summaryrefslogtreecommitdiffstats
Commit message (Collapse)AuthorAgeFilesLines
* calculate framesize for raw RGB and BGR.reimar2005-12-181-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17220 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix crash with invalid -vid and no audio streamreimar2005-12-181-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17219 b3059339-0415-0410-9bf9-f77b7e298cf2
* bitexact flagmichael2005-12-181-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17218 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.1180: [does not apply]ranma2005-12-171-21/+25
| | | | | | | | | | | | | | | | 1.1179: Removing obsolete, and until recently, misdocumented option -verbose. 1.1178: make -o mandatory and add a warning when the extension does not match the container format, patch by Reynaldo Pinochet 1.1177: Another examples showing how to play raw YUV video samples 1.1176: Make -really-quiet a common option. 1.1175: Fix -v/-verbose description. 1.1174: 10l: \ needs to be escaped in roff. 1.1173: 1/4l 1.1172: Formatting fix 1.1171: Give an example about how to use the famous cqif video samples git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17217 b3059339-0415-0410-9bf9-f77b7e298cf2
* deobfuscate some very simple code...ods152005-12-171-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17216 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo: ouput -> outputranma2005-12-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17215 b3059339-0415-0410-9bf9-f77b7e298cf2
* "cfg-mplayer-def.h" is what is written in ~/.mplayer/config when it is notods152005-12-171-1/+0
| | | | | | | found, completely unnecessary in mencoder.c git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17214 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to 1.216ranma2005-12-171-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17213 b3059339-0415-0410-9bf9-f77b7e298cf2
* some more new stuff..ods152005-12-171-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17212 b3059339-0415-0410-9bf9-f77b7e298cf2
* -o in mencoder now manditoryods152005-12-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17211 b3059339-0415-0410-9bf9-f77b7e298cf2
* -msglevel added, -verbose removedods152005-12-171-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17210 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removing obsolete, and until recently, misdocumented option -verbose .ods152005-12-172-7/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17209 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.100gpoirier2005-12-171-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17208 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.13, patch by Johan Bosgpoirier2005-12-171-15/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17207 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.72, patch by Johan Bosgpoirier2005-12-171-4/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17206 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/ 1.1178gpoirier2005-12-171-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17205 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.12, patch by Johan Bos, and fixes by me :pgpoirier2005-12-171-1/+75
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17204 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes by Bounecgpoirier2005-12-176-64/+64
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17203 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar fixdiego2005-12-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17202 b3059339-0415-0410-9bf9-f77b7e298cf2
* include fastmemcpy.h before stream.h, so it is used for the stream_readreimar2005-12-171-1/+2
| | | | | | | function, too. Gives a small speedup for e.g. high bandwidth MPEG2 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17201 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove now useless YV12 plane swap hack, patch by Luc Gallant lucgallant at ↵henry2005-12-161-18/+4
| | | | | | gmail com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17200 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not set the flag when config failedhenry2005-12-161-1/+4
| | | | | | | patch by Mikulas Patocka (mikulas at artax karlin mff cuni cz) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17199 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid gcc warnings:rathann2005-12-151-2/+1
| | | | | | | | | | | | '...' might be used uninitialized in this function In this case 'H', 'N', 'D', and 'F' can indeed be used unitialized, thus possibly causing all sorts of problems. Patch by Peter Breitenlohner git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17198 b3059339-0415-0410-9bf9-f77b7e298cf2
* make -o mandatory and add a warning when the extension does not match the ↵wanderer2005-12-153-2/+37
| | | | | | container format, patch by Reynaldo Pinochet git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17197 b3059339-0415-0410-9bf9-f77b7e298cf2
* one-word grammar fix for "incompatible codec" messagewanderer2005-12-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17196 b3059339-0415-0410-9bf9-f77b7e298cf2
* use snd_mixer_selem_set_playback_switch when muting ALSA, patch by Matthias ↵wanderer2005-12-151-0/+11
| | | | | | Lederhofer <matled -at- gmx dot net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17195 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.213ptt2005-12-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17194 b3059339-0415-0410-9bf9-f77b7e298cf2
* small grammatical/sentence fixptt2005-12-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17193 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compilation when dvdkit and dvdread are not availablenicodvb2005-12-145-5/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17192 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix small typos spoted by Paul TTreynaldo2005-12-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17191 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reformat for better readability.diego2005-12-131-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17190 b3059339-0415-0410-9bf9-f77b7e298cf2
* restore the old behavior for --enable-theora, ie. provide a sane default for ↵aurel2005-12-131-0/+3
| | | | | | $_ld_theora git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17189 b3059339-0415-0410-9bf9-f77b7e298cf2
* libdvdread configure script defines __DARWIN__ on darwin to triggerdiego2005-12-131-0/+4
| | | | | | | | the definition of SYS_BSD in dvd_reader.c. hint by Emanuele Giaquinta < emanuele . . . giaquinta . @ . gmail . . . com > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17188 b3059339-0415-0410-9bf9-f77b7e298cf2
* Darwin does not support -rdynamic.diego2005-12-131-1/+1
| | | | | | | patch by Emanuele Giaquinta < emanuele . . . giaquinta . @ . gmail . . . com > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17187 b3059339-0415-0410-9bf9-f77b7e298cf2
* small typo preventing compilation, sorry :(ptt2005-12-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17186 b3059339-0415-0410-9bf9-f77b7e298cf2
* little fixes....ptt2005-12-131-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17185 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync up to 1.210ptt2005-12-131-33/+57
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17184 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor grammar clarification to the last commit, + omitted periodswanderer2005-12-121-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17183 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify paths in patch and fix recent breakage, no -ko keyword expansiondiego2005-12-111-4/+4
| | | | | | | flag was set on this file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17182 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another examples showing how to play raw YUV video samplesgpoirier2005-12-112-3/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17181 b3059339-0415-0410-9bf9-f77b7e298cf2
* add hint to slave.txtreimar2005-12-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17180 b3059339-0415-0410-9bf9-f77b7e298cf2
* improve video equalizer command (brightness, contrast, etc.) descriptionreimar2005-12-111-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17179 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1176gpoirier2005-12-111-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17178 b3059339-0415-0410-9bf9-f77b7e298cf2
* make fribidi autodetect by default instead of disableods152005-12-111-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17177 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make -really-quiet a common option.diego2005-12-113-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17176 b3059339-0415-0410-9bf9-f77b7e298cf2
* make demuxer seek and close functions return void, patch by Dominik Mierzejewskiwanderer2005-12-114-11/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17175 b3059339-0415-0410-9bf9-f77b7e298cf2
* punctuation fixes for the previous commitwanderer2005-12-111-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17174 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update email address, old one is deadgpoirier2005-12-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17173 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1175gpoirier2005-12-111-18/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17172 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix -v/-verbose description.diego2005-12-111-14/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17171 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1174gpoirier2005-12-111-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17170 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: \ needs to be escaped in roff.diego2005-12-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17169 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.201gabrov2005-12-101-10/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17168 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1171gpoirier2005-12-101-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17167 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1/4lgpoirier2005-12-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17166 b3059339-0415-0410-9bf9-f77b7e298cf2
* Formatting fixgpoirier2005-12-101-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17165 b3059339-0415-0410-9bf9-f77b7e298cf2
* Give an example about how to use the famous cqif video samplesgpoirier2005-12-101-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17164 b3059339-0415-0410-9bf9-f77b7e298cf2
* move to next vo if /dev/3dfx could not be openediive2005-12-101-7/+16
| | | | | | | open it on preinit not at config time. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17163 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1170gpoirier2005-12-101-1/+242
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17162 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not exit() if /dev/3dfx is not available, approved by Ivan.diego2005-12-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17161 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete note.diego2005-12-101-15/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17160 b3059339-0415-0410-9bf9-f77b7e298cf2
* known bugs with P4 and SSE, small fixesdiego2005-12-101-2/+16
| | | | | | | based on a patch by compn < . tempn . @ . twmi . . . rr . . . com . > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17159 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert this file to UTF-8 as it contains funky caracters from all around ↵gpoirier2005-12-101-26/+26
| | | | | | | | | the world. What's even better is that this gets rid of a GTK assertion error. \o/ git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17158 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.1162: multithreaded decodingranma2005-12-101-3/+335
| | | | | | | | | | | | | | 1.1163: new -msglevel option, constrols msg level for every msg module 1.1164: stray LIVE.COM -> LIVE555 transition 1.1165: alphabetical order + better explanation for '-lavdopts threads' 1.1166: new arguments for -vf spp, patch by Corey Hickey 1.1167: -msglevel description improvement 1.1168: preliminary environment variables section 1.1169: vf_fspp bframes option 1.1170: Clarifications for the AUDIOSERVER environment variable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17157 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to rev. 1.210ranma2005-12-101-5/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17156 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove stray tab, which was confusing help_diff.shranma2005-12-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17155 b3059339-0415-0410-9bf9-f77b7e298cf2
* Harcoded eng strings on libmpdemux/network.c to help_mpreynaldo2005-12-102-31/+53
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17154 b3059339-0415-0410-9bf9-f77b7e298cf2
* ffmpeg updatertognimp2005-12-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17153 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove MPlayer native 14_4 and 28_8 codecs (they are in lavc)rtognimp2005-12-099-939/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17152 b3059339-0415-0410-9bf9-f77b7e298cf2
* cookdiego2005-12-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17151 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move audio packets reordering from codec interface to demuxers for realrtognimp2005-12-094-205/+199
| | | | | | | | | files (old and new format), pass only real extradata to the codec Enable cook codec from lavc, prefer lavc codecs for 14_4 and 28_8 formats. Disable internal 28_8, it's broken now and will be removed soon git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17150 b3059339-0415-0410-9bf9-f77b7e298cf2
* #include help_mp.h only once.diego2005-12-091-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17149 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some inactive maintainers.diego2005-12-091-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17148 b3059339-0415-0410-9bf9-f77b7e298cf2
* long obsoletediego2005-12-091-85/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17147 b3059339-0415-0410-9bf9-f77b7e298cf2
* some sync with the present day situationdiego2005-12-091-21/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17146 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify include paths, -I.. is in CFLAGS.diego2005-12-0830-196/+196
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17145 b3059339-0415-0410-9bf9-f77b7e298cf2
* M263 (M$ h263) can be decoded by lavc H.263 decoderrtognimp2005-12-081-1/+1
| | | | | | | Patch by Corey Hickey git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17144 b3059339-0415-0410-9bf9-f77b7e298cf2
* Bye-bye old email address, I'm a student no more!! :-Pgpoirier2005-12-081-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17143 b3059339-0415-0410-9bf9-f77b7e298cf2
* translate just 1.1169gpoirier2005-12-081-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17142 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1167gpoirier2005-12-081-4/+49
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17141 b3059339-0415-0410-9bf9-f77b7e298cf2
* -mc 0.1 is preferrable to -mc 10 since A/V sync is recovered quicker after ↵diego2005-12-081-1/+1
| | | | | | seeking. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17140 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarifications for the AUDIOSERVER environment variable.diego2005-12-081-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17139 b3059339-0415-0410-9bf9-f77b7e298cf2
* add fix for sbr_dec.c to local diff, toorathann2005-12-071-2/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17138 b3059339-0415-0410-9bf9-f77b7e298cf2
