summaryrefslogtreecommitdiffstats
path: root/stream
Commit message (Expand)AuthorAgeFilesLines
* stream: rearrange open functionswm42019-09-294-56/+96
* stream_cb: add cancel_fn callbackAman Gupta2019-09-271-0/+8
* stream_dvb: remove unused variablewm42019-09-211-1/+0
* stream_libarchive: Always use LC_CTYPE_MASK for libarchiveJames Hilliard2019-09-211-1/+1
* stream: add a generic concat implementationwm42019-09-192-0/+164
* stream: create memory streams in more straightforward waywm42019-09-193-40/+57
* stream: log positions on seek failureswm42019-09-191-1/+2
* stream: redo buffer handling and allow arbitrary size for stream_peek()wm42019-09-192-48/+95
* stream_libarchive: remove base filename stuffwm42019-09-192-6/+0
* stream_libarchive: fix another crash with broken rar fileswm42019-09-191-1/+3
* stream: stop randomly corrupting memorywm42019-09-181-1/+2
* stream_smb: remove unnecessary short write logicwm42019-09-141-11/+4
* stream_file: remove unnecessary short write logicwm42019-09-141-10/+1
* stream: handle short writeswm42019-09-141-7/+10
* demux, stream: remove old rar support in favor of libarchivewm42019-09-135-663/+1
* stream: remove some more optical disc leftoverswm42019-09-132-15/+0
* Remove classic Linux analog TV support, and DVB runtime controlswm42019-09-1316-5522/+4
* stream: remove BD/DVD/CDDA sector size alignmentwm42019-09-135-16/+4
* Remove optical disc fancification layerswm42019-09-134-355/+8
* stream_dvdnav: merge stream_dvd_commonwm42019-09-133-205/+106
* Remove libdvdread support in favor of libdvdnavwm42019-09-132-999/+0
* stream_file: avoid redundant freeAman Gupta2019-09-111-1/+0
* stream_dvb: Increase timeout of streaming read.Oliver Freyermuth2019-09-021-1/+1
* stream_dvb: Adapt to VDR channel config format.Oliver Freyermuth2019-09-021-3/+8
* libarchive: add fallback for systems without C.UTF-8dudemanguy2019-05-041-2/+5
* Merge branch 'master' into pr6360Jan Ekström2019-03-111-2/+2
|\
| * stream_dvb: Correct range for dvbin-card option.Oliver Freyermuth2018-12-121-2/+2
* | stream: silence failed seek message on terminationwm42018-12-061-1/+2
* | stream: somethingwm42018-12-061-3/+4
* | demux, stream: readd cache-speed in some other formwm42018-12-062-0/+5
* | Merge commit '559a400ac36e75a8d73ba263fd7fa6736df1c2da' into wm4-commits--mer...Anton Kindestam2018-12-0514-1243/+14
|\ \ | |/ |/|
| * demux, stream: rip out the classic stream cachewm42018-08-3112-1099/+0
| * options: add --http-proxywm42018-05-241-0/+4
| * player: some further cleanup of the mp_cancel crapwm42018-05-241-1/+1
| * command: whitelist some blocking accesses for certain demuxers/streamswm42018-05-242-0/+2
| * stream_file: use a separate mp_cancel thingwm42018-05-241-2/+8
| * misc: move mp_cancel from stream.c to thread_tools.cwm42018-05-246-143/+5
| * stream_file: properly detect stdin as pipewm42018-05-241-17/+16
* | stream_smb: make sure the string is NULL-terminated after strncpypavelxdd2018-10-251-0/+1
* | stream_libarchive: fix hangs when demuxer does out of bound seekswm42018-10-011-2/+9
* | stream_smb/stream_file: fix `write_buffer`Yclept Nemo2018-07-292-16/+16
* | stream_smb: locking to bypass libsmbclient issuesYclept Nemo2018-07-291-1/+21
* | stream_file: enable cache for FUSE filesystems on OpenBSD and FreeBSDgall0ws2018-06-051-1/+1
* | options: add --http-proxywm42018-05-311-0/+4
* | stream_file: properly detect stdin as pipewm42018-05-251-17/+16
|/
* stream_libarchive: mark as needing cachewm42018-04-151-0/+1
* demux, stream: ignore packets and errors on forced exitwm42018-03-261-1/+2
* stream_file: enable cache for FUSE filesystems on OS XPhilip Sequeira2018-03-151-1/+2
* stream_file: add more network file systems (Linux)Philip Sequeira2018-03-151-0/+1
* tv: Recognise v4l2 'JPEG' fourccPhilip Langdale2018-03-043-2/+7
* stream_file: add mode for reading appended fileswm42018-02-211-7/+48
* stream_lavf: remove deprecated hls protocol from whitelistwm42018-01-251-1/+1
* stream_bluray: always show list of available titlesRicardo Constantino2018-01-231-2/+2
* stream_bluray: silence libbluray's debug messages unless we want themRicardo Constantino2018-01-231-0/+4
* Fix undefined preprocessor behaviorwm42018-01-181-1/+5
* stream_bluray: support detecting UHD BD directoriesRicardo Constantino2018-01-111-10/+7
* cache: fix --cache-initial status messagewm42018-01-071-4/+3
* stream: use native libavformat reconnection featurewm42018-01-044-64/+3
* stream_lavf: minor fixes to HTTP reconnection supportwm42018-01-022-6/+14
* stream_libarchive: fix seeking fallbackwm42017-12-241-14/+14
* cache: propagate underlying stream seek errors in some caseswm42017-12-241-1/+12
* cache: lower default size to 2*10MBwm42017-12-231-2/+2
* dvb: Add multiple frontends support: MAX_FRONTENDS now 8.rim2017-12-164-88/+99
* msg: reinterpret a bunch of message levelsNiklas Haas2017-12-151-2/+2
* stream_libarchive: Fix locale includes on macOSsfan52017-12-031-0/+5
* stream_libarchive, osdep: use stubs for POSIX 2008 locale on MinGWwm42017-11-121-0/+1
* stream_libarchive: workaround various types of locale braindeathwm42017-11-122-4/+36
* stream_libarchive: stop reading on ARCHIVE_FATALwm42017-11-021-4/+41
* cache: throttle wakeupswm42017-10-201-2/+14
* Add checks for HAVE_GPL to various GPL-only source fileswm42017-10-109-0/+41
* dvb: SYS_DVBC_ANNEX_B is now supported if ATSC is activated.Oliver Freyermuth2017-10-091-0/+2
* dvb: Skip channel if ATSC device does not support cable / terr.Oliver Freyermuth2017-10-091-1/+3
* dvb: Implement parsing of modulation for VDR-style channels config.Oliver Freyermuth2017-10-091-0/+50
* dvb: Fixes for ATSC tuning.Oliver Freyermuth2017-10-092-2/+19
* stream_dvb: Multiply frequency and sample rate by 1000 for VDR.Oliver Freyermuth2017-10-091-4/+3
* dvb_tune: Pull out DVBv5 raw tuning part, add verbosity.Oliver Freyermuth2017-10-091-23/+24
* dvb: Explicitly clear via DVBv5 before reverting to DVBv3.Oliver Freyermuth2017-10-091-2/+12
* dvb: Use more elaborate tuning for DVBv5 tuning.Oliver Freyermuth2017-10-091-23/+111
* build: switch preliminary LGPL mode from v3 to v2.1wm42017-10-051-8/+1
* stream_lavf: use avio_read_partial()wm42017-09-011-0/+4
* stream: add an assert() to an obscure seek casewm42017-08-171-0/+1
* vo_opengl: support loading custom user texturesNiklas Haas2017-07-271-27/+1
* Avoid calling close(-1)wm42017-06-291-2/+4
* stream_bluray: change license to LGPLwm42017-06-261-7/+7
* demux_mf, stream_mf: change license to LGPLwm42017-06-241-7/+7
* stream: move cache option declarations to cache.cwm42017-06-231-0/+27
* build: simplify OSS checks and remove changes by "bugmen0t"wm42017-06-221-8/+0
* stream: change license to LGPLwm42017-06-192-28/+26
* Drop/move img_fourcc.hwm42017-06-185-4/+38
* stream_file: option to close fd after use -> fdclose://sfan52017-06-161-5/+8
* stream_lavf: change license to LGPLwm42017-06-161-7/+7
* stream: rewrite url escaping/unescaping functionswm42017-06-131-36/+48
* cache: move duplicated condition to a functionwm42017-05-151-6/+12
* cache: fix unnecessary seek blocking from f4d62dc4a0Uoti Urpala2017-05-151-9/+18
* cache: clarify that copyright will be changed to LGPL v2.1 if possiblewm42017-05-111-0/+2
* stream_smb: disable by default, mark as GPLv3wm42017-05-111-1/+1
* stream_file: change license to LGPLwm42017-05-111-10/+8
* cookies: change license to LGPLwm42017-05-112-15/+14
* cache: change license to LGPL v3wm42017-05-081-7/+12
* stream_null: change license to LGPLwm42017-05-081-7/+7
* wscript: decouple dvdnav check from dvdreadRicardo Constantino2017-03-311-1/+1
* stream/stream_dvdnav: show list of titles on verboseRicardo Constantino2017-03-291-0/+7
* stream/stream_dvdnav: don't ignore setting titleRicardo Constantino2017-03-291-1/+1
* stream_dvd: fix subs/audio detection on DVDs containing multi-PGC titlesqrwyeui2017-03-151-3/+3
* dvb: add support for DVB-T2ivan-832017-03-064-633/+777
* Revert "dvb: add support for DVB-T2"wm42017-02-144-766/+625
* dvb: add support for DVB-T2ivan-832017-02-134-625/+766
* dvb: move priv allocation to dvb_openThomas V2017-02-101-1/+1
* tv: Zero-out newly-allocated handle in tv_new_handle()Frédéric Brière2017-02-051-4/+1
* stream: get rid of streamtype enumwm42017-02-0212-31/+9
* stream: better method signal caching, rename weird uncached_stream fieldwm42017-02-022-7/+9
* tvi_dummy: don't return bad dummy PTSwm42017-02-021-2/+3
* stream: minor cleanup to previous commitwm42017-01-271-12/+7
* stream: set EOF if stream is canceledwm42017-01-261-1/+3
* stream_lavf: add support for data URIsRicardo Constantino2017-01-251-0/+1
* stream: check for playback aborts on reading toowm42017-01-241-0/+2
* player: remove --stream-capture option/propertywm42017-01-212-39/+0
* stream_bluray: use proper 0-based idxRicardo Constantino2017-01-161-1/+1
* cache: remove redundant free()wm42017-01-091-3/+1
* demux, stream: add option to prevent opening referenced fileswm42016-12-045-0/+16
* tv: fix option typewm42016-11-222-3/+3
* stream_bluray: check title index/playlist rangeschnusch2016-10-171-6/+20
* stream_bluray: select title by playlistschnusch2016-10-171-18/+34
* stream_file: don't use poll() on directorieswm42016-10-141-3/+5
* stream_libarchive: add some more points at which reading can be stoppedwm42016-10-011-1/+4
* stream_lavf: check seekable flag correctlywm42016-09-271-1/+1
* stream_lavf: fix determining seekabilitywm42016-09-261-3/+23
* stream/stream_lavf: user-agent option is deprecatedRiCON2016-09-181-1/+1
* stream_cb: don't add "*://" to protocol listwm42016-09-102-5/+1
* stream, demux, config: remove some dead/unneeded option-related codewm42016-09-092-92/+0
* stream_cdda: remove weird option parsing stuffwm42016-09-091-29/+12
* tv: remove weird option parsing stuffwm42016-09-091-17/+0
* stream_dvb: remove weird option parsing stuffwm42016-09-091-24/+24
* stream_dvd, stream_dvdnav: remove weird option parsing stuffwm42016-09-084-66/+93
* stream_bluray: fix a minor memory leakwm42016-09-081-2/+3
* stream_bluray: remove weird option parsing stuffwm42016-09-081-51/+45
* osdep: rename atomics.h to atomic.hwm42016-09-071-1/+1
* demux: do not access global optionswm42016-09-063-27/+65
* stream_cb: remove broken castwm42016-08-311-1/+1
* cache: don't use a backbuffer if the cache is as large as the filewm42016-08-261-10/+14
* stream_memory: disable stream cachewm42016-08-261-0/+1
* stream/stream_bluray: display list of available titles on verboseRicardo Constantino2016-08-111-0/+6
* stream: fix double-free if cache init failswm42016-08-081-1/+3
* client API: add stream_cb API for user-defined stream implementationsAman Gupta2016-08-073-0/+128
* tvi_v4l2: fix style in the uninit functionBen Boeckel2016-08-051-4/+6
* tvi_v4l2: explicitly brace the codeBen Boeckel2016-08-051-1/+4
* libarchive: sanitize non-UTF8 archive entrieswm42016-07-181-2/+2
* libarchive: unify entry iteration between stream/demux layerswm42016-07-182-26/+51
* cache: minor simplificationwm42016-07-111-7/+10
* cache: fix previous commitwm42016-07-111-1/+11
* cache: propagate seek failureswm42016-07-111-7/+17
* Fix misspellingsstepshal2016-06-261-1/+1
* build: silence -Wunused-resultNiklas Haas2016-06-071-1/+1
* stream: separate posix/win32 cancellation codewm42016-05-201-27/+55
* cache: simplify speed calculationswm42016-05-121-19/+7
* stream_cdda: enable cache by defaultwm42016-05-101-0/+2
* stream_memory: add hex:// protocolwm42016-04-201-2/+35
* cache: disable useless "Cache is not responding" warningwm42016-04-031-1/+1
* build: make DVB test stricterwm42016-04-021-0/+2
* cache: fix incorrect EOF conditionwm42016-03-291-1/+2
* cache: use a single STREAM_CTRL for various cache infowm42016-03-292-23/+23
* command: add cache-speed propertywm42016-03-202-14/+48
* cache: remove unused STREAM_CTRL_RESUME_CACHEwm42016-03-032-5/+0
* demux: remove relative seekingwm42016-02-281-33/+4
* stream_dvb: fix minor resource leakswm42016-02-121-0/+3
* stream_dvb: remove dead codewm42016-02-121-5/+0
* dvb: fix segmentation fault in case no valid configuration is found.Oliver Freyermuth2016-01-241-2/+3
* dvb: remove trailing whitespacewm42016-01-222-18/+18
* dvb: fix compilation with older Linux headerswm42016-01-221-1/+2
* stream_dvb: add verbose output in non-DVBv5 querying.Oliver Freyermuth2016-01-211-1/+3
* stream_dvb: use DVBv5 API also for DVB-C tuning.Oliver Freyermuth2016-01-211-8/+39
* stream_dvb: improve messages on delivery-type detection.Oliver Freyermuth2016-01-211-10/+14
* stream_dvb: don't requery tuner type, rely on initial query.Oliver Freyermuth2016-01-211-11/+9
* stream_dvb: support frontends with multiple delivery systems.Oliver Freyermuth2016-01-213-59/+122
* Relicense some non-MPlayer source files to LGPL 2.1 or laterwm42016-01-193-21/+22
* cache: add mechanism for disabling readaheadwm42016-01-182-1/+17
* player, stream_dvb: implement dvb-channel-name property.Oliver Freyermuth2016-01-143-1/+37
* stream_dvb: global protection mutex and usage bit for global_dvb_state.Oliver Freyermuth2016-01-142-1/+21
* stream_dvb: implement GET_METADATA and return program name.Oliver Freyermuth2016-01-141-2/+13
* stream_dvb: persist state-information across channel-switches.Oliver Freyermuth2016-01-142-35/+71
* dvb: rename dvb_config_t to dvb_state_t, keep config and state there.Oliver Freyermuth2016-01-143-117/+128
* stream: stream_read_complete() reads from current pos, not 0wm42016-01-121-1/+1
* mpv_talloc.h: rename from talloc.hDmitrij D. Czarkoff2016-01-116-6/+6
* cache: remove useless return valuewm42016-01-111-5/+2
* dvb: cleanup dvb_params struct, remove some unneeded fdsOliver Freyermuth2016-01-073-11/+8
* win32: fix fd://James Ross-Gowan2016-01-071-3/+4
* stream_lavf: remove tabswm42015-12-221-2/+2
* Fix some typos in code commentsAman Gupta2015-12-211-1/+1
* stream: drop PVR supportwm42015-12-102-1619/+0
* stream_libarchive: make libarchive seek callback lazyKevin Mitchell2015-11-091-3/+22
* stream_libarchive: add multivolume supportKevin Mitchell2015-11-092-16/+156
* libarchive: remove redundant log prefixKevin Mitchell2015-11-091-3/+3
* stream/audio: fix unchecked strdupswm42015-10-304-11/+23
* options: add support for client certificate authenticationJoschka Tillmanns2015-10-201-0/+4
* stream: minor cleanup to verbose loggingwm42015-09-302-3/+4
* cache: do not include backbuffer size in total stream cache sizewm42015-09-101-1/+1
* stream_libarchive: read tar only in "unsafe" modewm42015-08-221-2/+4
* stream_libarchive: disable raw filterwm42015-08-201-2/+0
* stream_libarchive: fix libarchive callback signaturewm42015-08-201-1/+1
* stream_libarchive: restrict number of allowed formatswm42015-08-181-2/+11
* stream: provide a stream_get_size() convenience functionwm42015-08-185-11/+17
* demux_libarchive: open flat compressed fileswm42015-08-172-3/+9
* stream: libarchive wrapper for reading compressed archiveswm42015-08-173-0/+274
* stream: remove remaining DVD/BD menu definitionswm42015-08-032-88/+0
* stream_bluray: remove menu implementationwm42015-08-031-358/+11
* stream_dvdnav: rip out lower-level menu implementationwm42015-08-031-255/+7
* win32: revert wchar_t changeswm42015-08-011-1/+1
* win32: more wchar_t -> WCHAR replacementswm42015-07-301-1/+1
* cache: make backbuffer size configurablewm42015-07-221-5/+12
* cache: fix backbuffer logicwm42015-07-221-4/+5
* stream_file: remove an indirectionwm42015-07-101-17/+13
* stream_file: cosmetics: shorten variable namewm42015-07-101-10/+10
* stream_file: initialize `fd`Ben Boeckel2015-07-091-1/+2
* stream_file: add fd:// protocolwm42015-07-091-2/+10
* Disable DVD and BD menu support (to be removed)wm42015-06-262-0/+4
* cache: limit readahead size to half the cache size at the beginningwm42015-05-291-0/+6
* vo_opengl: add support for custom shadersNiklas Haas2015-05-272-0/+16
* command: add protocol-list propertywm42015-05-232-6/+22
* Remove trailing whitespacesMichael Vetter2015-05-151-4/+4
* threads: use utility+POSIX functions instead of weird wrapperswm42015-05-111-3/+6
* path: make mp_path_join accept normal C stringswm42015-05-092-4/+4
* stream: don't print reconnection message if no stream supportwm42015-04-291-3/+5
* cache: exit early on cancellationwm42015-04-211-0/+3
* cache: another minor simplificationwm42015-04-211-11/+5
* cache: simplify the check for printing the "cache stuck" messagewm42015-04-211-16/+6
* command: disc-mouse-on-button propertyxylosper2015-04-213-6/+12
* stream_file: minor simplificationwm42015-04-171-11/+8
* player: allow playing directorieswm42015-04-172-4/+5
* Update license headersMarcin Kurczewski2015-04-1331-159/+127
* stream_rar: update commentwm42015-03-291-4/+2
* stream_lavf: workaround broken rtmp "timeout" optionwm42015-03-191-4/+7
* options: introduce --cache=yes choicewm42015-03-121-0/+2
* stream: use relaxed atomic loads for checking playback abortswm42015-03-091-1/+1
* stream/smb: mark as network stream for --cache=autoKevin Mitchell2015-03-091-0/+1
* options: add M_OPT_FILE to new options that are missing itPhilip Sequeira2015-03-071-1/+1
* cache: assume file size from EOF positionwm42015-03-041-2/+8
* stream_cdda: add option to enable cdtext, and disable it by defaultwm42015-03-031-3/+5
* stream_cdda: fix parameter passingwm42015-03-031-2/+0
* player: refine rar:// playlist-safety handlingwm42015-03-023-6/+2
* stream_dvb: Always define NO_STREAM_ID_FILTER if missing.Oliver Freyermuth2015-02-281-1/+1
* stream: remove stream filter conceptwm42015-02-274-42/+15
* stream_rar: treat rar files as playlistswm42015-02-272-77/+8
* cache: use MPCLAMP() macrowm42015-02-251-9/+2
* cache: limit to file sizewm42015-02-251-1/+8
* stream_file: open pipes non-blockingwm42015-02-201-4/+33
* cache: silence "EOF reached" messagewm42015-02-181-1/+1
* dvb_tune: fix invalid syntaxwm42015-02-111-1/+1
* stream: get rid of remaining uses of the end_pos fieldwm42015-02-067-26/+25
* stream: minor cleanupswm42015-02-064-88/+64
* stream: slightly improve reconnect behaviorwm42015-02-062-18/+29
* stream_lavf: fix build with Libavwm42015-02-061-2/+5
* options: add --network-timeoutwm42015-02-061-0/+3
* stream_cdda: fix bugs in chapter time retrievalwm42015-02-041-2/+2
* command: add dummy get implementation for tv-channel propertywm42015-02-021-0/+1
* stream: reject overly long URLswm42015-01-211-0/+4
* stream_lavf: escape disallowed characters in http URLswm42015-01-212-5/+24
