summaryrefslogtreecommitdiffstats
path: root/libvo
Commit message (Expand)AuthorAgeFilesLines
* Merge svn changes up to r29277Uoti Urpala2009-05-0812-55/+53
|\
| * Do not use flag CWBackPixel when calling vo_x11_create_vo_window():cehoyos2009-05-081-1/+3
| * Add missing 'void' to parameterless function declarations.diego2009-05-046-18/+18
| * Rename macosx video output driver to corevideo.diego2009-05-043-21/+21
| * Replace QuickTime.h #include with Carbon.h, which is really needed.diego2009-05-041-1/+1
| * Change getdladdr to always use dlopen, dlsym and then dlclose.reimar2009-04-231-11/+6
| * Fix a signedness issue that caused a warning to be wrongfully printed at runt...gpoirier2009-04-211-1/+1
| * Unify error message output and update error messages.diego2009-04-201-13/+13
| * follow renaming of pbBufPtr() to put_bits_ptr() by stefanorik2009-04-131-1/+1
| * fix a memory leak leading to ~80 bytes being leaked at each call to flip_page.gpoirier2009-04-131-0/+1
* | x11_common.h: Remove declarations of some nonexistent variablesUoti Urpala2009-05-041-3/+0
* | Merge svn changes up to r29154Uoti Urpala2009-04-092-31/+31
|\|
| * Rename RUNTIME_CPUDETECT to CONFIG_RUNTIME_CPUDETECT and always define it.ramiro2009-04-082-31/+31
* | Merge branch 'ordered_chapters'Uoti Urpala2009-04-086-7/+5
|\ \
| * | VO: Don't reset pause status in VO config() functionsUoti Urpala2009-04-025-6/+0
| * | VO: Don't force window position in X11 VOsUoti Urpala2009-03-311-1/+5
* | | vo_xv: Fix context Shminfo table sizeUoti Urpala2009-04-051-1/+1
* | | Make VO xv preferred over vdpau againUoti Urpala2009-04-021-3/+3
* | | Merge svn changes up to r29134Uoti Urpala2009-04-022-6/+3
|\ \ \ | | |/ | |/|
| * | Remove unnecessary malloc.h #includes and related #ifdeffery.diego2009-04-021-3/+0
| * | Prefer vo vdpau over vo xv where available.cehoyos2009-03-311-3/+3
* | | Merge svn changes up to r29117Uoti Urpala2009-04-0120-153/+238
|\| |
| * | Get rid of nonsensical limits on -geometry x, y,w and h values, they onlyreimar2009-03-311-15/+8
| * | Support IMGFMT_NV12 for vo vdpau.cehoyos2009-03-301-0/+6
| * | Make sure we do not accidentally use the vdp_get_error_string from thereimar2009-03-301-0/+1
| * | Add support for IMGFMT_YUY2 and IMGFMT_UYVY to vo vdpau.cehoyos2009-03-291-2/+20
| * | VDPAU supports IMGFMT_I420 and IMGFMT_IYUV.cehoyos2009-03-291-0/+2
| * | Consistently use MP_MAX_PLANES as size for plane pointer/stride arrays in libvo.reimar2009-03-294-19/+17
| * | Cosmetics: Reindent after last commit.cehoyos2009-03-291-1/+1
| * | 10l: Don't use MP_IMGFIELD_TOP_FIRST if MP_IMGFIELD_ORDERED is not set.cehoyos2009-03-291-0/+3
| * | Simplify vdpau deinterlacing code and fix timing for deint=2.cehoyos2009-03-251-7/+7
| * | New VDPAU deinterlacing code needs one reference surface less for software de...cehoyos2009-03-241-1/+1
| * | New vdpau deinterlacing code needs one reference surface less.cehoyos2009-03-241-6/+5
| * | Stephen Warren reported that VDPAU deinterlacing did not work correctly.cehoyos2009-03-241-4/+10
| * | Change function call order in config().cehoyos2009-03-221-10/+5
| * | 10l: Only try to create vdpau decoder if hardware decoding is intended.cehoyos2009-03-211-1/+1
| * | Test if create_vdp_decoder() might succeed by calling it from config()cehoyos2009-03-211-0/+3
| * | Change return value for create_vdp_decoder().cehoyos2009-03-211-3/+3
| * | Factorize create_vdp_decoder().cehoyos2009-03-211-32/+40
| * | Allow to use vdpau temporal deinterlacers with hardware accelerated decoding.cehoyos2009-03-181-4/+24
| * | Add chroma-deint option to vo vdpau (nochroma-deint speeds up deinterlacing).cehoyos2009-03-161-0/+11
| * | Check mpi type before returning an DR buffer in get_image, fixes jerkinessreimar2009-03-161-0/+3
| * | Move initialisation of deint_surfaces[] to free_video_specific().cehoyos2009-03-151-4/+4
| * | Update -vo vdpau command line help.cehoyos2009-03-151-4/+4
| * | Cosmetics: Fix whitespace.cehoyos2009-03-151-1/+1