* add my fix to ps_dec.c to our diffrathann2005-12-071-2/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17137 b3059339-0415-0410-9bf9-f77b7e298cf2
* Every contribution deserves to be listed on the "about" window of the gui.gpoirier2005-12-072-94/+218
| | | | | | | Change the way this list is done by following the layout of AUTHORS git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17136 b3059339-0415-0410-9bf9-f77b7e298cf2
* vf_fspp bframes optionhenry2005-12-071-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17135 b3059339-0415-0410-9bf9-f77b7e298cf2
* prevent flicker on b-frames, trivial port from vf_spphenry2005-12-071-6/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17134 b3059339-0415-0410-9bf9-f77b7e298cf2
* list myself as patch backlog maintainerwanderer2005-12-071-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17133 b3059339-0415-0410-9bf9-f77b7e298cf2
* option to show the lines containing anomalies, patch by Ivo van Poortenwanderer2005-12-071-0/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17132 b3059339-0415-0410-9bf9-f77b7e298cf2
* small updates and fixesdiego2005-12-071-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17131 b3059339-0415-0410-9bf9-f77b7e298cf2
* preliminary environment variables sectiondiego2005-12-071-0/+231
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17130 b3059339-0415-0410-9bf9-f77b7e298cf2
* really clear frames to black instead of grey, and make sure one of thosereimar2005-12-071-5/+14
| | | | | | | | cleared frames is actually shown (and not a leftover from last film, which happened at least with ATI cards). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17129 b3059339-0415-0410-9bf9-f77b7e298cf2
* signed division must be used for calculation vo_dx and vo_dy.reimar2005-12-072-4/+4
| | | | | | | Fixes a bug that causes overbig windows to disappear on Windows. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17128 b3059339-0415-0410-9bf9-f77b7e298cf2
* WM_PAINT is the "expose" event, not WM_ACTIVATEreimar2005-12-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17127 b3059339-0415-0410-9bf9-f77b7e298cf2
* Minor spelling fixesjheryan2005-12-071-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17126 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1163jheryan2005-12-071-19/+134
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17125 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't abort when xscreensaver window isn't available anymore.al2005-12-071-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17124 b3059339-0415-0410-9bf9-f77b7e298cf2
* more warning fixesods152005-12-073-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17123 b3059339-0415-0410-9bf9-f77b7e298cf2
* compiler warning fixes, some of these were actual (printing) bugs.ods152005-12-071-13/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17122 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some more cola for msglevel, codec-cfg can't even call mp_msg_init or it'llods152005-12-074-21/+9
| | | | | | | print bogus stuff. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17121 b3059339-0415-0410-9bf9-f77b7e298cf2
* -msglevel description improvementdiego2005-12-071-25/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17120 b3059339-0415-0410-9bf9-f77b7e298cf2
* new arguments for -vf spp, patch by Corey Hickeywanderer2005-12-061-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17119 b3059339-0415-0410-9bf9-f77b7e298cf2
* Must use glFlush when doublebuffering is not usedreimar2005-12-061-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17118 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of most #ifdefsreimar2005-12-064-65/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17117 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix message handling, process resize eventsreimar2005-12-061-7/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17116 b3059339-0415-0410-9bf9-f77b7e298cf2
* alphabetical order + better explanation for '-lavdopts threads'wanderer2005-12-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17115 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor grammar fix, + stray LIVE.COM -> LIVE555 transitionwanderer2005-12-061-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17114 b3059339-0415-0410-9bf9-f77b7e298cf2
* another 100l, codec-cfg relied on mp_msg printing nothing....ods152005-12-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17113 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, codec-cfg needs fixing after -msgl patchods152005-12-061-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17112 b3059339-0415-0410-9bf9-f77b7e298cf2
* prevent flicker, to get old behaviour use spp=x:y:4 / x:y:5michael2005-12-061-6/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17111 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix EDL to be per file, allow -edlout and -edl together as there is reallyods152005-12-064-41/+16
| | | | | | | no reason not to. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17110 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l, reverting 2 more unrelated changes with last commitods152005-12-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17109 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, reverting unrelated change with last commitods152005-12-061-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17108 b3059339-0415-0410-9bf9-f77b7e298cf2
* new -msglevel option, constrols msg level for every msg moduleods152005-12-066-20/+148
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17107 b3059339-0415-0410-9bf9-f77b7e298cf2
* more minor grammatical fixeswanderer2005-12-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17106 b3059339-0415-0410-9bf9-f77b7e298cf2
* multithreaded decodinggpoirier2005-12-052-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17105 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes suggested by The Wanderer and Coreygpoirier2005-12-051-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17104 b3059339-0415-0410-9bf9-f77b7e298cf2
* expand aspect works by display aspect, not video aspect.ods152005-12-051-2/+3
| | | | | | | try 2 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17103 b3059339-0415-0410-9bf9-f77b7e298cf2
* add missing -I..rathann2005-12-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17102 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-051-0/+1
| | | | | | | mplayer.c:509: warning: implicit declaration of function 'free_osd_list' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17101 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-051-1/+2
| | | | | | | sysdep/pci_linux.c:93: warning: implicit declaration of function 'iopl' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17100 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-052-4/+4
| | | | | | | | | | | | | | ps_dec.c:1938: warning: missing braces around initializer ps_dec.c:1938: warning: (near initialization for 'X_hybrid_left[0][0]') ps_dec.c:1939: warning: missing braces around initializer ps_dec.c:1939: warning: (near initialization for 'X_hybrid_right[0][0]') sbr_dec.c:530: warning: missing braces around initializer sbr_dec.c:530: warning: (near initialization for 'X_left[0][0]') sbr_dec.c:531: warning: missing braces around initializer sbr_dec.c:531: warning: (near initialization for 'X_right[0][0]') git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17099 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-051-1/+1
| | | | | | | ao_alsa.c:115: warning: suggest parentheses around assignment used as truth value git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17098 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-051-0/+3
| | | | | | | ae_lavc.c:168: warning: implicit declaration of function 'codec_get_wav_tag' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17097 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-051-2/+2
| | | | | | | vf_remove_logo.c:738: warning: passing argument 2 of 'memcpy_pic' discards qualifiers from pointer target type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17096 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | vf_phase.c:101: warning: suggest parentheses around + or - inside shift vf_phase.c:102: warning: suggest parentheses around + or - inside shift vf_phase.c:105: warning: suggest parentheses around + or - inside shift vf_phase.c:106: warning: suggest parentheses around + or - inside shift vf_phase.c:112: warning: suggest parentheses around + or - inside shift vf_phase.c:113: warning: suggest parentheses around + or - inside shift vf_phase.c:116: warning: suggest parentheses around + or - inside shift vf_phase.c:117: warning: suggest parentheses around + or - inside shift vf_phase.c:123: warning: suggest parentheses around + or - inside shift vf_phase.c:124: warning: suggest parentheses around + or - inside shift vf_phase.c:127: warning: suggest parentheses around + or - inside shift vf_phase.c:128: warning: suggest parentheses around + or - inside shift vf_phase.c:134: warning: suggest parentheses around + or - inside shift vf_phase.c:135: warning: suggest parentheses around + or - inside shift vf_phase.c:136: warning: suggest parentheses around + or - inside shift vf_phase.c:139: warning: suggest parentheses around + or - inside shift vf_phase.c:140: warning: suggest parentheses around + or - inside shift vf_phase.c:141: warning: suggest parentheses around + or - inside shift git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17095 b3059339-0415-0410-9bf9-f77b7e298cf2
* ad_libvorbis.c:119: warning: assignment from incompatible pointer typerathann2005-12-051-1/+2
| | | | | | | | | ad_libvorbis.c:120: warning: assignment from incompatible pointer type ad_libvorbis.c:121: warning: assignment from incompatible pointer type ad_libvorbis.c:127: warning: assignment from incompatible pointer type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17094 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-053-0/+3
| | | | | | | | | pnm.c:228: warning: implicit declaration of function 'usec_sleep' realrtsp/rtsp.c:184: warning: implicit declaration of function 'usec_sleep' ad_acm.c:149: warning: implicit declaration of function 'usec_sleep' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17093 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-051-0/+2
| | | | | | | | muxer_mpeg.c:2315: warning: implicit declaration of function 'mp_get_mp3_header' muxer_mpeg.c:2339: warning: implicit declaration of function 'a52_syncinfo' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17092 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-051-0/+1
| | | | | | | demux_ogg.c:371: warning: implicit declaration of function '_ilog' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17091 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixrathann2005-12-051-1/+2
| | | | | | | | | | | stream_livedotcom.c:70: warning: assignment makes pointer from integer without a cast stream_livedotcom.c:77: warning: passing argument 1 of 'lseek' makes integer from pointer without a cast stream_livedotcom.c:78: warning: passing argument 1 of 'lseek' makes integer from pointer without a cast stream_livedotcom.c:84: warning: passing argument 1 of 'read' makes integer from pointer without a cast stream_livedotcom.c:96: warning: control reaches end of non-void function git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17090 b3059339-0415-0410-9bf9-f77b7e298cf2
* mplayer.c:1928: warning: implicit declaration of function 'cache_uninit'rathann2005-12-051-0/+2
| | | | | | | mplayer.c:2897: warning: implicit declaration of function 'mpcodecs_config_vo' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17089 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix popup menu problems: GTK cannot get a grab while the button is down,reimar2005-12-044-11/+3
| | | | | | | so show it on button release instead of button press. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17088 b3059339-0415-0410-9bf9-f77b7e298cf2
* About text should _not_ be editable, it just looks stupid.reimar2005-12-041-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17087 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing dotranma2005-12-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17086 b3059339-0415-0410-9bf9-f77b7e298cf2
* lots of small fixes a few rephrasingsranma2005-12-031-136/+136
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17085 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to 1.205ranma2005-12-031-10/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17084 b3059339-0415-0410-9bf9-f77b7e298cf2
* attribute alignmichael2005-12-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17083 b3059339-0415-0410-9bf9-f77b7e298cf2
* switch to snowmichael2005-12-031-12/+17
| | | | | | | various bugfixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17082 b3059339-0415-0410-9bf9-f77b7e298cf2
* multithreaded decodingmichael2005-12-021-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17081 b3059339-0415-0410-9bf9-f77b7e298cf2
* muxer_lavf MUST be disabled by default until someone adds AVParserrfelker2005-12-021-0/+20
| | | | | | | | | | | | support to it. Otherwise users will generate files with totally nonsensical pts if they use B frames! (And they are already doing so -- see mplayer-users list!) If anyone wants to volunteer to add AVParser support, go right ahead! But until then, do not remove this check. :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17080 b3059339-0415-0410-9bf9-f77b7e298cf2
* fatal error when muxer cannot initializerfelker2005-12-021-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17079 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.100jheryan2005-12-021-11/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17078 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.99jheryan2005-12-021-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17077 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.34jheryan2005-12-021-8/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17076 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.12jheryan2005-12-021-1/+71
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17075 b3059339-0415-0410-9bf9-f77b7e298cf2
* make -lavdopts debug work again, patch by Jason Tackaberry ( tack AH sault ↵gpoirier2005-12-021-0/+2
| | | | | | | | | | | POIS org ) Original thread: Subject: Re: [MPlayer-dev-eng] [PATCH] make -lavdopts debug work again Date: Fri, 2 Dec 2005 01:38:02 +0100 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17074 b3059339-0415-0410-9bf9-f77b7e298cf2
* export ldexp() and frexp() in pncrt, they are needed by rp8 sipr dllrtognimp2005-12-011-0/+2
| | | | | | | Patch by Benjamin Larsson git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17073 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add CharNextA(), needed by rp8 sipr dllrtognimp2005-12-011-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17072 b3059339-0415-0410-9bf9-f77b7e298cf2
* nits and fixes suggested by The Wanderer and Loren Merrittgpoirier2005-12-011-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17071 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_tdfxfb should be preferred over vo_3dfx.diego2005-12-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17070 b3059339-0415-0410-9bf9-f77b7e298cf2
* wrong output level calculation on af_equalizer leaded to low level output ↵reynaldo2005-12-011-1/+1
| | | | | | even with all octaves at 0db (default), patch by Corey Hickey bugfood-ml AT -fatooh/org- git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17069 b3059339-0415-0410-9bf9-f77b7e298cf2
* AMD's Family 6 CPUs come with two flavors: one that supports SSE anddiego2005-12-011-16/+9