* dvd: try to improve seekingwm42015-01-191-3/+41
* stream_dvb: silence bogus compiler warningwm42015-01-191-1/+1
* cache: cache-position needs to be int64_tOliver Freyermuth2015-01-131-1/+1
* stream_dvb: Add MP_ERR if polling worked, but read fails.Oliver Freyermuth2015-01-131-0/+4
* stream_pvr: uncrustifywm42015-01-061-1306/+1188
* dvb: uncrustifywm42015-01-063-1272/+1261
* stream_dvb: Enable streaming mode, activates cache.Oliver Freyermuth2015-01-061-0/+1
* stream_dvb: Do not add special PIDs if we anyways record the full TP.Oliver Freyermuth2015-01-061-23/+22
* stream_dvb: Add possibility to dump a full transponder.Oliver Freyermuth2015-01-062-4/+11
* stream_dvb: Record PIDs with human-readable content, bump max demuxer count.Oliver Freyermuth2015-01-062-1/+15
* stream_dvb: Also demux PMT if possible, reactivate TPID parsing.Oliver Freyermuth2015-01-064-12/+113
* stream_dvb: Extend token-list for pid-parsing, magically allows to parse VDR-...Oliver Freyermuth2015-01-061-3/+33
* stream_dvb: Move out PID-parsing, disable TPID parsing.Oliver Freyermuth2015-01-061-26/+38
* stream_dvb: Add TPID (teletext-pid) parsing from VDR-style channel-lists.Oliver Freyermuth2015-01-061-23/+28
* stream_dvb: Handle VDR-config location-field as DISEQc-field.Oliver Freyermuth2015-01-061-6/+26
* dvb: Extend understanding of VDR channel config: stream_id, inversion.Oliver Freyermuth2015-01-064-9/+33
* stream_dvb: Very basic vdr-type channels.conf support.Oliver Freyermuth2015-01-061-24/+80
* dvb: Extend dvb_channel struct, needs to know whether channel is S2.Oliver Freyermuth2015-01-063-11/+19
* dvb_tune: (DVB-S) Initial S2API support.Oliver Freyermuth2015-01-061-13/+79
* dvbin: Prepare S2API-implementation, support different DVB-API versions.Oliver Freyermuth2015-01-061-1/+17
* stream_pvr: sort channel list by --tv-channels orderwm42014-12-281-2/+25
* stream: always make stream dumping/capturing append to output filewm42014-12-271-1/+1
* stream_pvr: remove redundant log prefixeswm42014-12-261-103/+82
* stream_pvr: increase timeout, slightly better error reportingwm42014-12-261-5/+10
* stream: always disable cache for pseudo-streamswm42014-12-242-1/+3
* stream_edl: disable cachingwm42014-12-231-0/+1
* dvd: add the last chapterwm42014-12-161-1/+1
* command, dvd: add property which returns list of DVD titleswm42014-12-133-22/+63
* stream_cdda: don't return number of tracks as number of titleswm42014-12-131-5/+0
* dvd: drop last chapterwm42014-12-131-2/+2
* dvd: add an extra chapter at position 0wm42014-12-131-2/+2
* dvd, bd: don't unnecessarily block on demuxer/stream all the timewm42014-12-041-2/+2
* Do not call strerror()wm42014-11-268-75/+81
* Silence some Coverity warningswm42014-11-211-0/+1
* Remove some unneeded NULL checkswm42014-11-211-3/+2
* stream: fix endian swappingwm42014-11-211-2/+2
* stream: reduce ifdeffery for win32 somewhatwm42014-11-182-16/+8
* stream: signal a Windows event object on cancelJames Ross-Gowan2014-11-182-0/+35
* cache: don't relay STREAM_CTRL_AVSEEK if it's unsupportedwm42014-11-011-0/+4
* demux_lavf, stream_lavf: drop local buffers on time-seekswm42014-10-301-1/+3
* demux_lavf: mark as seekable if protocol supports seeking by timewm42014-10-303-0/+9
* Drop libquvi supportwm42014-10-253-334/+0
* tv: remove some differences between immediate/normal modewm42014-10-251-38/+23
* tv: reduce waiting loop from 10ms to 1mswm42014-10-251-2/+2
* stream: fix --stream-dump dropping the file headerwm42014-10-251-10/+12
* stream: remove duplicate messagewm42014-10-251-1/+1
* tv: remove duplicated crapwm42014-10-251-124/+76
* tv: unqueue buffers correctly (maybe, maybe not)wm42014-10-251-5/+7
* stream: stupid compilation workaround for win32wm42014-10-191-1/+1
* Set thread name for debuggingwm42014-10-191-0/+1
* lua: add an utility function for starting processeswm42014-10-192-7/+30
* stream: better error message for unmatched protocolwm42014-10-171-1/+3
* demux_lavf: set stream network options if applicablewm42014-10-142-29/+47
* stream_lavf: expose concat://wm42014-10-141-0/+1
* stream: change internal instead of external pos when dropping bufferswm42014-10-081-0/+1
* stream_dvb: use stream_drop_buffers()wm42014-10-081-2/+1
* stream: don't drop buffers on failed seekswm42014-09-291-6/+2
* cache_file: refuse to cache unseekable streamswm42014-09-291-0/+5
* stream_bluray: autodetect AVCHD directorieswm42014-09-271-3/+4
* stream: change malloc+memset to callocBruno George Moraes2014-09-273-8/+2
* stream_bluray: allow opening BDMV directories directlywm42014-09-262-0/+88
* stream_dvdnav: allow opening DVD directories directlywm42014-09-262-0/+54
* stream_dvd: better .ifo probingwm42014-09-255-21/+66
* Remove mpbswap.hwm42014-09-251-2/+1
* stream_cdda, demux_raw: always use s16lewm42014-09-251-8/+0
* audio: drop swapped-endian audio formatswm42014-09-234-6/+6
* stream: fix build with emulated atomicswm42014-09-131-3/+3
* stream: redo playback abort handlingwm42014-09-137-26/+62
* stream: change cache return valueswm42014-09-072-7/+7
* stream_lavf: assume icy title data is terminated with ';'wm42014-09-061-1/+1
* player: don't allow remote playlists to load local fileswm42014-09-013-4/+11
* player: always load playlistswm42014-08-314-3/+37
* cache_file: add a mode that creates a temporary filewm42014-08-301-1/+2
* stream: correctly propagate uncached stream typewm42014-08-301-1/+1
* Move compat/ and bstr/ directory contents somewhere elsewm42014-08-294-5/+5
* stream: tweaks to network reconnection codewm42014-08-293-3/+6
* tv: initialize frequencies to 0Ben Boeckel2014-08-281-2/+2
* player: redo how stream caching and pausing on low cache workswm42014-08-271-0/+1
* stream_dvb: restore --dvbin-file optionwm42014-08-062-7/+15
* stream_dvb: fix channels.conf preference orderwm42014-08-061-3/+4
* Improve setting AVOptionswm42014-08-021-5/+1
* stream: hack-fix rtmp-level seekingwm42014-07-303-7/+15
* stream_lavf: allow setting AVOptions with --stream-lavf-owm42014-07-301-0/+17
* demux: add a demuxer threadwm42014-07-161-23/+0
* Revert "Remove DVD and Bluray support"wm42014-07-156-0/+2608
* Remove DVD and Bluray supportwm42014-07-146-2608/+0
* stream_dvdnav: suspend read on vts change even if the requested title is not ...Alessandro Ghedini2014-07-131-1/+0
* stream: don't sleep for reconnecting network if playback is stoppedwm42014-07-121-0/+2
* cache_file: fix operation if stream size is unknownwm42014-07-121-2/+3
* Revert "build: avoid defining _GNU_SOURCE"wm42014-07-101-3/+0
* build: include <strings.h> for strcasecmp()wm42014-07-104-0/+4
* build: deal with endian messwm42014-07-101-1/+2
* build: avoid defining _GNU_SOURCEwm42014-07-091-0/+3
* cache, dvd, bluray: simplify stream time handlingwm42014-07-071-42/+16
* stream_dvdnav: more debugging outputwm42014-07-061-2/+5
* stream: remove now unused STREAM_CTRL_GET_START_TIMEwm42014-07-064-19/+0
* tv: move demuxer parts to separate filewm42014-07-052-250/+13
* demux: minor simplification to internal APIwm42014-07-051-3/+3
* dvd, bluray, cdda: add demux_disc containing all related hackswm42014-07-058-24/+7
* demux, stream: change metadata notificationwm42014-07-052-41/+28
* stream_dvdnav: check the length of all titles with dvdnav://longesttholin2014-07-041-1/+1
* stream_dvdnav: free pointer to priv->filename on closetholin2014-07-041-0/+2
* stream_dvdnav: make sure seeking bounds are within rangetholin2014-07-041-1/+5
* cache_file: use unicode on windowswm42014-07-021-0/+2
* cache: clear DVD timestampswm42014-07-021-0/+3
* Audit and replace all ctype.h useswm42014-07-015-7/+4
* options: add --list-protocols optionAlessandro Ghedini2014-06-302-0/+24
* Basic xdg directory implementationKenneth Zhou2014-06-261-12/+7
* stream: add a file cachewm42014-06-223-16/+183
* stream: minor cleanupswm42014-06-223-10/+7
* stream_dvd, stream_dvdnav: map dvd:// to dvdnavwm42014-06-202-3/+3
* stream_dvd: fix potential endless loop on seekingwm42014-06-201-1/+2
* cache: avoid race condition between cache wakeup and idlingwm42014-06-161-0/+1
* tv: if timestamp is unset, return NOPTSwm42014-06-141-4/+4
* tv: remove some non-sensewm42014-06-141-2/+2
* tv: fix compilation without clock_gettime, don't claim to be MPlayerwm42014-06-141-1/+1
* tv: add missing header for clock_gettimewm42014-06-131-0/+1
* cache: print cache size only in verbose modewm42014-06-121-2/+2
* tv: fix a hidden static variablewm42014-06-121-9/+9
* stream_bluray: fix some const declarationswm42014-06-121-6/+6
* tv: use correct timestampsiive2014-06-121-12/+48
* Add more constwm42014-06-1119-31/+31
* stream_dvd: minor cleanupswm42014-06-113-141/+44
* stream_dvd, stream_dvdnav, stream_bluray: remove global option variableswm42014-06-117-67/+61
* stream_dvb: remove global option variableswm42014-06-112-20/+22
* stream_cdda: remove global option variableswm42014-06-113-33/+37
* stream: add a generic way to setup stream priv defaultswm42014-06-112-0/+3
* stream_pvr: remove global option variableswm42014-06-114-188/+84
* tv: remove printing of useless comment informationwm42014-06-114-14/+3
* tv: remove global option variableswm42014-06-115-194/+244
* command: redo ancient TV/DVB/PVR commandswm42014-06-115-10/+113
* stream/cache: handle failure of seeking underlying streamwm42014-06-051-1/+4
* stream: remove VCD supportwm42014-06-016-989/+0
* tv: remove sysinfo() usagewm42014-05-301-10/+0
* af_fmt2bits: change to af_fmt2bps (bytes/sample) where appropriateMarcoen Hirschberg2014-05-281-1/+1
* audio: rename i_bps to 'bitrate' to avoid confusionMarcoen Hirschberg2014-05-281-1/+1
* audio: change values from bytes-per-second to bits-per-secondMarcoen Hirschberg2014-05-281-4/+5
* stream: unbreak writeable streamswm42014-05-271-2/+2
* stream_cdda: fix compilationwm42014-05-241-1/+1
* stream_smb: fix compilationwm42014-05-241-4/+4
* stream_file: readjust some windows ifdefferywm42014-05-241-23/+9
* stream: remove chaos related to writeable streamswm42014-05-2419-83/+41
* stream_lavf: remove redundant message prefixeswm42014-05-241-6/+6
* stream: don't use end_poswm42014-05-2412-69/+67
* stream: kill start_pos, remove --sb optionwm42014-05-249-9/+17
* cache: be silent if no initial fill is requestedwm42014-05-221-1/+3
* cache: redo options and default settingswm42014-05-203-35/+34
* threads: use mpv time for mpthread_cond_timedwait wrapperwm42014-05-181-2/+2
* stream_smb: increase to 128k read_chuuk from default 8kKevin Mitchell2014-05-121-0/+1
* stream_bluray: remove unused variableswm42014-05-041-3/+0
* options: remove deprecated --identifyMartin Herkt2014-05-043-75/+1
* stream: use libavformat interrupt callbackwm42014-04-251-1/+12
* stream: remove interrupt callback global variableswm42014-04-253-28/+8
* stream: use uninterruptible sleep on reconnectingwm42014-04-251-2/+8
* stream: remove unused functionswm42014-04-251-25/+0
* cache: remove redundant log prefixwm42014-04-231-1/+1
* threads: fix function namewm42014-04-231-2/+2
* Fix some libav* include statementswm42014-04-192-2/+1
* stream_dvdnav: print more debugging infowm42014-04-171-1/+6
* stream_dvd: fix seeking regressionwm42014-04-171-8/+48
* Remove radio://wm42014-04-133-1040/+0
* Kill all tabswm42014-04-1323-2382/+2382
* stream_dvd, cache: hack seeking with --cache + dvd:// back into workingwm42014-04-092-41/+1
* cache: fix description of the offset fieldwm42014-04-091-1/+3
* cache: change a define to an enumwm42014-04-091-3/+3
* cache: fix checks/output on initializationwm42014-04-091-8/+3
* stream_file: Check the handle for network streamsJames Ross-Gowan2014-04-091-9/+34
* cache: simplifywm42014-04-091-25/+17
* cache: allow resizing at runtimewm42014-04-092-21/+78
* cache: minor simplificationwm42014-04-091-11/+7
* cache: adjust stream position if necessarywm42014-04-091-1/+6
* cache: no short reads in read_bufferwm42014-04-091-16/+21
* cache: move ringbuffer read into a separate functionwm42014-04-091-17/+32
* cache: fix typo in commentwm42014-04-091-1/+1
* cache: always update cached controls after running a stream controlwm42014-04-091-0/+1
* stream_bluray: move lookup of AACS error codes into a functionwm42014-03-301-30/+16
* stream_bluray: check AACS and BD+ protectionsxylosper2014-03-301-5/+80
* player: rename dvdnav to discnavxylosper2014-03-303-2/+2
* stream_bluray: cosmetic refactoringxylosper2014-03-301-74/+33
* stream_bluray: select initial angle only if peeking title succeededxylosper2014-03-301-39/+52
* stream_bluray: use more proper error code for stream controlxylosper2014-03-301-7/+7
* stream_bluray: implement navigation interface for Blu-ray streamxylosper2014-03-293-62/+447
* stream_bluray: remove BD_EVENT_IDLEwm42014-03-261-3/+0
* stream_bluray: use bd_get_playlist_info()xylosper2014-03-261-4/+10
* stream_bluray: cache current playback informationsxylosper2014-03-261-20/+34
* stream_bluray: implement event handler for libblurayxylosper2014-03-261-0/+16
* mf: fix operation with --cachewm42014-03-261-0/+1
* stream_cdda: print cd text header only if there are any cd text fieldswm42014-03-261-2/+6
* stream_cdda: remove unused stuffwm42014-03-263-251/+2
* stream_cdda: fix track time accuracywm42014-03-261-2/+2
* dvdnav: make MP_NAV_EVENT_RESET_ALL handled properlyxylosper2014-03-251-30/+37
* stream: remove old chapter handling codewm42014-03-255-103/+0
* stream_cdda: report track timeswm42014-03-251-27/+8
* stream_bluray: fix for significant memory leakxylosper2014-03-241-0/+1
* stream_bluray: fix for zero-based title index for Blu-rayxylosper2014-03-181-7/+11
* command: make 'disc-title' property writablexylosper2014-03-181-1/+8
* stream_dvd/stream_dvdnav: make disc-title for DVDs start from 0xylosper2014-03-172-27/+35
* Remove some more unneeded version checkswm42014-03-161-11/+2
* stream_dvdnav: implement STREAM_CTRL_GET_NUM_TITLES for dvdnavxylosper2014-03-151-0/+7
* command: set 'media-title' property for bluray disc with meta-dataxylosper2014-03-135-11/+19
* stream_file: network file system detection for LinuxPhilip Sequeira2014-03-121-0/+28
* dvd: treat missing volume ID as "unsupported", not errorwm42014-02-232-4/+4
* cache: cache DVD volume IDwm42014-02-231-0/+13
* dvd: check for empty DVD volume IDwm42014-02-232-3/+7
* command: use DVD volume ID for media-title propertyxylosper2014-02-233-0/+17
* stream_file: cache remote files on WindowsJames Ross-Gowan2014-02-181-0/+17
* stream_file: activate cache with files on network file systemsStefano Pigozzi2014-02-171-0/+28
* stream_lavf: prefix icy metadata with "icy-"wm42014-02-061-1/+1
* cache: refuse to seek outside of cache boundarieswm42014-01-311-4/+18
* stream_pvr: Fix fd check, -1 indicates invalid, not 0.reimar2014-01-231-1/+1
* stream: print stream_read_line warnings by defaultwm42014-01-191-1/+1
* stream: treat embedded 0 bytes as error in stream_read_linewm42014-01-191-1/+1
* stream: redo stream_read_line()wm42014-01-191-114/+54
* cookies.c: cols must (and does) have 7 elements.reimar2014-01-191-1/+1
* vcd_read: Fix sizeof argument.reimar2014-01-191-1/+1
* cache: remove debug codewm42014-01-171-1/+0
* cache: reduce message spamwm42014-01-161-7/+16
* player: avoid stalling when starting a network streamwm42014-01-142-0/+2
* player: strip 'file://' from filenames on playback startwm42014-01-082-12/+27
* quvi: add option to not fetch subtitlesAndre D2014-01-051-1/+1
* stream_pvr: fix crash on initializationwm42014-01-031-0/+1
* stream: always respect sector_size, fixes cdda://wm42014-01-021-1/+1
* stream_smb: remove dead codewm42013-12-221-22/+1
* stream_radio: suppress error with -Werror=format-security compilation flagMiro Hrončok2013-12-221-1/+1
* stream: minor cookie cleanupwm42013-12-222-26/+23
* options: move network related options to MPOptswm42013-12-223-19/+20
* msg: rename mp_msg_log -> mp_msgwm42013-12-212-4/+4
* path lookup functions: mp_msg conversionswm42013-12-211-3/+0
* quvi: mp_msg conversionswm42013-12-213-17/+30
* stream: mp_msg conversionswm42013-12-2130-721/+539
* demux: mp_msg conversionswm42013-12-2110-209/+217
* m_option, m_config: mp_msg conversionswm42013-12-211-1/+1
* stream: remove stale MAX_STREAM_PROTOCOLS definewm42013-12-191-2/+0
* Reduce recursive config.h inclusions in headerswm42013-12-183-1/+2
* stream: move O_BINARY dummy definitionwm42013-12-181-4/+0
* Remove the _ macrowm42013-12-181-0/+2
* Split mpvcore/ into common/, misc/, bstr/wm42013-12-1731-37/+37
* Merge mp_talloc.h into ta/ta_talloc.hwm42013-12-172-2/+2
* Move options/config related files from mpvcore/ to options/wm42013-12-1717-22/+22
* Move libquvi stuff to stream/resolve/wm42013-12-173-0/+321
* Move mpvcore/input/ to input/wm42013-12-171-1/+1
* Replace mp_tmsg, mp_dbg -> mp_msg, remove mp_gtext(), remove set_osd_tmsgwm42013-12-1617-168/+166
* dvdnav: select longest title by defaultwm42013-12-141-6/+26
* dvdnav: crappy hack to respect timed still frameswm42013-12-142-21/+12
* dvdnav, tv: force-disable cachingwm42013-12-144-4/+5
* dvdnav: enable cachingwm42013-12-141-2/+1
* stream_dvdnav: drop stream buffers on seekwm42013-12-141-3/+5
* cache: add a way to explicitly resume cachewm42013-12-142-0/+5
* cache: try harder on EOFwm42013-12-141-5/+11
* stream: don't seek when seeking to the same positionwm42013-12-141-0/+3
* stream: add function for dropping the bufferwm42013-12-142-2/+11
* dvdnav: remove highlights if no PCI availablewm42013-12-131-1/+3
* Add prelimimary (basic, possibly broken) dvdnav supportwm42013-12-125-0/+807
* stream: fix clang warningStefano Pigozzi2013-12-071-1/+1
* player: load external subs for uncompressed rar archiveswm42013-12-062-0/+13
* Use O_CLOEXEC when creating FDswm42013-11-309-16/+32
* build: make pthreads mandatorywm42013-11-281-6/+1
* Reduce stheader.h includes, move stream types to mp_common.hwm42013-11-234-4/+0
* demux: remove gsh field from sh_audio/sh_video/sh_subwm42013-11-231-6/+6
* stream_lavf: fix a small memory leakwm42013-11-211-1/+5
* timeline: add edl:// URIswm42013-11-193-0/+24
* stream_dvb: remove bogus free callswm42013-11-181-5/+0
* stream: split out pthread helper functionwm42013-11-171-26/+3
* demux: use talloc for certain stream headerswm42013-11-141-1/+1
* tvi_v4l2: remove VBI stuffwm42013-11-131-100/+0
* tvi_v4l2: let libv4l2 convert to a known pixel formatbugmen0t2013-11-131-47/+58
* stream: don't include linux/types.h in some fileswm42013-11-133-4/+0
* Remove sh_audio->samplesizewm42013-11-093-14/+5