| * | Initial support for advanced VDPAU deinterlacers (software-decoded videocehoyos2009-03-151-9/+34
| * | Fix warning: Add forgotten 'int' to variable declaration.iive2009-03-151-1/+1
| * | cosmetics: Remove file names from file header, it only causes trouble.diego2009-03-152-2/+2
| * | Remove obsolete extra elements from opt_t struct initialization.diego2009-03-158-37/+37
| * | Get rid of pointless preprocessor condition indirection and use ARCH_X86diego2009-03-152-23/+17
| * | "MPlayer - The Movie Player" should be used as the player name.diego2009-03-151-1/+1
| * | cosmetics: typo fixdiego2009-03-151-1/+1
* | | vo_gl: Fix libass subtitles disappearing during pauseUoti Urpala2009-03-221-0/+2
| |/ |/|
* | Merge svn changes up to r28951Uoti Urpala2009-03-1422-50/+1114
|\|
| * KVA vo driver for OS/2, patch by KO Myung-Hun, komh chollian netdiego2009-03-142-0/+1091
| * Output number of reference frames before creating H264 vdpau decoder.cehoyos2009-03-091-0/+1
| * Merge two preprocessor conditions in order to drop one duplicated #else case.diego2009-03-091-9/+2
| * Change default OSD/subtitle font sizes.greg2009-03-091-2/+2
| * cosmetics: spelling fixesdiego2009-03-071-7/+7
| * cosmetics: Reformat file header.diego2009-03-071-8/+3
| * Setting vo_fs is handled by x11_common.c, so remove that code from vo_xv/vo_x...reimar2009-03-072-4/+0
| * Make data related to suboption parsing const in libvoreimar2009-03-0717-20/+20
* | Merge svn changes up to r28862Uoti Urpala2009-03-075-34/+128
|\|
| * Refactor smalltex/tinytex EOSD optimization in vo_glreimar2009-03-061-18/+39
| * Simplify EOSD code by rendering it in VOCTRL_DRAW_EOSD instead of genEOSD,reimar2009-03-061-3/+2
| * Remove duplicate OSD drawing introduced due to a conflict between r28840 and ...reimar2009-03-061-3/+1
| * As for vo_gl, do not rely on draw_osd to render EOSD.reimar2009-03-061-1/+6
| * Draw EOSD with VOCTRL_DRAW_EOSD instead of along with OSD.greg2009-03-061-1/+1
| * Do not rely on draw_osd to render the EOSD, instead draw it already at thereimar2009-03-061-10/+15
| * Make sure all output_surfaces are initialized in preinit.reimar2009-03-041-1/+1
| * Make sure vo_x11_create_vo_window sets vo_dwidth and vo_dheight rightreimar2009-03-041-0/+6
| * Make WinID a 64 bit integer, this should avoid issues with valid Windowreimar2009-03-022-2/+2
| * Use M_PI for pi.cehoyos2009-02-281-2/+3
| * Make VdpVideoMixerAttribute attributes[] static const.cehoyos2009-02-281-1/+1
| * Support brightness, contrast, hue and saturation adjustments viacehoyos2009-02-281-2/+54
| * Fix OSD for vo vdpau:deint>1.cehoyos2009-02-281-1/+3
| * Handle vdp_decoder_create failures better, in particular avoid unrelatedreimar2009-02-281-0/+5
* | Merge svn changes up to r28755Uoti Urpala2009-02-282-18/+35
|\|
| * Do not forget the chosen deinterlacer for -vo vdpau.cehoyos2009-02-271-0/+6
| * Add one-field-only output for -vo vdpau.cehoyos2009-02-271-6/+7
| * Document that all vdpau deinterlacers respect -field-dominance.cehoyos2009-02-271-1/+1
| * 10l: Remove debug printf() from last commit.cehoyos2009-02-261-1/+0
| * Support "D" to (de-)activate deinterlacing when using vo vdpau.cehoyos2009-02-261-0/+7
| * 10l: Add missing braces for VOCTRL_GET_EOSD_RES.cehoyos2009-02-251-2/+4
| * Use memset to make sure all parts of struct sockaddr_in are always initialized.reimar2009-02-251-0/+1
| * Change code to actually work when NUM_OUTPUT_SURFACES is changed.reimar2009-02-251-9/+10
* | Merge svn changes up to r28728Uoti Urpala2009-02-252-24/+39
|\|
| * Cosmetics: Fix indentation and line length.cehoyos2009-02-241-6/+7
| * Enable Bob de-interlacing for VDPAU.cehoyos2009-02-241-13/+26
| * Calculate border size in aspect keeping code by using AdjustWindowRectreimar2009-02-231-5/+6
* | Merge svn changes up to r28712Uoti Urpala2009-02-231-5/+192
|\|
| * Only check for vdp_video_mixer_destroy failure when we actually executed that...reimar2009-02-231-2/+3