| | | | | | | | | | | | one that dosen't. However, they're not easily distinguishible from their signature (family, model and stepping). Original configure might set -march=athlon-4 for a CPU that dosen't support SSE and causes gcc to generate code that won't run on the target machine. Closes bug #267. patch by Zuxy Meng zuxy -- dot -- meng -- at -- gmail -- dot -- com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17068 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed wrong telecine trf pattern; fall back to mpeg2 when user specifies ↵nicodvb2005-11-301-14/+35
| | | | | | unknown format git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17067 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clean up some muxer messages, patch by Corey Hickey bugfood-ml AT ↵reynaldo2005-11-296-15/+22
| | | | | | -fatooh/org- , small fixes by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17066 b3059339-0415-0410-9bf9-f77b7e298cf2
* Link was a bit dated (but still working :-))ranma2005-11-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17065 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed wrong M_OPT_RANGE in vrc_maxrate/vrc_minrate , default was 0 and range ↵reynaldo2005-11-291-2/+2
| | | | | | [4,2400000] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17064 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync man page structure description with actual man page structure.diego2005-11-291-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17063 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling, capitalization and wording fixesdiego2005-11-291-20/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17062 b3059339-0415-0410-9bf9-f77b7e298cf2
* Smarter defaults, removing obsolete options.diego2005-11-291-18/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17061 b3059339-0415-0410-9bf9-f77b7e298cf2
* -aop is long obsolete.diego2005-11-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17060 b3059339-0415-0410-9bf9-f77b7e298cf2
* -aop is long obsolete.diego2005-11-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17059 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a function to remove osd msg and use it to remove the "OSD: enabled"albeu2005-11-271-0/+25
| | | | | | | msg when switching the OSD to a level above 1. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17058 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add indicative QP for ASP and AVC codecsgpoirier2005-11-271-3/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17057 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain how to make regression tests with CVSgpoirier2005-11-271-0/+74
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17056 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar fix on the documentation-updates notewanderer2005-11-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17055 b3059339-0415-0410-9bf9-f77b7e298cf2
* some comments and simplificationalex2005-11-271-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17054 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.1161: misc fixes [partly]ranma2005-11-271-3/+12
| | | | | | | | | 1.1160: Explain -vo gl:slice-height behaviour if YUV rendering is used. 1.1159: [does not apply] 1.1158: sync to x264 r373 (brdo) [partly] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17053 b3059339-0415-0410-9bf9-f77b7e298cf2
* Note about handling patches that contain documentation updates.diego2005-11-261-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17052 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support to get the list of files from a file containing one filenamealbeu2005-11-261-1/+30
| | | | | | | per line. Patch from devik (devik .at. cdi .dot. cz). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17051 b3059339-0415-0410-9bf9-f77b7e298cf2
* How to create a MPEG4 video from an explicit list of files, based on a patch ↵gpoirier2005-11-261-0/+11
| | | | | | | | | | | by devik <devik AH cdi POIS cz> Original thread: Date: Jun 18, 2005 11:44 AM Subject: [MPlayer-dev-eng] [PATCH] Allow mf:// to read indirect file list git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17050 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix URL escaping to correctly handle URL containing an ip6 address oralbeu2005-11-261-24/+65
| | | | | | | escaped special chars like & or ; git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17049 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correct optimization for C3, patch by Zuxy Meng < zuxy POIS meng AH gmail ↵gpoirier2005-11-261-8/+4
| | | | | | | | | | | POIS com > Original thread Date: Nov 25, 2005 3:35 AM Subject: [MPlayer-dev-eng] [PATCH] Correct optimization for C3 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17048 b3059339-0415-0410-9bf9-f77b7e298cf2
* skin authors, trailing whitespace cosmeticsdiego2005-11-251-2/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17047 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording and gramma fixes by Bougizgpoirier2005-11-252-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17046 b3059339-0415-0410-9bf9-f77b7e298cf2
* When it comes to CD/DVD handling bsdi has a linux CD/DVD compatibilitydiego2005-11-251-3/+5
| | | | | | | | library, use this to fix building on this (weird ;)) system. patch by Steven M. Schultz sms __ at __ 2BSD __ dot __ COM git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17045 b3059339-0415-0410-9bf9-f77b7e298cf2
* Grammar and wording fixes by Bougizgpoirier2005-11-244-47/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17044 b3059339-0415-0410-9bf9-f77b7e298cf2
* productive skindiego2005-11-241-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17043 b3059339-0415-0410-9bf9-f77b7e298cf2
* M-x untabifygpoirier2005-11-231-208/+208
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17042 b3059339-0415-0410-9bf9-f77b7e298cf2
* correct k6_mtrr detection, add a great deal of infos about newer processorsgpoirier2005-11-231-6/+62
| | | | | | | | | | patch by Zuxy Meng < zuxy POIS meng @gmail POIS com > Original thread: Date: Nov 21, 2005 11:36 AM Subject: [MPlayer-dev-eng] [PATCH] TOOLS/cpuinfo.c: correct k6_mtrr detection git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17041 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes in examples, minor detailswight2005-11-231-12/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17040 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.202jheryan2005-11-231-57/+138
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17039 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.99, Patch by Johan B. < dariusjb AH gmail POIS com >gpoirier2005-11-231-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17038 b3059339-0415-0410-9bf9-f77b7e298cf2
* -mc is useful to get rid of A/V desync.diego2005-11-231-0/+9
| | | | | | | based on patch by compn < tempn __ at __ twmi __ dot __ rr __ dot __ com > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17037 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1161gpoirier2005-11-231-7/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17036 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc fixesdiego2005-11-231-6/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17035 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert previous commital2005-11-221-2/+0
| | | | | | | | | | | ``Nov 22 To mplayer-cvsl ( 32) [MPlayer-cvslog] CVS: main/libvo x11_common.c,1.199,1.200'' - causes unneeded massive slowdown when stop-xscreensaver is used - is not consistent with the other xscreensaver functions - was commited without my approval git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17034 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore OPTIONS rtsp command during playback. Fixesrtognimp2005-11-221-1/+2
| | | | | | | | | rtsp://mms.sonix.de/universal/rock/apocalyptica_lifeburns_300.rm?start=0 (playback stopped after 82 sec) Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17033 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1159gpoirier2005-11-221-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17032 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain -vo gl:slice-height behaviour if YUV rendering is used.reimar2005-11-221-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17031 b3059339-0415-0410-9bf9-f77b7e298cf2
* added a '.'... not abig effort by me indeed :-)))n..ptt2005-11-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17030 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1158ptt2005-11-221-42/+122
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17029 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use slice-height 16 as default for yuv colorspaces (only relevant if decoderreimar2005-11-221-1/+3
| | | | | | | does not support slice rendering). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17028 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10llorenm2005-11-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17027 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r373 (brdo)lorenm2005-11-223-5/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17026 b3059339-0415-0410-9bf9-f77b7e298cf2
* resolves problem in module stop_xscreensaver, crashing mp after sleep and ↵ptt2005-11-211-0/+2
| | | | | | awake or enabling/disabling xssaver by hand git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17025 b3059339-0415-0410-9bf9-f77b7e298cf2
* buffering in the muxer layer; patch by Corey Hickey (bugfood-ml ad fatooh ↵nicodvb2005-11-219-60/+126
| | | | | | punctum org) plus small fixes by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17024 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mentions that --enable-runtime-cpudetection is not on by default.gpoirier2005-11-211-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17023 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the osd command only switch between enabled/disabled whenalbeu2005-11-201-7/+14
| | | | | | | | using the term osd. Also put a define to test for the term osd without #ifdef. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17022 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify include paths, -I.. is in CFLAGS.diego2005-11-192-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17021 b3059339-0415-0410-9bf9-f77b7e298cf2
* Also parse glX extension string, makes -vo gl:swapinterval work again on linuxreimar2005-11-191-4/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17020 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change MUST to SHOULD have disposition and if applicable language tags.al2005-11-181-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17019 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify include path handling by using -I.diego2005-11-183-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17018 b3059339-0415-0410-9bf9-f77b7e298cf2
* 302m_convert and 360m_convert are generated files.diego2005-11-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17017 b3059339-0415-0410-9bf9-f77b7e298cf2
* fastmemcpybench and cpuinfo are x86-specific.diego2005-11-181-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17016 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify include path handling by adding $(MPROOT) to CFLAGS.diego2005-11-182-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17015 b3059339-0415-0410-9bf9-f77b7e298cf2
* Makefile reorganized for better clarity and maintainability.diego2005-11-181-5/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17014 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify include path handling, -I.. is in CFLAGS.diego2005-11-18151-430/+430
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17013 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.1157: -novideo does not work in some cases, e.g. with MPEG demuxers.ranma2005-11-181-0/+18
| | | | | | | 1.1155/1.1156: Document the new osd options: -osd-duration, -noterm-osd, -term-osd-esc git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17012 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1157gpoirier2005-11-181-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17011 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavformat seems to use "Vo" as Vorbis tag, so add that.reimar2005-11-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17010 b3059339-0415-0410-9bf9-f77b7e298cf2
* -novideo does not work in some cases, e.g. with MPEG demuxers.reimar2005-11-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17009 b3059339-0415-0410-9bf9-f77b7e298cf2
* new -(no)border optionreimar2005-11-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17008 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable border toggling for gl and gl2 under windows.reimar2005-11-173-2/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17007 b3059339-0415-0410-9bf9-f77b7e298cf2
* print the number of encoded frames per seconds (fps) with a greater precisiongpoirier2005-11-171-2/+2
| | | | | | | | | | (float instead of int). Original thread: Date: Nov 17, 2005 3:25 PM Subject: [MPlayer-dev-eng] [PATCH] MEncoder: print more precise FPS git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17006 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reformating and nitgpoirier2005-11-171-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17005 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1155gpoirier2005-11-171-13/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17004 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document the new osd options: -osd-duration, -noterm-osd, -term-osd-escalbeu2005-11-171-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17003 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove stray \n and shorten overly long lines in the process.diego2005-11-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17002 b3059339-0415-0410-9bf9-f77b7e298cf2
* Tests should use echocheck/echores instead of plain echo for output.diego2005-11-171-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17001 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update credits, sync a few lines.diego2005-11-171-9/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@17000 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not build Debian package with runtime CPU detection by default.gpoirier2005-11-171-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16999 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/grammardiego2005-11-172-24/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16998 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added new TOOL to convert 'anything supported' to VCD/SVCD (PAL/NTSC) using ↵reynaldo2005-11-162-0/+304
| | | | | | mencoder git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16997 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small fixes...ptt2005-11-161-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16996 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.1153: Document the new oss config parameters.ranma2005-11-161-3/+14
| | | | | | | | 1.1152: Adds a target parameter to the volnorm filter. 1.1151: add a switch, slave command, and vo control to toggle borderless window. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16995 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with rev. 1.202ranma2005-11-161-1/+70
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16994 b3059339-0415-0410-9bf9-f77b7e298cf2
* Big OSD cleanup. Replace the mess with 100's of counter varsalbeu2005-11-162-265/+325
| | | | | | | | | with a clean and simple interface. As a bonus osd messages can now be displayed on the console if there is no vo (or osd is disabled in libvo). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16993 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix to uninstall section, pointed out by Reshat Sabiq to -users ml sabiq -- ↵ptt2005-11-161-4/+5