* audio: replace af_fmt2str_short -> af_fmt_to_strwm42013-11-071-3/+2
* stream_lavf: don't duplicate list of rtmp protocolswm42013-11-041-6/+4
* stream_lavf: support more libavformat protocolswm42013-11-041-1/+3
* Merge branch 'master' into have_configurewm42013-11-041-5/+11
|\
| * stream: more consistent checks for whether stream is seekablewm42013-11-031-6/+10
| * stream: reconnecting doesn't make sense if stream is not seekablewm42013-11-031-0/+2
* | configure: uniform the defines to #define HAVE_xxx (0|1)Stefano Pigozzi2013-11-037-72/+72
|/
* Fix some more -Wshadow warningswm42013-11-013-4/+4
* Enable -Wshadowwm42013-11-011-3/+3
* ao_alsa: don't include alloca.hwm42013-10-251-1/+0
* tv: simplify ifdefferywm42013-10-171-8/+2
* Copyright, LICENSE: switch to GPL version 2 or laterwm42013-10-131-1/+2
* audio/out: add sndio supportChristian Neukirchen2013-10-033-0/+127
* cosmetics: replace "CTRL" defines by enumswm42013-10-021-25/+27
* network: add options to control TLS verificationwm42013-09-271-0/+3
* mplayer: attempt to make playback resume work with DVD/BDwm42013-09-224-6/+3
* network: fix rtsp playbackwm42013-09-221-1/+1
* stream_lavf: print lavf options that could not be setwm42013-09-221-0/+6
* stream_dvd: prevent segmentation fault with some broken filesStefano Pigozzi2013-09-141-2/+2
* stream_bluray: return number of titleswm42013-09-101-6/+11
* stream: force demuxer of cached stream, fixes cdda:// + cachewm42013-09-101-0/+1
* path: add a common mp_is_url() functionwm42013-09-041-4/+3
* tv: attempt to support mjpeg streamswm42013-09-041-2/+6
* stream: read at least a full buffer with stream_peek()wm42013-08-281-1/+1
* stream: add uncompressed rar supportwm42013-08-265-0/+747
* stream: change open code, add stream filter conceptwm42013-08-262-55/+83
* stream: don't drop buffer when creating the cachewm42013-08-261-3/+0
* stream: fix url_options field, make protocols field not fixed lengthwm42013-08-2617-77/+82
* core: add a playlist demuxerwm42013-08-262-0/+20
* stream: allow potentially faster skippingwm42013-08-221-3/+12
* stream: don't require streams to set s->pos in seek callbackwm42013-08-229-22/+11
* stream: move file forward skipping to common stream implementationwm42013-08-223-52/+29
* stream_avdevice: remove redundant dummy callbackwm42013-08-221-6/+0
* stream_file: uncrustifywm42013-08-221-132/+140
* stream_bluray: fix bd:// url segfault introduced by commit bc1d61Noble Huang2013-08-121-6/+2
* core: move contents to mpvcore (2/2)Stefano Pigozzi2013-08-0628-46/+46
* stream_radio: fix some thingswm42013-08-051-2/+2
* stream: parse URL escapes for file://wm42013-08-024-0/+41
* stream: redo URL parsing, replace m_struct usage with m_configwm42013-08-0219-362/+280
* stream: remove inactive URL option fieldswm42013-07-303-23/+0
* stream_dvd: fix .ifo redirectionwm42013-07-301-2/+1
* Fix some -Wshadow warningswm42013-07-233-8/+5
* stream_vcd.c: fix compilation on win32Diogo Franco (Kovensky)2013-07-222-3/+8
* cache: fix time check for printing warningwm42013-07-201-1/+1
* stream: remove unused vcd functionswm42013-07-154-22/+0
* Merge branch 'remove_old_demuxers'wm42013-07-1421-323/+190
|\
| * demux: remove useless author/comment fieldswm42013-07-121-4/+1
| * stream: remove useless author/comment fieldswm42013-07-1217-58/+19
| * stream: remove unused functionswm42013-07-121-36/+0
| * stream: remove fd memberwm42013-07-128-66/+57
| * stream: use talloc for some string memberswm42013-07-121-7/+7
| * stream: don't require streams to set a typewm42013-07-129-34/+13
| * Cleanup some include statementswm42013-07-1210-16/+8
| * demux: rewrite probing and demuxer initializationwm42013-07-123-3/+7
| * core: change open_stream and demux_open signaturewm42013-07-1217-65/+47
| * demux: change signature of open functions, cleanupswm42013-07-111-19/+15
| * video: eliminate frametime variablewm42013-07-111-2/+0
| * core: don't access demux_stream outside of demux.c, make it privatewm42013-07-111-1/+1
| * tv: add hack in preparation of demux_stream removalwm42013-07-111-4/+17
| * mplayer: fix incorrect audio sync after format changeswm42013-07-111-1/+1
| * Merge branch 'master' into remove_old_demuxerswm42013-07-084-26/+6
| |\
| * | demux: remove separate arrays for audio/video/sub streams, simplifywm42013-07-081-12/+0
| * | demux: remove some old stream header functionswm42013-07-081-2/+4
| * | Remove old demuxerswm42013-07-072-2/+2
* | | w32: silence some warningsJames Ross-Gowan2013-07-131-1/+1
* | | stream_vcd: use intptr_t cast for _open_osfhandle in accordance to MSDNJonathan Yong2013-07-131-1/+1
* | | stream: remove some more forgotten network stuffwm42013-07-121-13/+0
* | | options: add --cache-default optionwm42013-07-102-17/+12
| |/ |/|
* | cache: fix compilation without posix timersStefano Pigozzi2013-07-081-0/+1
* | stream/tv: remove unused dshow-specific optionsMartin Herkt2013-07-082-26/+1
* | stream_radio: fix buildwm42013-07-081-0/+4
|/
* stream: unbreak streams with large sector sizes (stream_cdda)wm42013-07-071-1/+2
* stream: don't treat position 0 speciallywm42013-07-071-7/+6
* Remove some leftovers from network removalwm42013-07-073-182/+1
* stream: remove weird STREAMTYPE_STREAM special handlingwm42013-07-076-50/+27
* stream: re-add accidentally removed seek callwm42013-07-071-0/+7
* Remove internal network supportwm42013-07-0722-5996/+9
* core: make network options available even if old net code is disabledwm42013-07-075-23/+3
* stream: make eof flag more consistentwm42013-07-041-1/+6
* stream_lavf: request and read streamcast/ICY metadatawm42013-07-021-4/+89
* core: update metadata during playback, allow streams to export metadatawm42013-07-022-1/+23
* cache: fix per-block metadata memory leakwm42013-07-021-0/+1
* stream: redo memory streamswm42013-06-283-8/+91
* Merge branch 'sub_mess2'wm42013-06-252-46/+77
|\
| * stream: remove stream_unread_buffer()wm42013-06-252-21/+0
| * stream: add stream_peek functionwm42013-06-252-0/+35
| * stream: never let read functions return values < 0wm42013-06-251-3/+5
| * stream: readd memory streamswm42013-06-252-5/+21
| * stream: remove padding parameter from stream_read_complete()wm42013-06-232-18/+17
* | cache: cache number of chapterswm42013-06-241-0/+10
* | cache: fix stream_pts cachingwm42013-06-181-20/+20
* | osdep: remove shmem wrapperwm42013-06-181-1/+0
* | cache: actually use time instead of retry count for slow cache warningwm42013-06-181-9/+11
|/
* cache: fix build on OSX (again)wm42013-06-161-0/+7
* cache: fix compilation on Libavwm42013-06-161-1/+8
* cache: use correct header for clock_gettimewm42013-06-161-0/+1
* stream: don't set sector size on cachewm42013-06-161-3/+1
* cache: attempt to improve slow cache warningwm42013-06-161-26/+35
* cache: report more precise stream timewm42013-06-161-9/+39
* stream: don't align stream position if not neededwm42013-06-161-3/+1
* stream: don't adjust stream position if seek succeeds, but read failswm42013-06-161-3/+2
* stream: fix some aspects of EOF handlingwm42013-06-161-10/+22
* stream: don't set EOF flag in stream implementationswm42013-06-167-13/+1
* stream: remove stream_reset()wm42013-06-162-12/+3
* stream: check for interruption when trying to reconnect streamwm42013-06-161-3/+3
* stream: cosmeticswm42013-06-162-26/+12
* stream: reset buffer even on EOF/errorwm42013-06-161-4/+2
* cache: use threads instead of fork()wm42013-06-163-542/+403
* stream: add partial read functionwm42013-06-162-17/+28
* stream: add stream_unread_buffer()wm42013-06-162-4/+33
* cache: make the stream cache a proper stream that wraps other streamswm42013-06-165-331/+220
* stream: remove pointless checkwm42013-06-091-7/+3
* stream: remove unused functionwm42013-06-091-9/+0
* stream: move VCD specific stuff to stream_vcdwm42013-06-093-5/+4
* stream_cdda, stream_vcd: check read buffer sizewm42013-06-092-0/+5
* stream_dvd: remove some deadly insane codewm42013-06-091-15/+0
* stream: misleading statementwm42013-06-091-1/+1
* core: use STREAM_CTRL instead of accessing stream_dvd internalswm42013-06-093-0/+24
* stream: rename cache2.c to cache.cwm42013-06-091-0/+0
* cache2: uncrustifywm42013-06-091-452/+521
* demux: fix "-demuxer mpegps", don't force demuxer in stream_dvdwm42013-06-021-1/+0
* stream: kill STREAM_CTRL_RESETwm42013-05-262-4/+0
* stream: kill memory streamswm42013-05-262-23/+3
* stream: de-inline some larger functionswm42013-05-262-70/+73
* Replace calls to usec_sleep()wm42013-05-262-4/+4
* Replace all calls to GetTimer()/GetTimerMS()wm42013-05-262-4/+4
* Silence some compiler warningswm42013-05-211-8/+7
* core: add --stream-capturewm42013-05-123-0/+41
* Merge branch 'audio_changes'wm42013-05-121-4/+6
|\
| * core: use channel map on demuxer level toowm42013-05-121-4/+6
* | stream_bluray: report chapter timeswm42013-05-091-0/+21
* | stream_bluray: general timeline supportwm42013-05-091-0/+37
* | stream_bluray: make code a bit more obviouswm42013-05-091-4/+4
* | stream: report chapter times, use time seeks for DVD chapterswm42013-05-063-6/+41
* | Fix some cppcheck / scan-build warningswm42013-05-065-32/+5
* | stream: fix bad cache behavior introduced by recent commitwm42013-05-051-1/+8
* | stream: add start time reportingwm42013-05-053-0/+9
* | core: don't report byte-based playback position with dvdwm42013-05-054-0/+17
* | stream: remove unused new_ds_stream()wm42013-05-032-13/+0
* | stream_bluray: remove the broken -bluray-chapter optionreimar2013-04-272-16/+2
* | stream_bluray: fix querying current chapterreimar2013-04-271-3/+1
* | options: untangle track range parsing for stream_cddawm42013-04-211-17/+14
|/
* stream_cddb: fix compilation on MinGW-w64Stephen Hutchinson2013-04-061-1/+1
* vcd_read_win32.h: fix compilation on MinGW-w64Stephen Hutchinson2013-04-061-1/+1
* http: handle broken QuickTime Streaming Server headersreimar2013-04-041-3/+9
* http: fix for broken SHOUTcast streamsreimar2013-04-041-0/+6
* vcd_read: cleanup ifdefsreimar2013-04-041-14/+7
* stream: silence clang empty statement warningswm42013-03-191-12/+8
* network: set default user-agent to MPlayer'swm42013-02-261-1/+1
* core: redo how codecs are mapped, remove codecs.confwm42013-02-101-6/+4
* Check return values of some mp_find_..._config_file function calls for NULLwm42013-02-091-2/+5
* Remove BSD legacy TV/radio support (BT848 stuff)wm42013-02-064-1053/+0
* build: make it work on somewhat older ffmpeg versionswm42013-01-311-1/+1
* stream: set default HTTP user agent to "Mozilla/5.0"wm42013-01-311-1/+1
* stream: fix reconnecting on broken network connectionswm42013-01-243-21/+50
* stream: uncrustify stream.c/.hwm42013-01-242-582/+664
* stream: implement some HTTP specific options for stream_lavfwm42013-01-247-7/+61
* cookies: fix crashwm42013-01-241-3/+3
* stream_cdda: support latest libcdio versionUoti Urpala2013-01-241-1/+31
* Silence two compiler warningswm42013-01-161-3/+2
* video: decouple internal pixel formats from FourCCswm42013-01-135-84/+84
* Remove netstream supportwm42013-01-133-472/+0
* Fix lots of bugs in mp_http URL handlingRudolf Polzer2013-01-102-7/+10
* stream_lavf: warn if protocol not foundwm42012-12-281-1/+6
* stream_dvd: fix angle mathRudolf Polzer2012-12-221-8/+7
* path: add mp_find_config_file and reorganize some of the codeStefano Pigozzi2012-12-152-30/+39
* Fix compilation with Libavwm42012-12-111-0/+2
* audio: remove support for native alaw/mulaw/adpcm outputwm42012-12-111-3/+0
* stream_lavf/demux_lavf: export/use HTTP MIME typewm42012-12-113-15/+17
* stream: handle mms streaming with ffmpegwm42012-12-113-14/+23
* stream_dvd: add a stream_seek() callRudolf Polzer2012-12-071-0/+2
* stream_ftp: cleanupsal2012-12-031-19/+13
* core: automatically pause on low cachewm42012-12-032-1/+9
* stream_lavf: use ffmpeg for http/https streamingwm42012-12-032-3/+5
* cache: simplify furtherwm42012-12-038-34/+28
* cache: refactor how cache enabling is doneUoti Urpala2012-12-038-27/+24
* demux_lavf: add support for libavdevicewm42012-12-033-0/+52
* stream_ftp: fix compilation with libavStefano Pigozzi2012-11-221-1/+1
* stream_ftp: support longer filenamesal2012-11-211-31/+73
* stream: fix dvd:// + cache crashingwm42012-11-203-3/+5
* stream, demux_lavf: minor cleanup for stream size codewm42012-11-202-0/+10
* stream, demux: replace off_t with int64_twm42012-11-2017-48/+48
* stream: change STREAM_CTRL_GET_SIZE argument type to uint64_treimar2012-11-204-4/+13
* asf_streaming: remove broken MMSU support codeupsuper2012-11-201-15/+3
* Fix potential bugs and issues, general cleanupsreimar2012-11-209-89/+87
* cookies: don't read cookie files from ancient browserswm42012-11-161-42/+3
* network: fix crash with -playlist http://...wm42012-11-141-0/+2
* Rename directories, move files (step 2 of 2)wm42012-11-1245-109/+108
* Rename directories, move files (step 1 of 2) (does not compile)wm42012-11-121-0/+0
* stream: open_stream_plugin() should set error code on failurewm42012-11-011-0/+1
* http: fix potential NULL pointer issuewm42012-11-011-10/+9
* http: fix potential NULL pointer issuewm42012-11-011-1/+4
* cookies: replace sprintf with snprintfreimar2012-10-311-5/+7
* stream_cddb: replace sprintf with snprintfreimar2012-10-311-12/+14
* cleanup: remove references to CONFIG_TV_DSHOWwm42012-10-301-8/+1
* stream: fix redirection for proxy URLsreimar2012-10-303-15/+55
* url: simplifycboesch2012-10-303-25/+43
* stream: add STREAM_CTRL_GET_CURRENT_TITLEib2012-10-304-0/+14
* cache: enable STREAM_CTRL_GET_NUM_TITLESib2012-10-301-0/+3
* cache: fix long hangsreimar2012-10-301-1/+1
* stream_file: explicitly signal EOFreimar2012-10-301-0/+2
* stream_ftp: fix double free in one error caseUoti Urpala2012-10-301-1/+0
* stream_ffmpeg: handle rtsp:// URLs by default, add lavf://Uoti Urpala2012-10-282-17/+23
* stream: remove NULL checks for open callswm42012-10-141-13/+3
* core: show quvi page title in window title, clean up libquvi handlingwm42012-10-142-132/+24
* Rename to "mpv"wm42012-10-121-1/+1
* core, timeline: cache external ordered chapter files tooStefano Pigozzi2012-09-184-7/+17
* bluray: add bd:// as stream prefixwm42012-09-181-1/+1
* core: fix DVD subtitle selectionwm42012-09-183-10/+5
* libaf: rename af_format.h to format.hwm42012-08-293-3/+3
* Adjust ffmpeg/libav #includes to work with recent upstream changesUoti Urpala2012-08-211-3/+4
* Remove support for libnemesi RTSP streamingwm42012-08-202-83/+0
* Remove support for LIVE555 RTSP streamingwm42012-08-204-146/+0
* libmpdemux: remove demux_real, demux_viv, demux_audiowm42012-08-202-2/+2
* Remove dvdnav support (DVD menus)wm42012-08-164-1085/+0
* Remove win32/qt/xanim/real binary codecs loadingwm42012-08-162-4242/+0
* stream_file: print strerror() when failing to open a fileUoti Urpala2012-08-161-1/+3
* win32: fix compilation on MinGWwm42012-08-071-9/+9
* options: get rid of ambiguous option parsingwm42012-08-051-1/+1
* mplayer, stream_tv: move variable initializationwm42012-08-031-1/+1
* tv: reduce code duplicationmplayer-svn2012-08-031-21/+14
* stream_pvr: fix buffer overflowmplayer-svn2012-08-031-16/+13
* stream: detect prematurely closed connectionmplayer-svn2012-08-031-1/+2
* stream: retry reconnecting several timesmplayer-svn2012-08-031-8/+22
* commands, dvd, dvdnav, bluray: cleanup sub/audio track language displaymplayer-svn2012-08-037-23/+99
* cache2: allow cache sizes up to 4 TBmplayer-svn2012-08-032-29/+30
* stream: add new stream control command STREAM_CTRL_GET_NUM_TITLESmplayer-svn2012-08-034-0/+12
* cache2: flush cache and sync stream position/eof after seeking STREAM_CTRLsmplayer-svn2012-08-031-10/+33
* stream/http: add a test file for ultravox in commentmplayer-svn2012-08-031-0/+3
* cache2: make cache process exit when main process diesmplayer-svn2012-08-031-0/+13
* Replace 'q' printf length modifier by 'll'mplayer-svn2012-08-031-1/+1
* cache2: make warnings easier to understandmplayer-svn2012-08-031-2/+2
* Remove teletext supportwm42012-08-035-128/+18
* stream: remove V4L TV input and V4L radio supportwm42012-08-023-2072/+0
* mplayer: rip out --capture supportwm42012-08-023-20/+0
* stream: remove stream_cuewm42012-08-022-643/+0
* stream: remove native RTSP/RTP/PNM supportwm42012-08-0130-10376/+2
* Change <endian.h> include to <sys/types.h>wm42012-07-311-1/+1
* Remove some demuxers and decoderswm42012-07-301-21/+0
* Remove compile time/runtime CPU detection, and drop some platformswm42012-07-301-1/+2
* bstr: rename bstr() function to bstr0(), and typedef bstr to struct bstrwm42012-07-281-1/+1
* Add support for playing video from streaming sites with libquviwm42012-07-281-2/+69
* Merge remote-tracking branch 'origin/master'wm42012-07-281-2/+2
|\
| * demux, vd_ffmpeg: fix demux keyframe flag, set AV_PKT_FLAG_KEYUoti Urpala2012-07-251-2/+2
* | Merge remote-tracking branch 'origin/master'wm42012-04-291-1/+1
|\|
| * stream_cdda: print CDTEXT if availablewm42012-04-281-17/+51
| * configure, stream_cdda: remove libcdparanoia supportwm42012-04-281-59/+11
| * cosmetics: stream_cdda.c: reformatwm42012-04-281-359/+368
| * stream_cdda: various fixesreimar2012-04-281-10/+28
| * stream_ffmpeg: fix broken line from 30afc64532ff61Uoti Urpala2012-04-181-1/+1
* | Merge remote-tracking branch 'origin/master'wm42012-04-281-1/+1
|\|
| * stream_pvr: fix field size / snprintf size mismatchUoti Urpala2012-04-111-1/+1
* | Merge remote-tracking branch 'origin/master'wm42012-04-134-340/+1
|\|
| * build: remove OS/2 supportUoti Urpala2012-04-064-340/+1
* | stream_cdda: print CDTEXT if availablewm42012-04-011-17/+51
* | configure, stream_cdda: remove libcdparanoia supportwm42012-04-011-59/+11
* | stream_cdda: reformatwm42012-04-011-359/+368
* | stream_cdda: various fixesreimar2012-04-011-10/+28
* | Merge remote-tracking branch 'origin/master'wm42012-04-011-2/+3
|\|
| * stream_vstream: fix vstream_error format stringUoti Urpala2012-04-011-2/+3
* | Merge remote-tracking branch 'origin/master' into my_masterwm42012-03-164-7/+9
|\|
| * windows support: unicode filenameswm42012-03-093-7/+7
| * cleanup: Silence compilation warnings on MinGW-w64wm42012-03-011-0/+2
* | Merge remote-tracking branch 'origin/master' into my_masterwm42012-03-0510-207/+31
|\|
| * configure, ao_alsa: drop support for obsolete ALSA versionsUoti Urpala2012-02-271-184/+0
| * build: switch to libavutil bswap.h and intreadwrite.hUoti Urpala2012-02-018-21/+29
| * Update Libav API usesUoti Urpala2012-02-011-2/+2
