Urpala2010-06-021-0/+18
|\
| * Add a referrer option to set the HTTP Referer field.reimar2010-05-301-0/+18
| * misc cosmetics: K&R style nits, #include placement, indentationdiego2010-05-291-1/+1
* | stream_radio.c: fix corrupt line from e3061749Uoti Urpala2010-06-021-1/+1
* | Merge svn changes up to r31256Uoti Urpala2010-05-303-6/+38
|\|
| * Fix typo in message.reimar2010-05-281-1/+1
| * stream_check_interrupt should sleep even if no callback is set.reimar2010-05-281-1/+4
| * 100l, stream_check_for_interrupt argument is not in usec,reimar2010-05-281-3/+3
| * Document time scale for stream_check_interrupt argument.reimar2010-05-281-1/+2
| * Improve handling of cache process/thread hanging/being killed.reimar2010-05-281-3/+23
| * Fix cache process accidentally being killed by SIGUSR1.reimar2010-05-281-0/+7
* | Merge svn changes up to r31244Uoti Urpala2010-05-301-6/+6
|\|
| * Fix a bunch of typos in the stream cache code.diego2010-05-271-6/+6
| * Drop pointless _st suffix from 'struct stream'.diego2010-05-276-29/+29
* | Merge svn changes up to r31226Uoti Urpala2010-05-302-4/+15
|\|
| * Retry reading even if we hit eof before.reimar2010-05-262-3/+6
| * Re-enable wakeup-on-signal for cache process.reimar2010-05-261-5/+10
| * Disable waking the cache process up via a signal, itreimar2010-05-261-1/+4
| * Add support for STREAM_CTRL_SEEK_TO_TIME in ffmpeg streamshyc2010-05-251-1/+10
* | Merge svn changes up to r31211Uoti Urpala2010-05-301-45/+78
|\|
| * Slightly reduce number of #ifsreimar2010-05-231-22/+20
| * Use an extra define to simplify ifdefsreimar2010-05-231-14/+20
| * Try reducing the #ifdef mess for the different cache variants.reimar2010-05-231-15/+13
| * Extract the cache main loop into a separate function.reimar2010-05-231-14/+19
| * Optimize cache behaviour for the many-consecutive-seeks case.reimar2010-05-231-1/+13
| * Add code to wake up cache process when e.g. a seek is needed.reimar2010-05-231-0/+14
* | cosmetics: "struct vf_instance* vf" -> "struct vf_instance *vf"Uoti Urpala2010-05-293-7/+13
* | stream.h: remove bad EOF check in stream_seek()Uoti Urpala2010-05-221-2/+0
* | Merge svn changes up to r31033Uoti Urpala2010-04-267-3/+26
|\|
| * Do not print the "Loading cookie file" message twice.reimar2010-04-051-2/+0
| * Try to fix VCD compilation on non-Linux systems.reimar2010-04-056-1/+26
* | Merge svn changes up to r31020Uoti Urpala2010-04-261-0/+35
|\|
| * Export VCD tracks as chapters, just like for cue:// URLs.reimar2010-04-051-0/+35
* | Merge svn changes up to r31004Uoti Urpala2010-04-262-3/+6
|\|
| * Remove commented-out #include of a non-existing file.diego2010-04-031-2/+0
| * Change type to uint8_t to avoid checks depending on char signedness.reimar2010-04-021-1/+1
| * Sanitize ICY metadata a bit before printing it.reimar2010-03-311-0/+5
* | Merge svn changes up to r30967Uoti Urpala2010-04-262-2/+5
|\|
| * Make http_read_response fail if parsing the response failed.reimar2010-03-231-1/+4
| * Rename get_path.[ch] --> path.[ch].diego2010-03-201-1/+1
* | options: move -chapter values to option structUoti Urpala2010-04-255-45/+3
* | demux_lavf, stream_ffmpeg: support librtmp seeksUoti Urpala2010-04-231-1/+10
* | stream_ffmpeg, demux_lavf: Use flv demuxer for rtmp streamsUoti Urpala2010-04-232-0/+8
* | stream_ffmpeg.c: change reads back to url_read_complete()Uoti Urpala2010-04-231-1/+1
* | Delete things related to old translation systemUoti Urpala2010-03-1034-35/+0
* | Merge svn changes up to r30876Uoti Urpala2010-03-104-10/+5
|\|
| * Define O_BINARY in stream/stream.h unless it is defined yet, and use itkomh2010-03-064-10/+5
* | Merge svn changes up to r30848Uoti Urpala2010-03-106-324/+263
|\|
| * Define HAVE_SETMODE conditionally, and use it in stream/stream_file.c insteadkomh2010-03-041-4/+4
| * Add a VCD support for OS/2komh2010-03-032-0/+254
| * Drop support for old-style DVB code.diego2010-03-023-320/+5
* | Merge svn changes up to r30815Uoti Urpala2010-03-103-102/+217
|\|
| * Remove unused and useless define.reimar2010-03-011-1/+0
| * Fix memleak due to strdup'd filename not being freed.reimar2010-03-011-0/+2
| * Move functions into proper order to avoid extra declarations.reimar2010-03-011-15/+12
| * Deduplicate code to set stream start_pos/end_pos.reimar2010-03-011-12/+15
| * Set stream->pos correctly after seeking to a VCD title.reimar2010-03-011-0/+1
| * Ensure that cue_current_pos.track is not set to an invalid value afterreimar2010-03-011-8/+5
| * Fix off-by-one error in chapter<->VCD track conversion.reimar2010-03-011-2/+2
| * Fix cue_read_toc_entry to also reject negative track numbersreimar2010-03-011-1/+1
| * Implement cue:// track switching via chapter forward/backward like for audio ...reimar2010-03-011-0/+28
| * Fix cue_vcd_get_track_end to not change the current position.reimar2010-03-011-4/+3
| * Avoid fd_bin and fd_cue global variables.reimar2010-03-011-9/+9
| * Avoid a global variable and a strcpy.reimar2010-03-011-6/+2
| * Reindent.reimar2010-03-011-19/+19
| * Avoid code duplication and excessively deep nesting in cue_find_binreimar2010-03-011-37/+32
| * Use sizeof instead of hardcoded size.reimar2010-03-011-2/+2
| * Extend stream_read_line to support reading lines from UTF-16 encoded filesreimar2010-02-282-6/+102
* | Merge svn changes up to r30798Uoti Urpala2010-03-109-104/+114
|\|
| * Move stream_read_line implementation from stream.h to stream.c,reimar2010-02-282-26/+27
| * Simplify handling of 0-termination in stream_read_linereimar2010-02-281-3/+5
| * Remove useless cast.reimar2010-02-281-1/+1
| * Add cddb:// support for OS/2komh2010-02-281-0/+74
| * Fix warning "missing braces around initializer".cehoyos2010-02-271-0/+2
| * Remove unused functions.cehoyos2010-02-271-60/+0
| * Fix cd_info_new() prototype.cehoyos2010-02-271-1/+1
| * Threaded cache fixes: do not free the stream_t struct twice on windowsreimar2010-02-271-8/+6
| * Remove unused static function streaming_stop().cehoyos2010-02-271-6/+0
| * Restructure #ifs to be clearer, also ensures that we return from the threadreimar2010-02-271-3/+3
* | Merge svn changes up to r30748Uoti Urpala2010-03-10</