| | | | | | at -- csociety -- dot -- org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16992 b3059339-0415-0410-9bf9-f77b7e298cf2
* avisubdumpdiego2005-11-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16991 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify include paths, -I.. is in CFLAGS.diego2005-11-1511-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16990 b3059339-0415-0410-9bf9-f77b7e298cf2
* little fixes...ptt2005-11-151-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16989 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.202ptt2005-11-151-7/+61
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16988 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added a space after dv suboption for -lavfopts sectionptt2005-11-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16987 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify include paths, -I.. is in CFLAGS.diego2005-11-1422-37/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16986 b3059339-0415-0410-9bf9-f77b7e298cf2
* disable *SwapInterval function when extensions are missing, since itreimar2005-11-131-0/+5
| | | | | | | can cause crashes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16985 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify weird code. ;)rathann2005-11-131-4/+2
| | | | | | | Approved by Diego. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16984 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify include paths by adding -I.. to CFLAGS.diego2005-11-137-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16983 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicate leftover line.diego2005-11-121-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16982 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes missing caps on last patchesreynaldo2005-11-121-30/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16981 b3059339-0415-0410-9bf9-f77b7e298cf2
* Configure support for Cyrix C3gpoirier2005-11-122-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16980 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with help_mp-en.h 1.201, patch by Emfox Zhou < emfoxzhou AH gmail POIS com>gpoirier2005-11-121-1/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16979 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1153gpoirier2005-11-111-4/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16978 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document the new oss config parameters.albeu2005-11-111-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16977 b3059339-0415-0410-9bf9-f77b7e298cf2
* Generate double-click mouse events.joey2005-11-111-1/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16976 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add double-click mouse events.joey2005-11-112-0/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16975 b3059339-0415-0410-9bf9-f77b7e298cf2
* Intercept maximize event and go into fullscreen mode.joey2005-11-111-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16974 b3059339-0415-0410-9bf9-f77b7e298cf2
* DirectSound's GetVolume and SetVolume use 100ths of decibels and range from ↵joey2005-11-111-2/+3
| | | | | | | | | | -10,000 to 0. MPlayer uses a linear intensity value between 0.0 and 100.0. This patch converts the values properly rather than simply linearly mapping the range. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16973 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds a target parameter to the volnorm filter.joey2005-11-112-11/+21
| | | | | | | | This is useful to avoid clipping when processing data, but less important when watching a clip live. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16972 b3059339-0415-0410-9bf9-f77b7e298cf2
* -waveheader is deprecated, using -ao pcm:waveheader insteadreynaldo2005-11-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16971 b3059339-0415-0410-9bf9-f77b7e298cf2
* alphabetical orderdiego2005-11-101-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16970 b3059339-0415-0410-9bf9-f77b7e298cf2
* add a switch, slave command, and vo control to toggle borderless window.joey2005-11-1011-1/+63
| | | | | | | includes documentation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16969 b3059339-0415-0410-9bf9-f77b7e298cf2
* [TRIVIAL] More translatables to help_mp and printfs to mp_msg on libmpdemuxreynaldo2005-11-105-65/+122
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16968 b3059339-0415-0410-9bf9-f77b7e298cf2
* move window style to a macro for easier maintainingjoey2005-11-101-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16967 b3059339-0415-0410-9bf9-f77b7e298cf2
* attempt to fix missing and/or broken boundary checksreimar2005-11-101-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16966 b3059339-0415-0410-9bf9-f77b7e298cf2
* ffmpeg truemotion1 codec now outputs BGR32 for some filesreimar2005-11-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16965 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not set ctx->vo_inited when init fails. This caused a crash when areimar2005-11-101-1/+1
| | | | | | | matching colorspace is missing in codecs.conf. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16964 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not hang forever when the card delivers no new data.reimar2005-11-101-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16963 b3059339-0415-0410-9bf9-f77b7e298cf2
* implement norm switching, which was already documented??reimar2005-11-101-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16962 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with help_mp-en.h 1.198, patch by Emfox Zhou emfoxzhou AHgpoirier2005-11-101-3/+223
| | | | | | | gmail POIS com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16961 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow setting the mixer per instance so one can fallback betweenalbeu2005-11-101-11/+25
| | | | | | | | | several oos device and still have correct mixer settings all the time. The sytax is now: oss[:dsp_device[:mixer_device[:mixer_channel]]] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16960 b3059339-0415-0410-9bf9-f77b7e298cf2
* Test if source image dimensions are too big.al2005-11-104-0/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16959 b3059339-0415-0410-9bf9-f77b7e298cf2
* small typoptt2005-11-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16958 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.198ptt2005-11-101-4/+184
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16957 b3059339-0415-0410-9bf9-f77b7e298cf2
* reordered subtitles language OSD display, since it worked bad for ogm...ptt2005-11-091-36/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16956 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1150 (megaslow pp:) )gpoirier2005-11-091-1/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16955 b3059339-0415-0410-9bf9-f77b7e298cf2
* it looks like width needs to be a multiple of 64 for newer cardsfaust32005-11-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16954 b3059339-0415-0410-9bf9-f77b7e298cf2
* new orthographyranma2005-11-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16953 b3059339-0415-0410-9bf9-f77b7e298cf2
* Speling (das -> daß)ranma2005-11-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16952 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo, trailing whitespacediego2005-11-091-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16951 b3059339-0415-0410-9bf9-f77b7e298cf2
* SDL no longer needed by defaultrathann2005-11-081-5/+4
| | | | | | | libavcodec MUST be linked in statically git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16950 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add another content-type for aac audio in shoutcast streamsrtognimp2005-11-081-1/+1
| | | | | | | Fixes http://www.digitallyimported.com/aacplus/goapsy.pls git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16949 b3059339-0415-0410-9bf9-f77b7e298cf2
* document new vf_usppranma2005-11-081-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16948 b3059339-0415-0410-9bf9-f77b7e298cf2
* ultra simple&slow pp filter, yes yet another spp like filter :)michael2005-11-084-0/+424
| | | | | | | | | | | this one does actually compress&decompress the video at various shifts with lavc while the other spp filters are doing optimized intra only filtering limitations: mpeg4 is hardcoded, all options too, pretty trivial to change though, even filtering with non dct codecs like snow could be tried ... the qscale/qp is only taken fron the first MB of each image and then used for the whole image (would needs some small changes to lavc to let the user set the qscales for the mbs themselfs but iam to lazy ...) this needs ALOT of cpu time and memory especially at uspp=8 ... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16947 b3059339-0415-0410-9bf9-f77b7e298cf2
* fd --> file descriptor, small fixesdiego2005-11-081-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16946 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not call glFinish when we do not have a contextreimar2005-11-071-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16945 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not show cache-line size message, I've never seen a case where it was usefulreimar2005-11-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16944 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo: libcio --> libcdiodiego2005-11-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16943 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation, use vo_fs instead of fullscreen variable. Not tested.reimar2005-11-061-8/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16942 b3059339-0415-0410-9bf9-f77b7e298cf2
* save us from #ifndef hellfaust32005-11-061-29/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16941 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.197gabrov2005-11-061-6/+186
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16940 b3059339-0415-0410-9bf9-f77b7e298cf2
* there is no sh_video for audio only filesfaust32005-11-061-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16939 b3059339-0415-0410-9bf9-f77b7e298cf2
* mostly formatting fixesranma2005-11-061-48/+73
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16938 b3059339-0415-0410-9bf9-f77b7e298cf2
* libcdiofaust32005-11-061-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16937 b3059339-0415-0410-9bf9-f77b7e298cf2
* make it optionally possible to compile MPlayer with libcdio instead of ↵faust32005-11-065-5/+179
| | | | | | | | | | | libcdparanoia patch by Erik Lunchpail <erik_27can at yahoo.com> base on patch by Rocky Bernstein <rocky at panix.com> minor modification by myself git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16936 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed possible uint8 overflow; assign progid to the newly created pmtnicodvb2005-11-061-7/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16935 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: osd_show_dvd_nav_highlight is just a flagranma2005-11-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16934 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix typos: aslo->also, falback->fallback (they were just too annoying *g*)reimar2005-11-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16933 b3059339-0415-0410-9bf9-f77b7e298cf2
* Two minor corrections by mitch (mitch at cgarbs dot de)ranma2005-11-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16932 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix bugs/crash introduced by translation patchreimar2005-11-062-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16931 b3059339-0415-0410-9bf9-f77b7e298cf2
* Number of frames to show the OSD shouldn't be hardcoded, derive from fps insteadranma2005-11-061-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16930 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/ 1.1149gpoirier2005-11-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16929 b3059339-0415-0410-9bf9-f77b7e298cf2
* "describe" cdda://n-m syntaxreimar2005-11-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16928 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix cdda://n syntax: do not hang when n > nr_tracks and play only track n,reimar2005-11-061-2/+5
| | | | | | | not all after (unfortunately, cdda://n- does not work, use e.g. cdda://n-99999). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16927 b3059339-0415-0410-9bf9-f77b7e298cf2
* estimate total time also for audio-only files.reimar2005-11-061-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16926 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for OSD localizationptt2005-11-061-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16925 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added translatable messages for OSD localization to help/help_mp-en.hptt2005-11-061-12/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16924 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added translatable messages for OSD localization from libvo/sub.cptt2005-11-061-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16923 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.98gabrov2005-11-051-7/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16922 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1148gpoirier2005-11-051-5/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16921 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with rev. 1.196ranma2005-11-051-17/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16920 b3059339-0415-0410-9bf9-f77b7e298cf2
* Translated strings might be longer than the originals. One unnecessary ↵ranma2005-11-051-6/+5
| | | | | | dependancy on string length fixed; quadrupled buffer size for matroska case git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16919 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use correct demuxer type for aac in shoutcast streamsrtognimp2005-11-051-0/+2
| | | | | | | | (content-type="audio/aacp"). Fixes http://160.79.128.40:7040 (it does not work with internal faad) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16918 b3059339-0415-0410-9bf9-f77b7e298cf2
* Speex audio decodingreimar2005-11-051-0/+113
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16917 b3059339-0415-0410-9bf9-f77b7e298cf2
* Speex support. Seeking and pts generation does not work.reimar2005-11-058-1/+84
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16916 b3059339-0415-0410-9bf9-f77b7e298cf2
* set cdda paranoia default to 0 since e.g. cdda://2 breaks otherwise.reimar2005-11-052-3/+4
| | | | | | | | this was the default before, too, since a function call was missing and thus the paranoia setting was ignored git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16915 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow detection of theora without pkg-config and linking against internalreimar2005-11-051-3/+8
| | | | | | | tremor ogg functions instead of external ogg lib. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16914 b3059339-0415-0410-9bf9-f77b7e298cf2
* sort timestamps instead of assuming conventional B-frame order. (fixes x264 ↵lorenm2005-11-051-6/+14
| | | | | | B-pyramid) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16913 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enabled OSD localization / moved msgs to help/help_mp-en.hptt2005-11-051-26/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16912 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added translatable messages for OSD localizationptt2005-11-051-0/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16911 b3059339-0415-0410-9bf9-f77b7e298cf2