* | stream: refuse to open directorieswm42012-02-191-0/+9
|/
* stream_vcd: fix option value allocated with strdupUoti Urpala2012-01-161-2/+4
* stream_ffmpeg: switch to libavformat avio APIUoti Urpala2012-01-021-19/+31
* configure, build: require at least Libav 0.7Uoti Urpala2011-12-222-6/+0
* configure, build: remove --disable-libav supportUoti Urpala2011-12-112-4/+0
* stream_cdda: fix incorrectly allocated option fieldUoti Urpala2011-07-301-3/+5
* options: change option parsing to use bstrUoti Urpala2011-07-291-1/+1
* options: indicate ambiguous option parameters explicitlyUoti Urpala2011-07-291-1/+1
* cleanup: do libav* initialization on startupUoti Urpala2011-07-181-1/+0
* stream_bluray: switch to new libbluray APIRico Tzschichholz2011-07-101-7/+7
* cleanup: silence most of the clang warningsClément Bœsch2011-07-091-3/+4
* stream.c: make reconnect checks more robustreimar2011-07-061-14/+21
* stream.c: Pass streaming_ctrl eof on to struct stream fieldreimar2011-07-061-0/+2
* stream/network: don't clobber buffer byte counts on errorreimar2011-07-061-0/+1
* stream/network: distinguish EOF/error in streaming control APIreimar2011-07-061-1/+2
* cache: don't modify argument when stream control failsreimar2011-07-061-2/+3
* stream/tvi_v4l[2]: fix calculation of free RAM for buffersiive2011-07-062-16/+10
* cleanup: tvi_dshow: add "static", fix printf formatdiego2011-07-061-9/+16
* cache: allow STREAM_CTRL_GET_CURRENT_TIME with cachereimar2011-07-061-3/+12
* cosmetics: cache2.c: Fix commentreimar2011-07-061-2/+2
* cosmetics: stream_dvdnav.c: Remove pointless ()reimar2011-07-061-9/+9
* stream_dvd: fix dvd_get_current_time()reimar2011-07-061-5/+5
* stream_pvr: Replace <sys/fcntl.h> include by <fcntl.h>reimar2011-07-061-1/+1
* stream_cdda: work around libcdparanoia caching issuesreimar2011-07-061-0/+3
* stream: show negative seek position value in error messagereimar2011-07-061-1/+2
* stream_cue: Avoid probing empty filename in cue_find_bin()iive2011-07-061-0/+3
* stream_cue: fix multiple bugsreimar2011-07-061-24/+25
* Merge branch 'mplayer1_changes'Uoti Urpala2011-06-297-14/+22
|\
| * stream.c: make some stream messages translatableib2011-06-291-6/+7
| * Windows: stream_cddb.c: include <path.h> for MinGWvayne2011-06-291-0/+1
| * cleanup: Make vcd_seek_to_track() static in more filesreimar2011-06-294-4/+4
| * cache2.c: Avoid warnings about discarding volatilereimar2011-06-291-4/+10
* | stream/tvi_v4l2: Add V4L2 support for OpenBSD (and NetBSD)Uoti Urpala2011-06-291-0/+4
|/
* cleanup: shut up more warningsClément Bœsch2011-05-067-18/+15
* cleanup: remove more warningsClément Bœsch2011-05-026-7/+6
* Merge branch 'mplayer1_changes'Uoti Urpala2011-05-028-9/+76
|\
| * cache: call stream read with at least sector size spacereimar2011-05-011-2/+18
| * stream: http: Allow setting custom http headercehoyos2011-04-132-0/+9
| * stream_dvdnav: output ID_DVD_VOLUME_ID also for dvdnav://cehoyos2011-04-131-1/+1
| * stream_dvdnav: identify: show more title informationcehoyos2011-04-121-0/+3
| * stream: try to reset stream once if read failsreimar2011-04-121-1/+21
| * stream_dvdnav: don't skip last title for dvdnav:// -identifycehoyos2011-04-121-1/+1
| * stream: Make stream_write_buffer() check for short writesranma2011-04-124-4/+23
* | cleanup: avoid various GCC warningsClément Bœsch2011-04-202-2/+1
* | options: change -alang and -slang to use string list typeClément Bœsch2011-04-204-28/+19
* | stream.[ch], ass_mp: new stream function for whole-file readsUoti Urpala2011-03-032-0/+44
* | cleanup: demuxer.[ch]: remove unused code, make functions staticUoti Urpala2011-02-221-0/+3
|/
* stream/url.c: escape characters >= 127 in URLsreimar2011-02-151-2/+1
* terminal output: show cache fill changes in "PAUSED" messagereimar2011-02-152-5/+9
* fix compilation with old FFmpeg versionsUoti Urpala2011-02-082-0/+11
* cache: suggest increasing cache size in the "not filling!" messagereimar2011-01-311-1/+1
* stream/http: assume MakeMKV webservers always support rangesreimar2011-01-311-2/+6
* stream/tvi_v4l2.c: simplify by using getfps helper functionreimar2011-01-311-9/+2
* cleanup: Replace two malloc+memset with calloc.cboesch2011-01-292-6/+2
* stream/http: support 307 (Temporary Redirect) responsescboesch2011-01-291-0/+2
* Merge branch 'sub'Uoti Urpala2011-01-261-1/+1
|\
| * sub/OSD: move some related files to sub/Uoti Urpala2011-01-261-1/+1
* | cleanup: remove unused MEncoder-related codeClément Bœsch2011-01-251-1/+0
|/
* stream.h: check against huge negative values in stream_seek()reimar2010-12-161-0/+4
* stream/http: Add support for login/password in http_proxy env variablecboesch2010-12-163-3/+19
* stream/: delete base64_encode(), use libavutil av_base64_encode()cboesch2010-12-163-74/+13
* stream/network.c, stream/http.c: cleanupcboesch2010-12-162-13/+4
* stream/http: Do not keep authentication in URL when proxiedcboesch2010-12-163-2/+24
* stream/http: Add Proxy-Authorization header to authenticate on proxiescboesch2010-12-163-4/+19
* stream/http: don't use proxy values for "Authorization" headercboesch2010-12-161-1/+1
* cleanup: remove NULL checks before free() all over the codecboesch2010-11-147-35/+23
* stream/url.c: Unescape username/password when parsing URLsreimar2010-11-141-1/+4
* cache: read up to 64 KiB at once from stream_filereimar2010-11-143-1/+7
* stream/network.c: Replace hardcoded str size with sizeofcboesch2010-11-141-5/+5
* options: move some demux options to option structClément Bœsch2010-11-111-1/+0
* cleanup: don't check for NULL before free()diego2010-11-0817-127/+78
* stream_dvd: fill_buffer(): use given buffer, not stream's defaultreimar2010-11-081-2/+5
* stream_dvd: minor cleanupreimar2010-11-081-7/+4
* cache, stream: avoid extra memcpy when using cachereimar2010-11-073-38/+59
* cosmetics: cache2.c: Remove some irrelevant commented-out codereimar2010-11-071-8/+1
* stream_dvd: millisecond accuracy for chapters in -identify outputcigaes2010-11-071-3/+2
* Add a simple capture feature (-capture)Uoti Urpala2010-11-023-0/+22
* stream_network: Fix possible crash for invalid http_proxy URLsreimar2010-11-021-0/+4
* rtsp_rtp.c: Add missing avstring include for av_strlcpyreimar2010-11-021-0/+1
* rtsp_rtp.c: Replace snprintf by av_strlcpyreimar2010-11-021-1/+1
* Remove #warning preprocessor directivesdiego2010-11-021-1/+0
* Remove remaining %lf printf conversionsreimar2010-11-022-5/+5
* build: enable/disable all FFmpeg libraries togetherUoti Urpala2010-11-022-2/+2
* stream/tv: move new_handle() function from header to tv.cdiego2010-11-028-29/+31
* tvi_def.h: sizeof(type) -> sizeof(*ptr)diego2010-11-021-1/+1
* cosmetics: Remove vim/emacs coding style hints from sourcesdiego2010-11-021-4/+0
* cleanup: malloc+memset->calloc, sizeof(TYPE)->sizeof(*ptr)reimar2010-11-022-3/+3
* stream/tv: move free_handle() from header to tv.cdiego2010-11-026-18/+20
* cache: Remove unused cache_stats functiondiego2010-11-021-10/+0
* cache: Move cache_fill_status extern declaration to cache2.hdiego2010-11-021-0/+2
* stream/http.c: Move mime_type_table extern declaration to network.hdiego2010-11-022-1/+2
* stream: make stream_read_line() terminate line on EOFreimar2010-11-021-1/+1
* stream_file: Simplify and document MinGW stdin hackreimar2010-11-021-3/+4
* stream_dvd[nav]: Add const qualifiers to string argumentsreimar2010-11-024-8/+8
* Simplify code: make open_stream() accept NULL file_format argumentreimar2010-11-021-0/+2
* printf format fixes ("%d" -> "%zd")diego2010-11-022-2/+2
* cache: add sanity-check for sector sizereimar2010-11-022-2/+9
* spelling fixessiretart2010-11-025-9/+9
* cache: Don't mess up current position if time-based seek failsreimar2010-11-021-1/+2
* stream_dvd: Improve seeking by positiondiego2010-11-021-15/+8
* stream_dvd: Improve seeking by chaptersdiego2010-11-021-5/+12
* stream_dvd: fix incorrect assumption about chapter countdiego2010-11-021-10/+38
* stream_dvb.c: avoid compiler warning by adding initializationdiego2010-11-021-0/+1
* configure: Rename "network" variable and option to "networking"diego2010-11-022-6/+6
* cache: Use sigaction() instead of signal()reimar2010-11-021-3/+6
* stream.c: add <libavutil/common.h> include needed for GET_UTF16reimar2010-11-021-0/+2
* stream_bluray: implement slave mode compatible controlsben2010-11-021-6/+119
* stream_bluray: add unencrypted Blu-ray playbackben2010-11-023-0/+244
* Factorize MPlayer/MEncoder version string handling.diego2010-11-022-10/+6
* stream: Use MSG_NOSIGNAL flag if available for send().reimar2010-11-027-8/+15
* stream/dvbin.h: Use angular brackets for system #includes.diego2010-11-021-2/+1
* stream_cddb: move structs to the file they're used indiego2010-11-022-18/+18
* stream_cdda: change printf format for cdda_tracks to %ddiego2010-11-021-1/+1
* stream_cdda.c: Reorder functions to avoid forward declarations.diego2010-11-021-110/+106
* stream_cdd*: Move declarations for stream_cddb.c functions to cdd.hdiego2010-11-022-4/+4
* stream_cddb: Remove unused static functionsdiego2010-11-021-31/+0
* stream_ccda: Move cdda_priv structure to the only place it is useddiego2010-11-022-23/+21
* stream/tcp.c: Prefer the use of inet_ntop over inet_ntoaattila2010-11-021-3/+3
* stream.h: support backswards stream_skip() within bufferreimar2010-11-021-1/+1
* tv.h: Change function pointer types to proper declarationsreimar2010-11-026-13/+16
* cache: Respect -cache-seek-min also for on-disk filesreimar2010-11-021-3/+5
* Merge svn changes up to r31291Uoti Urpala2010-06-021-0/+18
|\
| * Add a referrer option to set the HTTP Referer field.reimar2010-05-301-0/+18
| * misc cosmetics: K&R style nits, #include placement, indentationdiego2010-05-291-1/+1
* | stream_radio.c: fix corrupt line from e3061749Uoti Urpala2010-06-021-1/+1
* | Merge svn changes up to r31256Uoti Urpala2010-05-303-6/+38
|\|
| * Fix typo in message.reimar2010-05-281-1/+1
| * stream_check_interrupt should sleep even if no callback is set.reimar2010-05-281-1/+4
| * 100l, stream_check_for_interrupt argument is not in usec,reimar2010-05-281-3/+3
| * Document time scale for stream_check_interrupt argument.reimar2010-05-281-1/+2
| * Improve handling of cache process/thread hanging/being killed.reimar2010-05-281-3/+23
| * Fix cache process accidentally being killed by SIGUSR1.reimar2010-05-281-0/+7
* | Merge svn changes up to r31244Uoti Urpala2010-05-301-6/+6
|\|
| * Fix a bunch of typos in the stream cache code.diego2010-05-271-6/+6
| * Drop pointless _st suffix from 'struct stream'.diego2010-05-276-29/+29
* | Merge svn changes up to r31226Uoti Urpala2010-05-302-4/+15
|\|
| * Retry reading even if we hit eof before.reimar2010-05-262-3/+6
| * Re-enable wakeup-on-signal for cache process.reimar2010-05-261-5/+10
| * Disable waking the cache process up via a signal, itreimar2010-05-261-1/+4
| * Add support for STREAM_CTRL_SEEK_TO_TIME in ffmpeg streamshyc2010-05-251-1/+10
* | Merge svn changes up to r31211Uoti Urpala2010-05-301-45/+78
|\|
| * Slightly reduce number of #ifsreimar2010-05-231-22/+20
| * Use an extra define to simplify ifdefsreimar2010-05-231-14/+20
| * Try reducing the #ifdef mess for the different cache variants.reimar2010-05-231-15/+13
| * Extract the cache main loop into a separate function.reimar2010-05-231-14/+19
| * Optimize cache behaviour for the many-consecutive-seeks case.reimar2010-05-231-1/+13
| * Add code to wake up cache process when e.g. a seek is needed.reimar2010-05-231-0/+14
* | cosmetics: "struct vf_instance* vf" -> "struct vf_instance *vf"Uoti Urpala2010-05-293-7/+13
* | stream.h: remove bad EOF check in stream_seek()Uoti Urpala2010-05-221-2/+0
* | Merge svn changes up to r31033Uoti Urpala2010-04-267-3/+26
|\|
| * Do not print the "Loading cookie file" message twice.reimar2010-04-051-2/+0
| * Try to fix VCD compilation on non-Linux systems.reimar2010-04-056-1/+26
* | Merge svn changes up to r31020Uoti Urpala2010-04-261-0/+35
|\|
| * Export VCD tracks as chapters, just like for cue:// URLs.reimar2010-04-051-0/+35
* | Merge svn changes up to r31004Uoti Urpala2010-04-262-3/+6
|\|
| * Remove commented-out #include of a non-existing file.diego2010-04-031-2/+0
| * Change type to uint8_t to avoid checks depending on char signedness.reimar2010-04-021-1/+1
| * Sanitize ICY metadata a bit before printing it.reimar2010-03-311-0/+5
* | Merge svn changes up to r30967Uoti Urpala2010-04-262-2/+5
|\|
| * Make http_read_response fail if parsing the response failed.reimar2010-03-231-1/+4
| * Rename get_path.[ch] --> path.[ch].diego2010-03-201-1/+1
* | options: move -chapter values to option structUoti Urpala2010-04-255-45/+3
* | demux_lavf, stream_ffmpeg: support librtmp seeksUoti Urpala2010-04-231-1/+10
* | stream_ffmpeg, demux_lavf: Use flv demuxer for rtmp streamsUoti Urpala2010-04-232-0/+8
* | stream_ffmpeg.c: change reads back to url_read_complete()Uoti Urpala2010-04-231-1/+1
* | Delete things related to old translation systemUoti Urpala2010-03-1034-35/+0
* | Merge svn changes up to r30876Uoti Urpala2010-03-104-10/+5
|\|
| * Define O_BINARY in stream/stream.h unless it is defined yet, and use itkomh2010-03-064-10/+5
* | Merge svn changes up to r30848Uoti Urpala2010-03-106-324/+263
|\|
| * Define HAVE_SETMODE conditionally, and use it in stream/stream_file.c insteadkomh2010-03-041-4/+4
| * Add a VCD support for OS/2komh2010-03-032-0/+254
| * Drop support for old-style DVB code.diego2010-03-023-320/+5
* | Merge svn changes up to r30815Uoti Urpala2010-03-103-102/+217
|\|
| * Remove unused and useless define.reimar2010-03-011-1/+0
| * Fix memleak due to strdup'd filename not being freed.reimar2010-03-011-0/+2
| * Move functions into proper order to avoid extra declarations.reimar2010-03-011-15/+12
| * Deduplicate code to set stream start_pos/end_pos.reimar2010-03-011-12/+15
| * Set stream->pos correctly after seeking to a VCD title.reimar2010-03-011-0/+1
| * Ensure that cue_current_pos.track is not set to an invalid value afterreimar2010-03-011-8/+5
| * Fix off-by-one error in chapter<->VCD track conversion.reimar2010-03-011-2/+2
| * Fix cue_read_toc_entry to also reject negative track numbersreimar2010-03-011-1/+1
| * Implement cue:// track switching via chapter forward/backward like for audio ...reimar2010-03-011-0/+28
| * Fix cue_vcd_get_track_end to not change the current position.reimar2010-03-011-4/+3
| * Avoid fd_bin and fd_cue global variables.reimar2010-03-011-9/+9
| * Avoid a global variable and a strcpy.reimar2010-03-011-6/+2
| * Reindent.reimar2010-03-011-19/+19
| * Avoid code duplication and excessively deep nesting in cue_find_binreimar2010-03-011-37/+32
| * Use sizeof instead of hardcoded size.reimar2010-03-011-2/+2
| * Extend stream_read_line to support reading lines from UTF-16 encoded filesreimar2010-02-282-6/+102
* | Merge svn changes up to r30798Uoti Urpala2010-03-109-104/+114
|\|
| * Move stream_read_line implementation from stream.h to stream.c,reimar2010-02-282-26/+27
| * Simplify handling of 0-termination in stream_read_linereimar2010-02-281-3/+5
| * Remove useless cast.reimar2010-02-281-1/+1
| * Add cddb:// support for OS/2komh2010-02-281-0/+74
| * Fix warning "missing braces around initializer".cehoyos2010-02-271-0/+2
| * Remove unused functions.cehoyos2010-02-271-60/+0
| * Fix cd_info_new() prototype.cehoyos2010-02-271-1/+1
| * Threaded cache fixes: do not free the stream_t struct twice on windowsreimar2010-02-271-8/+6
| * Remove unused static function streaming_stop().cehoyos2010-02-271-6/+0
| * Restructure #ifs to be clearer, also ensures that we return from the threadreimar2010-02-271-3/+3
* | Merge svn changes up to r30748Uoti Urpala2010-03-108-47/+47
|\|
| * Do not cast the results of malloc/calloc/realloc.diego2010-02-264-18/+16
| * Mark stream open filename parameter as const, the filename string is notreimar2010-02-253-7/+7
| * Remove unused function declaration.reimar2010-02-251-2/+0
| * Make local-only cddb functions static.reimar2010-02-251-19/+19
| * Remove declarations of functions now already declared in stream.hreimar2010-02-251-3/+0
* | Merge svn changes up to r30732Uoti Urpala2010-03-105-13/+13
|\|
| * Define O_BINARY if it is undefined.komh2010-02-251-5/+5
| * Mark vcd_get_track_end () and vcd_read_toc() as static.diego2010-02-224-8/+8
* | Merge svn changes up to r30702Uoti Urpala2010-03-103-29/+30
|\|
| * Declare functions from network.c in network.h.diego2010-02-223-3/+3
| * Move struct streaming_control from network.h to stream.h, where it is used.diego2010-02-222-22/+24
| * Remove commented-out declaration of non-existing function streaming_start.diego2010-02-221-1/+0
* | Merge svn changes up to r30694Uoti Urpala2010-03-106-138/+187
|\|
| * Declare stream_fill_buffer() and stream_seek_long() unconditionally.diego2010-02-211-2/+3
| * Add header for asf_mmst_streaming_start() instead of forward declaring it.diego2010-02-213-3/+28
| * Add header for exported DVB-related functions.diego2010-02-212-0/+38
| * cosmetics: Move functions around to avoid forward declarations and #ifdefs.diego2010-02-211-134/+119
| * cosmetics: Remove pointless empty lines at EOF.diego2010-02-205-5/+0
* | Merge svn changes up to r30672Uoti Urpala2010-03-105-741/+780
|\|
| * cosmetics: K&R coding style, indent with 4 spaces, no tabsdiego2010-02-201-733/+776
| * Print response headers as debugging output also for HTTP seeks.reimar2010-02-201-0/+3
| * 10l, fix a close() that should be a closesocket()reimar2010-02-201-1/+1
| * Do not discard stream buffer on eof, instead reuse it to slightly improvereimar2010-02-202-4/+6
| * Replace misuse of stream_reset to set stream pos to 0 by more appropriate code.reimar2010-02-201-3/+3
* | Merge svn changes up to r30663Uoti Urpala2010-03-107-9/+17
|\|
| * Fix mov reference files: for video/quicktime mime do not force a demuxerreimar2010-02-201-1/+5
| * Make sure we do not try to use IPv6 with winsock2, we end up connectingreimar2010-02-201-0/+8
| * Add dvd_parse_chapter_range() to stream_dvd.h instead of forward declaring it.diego2010-02-191-0/+2
| * Add missing 'defined' for __bsdi__.komh2010-02-191-1/+1
| * Remove pointless '#if 1' preprocessor directives.diego2010-02-191-2/+0
| * Replace platform preprocessor check by HAVE_DOS_PATHS.komh2010-02-191-1/+1
| * Remove useless CONFIG_SETLOCALEkomh2010-02-191-4/+0
| * stream: Mark functions not used outside of their files as static.diego2010-02-165-11/+18
* | Merge svn changes up to r30529Uoti Urpala2010-03-091-4/+5