| * EOSD/ASS support for vo_vdpau.creimar2009-02-231-1/+187
| * Add forgotten type to variable declaration.reimar2009-02-211-2/+2
* | Merge svn changes up to r28690Uoti Urpala2009-02-214-1474/+1509
|\|
| * 100l, place vdpau below xv, it should not normally be preferred for auto-sele...reimar2009-02-211-3/+3
| * Cosmetics. Reindent to 4 spaces.iive2009-02-211-473/+473
| * Cleanup.iive2009-02-211-20/+2
| * Cosmetics. Remove all trailing whitespacesiive2009-02-211-61/+61
| * Turn all remaining printf() into mp_msg().iive2009-02-201-84/+85
| * Cleanup.iive2009-02-201-53/+29
| * Cosmetics part2. Indent local variable definitions like the rest of the code.iive2009-02-201-55/+62
| * Cosmetics part 1. Reindent to 4 spaces.iive2009-02-201-916/+916
| * Comment out "else" statement without following block.iive2009-02-201-1/+1
| * Move libavcodec includes together.iive2009-02-201-1/+1
| * Document that and why deinterlacing is not workingreimar2009-02-201-3/+6
| * Add support for VDPAU deinterlacing, pullup, denoise and sharpening.reimar2009-02-201-5/+71
* | Merge svn changes up to r28655Uoti Urpala2009-02-192-2/+4
|\|
| * Use the same code to convert fps in float to fraction as used in mencoder,reimar2009-02-181-1/+1
| * Add VOCAP_NOSLICES and use it to allow vo_vdpau to not support slices forreimar2009-02-181-1/+3
* | Merge svn changes up to r28641Uoti Urpala2009-02-1812-13/+842
|\|
| * Extend calc_src_dst_rects to also calculate the border values needed forreimar2009-02-176-8/+30
| * Convert HAVE_MALLOC_H into a 0/1 definition, fixes the warning:diego2009-02-173-3/+3
| * Fix compilation after last commit.cehoyos2009-02-171-1/+1
| * Cropping parameter to calc_src_dst_rects is constreimar2009-02-171-1/+1
| * 100l, reset ass_border when switching out of fullscreen mode.reimar2009-02-171-0/+1
| * The CONFIG_TV_TELETEXT preprocessor directive is defined/undefined,diego2009-02-171-1/+1
| * Fix compilation without VDPAUuau2009-02-171-1/+1
| * Add support for VDPAU video out, including hardware decoding.reimar2009-02-162-0/+813
| * Replace double semicolon by single semicolon.diego2009-02-161-1/+1
* | Merge svn changes up to r28610Uoti Urpala2009-02-161-119/+111
|\|
| * Sync renaming of xvmc struct members in FFmpeg.diego2009-02-161-2/+2
| * The AV_XVMC_RENDER_MAGIC constant was renamed to AV_XVMC_ID in FFmpeg.diego2009-02-151-4/+4
| * Reflect ffmpeg change of xvmc struct field to xvmc_id.iive2009-02-151-4/+4
| * whitespace cosmetics: Remove all tabs and trailing whitespace.diego2009-02-151-75/+75
| * The xvmc_pixfmt_render structure was renamed to xvmc_pix_fmt in FFmpeg.diego2009-02-151-19/+19
| * Remove unnecessary #ifdef around internal #include.diego2009-02-151-3/+0
| * The xmvc structure member magic_id was renamed to unique_id.diego2009-02-151-4/+4
| * Reflect the change of xvmc struct name.iive2009-02-151-19/+19
| * Move direct-rendering hack from vo_xvmc to vf_vo, so it does not need toreimar2009-02-151-1/+0
| * Now xvmc struct uses magic_id fieldiive2009-02-151-4/+4
| * Remove display_flag remains as the member has been removed from the xvmc struct.iive2009-02-151-2/+0
| * Remove some xvmc field initializations. They are not used byiive2009-02-141-2/+0
| * Remove local copy of xvmc_render.h, it is now an installed header in FFmpeg.diego2009-02-141-15/+15
* | Merge svn changes up to r28549Uoti Urpala2009-02-138-116/+113
|\|
| * Remove now unused vo_calc_drwXY function.reimar2009-02-122-18/+0
| * Add a calc_src_dst_rects that calculates from window size, panscan etc.reimar2009-02-125-93/+99
| * Only set VO_EVENT_RESIZE if size actually changed, not if e.g. the window wasreimar2009-02-121-2/+6
* | Merge svn changes up to r28537Uoti Urpala2009-02-1252-195/+1020
|\|
| * Conditionally compile aclib.c instead of placing #ifdef around its content.diego2009-02-081-4/+0
| * Add standard license headers, unify header formatting.diego2009-02-0851-147/+976
| * Avoid message spam during video adapter uncooperative state.gogothebee2009-02-051-1/+1
| *