* Little fixes around ':' and spacesptt2005-11-051-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16910 b3059339-0415-0410-9bf9-f77b7e298cf2
* Changed MSGTR_MPDEMUX_URL_MallocFailed to MSGTR_MemAllocFailed (msg defined ↵ptt2005-11-051-10/+10
| | | | | | two times in help_mp-en.h) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16909 b3059339-0415-0410-9bf9-f77b7e298cf2
* Changed MSGTR_MPDEMUX_ASF_MallocFailed to MSGTR_MemAllocFailed (msg defined ↵ptt2005-11-051-1/+1
| | | | | | two times inhelp_mp-en.h) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16908 b3059339-0415-0410-9bf9-f77b7e298cf2
* Changed MSGTR_MPDEMUX_MMST_MallocFailed to MSGTR_MemAllocFailed (msg defined ↵ptt2005-11-051-1/+1
| | | | | | two times inhelp_mp-en.h) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16907 b3059339-0415-0410-9bf9-f77b7e298cf2
* changes from MSGTR_MPDEMUX_AIALSA1X_* to MSGTR_MPDEMUX_AIALSA_* since they ↵ptt2005-11-051-13/+13
| | | | | | are the same messages git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16906 b3059339-0415-0410-9bf9-f77b7e298cf2
* MSGTR_MemAllocFailed printout changed to fit its definition in help/help_mp-en.hptt2005-11-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16905 b3059339-0415-0410-9bf9-f77b7e298cf2
* libmpdemux translatables correctionsptt2005-11-051-20/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16904 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.136ptt2005-11-041-13/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16903 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.98jheryan2005-11-041-4/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16902 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1146jheryan2005-11-041-52/+79
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16901 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.193jheryan2005-11-041-7/+218
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16900 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r360 (trellis)lorenm2005-11-043-1/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16899 b3059339-0415-0410-9bf9-f77b7e298cf2
* Autoload vobsub's from ~/.mplayer/subalbeu2005-11-031-1/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16898 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed KEY_PREVIOUS to KEY_PREV, cause the first undefinedptt2005-11-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16897 b3059339-0415-0410-9bf9-f77b7e298cf2
* small grammar/wording fixesptt2005-11-031-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16896 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fix bust/mustreynaldo2005-11-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16895 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.192 by PaulTTptt2005-11-031-2/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16894 b3059339-0415-0410-9bf9-f77b7e298cf2
* libvo input cleanup: remove the dependency on libinput,albeu2005-11-0210-51/+92
| | | | | | | remove most of the crappy mappings (like O->o or ESC->q). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16893 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.193ranma2005-11-021-1/+154
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16892 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with rev. 1.192ranma2005-11-021-1/+59
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16891 b3059339-0415-0410-9bf9-f77b7e298cf2
* Too much spare time on tuesday, compared about 2/3 of the english manpage ↵ranma2005-11-021-66/+440
| | | | | | with the german one to find missing sections; some rephrasing git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16890 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1146gpoirier2005-11-021-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16889 b3059339-0415-0410-9bf9-f77b7e298cf2
* bump sync taggpoirier2005-11-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16888 b3059339-0415-0410-9bf9-f77b7e298cf2
* close stream_fd on uninit. Fixes bugzilla bug #400.reimar2005-11-011-0/+2
| | | | | | | Modified patch from T. Dekker {t dekker [at] student utwente nl}. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16887 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.98, patch by Johan Bos.gpoirier2005-11-011-4/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16886 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix two (loosely) related bugs: massive A-V desync with -audiofile (bugzillareimar2005-11-011-5/+6
| | | | | | | | bug #375, sh_audio->delay must only be set when seeking, not at every packet) and not switching to the next file when seeking hits eof. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16885 b3059339-0415-0410-9bf9-f77b7e298cf2
* more precise seeking based on calculated average video bitrate; works quite ↵nicodvb2005-10-311-6/+49
| | | | | | well in case of a TS with only 1 video stream git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16884 b3059339-0415-0410-9bf9-f77b7e298cf2
* libmpdemux translatables to help_mp part 1 / mp_msg calls / try 2reynaldo2005-10-319-156/+156
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16883 b3059339-0415-0410-9bf9-f77b7e298cf2
* libmpdemux translatables to help_mp part 1 / messages / try 2reynaldo2005-10-311-0/+154
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16882 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l typo, nomanyfmts should be used against playback problems.reimar2005-10-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16881 b3059339-0415-0410-9bf9-f77b7e298cf2
* More consistent and sane types. Also avoids some gcc 4 warnings.reimar2005-10-313-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16880 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.34, patch by Johan Bos + fixes by megpoirier2005-10-311-9/+705
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16879 b3059339-0415-0410-9bf9-f77b7e298cf2
* move resync_audio_stream after seeking to demuxer.creimar2005-10-3015-44/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16878 b3059339-0415-0410-9bf9-f77b7e298cf2
* Provide DEMUXER_CTRL_GET_TIME_LENGTH and DEMUXER_CTRL_GET_PERCENT_POS.reimar2005-10-301-1/+14
| | | | | | | | Might need some more fine-tuning. together with rev. 1.318 of mencoder.c fixes bug #116 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16877 b3059339-0415-0410-9bf9-f77b7e298cf2
* Provide percentage even when demuxer->movi_start and movi_end are not availablereimar2005-10-301-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16876 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, uninit() was not used, fixes bug #401reimar2005-10-301-0/+2
| | | | | | | Modified patch from T. Dekker (t dekker <at> student utwente nl) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16875 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updating little things I have done so farreynaldo2005-10-291-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16874 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow the user to set the $MPLAYER_HOME environment variable to point to the ↵albeu2005-10-291-1/+3
| | | | | | | | | | | location were they want mplayer to store its configuration stuff. Patch by Nikolai Weibull (nikolai _(dot)_ weibull _(at)_ gmail _(dot)_ com) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16873 b3059339-0415-0410-9bf9-f77b7e298cf2
* preliminary support for wpl playlists, closes #362reynaldo2005-10-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16872 b3059339-0415-0410-9bf9-f77b7e298cf2
* add a \n after whole cache fill.ods152005-10-271-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16871 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2005-10-261-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16870 b3059339-0415-0410-9bf9-f77b7e298cf2
* make myself console help messages maintainter at diego's requestreynaldo2005-10-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16869 b3059339-0415-0410-9bf9-f77b7e298cf2
* gcc -dumpmachine outputs x86_64-something on some machines anddiego2005-10-261-1/+1
| | | | | | | | amd64-something on others. Handle both cases. Fixes bug #325. patch by Pawel Sakowski < pawel __ dot __ sakowski __ dot __ pl > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16868 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.192gabrov2005-10-261-8/+63
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16867 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify subtitle alignment behavior.diego2005-10-261-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16866 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added support for remote controls.syrjala2005-10-261-4/+71
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16865 b3059339-0415-0410-9bf9-f77b7e298cf2
* Complete sync with 1.192reynaldo2005-10-261-38/+89
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16864 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify include paths, -I.. is in CFLAGS.diego2005-10-2610-63/+63
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16863 b3059339-0415-0410-9bf9-f77b7e298cf2
* Run dh_makeshlibs to create proper shlibs files and avoid warnings.diego2005-10-251-1/+1
| | | | | | | patch by Paul TT < paultt ( at ) hackerjournal ( dot ) it > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16862 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify include paths, -I.. is in CFLAGS.diego2005-10-253-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16861 b3059339-0415-0410-9bf9-f77b7e298cf2
* big-endian fixes for "extended" (i.e. mythtv) files.reimar2005-10-251-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16860 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l broken asm crap needs an external namerfelker2005-10-252-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16859 b3059339-0415-0410-9bf9-f77b7e298cf2
* INPUT section created, added messages from input/input.c and input/joystick.creynaldo2005-10-251-0/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16858 b3059339-0415-0410-9bf9-f77b7e298cf2
* translatable eng strings to new section on help_mp-enreynaldo2005-10-251-30/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16857 b3059339-0415-0410-9bf9-f77b7e298cf2
* printf to mp_msgreynaldo2005-10-251-9/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16856 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix incorrect use of strl* functions (patch by reimar)rfelker2005-10-251-4/+4
| | | | | | | (unknown suboption "cop" with -oac copy, etc) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16855 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix broken (off-by-one) behavior of our strl* functions (patch by reimar)rfelker2005-10-251-17/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16854 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not export useless symbols! fixed compile bug with decode support in lamerfelker2005-10-252-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16853 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1145gpoirier2005-10-251-4/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16852 b3059339-0415-0410-9bf9-f77b7e298cf2
* Extra processor information needs to be known in the x86_64 case as welldiego2005-10-251-5/+9
| | | | | | | | for x86_64 optimizations to get enabled. patch by Corey Hickey < bugfood-ml __ at __ fatooh __ dot __ org > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16851 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixing the unverified patch (one of the millions) commited by:gabucino2005-10-251-1/+1
| | | | | | | | Attila "I'll ban you forever" Kinali AKA KotH teh idiot, date: 2003/10/04 23:06:04 rev 1.779 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16850 b3059339-0415-0410-9bf9-f77b7e298cf2
* Switch from our own to the upstream DVD key caching strategy and directory.diego2005-10-242-79/+6
| | | | | | | | Should work just as well while reducing our diff towards upstream and enhancing compatibility with external libdvdcss implementations. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16849 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l to Reimar: common.h belongs to libdvdcss, not libdvdread.diego2005-10-242-15/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16848 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r334 (crf)lorenm2005-10-243-1/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16847 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1143gpoirier2005-10-231-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16846 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor spelling wording fixesdiego2005-10-231-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16845 b3059339-0415-0410-9bf9-f77b7e298cf2
* author list prettyprintingdiego2005-10-231-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16844 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reformat section titles so that it becomes easier to tell sections anddiego2005-10-231-18/+52
| | | | | | | subsections apart. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16843 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make include paths consistent among files in libvo. Since -I.. is addeddiego2005-10-231-2/+2
| | | | | | | to the CFLAGS in the Makefile this should be safe. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16842 b3059339-0415-0410-9bf9-f77b7e298cf2
* improve documentation of -subalignrfelker2005-10-231-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16841 b3059339-0415-0410-9bf9-f77b7e298cf2
* make bottom alignment the default since it's the only sane mode when sub_pos ↵rfelker2005-10-231-1/+1
| | | | | | is near bottom (default) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16840 b3059339-0415-0410-9bf9-f77b7e298cf2
* reverse incorrect sub alignment change, ok'd by diegorfelker2005-10-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16839 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l to whoever got aspect upside-down.. it's w/h, not h/w. hope this doesn't ↵rfelker2005-10-232-5/+5
| | | | | | bother anyone already using it too much git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16838 b3059339-0415-0410-9bf9-f77b7e298cf2
* comment on -noskip patchrfelker2005-10-231-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16837 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/grammar/wordingdiego2005-10-231-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16836 b3059339-0415-0410-9bf9-f77b7e298cf2
* The conditions for bottom (2) and top (1) subtitle alignment are reversed.diego2005-10-231-1/+1
| | | | | | | patch by Paul TT < paultt == at -- hackerjournal == dot -- it > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16835 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for prescott, nocona and pentium-m processorsdiego2005-10-231-9/+34
| | | | | | | based on a patch by Corey Hickey < bugfood-ml . at . fatooh . dot . org > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16834 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a comment to an esac where the case is very far away.diego2005-10-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16833 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplification of the system_name check and the PPC CPU type check.diego2005-10-231-14/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16832 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a comment to else clauses where the if is very far away.diego2005-10-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16831 b3059339-0415-0410-9bf9-f77b7e298cf2
* honor decoder's/filter's decision to remove frames when using -noskip.rfelker2005-10-231-0/+3