|\|
| * Prefer libavformat over our own mov demuxer also for video/quicktimereimar2010-02-051-4/+5
* | Merge svn changes up to r30502Uoti Urpala2010-03-092-8/+12
|\|
| * Reindentreimar2010-02-031-4/+4
| * Add support for FFmpeg's rtsp dummy URL-with-pseudo-demuxer scheme.reimar2010-02-031-3/+7
| * Fix argument order for lseek, fixes cookie loading in Windows and in generalreimar2010-02-031-1/+1
* | Merge svn changes up to r30475Uoti Urpala2010-03-0955-66/+995
|\|
| * Add license header to all files missing it in the stream subdirectory.diego2010-01-3054-62/+980
| * stream/rtp.h appears not to originate from dvbstream.diego2010-01-301-4/+15
* | translations: tweak cases that relied on concatenating adjacent stringsUoti Urpala2010-03-072-3/+6
* | Restore collapsed whitespace in output messagesUoti Urpala2010-03-073-4/+4
* | Merge svn changes up to r30419Uoti Urpala2010-01-254-17/+42
|\|
| * Fix ftp support to properly support large files > 2GB.reimar2010-01-241-3/+4
| * Always call cache_uninit to immediately free everything cache-related if wereimar2010-01-231-3/+10
| * Call cache-uninit unconditionally, it should always be safe to call.reimar2010-01-231-2/+0
| * Change code to allow playing a stream even if enabling the cache failedreimar2010-01-231-2/+5
| * Make cache_init static, it is not used outside this filereimar2010-01-231-1/+1
| * Handle Content-Length also when Content-Type is not set.reimar2010-01-231-5/+6
| * Use atoll to parse Content-Length to support http for files > 2GB.reimar2010-01-231-1/+1
| * Add an exit() to silence a gcc warning and ensure forked code will neverreimar2010-01-231-0/+2
| * 100l, shouldn't write to memory after freeing it.reimar2010-01-231-1/+2
| * Reindent.reimar2010-01-231-3/+3
| * Zero freed pointers.reimar2010-01-231-0/+3
| * Check for fork failing and make sure cache_uninit always frees the cache datareimar2010-01-231-1/+10
* | Merge svn changes up to r30375Uoti Urpala2010-01-251-38/+79
|\|
| * Add hack to fix tvi_dshow compilation with 64-bit MinGWreimar2010-01-171-0/+3
| * Change GUID declarations in tvi_dshow so they are not exported and thusreimar2010-01-171-38/+76
* | Merge svn changes up to r30301Uoti Urpala2010-01-251-1/+0
|\|
| * Add support for distinguishing between little- and big-endian SPDIF AC3reimar2010-01-111-1/+0
* | stream: improve EOF handling in seeksUoti Urpala2010-01-182-6/+11
* | Merge svn changes up to r30236Uoti Urpala2010-01-081-30/+4
|\|
| * Support rtmp:// URLs directly instead of requiring ffmpeg://rtmp://reimar2010-01-061-1/+1
| * Simplify ffmpeg stream support, we (so far) do not need any special option pa...reimar2010-01-061-29/+3
* | Merge svn changes up to r30216Uoti Urpala2010-01-088-0/+14
|\|
| * Add a few missing header #includes and #defines.diego2010-01-048-0/+14
* | Merge svn changes up to r30195Uoti Urpala2010-01-083-4/+4
|\|
| * Disambiguate HEADER_SIZE definition in stream/librtsp and stream/realrtsp.diego2010-01-043-4/+4
* | Merge svn changes up to r30173Uoti Urpala2010-01-082-0/+21
|\|
| * Several hacks to fix compilation of tvi_dshow on MinGW64.reimar2010-01-022-0/+21
* | Merge svn changes up to r30165Uoti Urpala2010-01-081-2/+5
|\|
| * Make code slightly more readable.reimar2009-12-311-2/+2
| * Fix crash if http reply contains neither "Accept-Ranges" nor "Server" fields.reimar2009-12-311-1/+2
| * Add a hack for broken youtube servers not returning Accept-Ranges.reimar2009-12-301-0/+2
* | Merge svn changes up to r30055Uoti Urpala2009-12-181-1/+1
|\|
| * 100l, fix check for V4L2 capture capability flag.reimar2009-12-111-1/+1
* | Fix printf format strings with invalid '%lf' conversionUoti Urpala2009-12-151-2/+2
* | Merge svn changes up to r29971Uoti Urpala2009-11-291-0/+1
|\|
| * mime type [video/x-ms-wmv] is not an ASF redirector.compn2009-11-261-0/+1
* | stream_ffmpeg: Fix reads near EOFUoti Urpala2009-11-231-1/+1
* | Merge svn changes up to r29962Uoti Urpala2009-11-2312-24/+173
|\|
| * Finally rename the STREAM_SEEK define to MP_STREAM_SEEK, there are just too manyreimar2009-11-229-16/+16
| * 10l to Reimar: Fix typo.cehoyos2009-11-181-1/+1
| * Deobfuscate the special hack to disable cache for live555.reimar2009-11-173-2/+6
| * Merge malloc+memset -> callocreimar2009-11-171-4/+2
| * Fall back to read-based seeking for ffmpeg:// URLs when is_streamed is setreimar2009-11-171-2/+2
| * Enable the read-based forward seek fallback also when CONFIG_NETWORK isreimar2009-11-171-2/+2
| * Use fill_buffer if available also for STREAMTYPE_STREAMreimar2009-11-171-0/+3
| * Add preliminary support for streaming via FFmpeg's URProtocol functions.reimar2009-11-172-0/+144
* | Merge svn changes up to r29912Uoti Urpala2009-11-1614-2174/+193
|\|
| * Move headers related to setting dvd speed to dvd_common.reimar2009-11-112-14/+19
| * Set the EOF flag when dvdnav reached the end of the requested title.reimar2009-11-111-2/+6
| * Move dvd_speed and dvd_set_speed to dvd_common and implement -dvd-speedreimar2009-11-104-73/+79
| * Move arrays used by both dvd and dvdnav to dvd_common.reimar2009-11-104-5/+6
| * Remove unused extern declarations.reimar2009-11-101-1/+0
| * Share dvd_device extern declaration between dvd and dvdnav.reimar2009-11-103-2/+1
| * Remove an unused variable.reimar2009-11-101-1/+1
| * Set demuxer->teletext to NULL when closing the TV interface,reimar2009-11-101-0/+1
| * The code for the non-networking case is the same whether networkingreimar2009-11-091-5/+2
| * Factor out triplicated break statement.reimar2009-11-091-3/+4
| * Remove unused mp_dvdnav_aid_from_audio_num functionreimar2009-11-091-21/+0
| * Fixup the dvdnav <-> sid mapping, dvdnav_spu_stream_to_lang andreimar2009-11-091-9/+13
| * Remove CONFIG_TV_TELETEXT.cehoyos2009-11-073-35/+0
| * Separate teletext from tv support.cehoyos2009-11-075-17/+31
| * dvdnav: print ID_SID_..._LANG, just like dvd://reimar2009-11-051-0/+2
| * Cosmetics: indentation, merge two consecutive ifs.reimar2009-11-051-6/+4
| * Make dvdnav also print info about audio streams with unknown language, just l...reimar2009-11-051-1/+1
| * Make the dvdnav stream language information output more similar to the dvd one.reimar2009-11-051-10/+6
| * Change the subtitle numbers in the dvdnav subtitle language info to matchreimar2009-11-051-1/+1
| * Replace two more occurences of tvi_vbi with dec_teletext.cehoyos2009-10-311-1/+1
| * Support ISDB-Tb tunning in Brazilcehoyos2009-10-301-3/+7
| * Add MSGT_TELETEXT, rename TVI_CONTROL as VBI_CONTROL and fix some pathscehoyos2009-10-293-3/+3
| * Move teletext specific code from stream into libmpcodecs.cehoyos2009-10-297-1960/+4
| * Fix teletext character set auto-detection.cehoyos2009-10-241-1/+1
| * cosmetics: Remove some pointless parentheses from return calls.diego2009-10-083-8/+8
* | Merge svn changes up to r29644Uoti Urpala2009-09-045-18/+26
|\|
| * Fix possible crashes with invalid SDPs that result in stream descriptionsreimar2009-09-022-1/+4
| * Fix several more rtsp-related memleaks.reimar2009-09-023-1/+4
| * Fix asmrp_dispose to also free the buffer.reimar2009-09-021-0/+1
| * Use calloc to ensure rmff_new_mdpr returns fully initialized data.reimar2009-09-021-1/+1
| * Move variable declaration to where it is used.reimar2009-09-021-2/+1
| * Make sure we do not strdup(NULL), avoids a crash with non-real streams.reimar2009-09-021-1/+4
| * Fix several memleaks in real_setup_and_get_headerreimar2009-09-021-1/+4
| * Change real_setup_and_get_header to use goto a single exit path to simplifyreimar2009-09-021-11/+7
* | Merge svn changes up to r29532Uoti Urpala2009-08-182-10/+30
|\|
| * Fix file information. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-151-1/+1
| * Add missing major contributors to copyright statement.cehoyos2009-08-151-0/+2
| * Fix another typo. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-1/+1
| * Add standard GPL license header. Patch by Francesco Lavra, francescolavra int...cehoyos2009-08-021-0/+22
| * Fix more typos. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-3/+3
| * Remove unused include's. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-4/+0
| * Fix typos. Patch by Francesco Lavra, francescolavra interfree itcehoyos2009-08-021-2/+2
* | Merge svn changes up to r29455Uoti Urpala2009-07-292-1/+5
|\|
| * stream/realrtsp/real.c: Fix another integer overflowuau2009-07-281-0/+2
| * stream/realrtsp/real.c: Fix integer overflowuau2009-07-271-0/+2
| * Replace WORDS_BIGENDIAN by HAVE_BIGENDIAN in all internal code.diego2009-07-261-1/+1
* | Replace libavutil internal header #includes with MPlayer copiesUoti Urpala2009-07-267-7/+7
* | Remove the internal GUIAnton Khirnov2009-07-071-4/+0
* | Merge svn changes up to r29412Uoti Urpala2009-07-073-12/+6
|\|
| * Replace incorrect use of strncpy by av_strlcpy.reimar2009-06-261-1/+2
| * Files should be opened in binary mode on OS/2.diego2009-06-031-3/+3
| * Using nl_langinfo in the asf mmst implementation makes no sense sincereimar2009-05-311-8/+1
| * whitespace cosmetics: Remove all trailing whitespace.diego2009-05-1380-966/+966
* | Remove trailing whitespace from most filesUoti Urpala2009-07-0781-973/+966
* | Translation system changes part 2: replace macros by stringsAmar Takhar2009-07-0726-421/+434
* | Translation system changes part 1: wrap translated stringsAmar Takhar2009-07-0726-421/+421
* | Merge svn changes up to r29277Uoti Urpala2009-05-082-5/+16
|\|
| * Reemit the ID_AID_x_LANG for the track. This allows the identification of thediego2009-04-111-3/+10
| * Make tvi_v4l2 print -1 as "Current input" if the ioctl to read it failed.reimar2009-04-101-0/+1
| * Add a -indentify message that indicates if the current DVDNAV title isreimar2009-04-091-2/+5
* | Merge svn changes up to r29134Uoti Urpala2009-04-021-1/+0
|\|
| * Remove unused variable along with the related warning.diego2009-04-011-1/+0
* | Merge svn changes up to r29117Uoti Urpala2009-04-015-6/+22
|\|
| * 100l, revert r29082, I missed that the vts comparison should be case-insensit...reimar2009-03-281-1/+5
| * Reindentreimar2009-03-281-2/+2
| * Simplify extracting title number from ifo namereimar2009-03-281-5/+1
| * Simplify detection of .ifo extension.reimar2009-03-271-2/+2
| * change close to closesocket, unifies close streaming codecompn2009-03-261-1/+1
| * Add support for mmsh:// as alias for mmshttp://reimar2009-03-261-2/+3
| * Add TVI_CONTROL_VID_SET_WIDTH_HEIGHT to set width and height together for v4l2,reimar2009-03-163-0/+15
| * 100l fix calculation of dropped frames, number of frames is time * fps, not t...reimar2009-03-151-1/+1
* | Merge svn changes up to r28951Uoti Urpala2009-03-142-2/+3
|\|
| * Ensure the string we're trying to compare is actually not NULL.ben2009-03-091-1/+2
| * The first valid index is total count - 1 (usually 0)ben2009-03-091-1/+1
* | Merge svn changes up to r28755Uoti Urpala2009-02-282-0/+3
|\|
| * Use memset to make sure all parts of struct sockaddr_in are always initialized.reimar2009-02-252-0/+3
* | Merge svn changes up to r28712Uoti Urpala2009-02-231-1/+8
|\|
| * Accept DVB API 5, patch by Steven Brudenell, steven.brudenell gmail com.diego2009-02-221-1/+8
* | Merge svn changes up to r28641Uoti Urpala2009-02-183-3/+3
|\|
| * Replace double semicolon by single semicolon.diego2009-02-163-3/+3
* | Merge svn changes up to r28461Uoti Urpala2009-02-0419-64/+56
|\|
| * Restructure network tests: Always check for both inet_aton and inet_pton.diego2009-02-013-25/+17
| * Convert HAVE_WINSOCK2_H into a 0/1 definition.diego2009-02-0119-40/+40
| * HAVE_ATON --> HAVE_INET_ATON to match FFmpeg and give it a 0/1 value.diego2009-02-013-6/+6
| * Convert HAVE_CLOSESOCKET and HAVE_SOCKLEN_T into 0/1 definitions.diego2009-02-011-2/+2
* | Merge svn changes up to r28366Uoti Urpala2009-01-261-1/+1
|\|
| * Fix a NULL-check that used && instead of || and thus could not avoid crashes.reimar2009-01-251-1/+1
* | Merge svn changes up to r28310Uoti Urpala2009-01-155-17/+12
|\|
| * Switch internal dvdread to libdvdread SVN external.reimar2009-01-083-15/+0
| * Add missing 'void' keyword to parameterless function declarations.diego2009-01-051-1/+1
| * Fix DVD seek_to_chapter: the title number must be converted to a per-VTSreimar2009-01-011-0/+9
| * Work around a dvdread bug where DVDReadBlocks would return values < 0 on read...reimar2008-12-311-1/+2
* | Merge svn changes up to r28204Uoti Urpala2008-12-271-1/+1
|\|
| * Avoid u_ BSD type names.diego2008-12-271-1/+1
* | Merge svn changes up to r28149Uoti Urpala2008-12-141-15/+25
|\|
| * Replace informal GPL notes by standard GPL header.diego2008-12-131-15/+25
* | Merge svn changes up to r28087Uoti Urpala2008-12-046-15/+15
|\|
| * Get rid of pointless 'extern' keywords.diego2008-12-036-15/+15
* | Merge svn changes up to r28065Uoti Urpala2008-12-021-4/+0
|\|
| * Move PTHREAD_CACHE define logic to configure.reimar2008-11-281-4/+0
* | Merge svn changes up to r27949Uoti Urpala2008-11-171-12/+32
|\|
| * 100l, stream->cache_pid can not be used directly in pthread_create,reimar2008-11-151-1/+5
| * Use pthreads for the cache on Cygwin, since _beginthread is not availablereimar2008-11-151-11/+27
| * Include cache2.h in cache2.c, fixes an implicit declaration warning for cache...reimar2008-11-141-0/+1
* | Merge svn changes up to r27899Uoti Urpala2008-11-065-6/+9
|\|
| * set to -1 fds that were closed; handle the sec_fd only if CONFIG_DVB_HEAD isn...nicodvb2008-11-052-3/+3
| * Intialize unused fd variables to -1 (which is actually invalid) insteadreimar2008-11-041-1/+1
| * Fix condition broken in r27401 which incorrectly caused stdin to be closed af...reimar2008-11-041-1/+1
| * Forgotten reindentreimar2008-11-021-1/+1
| * Add a noicyx:// protocol to allow easier testing for misconfigured servers.reimar2008-11-022-1/+2
| * vfw.h needs a windows.h include before on MinGW64.reimar2008-11-021-0/+1
| * Avoid a memleak if allocation of field_name fails, fixes bug #1319.reimar2008-10-311-0/+1
* | Merge svn changes up to 27824Uoti Urpala2008-10-2512-91/+50
|\|
| * Conditionally declare a conditionally used variable, fixes the warning:diego2008-10-241-1/+4
| * Determine default CD/DVD device in configure instead of using an #ifdef jungle.diego2008-10-211-26/+0
| * Replace typeof by __typeof__, the former is a non-portable GNU extension.diego2008-10-201-1/+1
| * Avoid CreateThread and especially TerminateThread since they cause a memleak.reimar2008-10-191-21/+18
| * Remove useless casts.reimar2008-10-191-2/+2
| * Revert declaring ThreadProc as void, it breaks the WINAPI.diego2008-10-161-2/+6
| * Move DEFAULT_CDROM_DEVICE/DEFAULT_DVD_DEVICE to stream.h where it belongs.diego2008-10-161-0/+27
| * Rename stream/netstream.h to stream/stream_netstream.h; netstream.h to make itdiego2008-10-162-1/+1
| * Replace preprocessor check for WIN32 with checks for __MINGW32__ and __CYGWIN__.diego2008-10-134-21/+21
| * Declare ThreadProc as void, it does not return anything, fixes the warning:diego2008-10-131-6/+2
| * Remove unused function, fixes the warning:diego2008-10-131-46/+0
| * Unconditionally #include osdep/shem.h, fixes the warnings on Cygwin:diego2008-10-131-1/+1
| * Move socklen_t typedef from config.h to stream/network.h.diego2008-10-122-0/+4
* | Merge svn changes up to r27682Uoti Urpala2008-10-021-5/+8
|\|
| * Add debug message about loaded frequency tables.voroshil2008-09-241-1/+2
| * Make output messages of frequency selection code more useful byvoroshil2008-09-241-2/+4
| * Fix overflow in frequency conversion code inside tvi_dshow.voroshil2008-09-241-2/+2
* | Merge svn changes up to r27649Uoti Urpala2008-09-201-1/+1
|\|
| * With -identify, ID_DVD_VOLUME_ID is not shown on some systems.diego2008-09-161-1/+1
* | Merge svn changes up to r27514Uoti Urpala2008-09-0331-91/+89
|\|
| * Move '#define closesocket close' preprocessor directive to a common placediego2008-09-0114-23/+17
| * Revert moving closesocket definition and network headers to network.h.diego2008-08-3114-15/+115
| * Rename internal libdvdread fork from dvdread to libdvdreadrathann2008-08-303-12/+12
| * Print DVD volume ID with -identify.reimar2008-08-301-0/+3
| * Move duplicated '#define closesocket close' into network.h along withdiego2008-08-2914-115/+15
| * consistency cosmetics: Avoid using .. in #include paths.diego2008-08-296-12/+12
| * Rename HAVE_WINSOCK preprocessor condition to HAVE_WINSOCK_H.diego2008-08-2920-45/+46
| * Use '#include <poll.h>' instead of '#include <sys/poll.h>'.diego2008-08-143-3/+3
* | Make various functions staticUoti Urpala2008-08-122-4/+4
* | Include corresponding .h in some .c filesUoti Urpala2008-08-121-0/+1
* | stream.h: Add 2 prototypes instead of declaring them in cache2.cUoti Urpala2008-08-122-5/+2
* | Merge svn changes up to r27441Uoti Urpala2008-08-0816-114/+114
|\|
| * Give a CONFIG_ prefix to preprocessor directives that lacked one anddiego2008-08-072-8/+8
| * Rename font-related preprocessor directives.diego2008-08-071-7/+7
| * Rename a bunch of miscellaneous preprocessor directives.diego2008-08-073-13/+13
| * Introduce CONFIG_ALSA preprocessor directive for ALSA 0.9 and 1.x.diego2008-08-065-17/+17
| * Rename some audio-output-related preprocessor directives.diego2008-08-055-17/+17
| * Change a bunch of video/audio-output-specific preprocessor directives fromdiego2008-08-0310-69/+69
* | Merge svn changes up to r27399Uoti Urpala2008-08-025-16/+16
|\|
| * Rename some preprocessor directives from CONFIG_* to HAVE_* where appropriate;diego2008-08-014-15/+15
| * Rename two GUI-related preprocessor directives:diego2008-07-301-1/+1
* | Merge svn changes up to r27374Uoti Urpala2008-07-3015-55/+56
|\|
| * Start unifying names of internal preprocessor directives.diego2008-07-3014-54/+54
| * Do not include sys/socket.h when using winsock2, it is pointlessreimar2008-07-261-1/+2
* | Merge svn changes up to r27332Uoti Urpala2008-07-214-5/+7
|\|
| * Our ALSA code needs alloca, so check for it in configure and include alloca.hreimar2008-07-172-0/+2
| * Replace S_IREAD|S_IWRITE by POSIX-compatible S_IRUSR|S_IWUSR (not exactly the...reimar2008-07-151-1/+1
| * Remove -std=gnu99/gnu89/default dialect linux define, as it violates themichael2008-07-151-4/+4
* | Merge svn changes up to r27281Uoti Urpala2008-07-152-2/+2
|\|
| * in dvd streams the title part ranges from 1 to 99nicodvb2008-07-122-2/+2
* | Merge svn changes up to r27242Uoti Urpala2008-07-095-1/+15
|\|
