summaryrefslogtreecommitdiffstats
path: root/libvo
Commit message (Collapse)AuthorAgeFilesLines
* Reuse the osx_common convert_key function to convert OSX keycodes to MPlayerreimar2009-08-281-52/+3
| | | | | | | keycodes instead of its own switch-case in vo_corevideo.m git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29575 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move aspect change handling from vo_quartz to osx_common.reimar2009-08-283-12/+34
| | | | | | | | This could probably be even moved to video_out, though the names should be improved. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29574 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add osx_common.c and move the keycode conversion (OSX to MPlayer) there.reimar2009-08-284-190/+47
| | | | | | | | Also get rid of our own defines for the keycodes and instead use the predefined ones from Carbon. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29573 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the standard MPlayer aspect handling instead of reimplementing our own ↵reimar2009-08-281-80/+42
| | | | | | in vo_quartz. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29572 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused movie_aspect extern declaration.reimar2009-08-271-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29571 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use lookup_keymap_table function with data structure instead of huge switch-casereimar2009-08-271-50/+33
| | | | | | | for mapping OSX keys onto MPlayer keys in vo_quartz. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29570 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable calc_src_dst_rects for windowed aspect and panscan.reimar2009-08-271-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29569 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove panscan related conditions and code that only breaks future windowedreimar2009-08-271-14/+0
| | | | | | | aspect and panscan without any real benefit. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29568 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make gl2 code capable of windowed aspect and panscan (no user option to ↵reimar2009-08-271-4/+4
| | | | | | enable it yet though). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29567 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add infrastructure and test code to enable aspect scaling and panscan in ↵reimar2009-08-274-9/+28
| | | | | | windowed mode. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29566 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix video placement with -vo gl2 -fs -wid.reimar2009-08-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29565 b3059339-0415-0410-9bf9-f77b7e298cf2
* -vo gl2 resize does not need to modify its arguments, so pass int instead of ↵reimar2009-08-271-12/+12
| | | | | | | | | int *. In particular, this avoids modifying vo_dwidth/vo_dheight which should only be modified by the "windowing layer" (w32_common, x11_common). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29564 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify -vo gl ass border etc. dimension calculation one bit more.reimar2009-08-271-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29563 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless code that has no effect.reimar2009-08-271-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29562 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify and fix ass border calculations for -vo gl and -wid -fs mode.reimar2009-08-271-6/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29561 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make panscan cover the same range in -wid -fs mode as in normal mode.reimar2009-08-271-8/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29560 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable -keepaspect with -wid in w32_common code.reimar2009-08-271-1/+1
| | | | | | | This does not work in a useful way and was unintentionally "enabled" when -wid was made to use a separate window. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29559 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix aspect_fit to work correctly when borders need to be added on top andreimar2009-08-271-2/+2
| | | | | | | | bottom, previous code accidentally compared against screen dimensions, resulting in cropping instead of added borders. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29558 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forgotten changes to aspect code to handle -wid with -fs.reimar2009-08-272-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29557 b3059339-0415-0410-9bf9-f77b7e298cf2
* First attempts at supporting -fs with -wid, -vo gl on X11 only so farreimar2009-08-272-1/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29556 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace WORDS_BIGENDIAN by HAVE_BIGENDIAN in all internal code.diego2009-07-264-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29443 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use memcpy_pic2 instead of reimplementing it.reimar2009-06-261-8/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29402 b3059339-0415-0410-9bf9-f77b7e298cf2
* Close /dev/tty again on uninit.reimar2009-06-261-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29401 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix indentation broken in last patchreimar2009-06-261-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29400 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of completely pointless vt_doit variablereimar2009-06-261-5/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29399 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, use fopen directly instead of open + fdopenreimar2009-06-261-7/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29398 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a single err_out in fb_preinit, also fixes a leak when vo_dbpp has anreimar2009-06-261-6/+8
| | | | | | | unexpected value. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29397 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use FFALIGN and FFMAX3reimar2009-06-261-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29396 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless castsreimar2009-06-261-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29395 b3059339-0415-0410-9bf9-f77b7e298cf2
* fbdev: remove pointless ()reimar2009-06-261-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29394 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the RESET_GEOMETRY macro in one more place instead of duplicating its code.reimar2009-06-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29392 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, RESET_GEOMETRY must reset values to INT_MIN, not -1, -1 is areimar2009-06-261-1/+1
| | | | | | | | valid value for e.g. the offsets. Patch by Benson Mitchell [benson mitchell gmail com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29391 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix missing event on move that breaks xmga window movementattila2009-06-191-1/+2
| | | | | | | broken in r28541 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29374 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable fontconfig support by default. This change takes only in effect,siretart2009-06-171-1/+1
| | | | | | | if fontconfig support is actually compiled in. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29370 b3059339-0415-0410-9bf9-f77b7e298cf2
* When used with shared_buffer, there's no need for a NSApp object, which ↵adrian2009-05-181-4/+6
| | | | | | causes MPlayer to be marked as unresponsive. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29314 b3059339-0415-0410-9bf9-f77b7e298cf2
* When used with shared_buffer, autorelease in each flip_page so objects don't ↵adrian2009-05-181-2/+4
| | | | | | accumulate until exit. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29313 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmetics: Remove all trailing whitespace.diego2009-05-1358-1288/+1288
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29305 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use flag CWBackPixel when calling vo_x11_create_vo_window():cehoyos2009-05-081-1/+3