| | | | | | | | | | | | | | | | | | | | this may go against the original intention of the vf layer, but it's how all the filters that drop frames have been written to work, so it's now the de-facto standard. without this patch, -noskip will result in tons of duplicate frames (either soft or hard duplicates) and a/v desync whenever decimation, ivtc, etc. is used. even with this patch -noskip is still a bad idea for most of these purposes, but it will work reliably with filmdint, framestep, and some other filters with fixed in:out ratios as long as the right -ofps value is used. without this patch, there is no hope of -noskip working with frame-dropping filters. (this patch was previously committed erroneously as part of another change, then reversed. it is now being committed again.) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16830 b3059339-0415-0410-9bf9-f77b7e298cf2
* reapply rawaudio muxer fix (don't disable audio without user's permission!) ↵rfelker2005-10-231-4/+0
| | | | | | (previously reversed because of mistake in patch.. 10l to me :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16829 b3059339-0415-0410-9bf9-f77b7e298cf2
* reverse patch that was mistakenly applied with unwanted unrelated changesrfelker2005-10-231-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16828 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing quotes around .IPs argument.diego2005-10-221-2/+2
| | | | | | | patch by Paul TT < paultt = at = hackerjournal = dot = it > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16827 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for video files created by Samsung Miniket VP-M100 diskless camcorderiive2005-10-221-0/+1
| | | | | | | initial patch by Georgi Chorbadzhiyski <gf@unixsol.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16826 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added support for A_AAC.mosu2005-10-222-1/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16825 b3059339-0415-0410-9bf9-f77b7e298cf2
* cross compiling probably worth mentioiningods152005-10-211-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16824 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a few more XML tags for better semantics markup.diego2005-10-201-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16823 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain how to place subtitles in black bands.diego2005-10-201-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16822 b3059339-0415-0410-9bf9-f77b7e298cf2
* mach64_mmio size fix from vidix.sf.net, possible bugfix for #59faust32005-10-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16821 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync amd64 fixes from vidix.sf.netfaust32005-10-201-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16820 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix seeking in wav files: align relative to start of data, not start of filereimar2005-10-201-1/+3
| | | | | | | and use nBlockAlign if available. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16819 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.32diego2005-10-202-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16818 b3059339-0415-0410-9bf9-f77b7e298cf2
* ilmv --> ilme typo fixdiego2005-10-202-4/+4
| | | | | | | patch by compn < tempn == at == twmi == dot == rr == dot == com > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16817 b3059339-0415-0410-9bf9-f77b7e298cf2
* semi-hack: avoid passing 0-length blocks to audio filters.reimar2005-10-201-0/+1
| | | | | | | Fixes bugzilla bug #391 (lavcresample crashes). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16816 b3059339-0415-0410-9bf9-f77b7e298cf2
* document hackods152005-10-201-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16815 b3059339-0415-0410-9bf9-f77b7e298cf2
* -vc null -vo null is not the fastest way to dump...diego2005-10-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16814 b3059339-0415-0410-9bf9-f77b7e298cf2
* Converted from GBK to UTF-8 encoding.diego2005-10-192-829/+829
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16813 b3059339-0415-0410-9bf9-f77b7e298cf2
* further sync by Emfox Zhou < emfoxzhou -- at -- gmail -- dot -- com >diego2005-10-191-8/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16812 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.188 by Paul TT < paultt == at == hackerjournal == dot == it >diego2005-10-191-13/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16811 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.98jheryan2005-10-191-3/+147
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16810 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo hunting.jheryan2005-10-191-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16809 b3059339-0415-0410-9bf9-f77b7e298cf2
* Formal syncing. Typo hunting.jheryan2005-10-191-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16808 b3059339-0415-0410-9bf9-f77b7e298cf2
* charset for help_mp-zh_TW.hdiego2005-10-191-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16807 b3059339-0415-0410-9bf9-f77b7e298cf2
* processing audio is sometimes essential for a/v sync, so 1000l torfelker2005-10-192-15/+4
| | | | | | | | | | | | | | whoever made rawvideo muxer disable audio!! with this patch, audio is processed but simply thrown away by the muxer. various 'error' conditions in rawvideo muxer are removed to make it work. feel free to re-add them if they can be done without breaking anything, but do not use printf !!!! btw old behavior can be obtained by manually specifying -nosound. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16806 b3059339-0415-0410-9bf9-f77b7e298cf2
* add cross-compiling supportaurel2005-10-181-0/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16805 b3059339-0415-0410-9bf9-f77b7e298cf2
* replace all the direct $TMPO calls by a tmp_run() function callaurel2005-10-181-14/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16804 b3059339-0415-0410-9bf9-f77b7e298cf2
* replace mp3lame version detection by required features detectionaurel2005-10-182-10/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16803 b3059339-0415-0410-9bf9-f77b7e298cf2
* modify DirectFB version detection so that it only requires pre-processingaurel2005-10-181-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16802 b3059339-0415-0410-9bf9-f77b7e298cf2
* modify alsa version detection so that it don't require running the generated ↵aurel2005-10-181-10/+25
| | | | | | binary git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16801 b3059339-0415-0410-9bf9-f77b7e298cf2
* add a cxx_check function to simplify C++ libs checkingaurel2005-10-181-14/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16800 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1140gpoirier2005-10-181-1/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16799 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updatertognimp2005-10-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16798 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add FFmpeg QDM2 audio decoderrtognimp2005-10-181-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16797 b3059339-0415-0410-9bf9-f77b7e298cf2
* xscreensaver --> XScreenSaverdiego2005-10-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16796 b3059339-0415-0410-9bf9-f77b7e298cf2
* Embarassing goofs in the basic key sections that nobody noticed for agesdiego2005-10-181-3/+3
| | | | | | | until Paul TT < paultt == at == hackerjournal == dot == it > came along. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16795 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make a few more messages translatable by moving them into help_mp-en.h.diego2005-10-188-21/+38
| | | | | | | patch by Paul TT < paultt == at == hackerjournal == dot == it > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16794 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a few more CPU models to the list.diego2005-10-181-19/+20
| | | | | | | patch by Zuxy < zuxy == dot == meng == at == gmail == dot == com > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16793 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a note about the "synce with 1.XXX" line that should be in everydiego2005-10-171-0/+8
| | | | | | | translated console message file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16792 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a note and a workaround about broken hardware players and how theydiego2005-10-171-0/+7
| | | | | | | choke on Unix line endings in SRT subtitle files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16791 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1139 + Reimar's patchgpoirier2005-10-171-10/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16790 b3059339-0415-0410-9bf9-f77b7e298cf2
* new message was even worse -- B/s means bytes per second, not sample!rfelker2005-10-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16789 b3059339-0415-0410-9bf9-f77b7e298cf2
* further sync by Emfox Zhou < emfoxzhou == at == gmail == dot == com >diego2005-10-171-0/+128
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16788 b3059339-0415-0410-9bf9-f77b7e298cf2
* deobfuscatioin: csp --> colorspacediego2005-10-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16787 b3059339-0415-0410-9bf9-f77b7e298cf2
* Guillaume now maintains the MEncoder documentation.diego2005-10-171-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16786 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor typodiego2005-10-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16785 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l -- mismatched type after changing sizes to type long!rfelker2005-10-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16784 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove nonsense break statements that do nothing..rfelker2005-10-171-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16783 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow mencoder to load win32 codecs properly patch by Zuxy <zuxy.meng at ↵faust32005-10-163-29/+43
| | | | | | gmail.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16782 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add MIPS64 detection.diego2005-10-161-1/+1
| | | | | | | patch by Luca Barbato < lu_zero == at == gentoo == dot == org > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16781 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l de Breizh Cola: build fix.gpoirier2005-10-161-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16780 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updatertognimp2005-10-151-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16779 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support DTA and FLX extensions for flic via ffmpeg decoderrtognimp2005-10-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16778 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add ffmpeg truemotion2 codec, make it default for TM20rtognimp2005-10-151-1/+9
| | | | | | | Flip dshow truemotion2 picture, it was upside-down git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16777 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1138gpoirier2005-10-151-25/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16776 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1137gpoirier2005-10-151-2/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16775 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix/improve vo_gl and vo_gl2 suboption documentationreimar2005-10-151-20/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16774 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another usage example for the %n%str escaping syntax and ao_sgi ↵reimar2005-10-151-1/+13
| | | | | | documentation update git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16773 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, demux_mpg_control was missing from demuxer info struct, causing audioreimar2005-10-151-5/+5
| | | | | | | switching not to work git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16772 b3059339-0415-0410-9bf9-f77b7e298cf2
* ugly hack to make it work again with external libdvdreadreimar2005-10-151-0/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16771 b3059339-0415-0410-9bf9-f77b7e298cf2
* Extend the network test to also check the socket libs.diego2005-10-151-1/+2
| | | | | | | patch by Derek E. Lewis < dlewis -- at -- solnetworks -- at -- net > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16770 b3059339-0415-0410-9bf9-f77b7e298cf2
* bumped sync tag after typo fix in English version (synced with 1.98)gabrov2005-10-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16769 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing ")", picked up by Mizda Gaborgpoirier2005-10-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16768 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.186gabrov2005-10-141-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16767 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.26gabrov2005-10-141-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16766 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.97gabrov2005-10-141-9/+305
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16765 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.31gabrov2005-10-141-4/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16764 b3059339-0415-0410-9bf9-f77b7e298cf2
* Kill a compiler warning, Patch by Zuxy Menggpoirier2005-10-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16763 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make FtpSendCmd() function more user friendly by making it append the ↵gpoirier2005-10-141-11/+15
| | | | | | | | | | | | necessary "\r\n" line break (instead of the caller) Patch by Zuxy Meng < zuxy POIS meng AH gmail POIS com > Original thread: Date: Oct 14, 2005 1:01 PM Subject: [MPlayer-dev-eng] [PATCH] More user friendly ftp error git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16762 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.96, patch by Johan Bos <dariusjb AH gmail POIS comgpoirier2005-10-141-778/+384
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16761 b3059339-0415-0410-9bf9-f77b7e298cf2
* third time is lucky, eh? last workaround broke netbsd, which apparently also ↵rfelker2005-10-141-2/+2
| | | | | | has a broken noncompliant implementation of tr. if it still doesn't work... blame someone else. :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16760 b3059339-0415-0410-9bf9-f77b7e298cf2
* exit mplayer if audio filter init fails (same as mencoder does)ivo2005-10-131-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16759 b3059339-0415-0410-9bf9-f77b7e298cf2
* The Wanderer rulez :)gpoirier2005-10-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16758 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics. does not change functionality, but makes code easier to readods152005-10-131-63/+43
| | | | | | | (removes redundant switch-case) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16757 b3059339-0415-0410-9bf9-f77b7e298cf2
* nit by diegoods152005-10-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16756 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes suggested by Diego and Alexgpoirier2005-10-131-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16755 b3059339-0415-0410-9bf9-f77b7e298cf2
* weirdness, flags aren't restored right unless you add this second pushods152005-10-131-0/+1
| | | | | | | | | | | mencoder a.avi b.avi -flag c.avi -flag should've only applied to b, but it applied to both b and c!! No clue why this happens and more so why this solves it. but it does. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16754 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix mencoder multi-file with some files having audio but others dontods152005-10-132-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16753 b3059339-0415-0410-9bf9-f77b7e298cf2