| * Add missing #include <sys/socket.h>, fixes the warnings:diego2008-07-081-0/+1
| * avoid unnecessary strdup(); patch by Aurelnicodvb2008-07-061-1/+1
| * Surround stream cache specific code by an appropriate #ifdef; fixes linkingdiego2008-07-051-0/+2
| * Add some more -identify information for CDDB.diego2008-07-051-0/+9
| * Add disc ID to -identify output.diego2008-07-051-0/+2
* | Merge svn changes up to r27202Uoti Urpala2008-07-052-18/+25
|\|
| * Rename stream_livedotcom.c to stream_live555.c, the name is used everywhere.diego2008-07-041-0/+0
| * cosmetics: in ifo_stream_oped() aligned the prototype to the stylenicodvb2008-07-041-9/+8
| * in ifo_stream_open() propagate the device based on the dirname of stream->url...nicodvb2008-07-041-0/+1
| * dvd_device must be handled exclusively by the option parser; it can't be chan...nicodvb2008-07-041-2/+0
| * added support for the device part in the url; patch bynicodvb2008-07-041-8/+17
* | Merge svn changes up to r27184Uoti Urpala2008-07-015-106/+122
|\|
| * Try to get frame rate information through VIDIOC_G_PARM ifvoroshil2008-06-301-0/+12
| * Fix division by zero in tvi_v4l2 which occures when capture devicevoroshil2008-06-301-8/+18
| * removed struct dvdnav_event_t that is 1) unused; 2) has an improper name. You...nicodvb2008-06-291-6/+0
| * mingw uses Windows sockets.vayne2008-06-281-1/+3
| * Fix the issue instead of revertinglu_zero2008-06-253-58/+56
| * Move rtsp_close away by simplification - avoids symbol clash with libnemesilu_zero2008-06-253-33/+33
* | Merge svn changes up to r27123Uoti Urpala2008-06-231-27/+28
|\|
| * Reorder some functions to avoid implicit declaration warnings.diego2008-06-191-27/+28
* | Merge svn changes up to r27092Uoti Urpala2008-06-174-6/+34
|\|
| * Add missing #includes to fix 'make checkheaders'.diego2008-06-162-0/+2
| * Ability for specifying TV standard individually for each TV channel.voroshil2008-06-142-6/+32
* | Merge svn changes up to r27025Uoti Urpala2008-06-072-36/+118
|\|
| * Factorizes dvdnav aid retrieval code.ben2008-06-071-30/+27
| * Add routine that provides audio ID corresponding to logical numberben2008-06-072-0/+33
| * Rename some functions as they are mplayer related and notben2008-06-072-15/+15
| * rename for consistencyben2008-06-071-5/+5
| * Add routine to determine if SPU has changed in dvdnav stream.ben2008-06-072-0/+25
| * Add routine to determine if audio has changed in dvdnav stream.ben2008-06-072-0/+25
| * Save DVDNAV palette info.ben2008-06-072-0/+2
* | Merge svn changes up to r26979Uoti Urpala2008-06-0419-209/+312
|\|
| * 100l, fix wrong order of cases in cache_do_controlreimar2008-06-011-3/+3
| * Fix compilation with internal dvdnavrtogni2008-05-311-0/+1
| * adapted to the dvdread->libdvdread transition in dvdnav's repositorynicodvb2008-05-313-4/+12
| * Handle NULL control function in cache_execute_control, fixes crash with http ...reimar2008-05-301-0/+7
| * Emulate STREAM_CTRL_GET_TIME_LENGTH if cache is used.reimar2008-05-261-2/+13
| * Add basic support for stream controls with cache enabled.reimar2008-05-244-7/+83
| * cosmetics: Remove useless parentheses from return statements.diego2008-05-1612-198/+198
* | Merge svn changes up to r26783Uoti Urpala2008-05-1518-233/+263
|\|
| * Add missing stream.h #include, fixes the warning:diego2008-05-151-0/+1
| * Use standard license headers with standard formatting.diego2008-05-1417-233/+262
* | Merge svn changes up to r26680Uoti Urpala2008-05-072-0/+3
|\|
| * Add missing header #includes to fix 'make checkheaders'.diego2008-05-032-0/+3
* | Create a context for input.c stateUoti Urpala2008-04-302-4/+11
* | Merge svn changes up to r26587Uoti Urpala2008-04-291-1/+1
|\|
| * Use consistent #include paths without "../".diego2008-04-281-1/+1
* | Merge svn changes up to r26540Uoti Urpala2008-04-261-73/+0
|\|
| * Merge stream/Makefile into top-level Makefile.diego2008-04-241-72/+0
| * cosmetics: alphabetical orderdiego2008-04-241-2/+1
* | Remove _s/_st suffix from some struct namesUoti Urpala2008-04-256-29/+29
* | Move audio_id and video_id to options structUoti Urpala2008-04-233-10/+14
* | Add option pointer to stream struct (at least temporarily)Uoti Urpala2008-04-233-19/+18
* | Mark some functions staticUoti Urpala2008-04-232-5/+5
|/
* in preparation for multi-frontend patch replaced file-static device names wit...nicodvb2008-04-131-17/+28
* removed useless parameter :type from -dvbin (the frontend type is reported by...nicodvb2008-04-121-6/+3
* removed defunct options :vid and :aid from -dvbin (they were useless from the...nicodvb2008-04-121-10/+5
* Remove the need for code using stream to export an mp_input_check_interrupt()albeu2008-04-094-4/+18
* Make stream independent of libmpdemux, the asf demuxer and streamingalbeu2008-04-091-10/+1
* Fix possible integer overflow in malloc by using calloc instead.reimar2008-03-291-1/+2
* mingw uses windows sockets.vayne2008-03-111-0/+2
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-101-0/+3
* Add missing header #includes to fix 'make checkheaders'.diego2008-03-1014-0/+39
* Remove useless #include.diego2008-03-101-1/+0
* search channels.conf in mplayer's instdir if all other searches fail; patch b...nicodvb2008-03-031-0/+6
* cache support for OS/2diego2008-02-281-17/+34
* FFmpeg now uses different (unified) #include paths.diego2008-02-251-4/+0
* Avoid a pointless special-case for opening a filereimar2008-02-241-4/+0
* Add MPLAYER_ prefix to multiple inclusion guards.diego2008-02-2234-106/+104
* Add multiple inclusion guard.diego2008-02-211-0/+5
* Add missing multiple inclusion guards.diego2008-02-214-0/+18
* Remove pointless #ifdefs around extern declarations.diego2008-02-201-26/+0
* Add support for DOS-style file:///x:/path paths.diego2008-02-201-0/+6
* Fill stream->end_pos if possible, fixing lavf demuxers that need to seek.albeu2008-02-191-1/+3
* Support icyx://.reimar2008-02-151-1/+1
* Always display Icy-Metadata if available, whether we recognize an ICY-Serverreimar2008-02-151-1/+2
* Move printing of Icy-Metadata into an extra functionreimar2008-02-151-14/+18
* Remove useless codereimar2008-02-151-6/+6
* Detect IceCast also by Icy-MetaInt header part in http_streaming_start(),reimar2008-02-151-1/+2
* typo fix: inited --> initializeddiego2008-02-142-12/+12
* -chapter is now handled uniformly calling demuxer_seek_chapter() insteadnicodvb2008-02-112-29/+2
* #include just libavutil/common.h, not all of libavutil/intreadwrite.h.diego2008-02-111-1/+1
* Stream IDs must be written as hex numbers. Fixes rtogni2008-01-291-2/+2
* vcd_read must read exactly VCD_SECTOR_DATA bytes.reimar2008-01-281-1/+1
* Consistently use uppercase filename as multiple inclusion guard.diego2008-01-285-15/+15
* factorize 2 testsben2008-01-261-2/+3
* add a new state flag to dvdnav in order to notify ifben2008-01-262-0/+21
* remove useless castsben2008-01-261-10/+10
* simplify by a one-linerben2008-01-261-2/+1
* remove the spu_set field, replaced by a flagben2008-01-261-3/+4
* this end brace was not correctly indentedben2008-01-261-1/+1
* automatically set spu button highlight when nav cell has changedben2008-01-261-0/+3
* Add support for dvdnav still frames playback.ben2008-01-262-26/+166
* array was defined for 6 elements while 7 were declaredben2008-01-241-1/+1
* type expected by dvdnav_get_title_string() is constben2008-01-241-1/+1
* remove some redundant declarationsben2008-01-241-3/+0
* Add new command to switch between dvdnav titlesben2008-01-242-0/+10
* Prevent possible buffer overflow on album_title[]rtogni2008-01-201-2/+5
* Clear tmp between ip6 check and string escape to prevent reuse of the rtogni2008-01-201-0/+1
* Fix compilation failue:ulion2008-01-201-0/+1
* Reindentreimar2008-01-191-2/+2
* Simplify and keep terminating end-of-linereimar2008-01-191-4/+4
* Remove a broken and useless hack to avoid a memcpyreimar2008-01-191-3/+1
* Cached file must be 0-terminated since we use string processing functions on itreimar2008-01-191-2/+3
* Make sure we do not write the terminating 0 out of boundsreimar2008-01-191-1/+1
* Simplify/cleanup of real_calc_response_and_checksum()rtogni2008-01-131-8/+2
* Don't oversize realchallenge buffersrtogni2008-01-131-6/+6
* Simplify cue-parsingreimar2008-01-131-13/+12
* Get rid of quite useless inum variablereimar2008-01-131-3/+2
* Use AV_WB*reimar2008-01-131-10/+3
* Remove some useless () and {}reimar2008-01-131-16/+13
* Simplifyreimar2008-01-131-1/+1
* Use AV_WB16 instead of ugly memcpy hacksreimar2008-01-131-10/+3
* Use AV_RB* instead of custom variants.reimar2008-01-131-19/+11
* Use sizeof instead of size variables/definesreimar2008-01-131-16/+10
* Make some pnm data constreimar2008-01-131-2/+2
* dvb_demuxdev etc. are only used in dvb_tune.c so make them staticreimar2008-01-131-6/+6
* Make several arrays constreimar2008-01-131-7/+7
* Remove some unused extern variablesreimar2008-01-131-1/+0
* stream_opts should be constreimar2008-01-1313-13/+13
* stream_info_t opts and protocols point to constant data as well.reimar2008-01-131-2/+2
* Make all tvi_info_t constreimar2008-01-136-10/+10
* Make some tvi_functions_t pointers const that I forgot to change beforereimar2008-01-131-5/+5
* Remove useless ifdefsreimar2008-01-131-8/+0
* Add type to extern declarationreimar2008-01-131-1/+1
* Make dvd_audio_stream_types and dvd_audio_stream_channels constreimar2008-01-131-2/+2
* tvi_functions_t should be constreimar2008-01-132-2/+2
* Add forgotten const for pal_ireland.reimar2008-01-131-1/+1
* Remove unnecessary <signal.h> includesuau2008-01-092-2/+0
* Fix illegal identifiers, names starting with __ are reserved for the system.diego2008-01-081-2/+2
* Fix illegal identifiers: Names starting with __ or _ and uppercase are reserveddiego2008-01-061-4/+4
* implemented _ANGLE STREAM_CTRLs, patch by oattila chello hu nicodvb2008-01-051-0/+27
* implemented _ANGLE STREAM_CTRLs, patch by oattila chello hu nicodvb2008-01-051-0/+19
* NEW STREAM_CTRLs: STREAM_CTRL_GET_NUM_ANGLES STREAM_CTRL_GET_ANGLE STREAM_CTR...nicodvb2008-01-051-0/+3
* fixed bug when playing multi-angle titles: the address field in the agli datanicodvb2008-01-051-1/+2
* Add multiple inclusion guards to all header files that lack them.diego2008-01-014-0/+21
* consistency cosmeticsdiego2008-01-011-1/+1
* Add explanatory comments to #endif preprocessor directives.diego2008-01-011-2/+1
* include dvdnav.h from its installation directory rather than appendingnicodvb2008-01-011-1/+1
* removed inclusion of unneeded header (forgotten in previous commit)nicodvb2008-01-011-2/+0
* private structures belong to the C file using them, not to header files inclu...nicodvb2008-01-012-11/+11
* Add explanatory comments to the #endif part of multiple inclusion guards.diego2007-12-3114-17/+14
* Simplify a little bitreimar2007-12-211-6/+4
* Remove a check that is never in any way usefulreimar2007-12-211-5/+0
* Avoid some le2me_ASF_* stuff operating directly on buffer, shouldreimar2007-12-211-5/+3
* Remove another useless castreimar2007-12-211-1/+1
* 100l, buffer bound checks work better when done _before_ access.reimar2007-12-211-3/+2
* Reduce some extreme parsing ugliness (mostly cosmetic)reimar2007-12-211-10/+12
* Remove useless alloc castsreimar2007-12-211-3/+3
* Reduce code duplication: add a asf_read_wrapper function that never does part...reimar2007-12-211-34/+23
* Fix stream_cache to use sector_size set in stream_t.ulion2007-12-201-1/+1
* Use tv_sec instead of tv_usec to set 1 second timeout, e.g. NetBSDreimar2007-12-201-2/+2
* Protocol name should be case insensitive.ulion2007-12-191-1/+1
* Caching toc header in vcd private structure for later use.ulion2007-12-172-12/+6
* Add cdda stream control for chapter commmands.ulion2007-12-171-0/+48
* Should not change stream->pos in fill_buffer function.ulion2007-12-161-1/+0
* Support cddb on darwin.ulion2007-12-161-1/+51
* 10l, in dvb_free_config() channels' names must be free individuallynicodvb2007-12-151-3/+6
* cosmetic: indent after r25415ben2007-12-151-1/+1
* do not override *file_format if already set by asf_streaming_start()ben2007-12-151-0/+1
* Make the end_sector accessable (it should be).ulion2007-12-151-7/+7
* removed the obscene priv->stream entry. Someone must have injected vodka in m...nicodvb2007-12-152-5/+3
* get rid of the file-static dvb_config and free the config at close() . Patch...nicodvb2007-12-152-10/+23
* Only read disc info once and save it for later using.ulion2007-12-151-17/+6
* dvb cleanup: call dvb_(set|step)_channel() without dereferencing stream->priv...nicodvb2007-12-152-7/+8
* The buffer used for pread need be aligned, but currently it got an offset 23ulion2007-12-151-1/+1
* Get end position of last track by adding its starting address with track size.ulion2007-12-151-2/+17
* Replace printf with mp_msg.ulion2007-12-151-9/+9
* Only print one track info when exactly seeking to the beginning of a track.ulion2007-12-141-1/+3
* Fix stream cdda seeks to CD's end and hangs forever bug.ulion2007-12-141-2/+2
* fix memleaks; patch by andrew calkin from gmail comnicodvb2007-12-121-0/+6
* Replace SYS_DARWIN by __APPLE__ and __DARWIN__ where appropriate.diego2007-12-112-3/+3
* removed stupid checksnicodvb2007-12-081-4/+0
* 10l ... the header was used there toolu_zero2007-12-041-2/+2
* Make libnemesi use specific struct and DEMUXER_TYPElu_zero2007-12-041-1/+1
* mime_type_table is const as wellreimar2007-12-022-2/+2
* Add a few forgotten static/const attributes in tvi_vbi.creimar2007-12-021-7/+7
* stream_opts arrays should be constreimar2007-12-0213-13/+13
* Make m_option_t arrays referenced by cfg-common.h constreimar2007-12-022-2/+2
* Preserve unsv:// protocol specifier over http redirects.reimar2007-12-021-0/+5
* Add appropriate const specifiers to some custom parse functions.reimar2007-12-021-1/+1
* Mark all stream_info_t as constreimar2007-12-0225-53/+53
* When IFO file is opened (detected by extension), set dvd-device to IFO file'svoroshil2007-12-022-0/+45
* Make auto_open_streams array itself constreimar2007-12-021-1/+1
* auto_open_streams should have const type, fix also the places where it is usedreimar2007-12-011-3/+3
* at startup show audio and subtitle streams available in the chosen title with...nicodvb2007-12-011-0/+52
* this variable was nothing but a useless memleakben2007-11-301-3/+1
* this local variable can be staticben2007-11-301-1/+1
* -identify also shows the duration(s) of the title(s)nicodvb2007-11-291-2/+4
* cosmetics: moved identification code to a separate functionnicodvb2007-11-291-8/+14
* when no title is chosen -identify all titles present in the dvdnicodvb2007-11-291-0/+6
* with -identify show the title being describednicodvb2007-11-291-1/+1
* -identify chapters of chosen titlenicodvb2007-11-281-0/+18
* Correct VCD track no. calculation on Windows.zuxy2007-11-281-1/+1
* Avoid gcc warning:zuxy2007-11-281-1/+1
* Return correct length in ID_VCD_TRACK_n_MSFzuxy2007-11-281-0/+2
* Enable -rtsp-port for nemesilu_zero2007-11-271-1/+0
* Remove stray varlu_zero2007-11-271-1/+0
* Add missing '\n' in tv scanner results output.voroshil2007-11-261-0/+1
* Support stream redirection from http to mms, fix bug #927.ulion2007-11-263-5/+36
* Revert r25089 (Ignore video formats which are supported by devicevoroshil2007-11-241-14/+3
* Move requested format at top and shift all oters downvoroshil2007-11-241-8/+11
* Сreate empty format arrays in case of error in init_chain_common.voroshil2007-11-241-6/+27
* pgc->subp_control and pgc->audio_control are no more bitfields,nicodvb2007-11-231-20/+0
* don't include anymore the dvdread headers from the dvdnav directorynicodvb2007-11-221-5/+0
* Compilation fix (typo)voroshil2007-11-211-1/+1
* Sizes of arpmt and arStreamCaps must be equal.voroshil2007-11-211-0/+3
* Move code related to chain initialization and similarvoroshil2007-11-201-80/+78
* Fix mplayer crash caused by r25116voroshil2007-11-201-0/+10
* Remove no more needed checkvoroshil2007-11-201-1/+1
* Fix totally wrong (due to mess of brackets) structures size check.voroshil2007-11-201-7/+7
* Replace several parameters for get_available_formats_streamvoroshil2007-11-201-60/+24
* New routine for reconnecting two pins with new media typevoroshil2007-11-191-23/+68
* Move pointer to SampleGrabber filter into chain structure.voroshil2007-11-191-6/+6
* Move common chain uninit code into separate routine.voroshil2007-11-191-52/+38
* pass chain structure instead of several variables to build_sub_graphvoroshil2007-11-191-18/+16
* fix missed changevoroshil2007-11-191-1/+1
* Add capture filter's pointer to vbi chain structure too.voroshil2007-11-191-0/+3
* Code unification: get rid of local variable arpmtVBIvoroshil2007-11-191-4/+11
* Add major media type to chain structurevoroshil2007-11-191-6/+10
* One step of code cleanup: move all variables, relatedvoroshil2007-11-191-204/+221
* 100l: Fix long standing copy-paste error:voroshil2007-11-191-1/+1
* Add all passed to VID_SET_FORMAT formats to the end ofvoroshil2007-11-181-2/+27
* Ensure that when VID_GET_FORMAT ioctl is called,voroshil2007-11-181-0/+5
* (cosmetics) Indentation fix of previous commit.voroshil2007-11-181-11/+11
* New media format negotiation code:voroshil2007-11-181-2/+14
* Move setting media format code voroshil2007-11-181-7/+6
* Pass all available formats to chain building routine andvoroshil2007-11-181-18/+30
* Ignore video formats which are supported by devicevoroshil2007-11-181-3/+14
* Fix crash when pin connection fails.voroshil2007-11-181-1/+1
* Prevent chains from building more than once.voroshil2007-11-181-0/+9
* Handle "out of memory" error.voroshil2007-11-181-0/+7
* Move chains building code into separate routines.voroshil2007-11-181-18/+71
* (cosmetics) Lookup table alignment.voroshil2007-11-171-12/+12
* Service routine for constructing AM_MEDIA_TYPE structure from voroshil2007-11-171-0/+47
* Disable terminating directshow chains with NullRenderer filter,voroshil2007-11-171-0/+7
* Fix bogus bits per pixel values in lookup table.voroshil2007-11-171-7/+7
* Cleanup sg_io_hdr initialization a bitreimar2007-11-171-2/+1
* We do not have any use for the sense data, so we don't need a buffer for it.reimar2007-11-171-4/+1
* (cosmetics) Indentation fixvoroshil2007-11-171-1/+1
* Some more cosmeticsreimar2007-11-171-5/+3
* Move the zeroing directly before the other initialization codereimar2007-11-171-3/+3