| | | | | | | | | It leads to VDPAU errors after video aspect ratio changes. Patch by Stephen Warren. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29276 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing 'void' to parameterless function declarations.diego2009-05-046-18/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29254 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename macosx video output driver to corevideo.diego2009-05-043-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29252 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace QuickTime.h #include with Carbon.h, which is really needed.diego2009-05-041-1/+1
| | | | | | | patch by Emanuele Giaquinta git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29249 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change getdladdr to always use dlopen, dlsym and then dlclose.reimar2009-04-231-11/+6
| | | | | | | | | Performance is not really important and dlsym(0, ...) is not defined while the more correct dlsym(RTLD_DEFAULT, ...) is a GNUism (although POSIX does reserve RTLD_DEFAULT). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29224 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a signedness issue that caused a warning to be wrongfully printed at ↵gpoirier2009-04-211-1/+1
| | | | | | | | | runtime. Patch by Adrian Stutz %adrian A sttz P ch% git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29218 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify error message output and update error messages.diego2009-04-201-13/+13
| | | | | | | patch by Adrian Stutz, adrian sttz ch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29211 b3059339-0415-0410-9bf9-f77b7e298cf2
* follow renaming of pbBufPtr() to put_bits_ptr() by stefanorik2009-04-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29178 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix a memory leak leading to ~80 bytes being leaked at each call to flip_page.gpoirier2009-04-131-0/+1
| | | | | | | | | Patch by Alexander Strange %astrange A ithinksw.com% Original thread: date: Thu, Apr 9, 2009 at 4:47 AM git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29177 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename RUNTIME_CPUDETECT to CONFIG_RUNTIME_CPUDETECT and always define it.ramiro2009-04-082-31/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29154 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary malloc.h #includes and related #ifdeffery.diego2009-04-021-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29126 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prefer vo vdpau over vo xv where available.cehoyos2009-03-311-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29118 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of nonsensical limits on -geometry x, y,w and h values, they onlyreimar2009-03-311-15/+8
| | | | | | | cause confusion on multi-monitor setups. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29112 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support IMGFMT_NV12 for vo vdpau.cehoyos2009-03-301-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29109 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure we do not accidentally use the vdp_get_error_string from thereimar2009-03-301-0/+1
| | | | | | | previous initialization. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29106 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for IMGFMT_YUY2 and IMGFMT_UYVY to vo vdpau.cehoyos2009-03-291-2/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29105 b3059339-0415-0410-9bf9-f77b7e298cf2
* VDPAU supports IMGFMT_I420 and IMGFMT_IYUV.cehoyos2009-03-291-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29104 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently use MP_MAX_PLANES as size for plane pointer/stride arrays in libvo.reimar2009-03-294-19/+17
| | | | | | | | This might avoid some issues since sws_scale in some cases assumes these have at least 4 valid entries. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29101 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: Reindent after last commit.cehoyos2009-03-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29094 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Don't use MP_IMGFIELD_TOP_FIRST if MP_IMGFIELD_ORDERED is not set.cehoyos2009-03-291-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29093 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify vdpau deinterlacing code and fix timing for deint=2.cehoyos2009-03-251-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29061 b3059339-0415-0410-9bf9-f77b7e298cf2
* New VDPAU deinterlacing code needs one reference surface less for software ↵cehoyos2009-03-241-1/+1
| | | | | | decoding. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29053 b3059339-0415-0410-9bf9-f77b7e298cf2
* New vdpau deinterlacing code needs one reference surface less.cehoyos2009-03-241-6/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29052 b3059339-0415-0410-9bf9-f77b7e298cf2
* Stephen Warren reported that VDPAU deinterlacing did not work correctly.cehoyos2009-03-241-4/+10
| | | | | | | New static function push_deint_surface() by Reimar. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29051 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change function call order in config().cehoyos2009-03-221-10/+5
| | | | | | | | This stops creating a window even if hardware decoding is certainly going to fail. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29040 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Only try to create vdpau decoder if hardware decoding is intended.cehoyos2009-03-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29028 b3059339-0415-0410-9bf9-f77b7e298cf2
* Test if create_vdp_decoder() might succeed by calling it from config()cehoyos2009-03-211-0/+3
| | | | | | | | | | | | | | | with a small value for max_reference_frames. This does not make automatic recovery by using software decoder possible, but lets MPlayer fail more graciously on - actually existing - buggy hardware that does not support certain H264 widths when using hardware accelerated decoding (784, 864, 944, 1024, 1808, 1888 pixels on NVIDIA G98) and if the user tries to hardware-decode more samples at the same time than supported. Might break playback of H264 Intra-Only samples on hardware with very little video memory. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29027 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change return value for create_vdp_decoder().cehoyos2009-03-211-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29026 b3059339-0415-0410-9bf9-f77b7e298cf2
* Factorize create_vdp_decoder().cehoyos2009-03-211-32/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@29024 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow to use vdpau temporal deinterlacers with hardware accelerated decoding.cehoyos2009-03-181-4/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28991 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add chroma-deint option to vo vdpau (nochroma-deint speeds up deinterlacing).cehoyos2009-03-161-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28979 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check mpi type before returning an DR buffer in get_image, fixes jerkinessreimar2009-03-161-0/+3
| | | | | | | with MPEG1/2 and -dr -slices git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28974 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move initialisation of deint_surfaces[] to free_video_specific().cehoyos2009-03-151-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28971 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update -vo vdpau command line help.cehoyos2009-03-151-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28970 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: Fix whitespace.cehoyos2009-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28969 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initial support for advanced VDPAU deinterlacers (software-decoded videocehoyos2009-03-151-9/+34
| | | | | | | | | only). With a lot of help from Reimar git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28968 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix warning: Add forgotten 'int' to variable declaration.iive2009-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28965 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Remove file names from file header, it only causes trouble.diego2009-03-152-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@28959 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete extra elements from opt_t struct initialization.diego2009-03-158-37/+37
| | | | | | | Fixes a bunch of 'excess elements in str