* Be less verbose.reimar2005-10-131-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16752 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use PRI?64 defines as format strings for 64 bit variables.reimar2005-10-1315-81/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16751 b3059339-0415-0410-9bf9-f77b7e298cf2
* further sync by Emfox Zhou < emfoxzhou -- at -- gmail -- dot -- com >diego2005-10-131-5/+192
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16750 b3059339-0415-0410-9bf9-f77b7e298cf2
* we need stdio.h for SEEK_SET on mingw, patch by Zuxy <zuxy.meng at gmail.com>faust32005-10-131-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16749 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1134 - patch by Paul TT <paultt - at - hackerjournal - dot - it>danny2005-10-131-102/+321
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16748 b3059339-0415-0410-9bf9-f77b7e298cf2
* List the different containers supported by MEncoder, as well as a nice ↵gpoirier2005-10-121-2/+147
| | | | | | example of how to produce flash videos. + a bit a clean-up. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16747 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement seekingreimar2005-10-121-3/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16746 b3059339-0415-0410-9bf9-f77b7e298cf2
* implement ADCTRL_RESYNC_STREAM, it tries to detect when decoding isreimar2005-10-121-0/+34
| | | | | | | "reliable" again. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16745 b3059339-0415-0410-9bf9-f77b7e298cf2
* Bigendian bugreimar2005-10-121-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16744 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing space in status linereimar2005-10-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16743 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for suboption escaping via both "" and %n%str syntaxreimar2005-10-121-13/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16742 b3059339-0415-0410-9bf9-f77b7e298cf2
* change to switch/case for dumpsubods152005-10-121-6/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16741 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change unsigned->signed and int->long, this fits the asm code better on 64reimar2005-10-124-236/+237
| | | | | | | | bit systems. Also fixes several crashes because (long)-i is incorrect if i is unsigned. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16740 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1136gpoirier2005-10-121-17/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16739 b3059339-0415-0410-9bf9-f77b7e298cf2
* -vc dummy is know to cause crashes, so suggest -vc null instead.reimar2005-10-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16738 b3059339-0415-0410-9bf9-f77b7e298cf2
* further partial sync by Emfox Zhou < emfoxzhou -- at -- gmail -- dot -- com >diego2005-10-121-0/+114
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16737 b3059339-0415-0410-9bf9-f77b7e298cf2
* Put networking lib linker flag checks in the order they were before thediego2005-10-111-1/+1
| | | | | | | configure cleanup. Fixes build on Solaris. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16736 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc corrections by Paul TT < paultt -- at -- hackerjournal -- dot -- it >diego2005-10-111-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16735 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync by Emfox Zhou < emfoxzhou -- at -- gmail -- dot com >diego2005-10-111-12/+67
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16734 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_macosx is a native audio output driver and should thus have prioritydiego2005-10-111-3/+3
| | | | | | | over non-native outputs drivers like ao_sdl and the like. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16733 b3059339-0415-0410-9bf9-f77b7e298cf2
* solaris bug workarounds, take 2..rfelker2005-10-111-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16732 b3059339-0415-0410-9bf9-f77b7e298cf2
* -frames plays one frame too many.reimar2005-10-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16731 b3059339-0415-0410-9bf9-f77b7e298cf2
* I think I know EDL enough to maintain it...ods152005-10-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16730 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.59, patch by Johan Bos dariusjb AH gmail POIS comgpoirier2005-10-111-30/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16729 b3059339-0415-0410-9bf9-f77b7e298cf2
* A few fixes noticed by Paul TT.diego2005-10-111-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16728 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compile fix: _lseeki64 is not available under cygwinreimar2005-10-112-2/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16727 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l, strtof is only C99, strtod is ANSI C, so use that instead.reimar2005-10-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16726 b3059339-0415-0410-9bf9-f77b7e298cf2
* work around (buggy?) solaris tr. hope this helps.. please report if its ↵rfelker2005-10-111-2/+2
| | | | | | still broken git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16725 b3059339-0415-0410-9bf9-f77b7e298cf2
* More consistency for the interactive control section.diego2005-10-111-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16724 b3059339-0415-0410-9bf9-f77b7e298cf2
* nitsgpoirier2005-10-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16723 b3059339-0415-0410-9bf9-f77b7e298cf2
* use subopt parser for arguments.joey2005-10-102-56/+46
| | | | | | | | change all printf to mp_msg. update man page gif89a example. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16722 b3059339-0415-0410-9bf9-f77b7e298cf2
* support float arguments in subopt helper.joey2005-10-102-0/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16721 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo fix: RFC959 says that FTP commands should end with a carriage returngpoirier2005-10-101-1/+1
| | | | | | | | | | | followed by a line feed. Patch by Zuxy < zuxy POIS meng AH gmail POIS com> Original thread: Date: Oct 10, 2005 10:08 AM Subject: [MPlayer-dev-eng] [PATCH] Typo in libmpdemux/stream_ftp.c git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16720 b3059339-0415-0410-9bf9-f77b7e298cf2
* makes demux_lavf (-demuxer 35) use the framerate specified in the containergpoirier2005-10-101-0/+5
| | | | | | | | | | | | | | if it's set and only fall back to the codec framerate if the former is not set. This solves the issue of some avi's playing at 30000/1 fps instead of the correct framerate. Patch by Ivo < ivop AH euronet POIS nl > Original thread: Date: Sep 25, 2005 12:34 AM Subject: [MPlayer-dev-eng] [PATCH] make demux_lavf use container framerate git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16719 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1132gpoirier2005-10-091-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16718 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with patches.xml removaldiego2005-10-096-27/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16717 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.26diego2005-10-096-27/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16716 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace unconditional #defines by build system trickery.diego2005-10-097-111/+72
| | | | | | | This reduces our local diff considerably. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16715 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmeticsdiego2005-10-091-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16714 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r318 (mixed_refs)lorenm2005-10-083-1/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16713 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fix at (_)ld_dliive2005-10-081-1/+1
| | | | | | | patch by jb13 at gomerbud com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16712 b3059339-0415-0410-9bf9-f77b7e298cf2
* some docs updatesdiego2005-10-081-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16711 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove the "How to send patches appendix", the info is in the FAQ.diego2005-10-082-9/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16710 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100000l to meods152005-10-081-3/+6
| | | | | | | | | fixdelay() pre-read a frame to make pts sane, and then called slowseek(), which AGAIN read another frame, and then tries to decode it (which breaks as all frames should be read) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16709 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.81jheryan2005-10-071-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16708 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.17jheryan2005-10-071-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16707 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.94jheryan2005-10-071-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16706 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.59jheryan2005-10-071-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16705 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.96jheryan2005-10-071-3/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16704 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.31jheryan2005-10-071-51/+176
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16703 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1131jheryan2005-10-071-18/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16702 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.34gabrov2005-10-061-19/+651
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16701 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo fix, patch by Ismail Dönmez <ismail AH kde POIS org POIS tr>gpoirier2005-10-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16700 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.17, patch by Johan Bossgpoirier2005-10-061-7/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16699 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.81, patch by johan bosgpoirier2005-10-061-197/+245
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16698 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.14, patch by Johan Bos, plus some formating changes by megpoirier2005-10-061-73/+99
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16697 b3059339-0415-0410-9bf9-f77b7e298cf2
* Centaur/VIA configure checkhenry2005-10-061-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16696 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.16, patch by Johan Bos, plus reformating by megpoirier2005-10-061-35/+63
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16695 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.70, patch by Johan Bos + reformating of the source by megpoirier2005-10-061-122/+413
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16694 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1131 (just after Diego's commit torrent) :-)gpoirier2005-10-061-26/+104
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16693 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1128jheryan2005-10-061-15/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16692 b3059339-0415-0410-9bf9-f77b7e298cf2
* stupid typodiego2005-10-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16691 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reformat the interactive control section.diego2005-10-061-8/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16690 b3059339-0415-0410-9bf9-f77b7e298cf2
* Keyboard control section renamed to interactive control, small structure change.diego2005-10-062-11/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16689 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.12, patch by johan bosgpoirier2005-10-061-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16688 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic reformatting: tabs --> spaces, prettyprinting, trailing whitespacediego2005-10-061-481/+493
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16687 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-10-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16686 b3059339-0415-0410-9bf9-f77b7e298cf2
* neightbour --> neighbor typo fixdiego2005-10-062-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16685 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.183jheryan2005-10-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16684 b3059339-0415-0410-9bf9-f77b7e298cf2
* hqdn3d: 2.5x faster temporal-only, 1.6x faster spatial-only.lorenm2005-10-061-1/+76
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16683 b3059339-0415-0410-9bf9-f77b7e298cf2
* detect Centaur CPUs (Winchip, VIA C3)henry2005-10-051-3/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16682 b3059339-0415-0410-9bf9-f77b7e298cf2
* faac vs _faac typo fix by Giacomo Comes < comes -- at -- naic -- dot -- edu >diego2005-10-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16681 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, off by one error in last patch (codecdata length sanity check),reimar2005-10-051-1/+1
| | | | | | | caused crashes with qdmc audio. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16680 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavcodec can encode to SVQ1 and RV20.diego2005-10-051-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16679 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compilation fix for systems lacking lrintf like e.g. NetBSD.diego2005-10-051-4/+14
| | | | | | | patch by Jan Knutar < jknutar -- at -- nic -- dot -- fi > and me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16678 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency nitdiego2005-10-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16677 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document XF86 multimedia keys.diego2005-10-041-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16676 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.183gabrov2005-10-041-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16675 b3059339-0415-0410-9bf9-f77b7e298cf2
* mouse and keyboard controldiego2005-10-041-0/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16674 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.59gabrov2005-10-041-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16673 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-10-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16672 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing keys to the keyboard section, fix typos in that section.diego2005-10-041-3/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16671 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.96gabrov2005-10-041-9/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16670 b3059339-0415-0410-9bf9-f77b7e298cf2
* Shut up jack pkg-config.diego2005-10-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16669 b3059339-0415-0410-9bf9-f77b7e298cf2
* General bug fixes, like missing includes, formats that were incorrectlyreimar2005-10-041-29/+133
| | | | | | | claimed to be supported etc. Patch by dega (dega quickclic net) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16668 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix vo_zr2 suboption description.diego2005-10-041-9/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16667 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rename compilation section to compilation and installation.diego2005-10-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16666 b3059339-0415-0410-9bf9-f77b7e298cf2
* much simpler signed/unsigned conversion.reimar2005-10-041-54/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16665 b3059339-0415-0410-9bf9-f77b7e298cf2
