summaryrefslogtreecommitdiffstats
path: root/libmpdemux/dvbin.c
Commit message (Collapse)AuthorAgeFilesLines
* Unify include path handling, -I.. is in CFLAGS.diego2005-11-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17013 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed dependency on glibc's %a in sscanf()nicodvb2005-09-181-22/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16517 b3059339-0415-0410-9bf9-f77b7e298cf2
* check the result of poll() before read()ing; 100lnicodvb2005-04-181-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15214 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark modified imported files as such to comply more closely with GPL §2a.diego2005-04-161-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15179 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for ATSC tuner and conf.filenicodvb2005-01-061-3/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14383 b3059339-0415-0410-9bf9-f77b7e298cf2
* added forgotten dvb-t params lp_coderate and hierarchynicodvb2004-08-261-2/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13156 b3059339-0415-0410-9bf9-f77b7e298cf2
* added multi-pid parsing code (up to 15), pid 0 is always added (for the PAT)nicodvb2004-07-121-62/+99
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12804 b3059339-0415-0410-9bf9-f77b7e298cf2
* new configuration structure, dvb_set_channel takes 2 parameters, 1000l ↵nicodvb2004-04-261-192/+175
| | | | | | memleak fix git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12308 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed broken diseqc fetch from channels filenicodvb2004-04-041-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12117 b3059339-0415-0410-9bf9-f77b7e298cf2
* disallow non-sense type parameter; added support for absolute file path; ↵nicodvb2004-04-031-26/+32
| | | | | | prefer channels.conf.{sat,ter,cbl} over channels.conf if the file is available git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12109 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing tuning parameters (inversion and coderate) and changed debug ↵nicodvb2004-03-191-2/+7
| | | | | | level in dvb_streaming_read() git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12048 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compliance with the DVB power management specification (doesn't closeattila2004-01-291-22/+21
| | | | | | | | | | | the tuner after having tuned). This permits to remove the parameter dvb_shutdown_timeout=0 to the module dvb-core and ultimately shuts down the card when the tuner isn't used. patch by Nico <nsabbi@tiscali.it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@11873 b3059339-0415-0410-9bf9-f77b7e298cf2
* Patch by Nico <nsabbi@libero.it>attila2003-11-011-14/+22
| | | | | | | | | | | | | | | | | | | | | | | | | this patch fixes a recently discovered bug for which DVB-C users couldn't tune (wrong parsing of the config file and incorrect parameter passing to tune_it()) and includes the still unapplied patch posted in date 6/9/2003: - it works correctly with and without caches; in the former case it doesn't take anymore a lot of time to empty the cache before changing channel; the uninit_cache() function is called in mplayer.c just after the new tuning operation - initialized a variable identifying the tuner type, and exit if it isn't supported - doesn't crash anymore when 1) the channels file doesn't exists 2) the tuner is used by another application 3) in the menu, when trying to select a channel before the first 4) some mp_msg() called in case of error git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@11353 b3059339-0415-0410-9bf9-f77b7e298cf2
* This patch fixes:alex2003-08-271-4/+19
| | | | | | | | | | | 1) if channels (in the list) are invalid excludes them 2) on encrypted/unreadable channels mplayer goes to the next/previous 3) when changing channel uninit all components but stream and input. Nico <nsabbi@libero.it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@10709 b3059339-0415-0410-9bf9-f77b7e298cf2
* this patch fixesarpi2003-08-111-421/+478
| | | | | | | | | | | | | 1) some bugs introduced in the tuner autodetection and in the channel-parsing functions, 3) retries reading when the mplayer/mencoder don't read fast enough (sooner it exited) but especially 4) makes the stream compliant with the new, modular stream api (the one currently in CVS is not and is totally unreachable). [and maybe more, next time please include cvslog in patch! -- A'rpi] patch by Nico <nsabbi@libero.it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@10561 b3059339-0415-0410-9bf9-f77b7e298cf2
* this is a combo patch that:arpi2003-03-161-0/+684
1) adds an experimental TS demuxer to mplayer 2) adds an input (streaming) interface from DVB cards. It compiles and runs with the following versions of the drivers: dvb-kernel (HEAD) (with stock kernel 2.4.20) and 0.9.4 (with kernel 2.4.18) patch by Nico <nsabbi@libero.it> some cleanups, ts demuxer fixes by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@9611 b3059339-0415-0410-9bf9-f77b7e298cf2