* Move everything that sets buffer values together.reimar2007-11-171-2/+4
* Another place that can use AV_WB32reimar2007-11-171-4/+2
* Some cosmetics in dvd_set_speedreimar2007-11-171-4/+6
* Move the DVD speed factor -> KB/s conversion into the casereimar2007-11-171-4/+3
* Add a missing close() to dvd_set_speed functionreimar2007-11-171-0/+1
* Open device file only right before we need it, so we do notreimar2007-11-171-5/+5
* Do not print Ok message when setting speed limit failedreimar2007-11-171-1/+1
* AV_WB16(..., 1000) more obviously represents one second that assigningreimar2007-11-171-2/+3
* Use AV_WB32 instead of manual bit-fiddling when setting DVD speedreimar2007-11-171-4/+4
* GPCMD_SET_STREAMING command is 12 bytes large, not 16reimar2007-11-171-1/+1
* Ignore stream id when checking rdt packet flagsrtogni2007-11-171-1/+1
* report why the dvd couldn't be opened. Patch by Jan Knutar jknutar+nic+finicodvb2007-11-162-4/+7
* Make sure that mplayer will receive actual media typevoroshil2007-11-161-0/+13
* Fix FPS from bitrate calculation (was 8 times larger than real value).voroshil2007-11-161-1/+1
* removed forgotten and out of date commentnicodvb2007-11-141-1/+0
* removed unneeded checks on MP_DVDNAV and DVDNAV_FORMAT_AC3 (we need and assum...nicodvb2007-11-141-4/+0
* Not all cards supports changing country code.voroshil2007-11-141-1/+0
* Add missing call to audio_in_uninit in v4l2 tv driver.voroshil2007-11-131-0/+2
* at the end of open() warn users that seeking won't work correctly if the cach...nicodvb2007-11-101-0/+2
* Fix possible null-pointer-dereference in stream_fill_buffer().cehoyos2007-11-081-1/+1
* Fix memory leak.voroshil2007-11-051-0/+1
* Fix segmentation fault after audio initialization failure in tv driver.voroshil2007-11-051-2/+5
* removed unused variables and parametersnicodvb2007-10-302-8/+7
* Comment out unused variable, fixes the warning:diego2007-10-301-1/+1
* Remove unused functions, fixes the warnings:diego2007-10-302-16/+0
* Make functions static if they aren't referenced externally.zuxy2007-10-271-2/+2
* Remove assert. Not only are they no help at all and proper checks shouldreimar2007-10-271-5/+0
* Don't wait for filling entire audio ringbuffer at each call to grab_audio_frame.voroshil2007-10-251-1/+1
* Add missing call to audio_in_start_capture.voroshil2007-10-251-0/+1
* add missing include (errno.h). fix compilation on openbsdivo2007-10-241-0/+1
* Simplify handling SET_NORM for V4l1: replace several if-else-if and switchvoroshil2007-10-201-67/+34
* czech/slovak character set fixes:voroshil2007-10-201-2/+2
* After receiving EINTR 'read' syscall should be restarted.voroshil2007-10-162-0/+4
* Disable channel scanner when no tuner is present.voroshil2007-10-151-0/+8
* Fix mplayer segfault when v4l driver initialization (at setting normvoroshil2007-10-141-1/+3
* #ifdef's in tv.c and tv.h becomes more and more hard to maintain.voroshil2007-10-142-26/+0
* Remove unnecessary curly braces.voroshil2007-10-141-4/+1
* 8 bytes buffer is not enough for at least SECAM-DK.voroshil2007-10-141-1/+1
* Replace duplicated code with call to routinevoroshil2007-10-141-7/+1
* 10l: routine sets norm from parameter, but prints value of tv norm optionvoroshil2007-10-141-1/+1
* (cosmetics) indentation fix of my previous commit and small readabilityvoroshil2007-10-141-22/+25
* Remove driver-dependent #ifdef from norm_from_string routine.voroshil2007-10-141-22/+14
* (cosmetics) remove trailing whitespacevoroshil2007-10-141-37/+37
* 10l fix compilation with v4l2iive2007-10-131-1/+1
* DirectShow based tv:// driver for win32voroshil2007-10-136-9/+4062
* removed useless inclusion of error.hnicodvb2007-10-131-1/+0
* Make sure forked code does not try to display a GTK message box (and thus cra...reimar2007-10-071-0/+4
* cosmetics: misc typo fixesdiego2007-09-251-1/+1
* Fix compilation with enabled radio capture and disabled OSS audio.voroshil2007-09-241-2/+3
* libnemesi support, yet another rtsp/rtp library...lu_zero2007-09-192-6/+88
* (Re)move idiotic checks, ret can't be < 0 or > 0 if the loop conditionreimar2007-09-191-3/+2
* Fix a few typosreimar2007-09-192-4/+4
* Implement setting gain control for video devices (usually webcams)voroshil2007-09-184-1/+42
* removed unused members from dvdnav_priv_tnicodvb2007-09-151-4/+0
* Removed dead code related to stills.nicodvb2007-09-151-8/+0
* Fix missing reset/initialization (with tv parameters) ofvoroshil2007-09-131-0/+2
* Add missing #include to fix compilation.diego2007-09-121-0/+1
* Implementation of tv:// driver autodetection.voroshil2007-09-102-9/+19
* Fix for:voroshil2007-09-081-1/+1
* More accurate calculating of teletextvoroshil2007-09-081-1/+3
* Implement boxes for subtitle teletext pages.voroshil2007-09-082-8/+26
* Decrease teletext page rendering frequency from 1/frame to about 4/sec.voroshil2007-09-082-1/+26
* Fix for:voroshil2007-09-031-0/+4
* Increase number of skipped buffers to 5 to avoid mixing teletext pages fromvoroshil2007-09-021-2/+6
* a mouse selection may require at least a video codec reinitnicodvb2007-09-011-0/+1
* implemented STREAM_CTRL_GET_ASPECT_RATIOnicodvb2007-09-011-0/+6
* Make sure that no pages will left in cache duringvoroshil2007-09-011-1/+9
* implemented STREAM_CTRL_GET_ASPECT_RATIOnicodvb2007-09-011-0/+5
* introduced STREAM_CTRL_GET_ASPECT_RATIO to report the aspect ratio read from ...nicodvb2007-09-011-0/+1
* Drop out control chars from page header in time position.voroshil2007-09-011-3/+7
* Fix missed -1 -> 0x3f7f changes for subpage number.voroshil2007-09-011-2/+2
* Fix displaying start page when it has subpages.voroshil2007-09-011-4/+4
* Proper support for flashing chars in teletext pages.voroshil2007-09-012-1/+5
* Support for selecting language via packet 28.voroshil2007-08-313-21/+207
* Small code simplification as suggested by Reimar:voroshil2007-08-291-18/+10
* Simplify code by using FFSWAPvoroshil2007-08-291-4/+1
* (cosmetics) replace tabs with spacesvoroshil2007-08-291-4/+4
* (cosmetics) fix indentation of previous commitvoroshil2007-08-291-1/+1
* Implement Hold/Release graphics (showing control chars asvoroshil2007-08-291-0/+13
* Implement Flash/Steady (swapping foreground/background colors)voroshil2007-08-291-3/+19
* Make charset constants naming consistantvoroshil2007-08-291-4/+4
* cosmetics: typo fix UNSUPORTED --> UNSUPPORTEDdiego2007-08-2822-53/+53
* Fix compilation by adding forgotten comma.iive2007-08-281-1/+1
* Conversion tables for Serbian/Croatian, Ukrainian and Greek charsets.voroshil2007-08-281-1/+49
* Move channels option parsing code into separate routine.voroshil2007-08-281-67/+72
* Implement X/27/0 packet decoding.voroshil2007-08-282-1/+70
* Clean up the way get_path is handled: Compile get_path.c to an object to linkdiego2007-08-281-2/+1
* Implement 8/30 format 1 teletext packet decodingvoroshil2007-08-282-0/+85
* in stream_control() remove redefinition of d in a case block, previously assi...nicodvb2007-08-271-1/+0
* in open_s() unified failure code in fail:nicodvb2007-08-271-20/+11
* (cosmetics) remove unnecessary ';'voroshil2007-08-261-1/+1
* Replace perror() with mp_msg()voroshil2007-08-261-31/+32
* Implement TVI_CONTROL_TUN_GET_SIGNAL in *BSD BT848 driver.voroshil2007-08-261-0/+11
* 10l: Move #endif upper to reflect changes in r24054.voroshil2007-08-261-1/+1
* Fix typovoroshil2007-08-261-1/+1
* Add teletext specification referencevoroshil2007-08-261-0/+3
* Remove ugly Russian language support hack.voroshil2007-08-261-11/+1
* Add support for Latin National Option Sub-Setsvoroshil2007-08-261-2/+46
* Enable decoding of packet X/24, it is usual teletext linevoroshil2007-08-261-2/+2
* 10l: "&" should be done after ">>"voroshil2007-08-251-1/+1
* Language bits in teletext page header arevoroshil2007-08-251-1/+1
* Remove redundant variable declarations.diego2007-08-251-4/+0
* Removed uninitialized variable.cehoyos2007-08-231-2/+1
* Automatic TV channels scanning ability for MPlayer.voroshil2007-08-236-1/+145
* Fix blue color for yv12 and i420 image formats in "automute" screenvoroshil2007-08-231-5/+7
* Fix [soc:eoc] stubs.voroshil2007-08-221-6/+10
* Set DVD speed earlier to avoid drive spinup during openreimar2007-08-211-1/+1
* Fix a bug in stream_read_qword_le due to sign extension from int to uint64_t.reimar2007-08-191-8/+2
* Sync libdvdread with version 0.9.5 (functional changes).diego2007-08-151-0/+1
* Fix compilation on BSD.diego2007-08-131-1/+1
* Remove unused variables.diego2007-08-131-3/+0
* Fix UDP select timeout.diego2007-08-121-2/+2
* Fix warning: too many arguments for formatcehoyos2007-08-081-1/+1
* Define teletext_control() in tvi_v4l.c and tvi_v4l2.c.cehoyos2007-08-081-0/+2
* Moved dvdtimetomsec to stream_dvd_common.c.cehoyos2007-08-044-23/+27
* cosmetics: removed commented code and small reindentationnicodvb2007-08-041-4/+1
* removed unused variablesnicodvb2007-08-041-6/+3
* Added missing newline.cehoyos2007-08-031-1/+1
* remove GNUism (case range)ivo2007-07-301-11/+4
* Teletext support for V4Lv1voroshil2007-07-301-0/+174
* 10l: wrong pointer was initialized (causes crash during startup).voroshil2007-07-302-2/+2
* Fix hopefully final 150 sector offset VCD bug. Caused no noticeable problems ...reimar2007-07-301-1/+2
* Simplify sun SCSI command generationreimar2007-07-301-26/+6
* big 10L of r9888 located: passed fd instead of pointer to sun_vcd_readreimar2007-07-301-1/+1
* Subtraction should be done after & operation.voroshil2007-07-301-1/+1
* Drop out overlooked debug linevoroshil2007-07-301-2/+1
* More doxygen commentsreimar2007-07-291-0/+10
* Teletext supportvoroshil2007-07-291-0/+179
* Teletext support.voroshil2007-07-294-0/+102
* Teletext support.voroshil2007-07-291-0/+1365
* Simplify and fix missing offset for Darwin vcd_get/set_msf functionsreimar2007-07-291-8/+2
* Make VCD work on little-endian macsreimar2007-07-291-3/+4
* Make vcd_get_track_end actually return the end, not the start on Darwinreimar2007-07-291-1/+1
* Make the vcd seek and get track end functions actually have an effectreimar2007-07-291-0/+2
* Fix wrong return type in darwin VCD codereimar2007-07-291-1/+1
* Replacing global variables in radio:// withvoroshil2007-07-292-74/+78
* Removing global variables from tv://voroshil2007-07-292-84/+0
* Removing global variables from tv://voroshil2007-07-291-33/+33
* Removing global variables from tv://voroshil2007-07-291-61/+61
* Removing global variables from tv://voroshil2007-07-291-30/+30
* Removing global variables from tv://voroshil2007-07-291-49/+49
* Removing global variables from tv://voroshil2007-07-291-1/+1
* Removing global variables from tv://voroshil2007-07-296-28/+36
* Removing global variables from tv://voroshil2007-07-292-19/+102
* Removing forward declarations of routines used only in tv.cvoroshil2007-07-292-8/+2
* Cosmetics.voroshil2007-07-291-10/+10
* Cosmetics: move two routines upvoroshil2007-07-291-34/+34
* cosmetics: misc typo fixesdiego2007-07-281-3/+3
* Remove completely pointless extra return statementsreimar2007-07-271-9/+0
* Fix MSF -> sector conversion being 150 sectors ofreimar2007-07-271-1/+2
* Simplify track length calculationreimar2007-07-271-18/+11
* Some more *BSD vcd_read simplificationreimar2007-07-271-41/+31
* Fix several 100lreimar2007-07-271-3/+3
* Factor out some common codereimar2007-07-271-28/+36
* Somewhat unified *BSD vcd readingreimar2007-07-273-196/+90
* READ_TOC for making *BSD code more similarreimar2007-07-272-6/+8
* One ifdef lessreimar2007-07-271-3/+1
* Simplify NetBSD vcd_read codereimar2007-07-271-21/+6
* vcd_inc_msf function also for freebsd vcd_readreimar2007-07-271-9/+15
* More VCD cosmeticsreimar2007-07-271-16/+16
* 100l, return is missing a valuereimar2007-07-261-1/+1
* Cosmetics to reduce diff between Free- and netBSD vcd stuffreimar2007-07-262-61/+74
* 10l, fix vcd netbsd compilationreimar2007-07-261-1/+1
* TOCADDR macro as first step to common *BSD vcd reading codereimar2007-07-262-45/+50
* Remove unnecessary #ifdef around the whole file.diego2007-07-091-3/+0
* Remove unnecessary #ifdef around the whole file.diego2007-07-091-3/+0
* ISO8859-1 --> UTF-8diego2007-07-091-1/+1
* Remove unnecessary flip for RGB in v4l1.voroshil2007-07-081-22/+1
* Avoid code duplication and ugly config.h hack by using av_strlcat/av_strlcpyreimar2007-07-055-14/+19
* Cygwin has had inttypes.h since version 1.5.diego2007-07-031-2/+0
* The file is compiled conditional to USE_DVDREAD so the #ifdef USE_DVDREADdiego2007-07-031-13/+0
* The header is always included conditional to USE_DVDREAD,diego2007-07-031-5/+0
* Do not use leading underscores in multiple inclusion guards, they are reserved.diego2007-07-0215-41/+41
* Cosmetics.voroshil2007-06-301-3/+3
* Don't override input= option value is no input id is passed in tv:// url.voroshil2007-06-301-2/+4
* wvx files (mimetype video/x-ms-wvx) are asx playlists. Fix bugzilla #750rtogni2007-06-292-2/+1
* remove file that was added by mistake.voroshil2007-06-291-0/+0
* Implemented tv://[<channel>][/<input_id>] url syntaxvoroshil2007-06-282-3/+34
* start= and end= parameters on realrtspurls may be optionally quoted with rtogni2007-06-241-0/+5
* get rid of useless *alloc castsreimar2007-06-241-5/+5
* Fix dvd:// subtitle handling to always report the MPEG stream id, becausereimar2007-06-241-7/+13
* Revert r23530.voroshil2007-06-215-1407/+0
* Teletext support for tv:// (v4l and v4l2 only)voroshil2007-06-105-0/+1407
* Set errno to 0 after printing it, not beforereimar2007-06-081-1/+1
* Fix compiler warnings.voroshil2007-06-083-5/+2
* Replace implicit use of fast_memcpy via macro by explicit use to allowreimar2007-06-051-7/+7
* Avoiding sscanf in cddb support reading more data with %s than buffer sizereimar2007-06-051-3/+3
* mjpeg support for v4l2 tv:// drivervoroshil2007-06-012-40/+46
* New "automute" tv:// option.voroshil2007-05-315-0/+75
* Remove some unused variables, patch by timwoj ieee org.diego2007-05-282-3/+1
* More fastmemcpy.h removalreimar2007-05-272-2/+0
* fixed off-by-one bug during chapter-listing; fixed by Jared Breland (list-mpl...nicodvb2007-05-261-2/+2
* remove unnecessary stubs which were not ever used.voroshil2007-05-244-26/+0
* make v4l1 driver work properly.voroshil2007-05-211-43/+45
* Fix OpenBSD compilation: strndup is a GNU extension.reimar2007-05-201-2/+2
* Fix track info being read for the wrong track introduced in r20598reimar2007-05-101-3/+3
* Missing -1 in the FreeBSD code to get the first CD track numberreimar2007-05-101-1/+1
* added proper GPL headers to new stream/pvr.h fileben2007-05-081-0/+23
* give credits to Sven for pvr channel navigationben2007-05-081-0/+1
* support for PVR channel navigation (patch by Sven Gothel <sgothel at jausoft ...ben2007-05-082-23/+824
* deprecated comment from the time the pvr code was half V4L2 and half IVTV spe...ben2007-04-301-2/+0
* (cosmetics) replace tabs with spacesvoroshil2007-04-291-970/+970
* typo fix.voroshil2007-04-291-1/+1
* (cosmetics) more indentation fixes.voroshil2007-04-281-59/+55
* cosmetics: Fix one more stray wrongly indented line.diego2007-04-281-1/+1
* cosmetics: Remove all trailing whitespace and tabs, indentation fixes.diego2007-04-281-1095/+1089
* Add Makefile variable for audio input that is enabled by V4L or radio capture.diego2007-04-221-7/+1
* after a DVDNAV_VTS_CHANGE event report the title being playednicodvb2007-04-221-0/+2
* cosmetics. restore empty line removed in r22985.voroshil2007-04-131-0/+1
* Move translatable strings from tv.c to help_mp*voroshil2007-04-131-51/+44
* Rework of *BSD BT848 detection for radio://voroshil2007-04-111-8/+11
* Cleanup real_calc_response_and_checksum()rtogni2007-04-091-10/+5
* Merge calc_response_string() into real_calc_response_and_checksum()rtogni2007-04-091-13/+6
* Simplify calc_response_string()rtogni2007-04-091-10/+3
* 10000000l learn to countrtogni2007-04-091-1/+1
* Size of response is known, no need to calculate itrtogni2007-04-091-4/+3
* The size of xor_table is known and fixed, no need to calculate itrtogni2007-04-091-8/+6
* implemented STREAM_CTRL_GET_CURRENT_TIME and STREAM_CTRL_SEEK_TO_TIME - dvdna...nicodvb2007-04-091-0/+20
* remove ugly #include from tvi_bsdbt848.cvoroshil2007-04-091-14/+12
* Fix typo in r22772 which causes compilation error under *BSD.voroshil2007-04-081-8/+8
* Ability to specify video and audio capture device namesvoroshil2007-04-051-8/+40
* Length of interleaved RTSP frames (0x24) in only 16 bit, the other byte rtogni2007-04-031-1/+2
* Check buffer size in header dump functionsrtogni2007-03-253-22/+84
* Use AV_WB* instead of swap+memcpy+swaprtogni2007-03-241-120/+46
* at open() discard front margin/empty sectors (fixes demuxing by libavformat);...nicodvb2007-03-241-1/+13
* Radio driver loading rework.voroshil2007-03-211-133/+86
* Declare eof only when stream 0 gets eofrtogni2007-03-201-1/+9
* Fix for realrtsp urls with more than 2 streams:rtogni2007-03-201-3/+5
* Add missing bogus norm warning for v4l2voroshil2007-03-191-0/+3
* Make sure bogus parameter will not be ignored by user. voroshil2007-03-191-1/+1
* Support application/smil as mimetype for smil-over-realrtsprtogni2007-03-181-1/+2
* New slave command: tv_step_freq <offset in MHz>voroshil2007-03-172-0/+16
* Remove unnecessary -I option from CFLAGS.diego2007-03-161-2/+0
* Allow to specify frequencies in channels option.voroshil2007-03-161-0/+7
* Fix live555 compilation when stream cache is disabled.diego2007-03-131-0/+2
* cosmetics: Fix indentation, reorder some lines for consistency.diego2007-03-131-30/+30
* Give more descriptive names to the source and library variables and splitdiego2007-03-131-29/+28
* add vcd:// for win32, patch by zuxy mengcompn2007-03-121-0/+130
* Source files should not contain non-ASCII characters.diego2007-03-121-1/+1
* add vcd:// for win32, patch by zuxy mengcompn2007-03-121-1/+25
* optionally reuse the socket if -reuse-socket is selected; patch by Yong Hwan ...nicodvb2007-03-081-0/+6
* truncate mencoder's output file if it exists, instead of overwriting just par...lorenm2007-03-052-2/+2
* print the disc_id without using a buffernicodvb2007-03-041-3/+3
* 10000l; in previous commit I allocated a buffer 1 byte too shortnicodvb2007-03-031-1/+1
* replaced 1 instances of sprintf() with snprintf(); patch by njkain gmail com.nicodvb2007-03-031-2/+3
* replaced 2 instances of sprintf() with snprintf() and one instancenicodvb2007-03-031-4/+3
* tv driver loading rework. As a side effect "-tv driver=help" option isvoroshil2007-03-017-41/+75
* winsocks expects an int in milliseconds instead of struct timeval to setivo2007-03-011-4/+12
* Replace MIN with FFMINreimar2007-03-011-1/+1
* Use libavutil AV_RB/AV_WB macros instead of defining out own variants.reimar2007-03-012-163/+148
* cleaned stream_seek() : simplified the alignment to STREAM_BUFFER_SIZE or s->...nicodvb2007-02-281-20/+4
* Add support for smil playlist served over realrtsprtogni2007-02-183-3/+17
* Simplify code by using separate variables for large common expressions.reimar2007-02-151-22/+26
* More strncat() misuses.rtogni2007-02-111-5/+5
* strncat() misuses, may have been exploitable.rtogni2007-02-111-3/+3
* More boundary checks for fixed-length arrays. Some of them may have been rtogni2007-02-111-4/+12
* Quick hack mostly for documentation purposes to make -aid work with mms://reimar2007-02-081-0/+10
* Fix a few gcc warnings, approved by Diego and Reimar.rathann2007-02-053-4/+2
* Use defined() syntax instead without ().reimar2007-02-041-1/+1
* Add timeout to tcp connections, avoid hanging forever.rtogni2007-02-041-0/+7
* Fix base64_encode() max output length checking.uau2007-01-281-4/+3
* Accept rdt packets with "is-reliable" flag setrtogni2007-01-281-1/+1
* Fix FSF address and otherwise broken license headers.diego2007-01-223-9/+5
* at open() assign *file_format=DEMUXER_TYPE_MPEG_PS to avoid useless demuxer p...nicodvb2007-01-162-0/+5
* GNU/kFreeBSD support, closes Bugzilla #704.diego2007-01-103-6/+6
* Don't drop last rdt packet on eofrtogni2007-01-093-2/+9
* removed static declaration before non-instantiated struct; patch by cehoyos a...nicodvb2007-01-091-1/+1
* Two crash issues fixed:voroshil2007-01-081-1/+9
* Make sure we do not crash when eof is reset, e.g. due to an attempt to seek.reimar2007-01-071-0/+1
* in dvb_get_config() open the frontend in READ_ONLY mode for probing (worksaro...nicodvb2007-01-071-1/+1
* reindentednicodvb2007-01-061-16/+16
* init to 0 feparams before tuningnicodvb2007-01-061-0/+1
* removed useless reporting codenicodvb2007-01-061-55/+3
* moved actual tuning code from check_status() to tune_it()nicodvb2007-01-061-18/+12
* don't add pid 0 if it's already present in the listnicodvb2007-01-061-6/+5
* More free() that were forgotten in r21806 memleak fixrtogni2007-01-011-0/+3
* Memleak fix (implement sdpplin_free() and use it)rtogni2007-01-012-1/+28
* Fix invalid memory access if identifier is unknownrtogni2007-01-011-1/+1
* Fix potential buffer overflow in asm rules matching codertogni2006-12-313-3/+9
* reindentationnicodvb2006-12-301-13/+13
* Fix double free of *http_hdr at server error.iive2006-12-301-2/+2
* replace call to UDFFindFile() (that is not part of the public API) with DVDOp...nicodvb2006-12-231-6/+6
* fix compilation on the most delicious variant of unix (mingw) that lacks S_IR...nicodvb2006-12-211-2/+7
* reindented after yesterday's commitnicodvb2006-12-201-2/+2
* support for writing over smb sharesnicodvb2006-12-191-6/+23
* in WRITE mode open the output file with mode 0666; umask will filter itnicodvb2006-12-191-1/+1
* support functions for writing to streamsnicodvb2006-12-181-0/+28
* implemented STREAM_CTRL_GET_SIZEnicodvb2006-12-181-0/+17
* new STREAM_CTRL_GET_SIZE to get size of output streamnicodvb2006-12-181-0/+1
* in STREAM_WRITE mode open the stream with O_RDWR|O_CREAT, S_IRUSR|S_IWUSR and...nicodvb2006-12-181-3/+6
* added member and definitions for output streamsnicodvb2006-12-181-0/+3
* support for limiting dvd speed; patch by Tobias Diedrich (ranma tdiedrich se)nicodvb2006-12-171-0/+87
* simplified aid management in dvdnav_lang_from_aid(); patch by Joakim Pattenicodvb2006-12-151-7/+1
* Force lavf on flv streams. Closes bugzilla #354rtogni2006-12-151-0/+4
* implemented dvdnav_lang_from_aid() to retrieve audio languagenicodvb2006-12-142-0/+31
* added dvdnav_aid_from_lang() to support -alangnicodvb2006-12-142-0/+45
* Add missing buf.memory = V4L2_MEMORY_MMAP; initializations.reimar2006-12-121-0/+3
* Make sure closesocket is called.reimar2006-12-101-0/+10
* STREAM_UNSUPPORTED is -1, so use the former for return value in all places.reimar2006-12-101-4/+2
* Make sure stream->fd is set correct (esp. to -1 on error when fd is closed)reimar2006-12-101-1/+2
* added function to return the language of the specified subtitle id. Patch bynicodvb2006-12-102-0/+22
* ID_SUBTITLE_ID should show the -sid number, not the vobsub id also for dvd subs.reimar2006-12-101-1/+1
* Fix misplaced http_freereimar2006-12-091-1/+1
* Fix potential endless loop in http_streaming_start duereimar2006-12-091-0/+1
* Fix lots and lots of potential memory/fd leaks in http_streaming_startreimar2006-12-091-19/+28
* export spu palette; part of a patch by Otvos Attilanicodvb2006-12-092-0/+13
* Avoid memory and fd leaks in asf streaming open code.reimar2006-12-091-15/+15
* Forgotten closesocket on error, patch byreimar2006-12-091-1/+4
* Close fd on error.reimar2006-12-091-1/+2
* Hack around libavutil/bswap.h compilation problems due to always_inline undef...reimar2006-12-073-3/+3
* Simplify NEXT_LINE macro and put most of it in a separate function.reimar2006-12-061-16/+16
* remove useless and incorrect const-removing castreimar2006-12-061-1/+1
* Do not define _GNU_SOURCE, it is not necessary and causes a warning if it isreimar2006-12-061-2/+0
* Make sure invalid protocols are rejected instead of treatedreimar2006-12-051-1/+2
* Add full support for en-/disabling cddb supportreimar2006-12-041-3/+7
* remove headers included twiceaurel2006-12-031-2/+0
* use strchr() instead of index()aurel2006-12-031-1/+1
* doxygenized dvdnav_sid_from_lang() and dvdnav_number_of_subs()nicodvb2006-12-021-0/+11
* Move system headers before libavutil headers to work around build issues ondiego2006-12-021-3/+3
* Remove bswap.h, use libavutil/bswap.h instead.diego2006-11-293-3/+6
* cosmetical reformattingnicodvb2006-11-271-13/+14
* feed the content of NAV_PACKET to the demuxernicodvb2006-11-271-0/+3
* Add a config.mak variable for CDDB.diego2006-11-271-3/+1
* FFmpeg-style dependency declarationdiego2006-11-271-96/+51
* cosmetics: Merge SRCS together, alphabetical order, whitespace.diego2006-11-271-32/+16
* cosmetics:indentationdiego2006-11-271-37/+37
* Untangle dependencies that are handled by configure.diego2006-11-271-5/+5
* Remove unused LIBAV_INC variable.diego2006-11-271-1/+1
* Merge common parts of all Makefiles into one file included by all.diego2006-11-261-28/+4
* match exactly card number N specified, rather than the N-th actually usablenicodvb2006-11-261-3/+12
* keep nav highlight event in dvdnav priv structureben2006-11-252-12/+16
* Remove superfluous comment.diego2006-11-251-3/+0
* support for comma-separated language codes in -slangnicodvb2006-11-251-1/+6
* spurious () like in ({code;}) probably is not valid C, icc 9, definitelyreimar2006-11-251-2/+2
* better nav highlight handlingben2006-11-252-4/+13
* removed unused members and variablesnicodvb2006-11-252-19/+0
* COSMETICS: consistently reformatted after ben's messnicodvb2006-11-251-6/+4
* added code to identify subs language and count; needed for forthcoming suppor...nicodvb2006-11-252-0/+30
* support for dvdnav menu buttons overlay as simple alpha boxes (rework from Ot...ben2006-11-251-0/+48
* cosmeticsreimar2006-11-211-1/+1
* Also support absolute url redirection, e.g. http://www.youtube.com/v/buKaqRG2SFAreimar2006-11-211-1/+6
* Unify dep/depend targets.diego2006-11-201-3/+1
* new slave command: radio_step_freqvoroshil2006-11-192-0/+22
* riformatted after previous commitnicodvb2006-11-191-2/+2
* if in the list of pids appears at least one 8192 (while TS) remove all other ...nicodvb2006-11-191-1/+18
* Add *BSD BT848 radio supportvoroshil2006-11-182-1/+156
* Rename libdvdread to dvdread. We really only include only the dvdreaddiego2006-11-181-4/+4
* add public wrapper for get_frequencyvoroshil2006-11-172-0/+16
* Change verbosity level from MSGL_V to MSGL_INFO for "Current frequency is"voroshil2006-11-171-1/+1
* consistency fix: STREAM_CTRL_GET_TIME_LENGTH and STREAM_CTRL_GET_CURRENT_TIME...nicodvb2006-11-122-4/+3
* make fail STREAM_CTRLs related to seeking/fetching time/chapter when the cach...nicodvb2006-11-111-2/+9
* idenfify now shows the timings of chapters of the chosen pgcnicodvb2006-11-101-0/+26
* one more deuglificationnicodvb2006-11-091-1/+2
* COSMETICS: renamed dvdnav_priv to privnicodvb2006-11-091-56/+56
* Add missed 'break'.voroshil2006-11-091-0/+2
* Move non driver-specific block to non-driver specific procedure, to avoidvoroshil2006-11-091-17/+15
* changed ugly sizeof(*type_ptr) width sizeof(type)nicodvb2006-11-081-1/+1
* COSMETICS: reformatted this ugly mess in a consistent mannernicodvb2006-11-081-70/+71
* Support URL redirections that do not specify full URL.reimar2006-11-083-2/+21
* Adding ability to check allowed frequency range.voroshil2006-11-081-2/+17
* support for -dvdanglenicodvb2006-11-081-0/+3
* implemented STREAM_CTRL_GET_CURRENT_TIME and STREAM_CTRL_SEEK_TO_TIME (precis...nicodvb2006-11-072-0/+111
* added definitions of STREAM_CTRL_GET_CURRENT_TIME STREAM_CTRL_SEEK_TO_TIMEnicodvb2006-11-071-0/+2
* Replace enneccesery O_RDWR with O_RDONLYvoroshil2006-11-071-1/+1
* Restoring volume level of radio card on exit.voroshil2006-11-071-0/+3
* printf->mp_msgrtogni2006-11-051-13/+14
* Fix compilation: forgotten mp_msg.h includereimar2006-11-051-0/+1
* printf ->mp_msgrtogni2006-11-051-8/+8
* Do not use abort()rtogni2006-11-051-7/+7
* cosmetics: reformatted with only tabsnicodvb2006-11-041-8/+6
* use calloc() instead of malloc()nicodvb2006-11-041-1/+1
* nonsense removal: compare old and new frequency in order to skip tuningnicodvb2006-11-042-43/+3
* changed email addresshenry2006-11-042-2/+2
* Streamline and simplify internal vs external libdvdread handling.diego2006-11-034-9/+9
* libmpdvdkit2 --> libdvdread, it just contains libdvdread now.diego2006-11-031-4/+4
* More code shufflingreimar2006-11-011-26/+13
* cosmetics: move WIN32 read_toc code to allow for summarizing more commonreimar2006-11-011-22/+24
* Avoid code duplication for "last" toc entry.reimar2006-11-011-28/+7
* simplify/unify read_tocreimar2006-11-011-28/+28
* Factor out common code in stream_cddb read_toc function.reimar2006-11-011-35/+11
* Remove useless codereimar2006-11-011-2/+0
* printf -> mp_msgrtogni2006-10-301-7/+10
* Realrtsp authenticationrtogni2006-10-305-6/+58
* support for -chapter option (same semanthics as for dvd://)nicodvb2006-10-231-0/+16
* simplified code to handle titleset transition (removed useless assignment)nicodvb2006-10-231-2/+1
* spell fixnicodvb2006-10-231-1/+1
* don't play any other title other than N when N is specified (with dvdnav://N)nicodvb2006-10-232-0/+9
* bails out if cdparanoia can't read cd (avoid lockup)ben2006-10-131-0/+2
* slight overall verbosity reductiondiego2006-10-122-3/+3
* gcc 2.95 fixods152006-10-111-1/+1
* added OSD audio switching visualizationptt2006-10-112-0/+14
* Change occurrences of "(int)*(void **)arg" to "*(int *)arg".uau2006-10-101-17/+17
* Forgotten http_free on send error.reimar2006-10-081-0/+1
* Print current DVD title as ID_DVD_CURRENT_TITLE.corey2006-10-061-0/+1
* warn the user to disable the cache when playing dvdnav streamsnicodvb2006-10-041-0/+2
* removed ivtv driver dependancy in favor of native V4L2 MPEG API (requires Lin...ben2006-09-271-242/+264
* cosmetic renames because pvr support will soon be less ivtv driver dependantben2006-09-251-11/+11
* made file-static new_dvdnav_stream() and dvdnav_stream_read()nicodvb2006-09-201-2/+2
* removed definitions of no more used or file-static functionsnicodvb2006-09-201-12/+0
* introduced new MP_CMD_DVDNAV_MOUSECLICK command (bound to mouse0);nicodvb2006-09-192-0/+13
* removed dead codenicodvb2006-09-191-117/+0
* Іnitial button value is -1. Only (button>0) is a correct button selection.jonas2006-09-191-1/+1
* permit seeking to 0: there's no reason to prevent itnicodvb2006-09-181-6/+3
* in the previous commit I forgot to set s->end_pos=0nicodvb2006-09-181-0/+1
* at titleset change call update_title_len() to reset stream->end_posnicodvb2006-09-181-0/+4
* don't seek until dvdnav_get_position() returns something meaningfulnicodvb2006-09-181-1/+8
* Restore original copyright notice as found in xine and xine-mms where thisdiego2006-09-181-7/+27
* report mouse coordinates after movement to dvdnav; this permits to enable but...nicodvb2006-09-162-0/+15
* at start, when not playing a specific titleset, try to call the Title menu (a...nicodvb2006-09-151-1/+3
* Change demuxer for "application/octet-stream" http streams fromeugeni2006-09-151-1/+1
* in mp_dvdnav_handle_input() update current button only if the status of the p...nicodvb2006-09-151-1/+2
* dvdnav_stream_reset() should be called on dvdnav_priv->dvdnav not on dvdnav_p...nicodvb2006-09-151-1/+1
* removed code that propagated the slave command dvdnav_event that hasn't been ...nicodvb2006-09-151-12/+0
* when cmd == MP_CMD_DVDNAV_SELECT set reset=1 only if dvdnav_button_activate()...nicodvb2006-09-151-1/+1
* * remove extern definitions of functions in .c filesattila2006-09-122-2/+7
* ability to pass channel name (not only number) to radio_set_channelvoroshil2006-09-111-1/+16
* at start, reset dvdnav at the beginning of the stream after the first read (t...nicodvb2006-09-101-0/+1
* try to start from the root menu skipping all intros when playing dvdnav://-1;...nicodvb2006-09-101-1/+3
* permit to select previous dvdnav menu, in the order chapter->title->rootnicodvb2006-09-101-0/+15
* in mp_dvdnav_handle_input() assign the currently selected button, shown in th...nicodvb2006-09-092-2/+4
* added mp_dvdnav_handle_input to handle user's input (revived from the reposit...nicodvb2006-09-092-0/+41
* if no track number specified play the whole disc, or the menus can't be shown...nicodvb2006-09-091-1/+4
* detect dvdnav before mpdvdkit and dvdread; if dvdnav is set mplayer will use ...nicodvb2006-09-091-0/+5
* Add #include <limits.h>, fixes build on Solaris 8.diego2006-09-071-0/+1
* Remove stray and superflous #ifdef checks.diego2006-09-011-5/+0
* fix build on some old 2.6 kernels, patch by Gernot Hillierben2006-09-011-0/+1
* The FSF changed postal address.diego2006-09-012-2/+2
* Check for requirements at configure-time, not at run-time.diego2006-08-311-5/+1
* Do not cast calloc/malloc resultsreimar2006-08-311-5/+5
* Avoid a potential strdup(NULL)rtogni2006-08-301-5/+1
* complete range of frequencies for Ireland; patch by gmccullagh gmail comnicodvb2006-08-291-10/+38
* Radio support, patch by Vladimir Voroshilov (voroshil gmail com)reimar2006-08-285-0/+1155
* Remove XMMS_CFLAGS from CFLAGS, the variable is never set.diego2006-08-271-1/+1
* Fix mingw compilationreimar2006-08-261-1/+1
* Cosmetics: recommit patch changing return values to definesreimar2006-08-261-11/+11
* Recreate tcp.c as partial copy from network.creimar2006-08-261-0/+242
* remove to allow readding as copy from network.creimar2006-08-261-291/+0
* implemented STREAM_CTRL_GET_NUM_CHAPTERSnicodvb2006-08-211-0/+11
* implemented STREAM_CTRL_GET_NUM_CHAPTERSnicodvb2006-08-211-0/+6
* added STREAM_CTRL_GET_NUM_CHAPTERS to get total number of chapters from the s...nicodvb2006-08-211-0/+1
* missing header for struct timevalrfelker2006-08-202-0/+2
* Avoid crash if initialization failed.reimar2006-08-201-0/+1
* Handle 303 (See Other) redirect, part of a patch by Benjamin Zores (ben at ge...reimar2006-08-201-0/+2
* corrected _very_ misleading commentnicodvb2006-08-191-1/+1
* implemented STREAM_CTRL_GET_TIME_LENGTH (duration of the pgc playing)nicodvb2006-08-192-0/+15
* removed #if-0 code that dereferenced dvdnav_t's internal members, violating ...nicodvb2006-08-191-11/+0
* 10l: misplaced brace in a switchnicodvb2006-08-191-1/+1
* Print DVD audio channel and subtitle track information in non-verbose mode,diego2006-08-191-9/+9
* implemented seeking to chapternicodvb2006-08-191-0/+29
* sanity check: since chapter is 0-based it can't exceed nr_of_ptts-1nicodvb2006-08-191-1/+1
* support for seeking to chapter and getting current playing chapternicodvb2006-08-181-1/+38
* new stream_ctrl to get currently playing chapter (needed for stream-driven re...nicodvb2006-08-181-0/+1
* new STREAM_CTRL_SEEK_TO_CHAPTER (will be used by streams dvd[nav], maybe [s]vcdnicodvb2006-08-181-0/+1
* Explicitly include libmpcodecs/img_format.h and libvo/fastmemcpy.h.diego2006-08-186-6/+6
* Move all internal -I parameters to the front of CFLAGS to avoid using externaldiego2006-08-171-1/+1
* isolated tcp socket code from network.c to a dedicated fileben2006-08-0512-209/+331
* missing ifndef/define/endif couple in udp headerben2006-08-051-0/+5
* kill a warning in getsockopt()ben2006-08-051-1/+2
* kill a warning in getsockopt()ben2006-08-051-1/+2
* removed some useless includesben2006-08-041-7/+0
* moved some definitions from rtp.h to rtp.c as they're not exported or used an...ben2006-08-042-18/+18
* removed udp socket creation code from rtp stack to a new dedicated udp helper...ben2006-08-047-115/+216
* fix compilation of librtspben2006-08-041-0/+1
* few cosmectic changes to remove duplicationben2006-08-041-6/+1
* split rtp stack, udp input layer and rtp input layer from rtp.cben2006-08-046-84/+229
* proper inclusion of demuxer.h (including libmpdemux in Makefile only was to m...ben2006-08-0416-19/+17
* moved pnm.h to stream/ (where it belongs)ben2006-08-041-0/+43
* renamed dvdnav_stream to stream_dvdnav for consistencyben2006-08-033-2/+2
* added dedicated file for mf:// inputben2006-08-035-5/+51
* mf.[hc] belong to libmpdemuxben2006-08-033-174/+1
* renamed cue_read.c to stream_cue.c for consistencyben2006-08-032-3/+1
* removed useless cue_read.h fileben2006-08-032-8/+0
* renamed dvbin.c to stream_dvb.c for consistencyben2006-08-032-1/+1
* conversion from stream_null to stream_tv was missing stream typeben2006-08-032-0/+2
* correctly report audio inputben2006-08-031-10/+2
* Move conditional compilation of cdinfo.c to the build system.diego2006-08-022-7/+2
* removed deprecated test.c file from libmpdemuxben2006-07-311-2/+2
* add an explicit tv stream input instead of the previous hack in stream_nullben2006-07-314-16/+56
* renamed cddX stream interface to stream_cddX for consistencyben2006-07-313-2/+2
* introduce new 'stream' directory for all stream layer related components and ...ben2006-07-3185-0/+32320