* CVS now supports GTK 2.0gpoirier2005-10-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16664 b3059339-0415-0410-9bf9-f77b7e298cf2
* according to Intel/AMD official documentations, CPU family should be ↵gpoirier2005-10-041-2/+5
| | | | | | | | | | | | | | displayed as the sum of CPUID's family field and extended family field when a CPU has a CPUID family 0xF. Patch by Zuxy <zuxy POIS meng AH gmail POIS com> Original thread: Date: Oct 2, 2005 11:08 AM Subject: [MPlayer-dev-eng] [Patch] Correction of P4 family CPUs detection in cputable.h git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16663 b3059339-0415-0410-9bf9-f77b7e298cf2
* Stupidity in last patch broke compile without MMX: RTjpeg_lmask is a unionreimar2005-10-041-5/+5
| | | | | | | only in the MMX case. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16662 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use pkg-config to detect theora dependencies.diego2005-10-041-4/+6
| | | | | | | patch by j -- at -- thing -- dot -- net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16661 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add changes from last patch (stream mapping).reimar2005-10-041-0/+114
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16660 b3059339-0415-0410-9bf9-f77b7e298cf2
* MEncoder FAQs as suggested by Compn < tempn - a - twmi - d - rr - d - com >diego2005-10-041-0/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16659 b3059339-0415-0410-9bf9-f77b7e298cf2
* random improvements plus some readability cosmeticsdiego2005-10-041-24/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16658 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document subsearch.sh, menc2pass.diego2005-10-041-0/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16657 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix incorrect information for P4 family CPU, patch by Zuxy <zuxy POIS meng ↵gpoirier2005-10-041-5/+5
| | | | | | | | | | | AH gmail POIS com> Original thread: Date: Oct 2, 2005 11:08 AM Subject: [MPlayer-dev-eng] [Patch] Correction of P4 family CPUs detection in cputable.h git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16656 b3059339-0415-0410-9bf9-f77b7e298cf2
* Show total time when playing audio-only filesreimar2005-10-041-13/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16655 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix 100l bugs that break playback on 64 bit systems (like typedefing __u32reimar2005-10-042-21/+20
| | | | | | | as long!!). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16654 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.14gabrov2005-10-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16653 b3059339-0415-0410-9bf9-f77b7e298cf2
* General cleanup: do not link -lm multiple times, use for...in loops insteadreimar2005-10-031-153/+73
| | | | | | | of some if..elif constructs etc. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16652 b3059339-0415-0410-9bf9-f77b7e298cf2
* expGetSystemInfo should not leave SYSTEM_INFO unitialized, even whenreimar2005-10-031-4/+10
| | | | | | | | /proc/cpuinfo is unreadable. Fixes some weird behaviour with the wmv decoder (it tries multithreaded decode). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16651 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix DVD audio and subtitle stream mapping, esp. for DVD with both 4:3 andreimar2005-10-034-32/+80
| | | | | | | | 16:9 subtitles. Patch by Lehel Bernadt (lehel at pmc-services hu) with minor modifications. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16650 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make fragment program snprintf less confusing.reimar2005-10-031-14/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16649 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.30gabrov2005-10-031-59/+626
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16648 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.34jheryan2005-10-031-13/+651
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16647 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1121jheryan2005-10-031-99/+317
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16646 b3059339-0415-0410-9bf9-f77b7e298cf2
* typogpoirier2005-10-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16645 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.22, patch by johan bosgpoirier2005-10-021-11/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16644 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.25, patch by johan bosgpoirier2005-10-021-62/+100
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16643 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.72, Patch by johan bosgpoirier2005-10-021-82/+220
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16642 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.11, patch by johan bosgpoirier2005-10-021-91/+123
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16641 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.15, patch by johan bosgpoirier2005-10-021-52/+89
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16640 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.13, patch by johan bosgpoirier2005-10-021-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16639 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.31, patch by johan bos dariusjb AH gmail POIS comgpoirier2005-10-021-1173/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16638 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nits suggested by Ivo and Diego. Patch by Matthias Wieser < mwieser AH gmx ↵gpoirier2005-10-021-31/+59
| | | | | | | | | | | POIS de > Original thread: Date: Oct 2, 2005 7:12 PM Subject: Re: Fwd: [MPlayer-cvslog] CVS: main/TOOLS psnr-video.sh, NONE, 1.1 README, 1.9, 1.10 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16637 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, forgotten call to paranoia_modeset to actually set the desired mode.reimar2005-10-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16636 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates, fixesdiego2005-10-021-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16635 b3059339-0415-0410-9bf9-f77b7e298cf2
* Expose MSG_USE_COLORS in config.h.diego2005-10-021-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16634 b3059339-0415-0410-9bf9-f77b7e298cf2
* Several minor fixes: Correctly advertise SSE and SSE2 instruction sets,reimar2005-10-022-1/+15
| | | | | | | | add MSVCRT._winver and KERNEL32.GetThreadPriority exports. Should fix some crashes esp. with wmv9dmo.dll git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16633 b3059339-0415-0410-9bf9-f77b7e298cf2
* modification notices according to GPL 2adiego2005-10-015-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16632 b3059339-0415-0410-9bf9-f77b7e298cf2
* upgrade to libdvdcss 1.2.9diego2005-10-0112-800/+601
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16631 b3059339-0415-0410-9bf9-f77b7e298cf2
* long obsoletediego2005-10-011-32/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16630 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes the bug #382 http://bugzilla.mplayerhq.hu/show_bug.cgi?id=382gpoirier2005-10-011-11/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16629 b3059339-0415-0410-9bf9-f77b7e298cf2
* documentation-only patch: make doxygen compatible and createreimar2005-10-012-58/+178
| | | | | | | af_chain and af_filter doxygen modules. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16628 b3059339-0415-0410-9bf9-f77b7e298cf2
* documentation update.reimar2005-10-012-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16627 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for ATI specific YUV->RGB conversion.reimar2005-10-012-17/+154
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16626 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for eof instead of decoding the same data over and over.reimar2005-10-011-0/+1
| | | | | | | The whole code could use a lot more checks on return values... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16625 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add Compn, expert at wrangling useful bugreports from users ;-)reimar2005-10-011-0/+5
| | | | | | | Patch by himself (tempn at twmi rr com). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16624 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better wording by The Wanderergpoirier2005-09-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16623 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000lods152005-09-301-6/+10
| | | | | | | gcc 2.95 only works with this kind of define, instead of the C99 one. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16622 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing defaut for a suboption of tfieldsgpoirier2005-09-291-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16621 b3059339-0415-0410-9bf9-f77b7e298cf2
* document missing parameter of tfields: field dominance.gpoirier2005-09-291-1/+13
| | | | | | | ... but what's the default ? git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16620 b3059339-0415-0410-9bf9-f77b7e298cf2
* mp_msg cleanup.ods152005-09-292-93/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16619 b3059339-0415-0410-9bf9-f77b7e298cf2
* A long-standing bug... -vfwopts in cfg-mencoder.h is being overriddendiego2005-09-281-1/+1
| | | | | | | | | by -vf* in cfg-common.h. The easiest fix of all, add an 'x' to the name: -xvfwopts patch by RC <rcooley -- at -- spamcop -- dot -- net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16618 b3059339-0415-0410-9bf9-f77b7e298cf2
* forgotten include; patch by Jan Knutar (jknutar ad nic puntum fi)nicodvb2005-09-281-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16617 b3059339-0415-0410-9bf9-f77b7e298cf2
* code before decleration, gcc2.95 fixods152005-09-281-11/+10
| | | | | | | patch by Jan Knutar (jknutar SIGH nic BOOM fi) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16616 b3059339-0415-0410-9bf9-f77b7e298cf2
* another url_free that shouldn't be commented out.reimar2005-09-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16615 b3059339-0415-0410-9bf9-f77b7e298cf2
* Detect eof when seeking and do _not_ restart the video.reimar2005-09-281-1/+8
| | | | | | | Also fixes some invalid reads. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16614 b3059339-0415-0410-9bf9-f77b7e298cf2
* Report total timereimar2005-09-271-3/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16613 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sanity-check codecdata_len, fixes crash in libfaad due to failed malloc forreimar2005-09-271-0/+3
| | | | | | | http://images.apple.com/movies/us/hd_gallery/gl1800/480p/the_brothers_grimm_m480pa.mov git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16612 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1119gpoirier2005-09-271-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16611 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow string escaping via "".reimar2005-09-271-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16610 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing GL_REGISTER_COMBINERS_NV definereimar2005-09-271-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16609 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add -panscanrange optionreimar2005-09-273-0/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16608 b3059339-0415-0410-9bf9-f77b7e298cf2
* the "psnr" option doesn't really need to be in the encoding setting examples.gpoirier2005-09-261-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16607 b3059339-0415-0410-9bf9-f77b7e298cf2
* Random fixes and more coherencygpoirier2005-09-261-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16606 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't pass NULL pointers to demux_info_add()rtognimp2005-09-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16605 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1098 - patch by Paul TT <paultt - at - hackerjournal - dot - it>danny2005-09-261-77/+155
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16604 b3059339-0415-0410-9bf9-f77b7e298cf2
* make xvid encoding use the filename fromgpoirier2005-09-261-3/+4
| | | | | | | | | | | -passlogfile to store and retreive pass information. Patch by Olivier Rolland < billl AH users POIS sf POIS net> Original thread: Date: Sep 25, 2005 9:41 PM Subject: [MPlayer-dev-eng] [PATCH] XviD and -passlogfile git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16603 b3059339-0415-0410-9bf9-f77b7e298cf2
* Config file option format corrected.jheryan2005-09-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16602 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1118gpoirier2005-09-251-15/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16601 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nits noticed by Diegogpoirier2005-09-251-18/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16600 b3059339-0415-0410-9bf9-f77b7e298cf2
* the on suboption of -rawaudio and -rawvideo do not work anymore since thereimar2005-09-253-9/+5
| | | | | | | demuxer API rework. So remove them and change the docs to use -demuxer raw*. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16599 b3059339-0415-0410-9bf9-f77b7e298cf2
* little updatereimar2005-09-251-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16598 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds encoding setting examples for lavc and XviD.gpoirier2005-09-251-25/+147
| | | | | | | | Remove the references to constant quant in x264 section (Jeff did not like that :-) ). Put all examples in a table so that it they are easier to read. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16597 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix/improve code doxumentation. Also group gl_common functions in severalreimar2005-09-253-7/+59
| | | | | | | doxygen modules git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16596 b3059339-0415-0410-9bf9-f77b7e298cf2
* debugging/testing helpers: allow forcing a certain width/height for texturesreimar2005-09-251-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16595 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow specifying a custom (ppm) texture for texture unit 3reimar2005-09-251-0/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16594 b3059339-0415-0410-9bf9-f77b7e298cf2
* support loading a texture from a PPM filereimar2005-09-252-0/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16593 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_gl2 now supports panscanreimar2005-09-251-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16592 b3059339-0415-0410-9bf9-f77b7e298cf2
* panscan supportreimar2005-09-251-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16591 b3059339-0415-0410-9bf9-f77b7e298cf2
* contrast 0 should lead to a grey, not a black imagereimar2005-09-251-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16590 b3059339-0415-0410-9bf9-f77b7e298cf2
* get rid of global getProcAddress variablereimar2005-09-251-7/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16589 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_gl rectangle and yuv options should work together nowreimar2005-09-251-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16588 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support rectangular texture in fragment programsreimar2005-09-254-19/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16587 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improve/clarify description of -vo gl and -vo gl2 suboptionsreimar2005-09-251-5/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16586 b3059339-0415-0410-9bf9-f77b7e298cf2
* Several bugfixes:reimar2005-09-251-3/+5
| | | | | | | | | black OSD border with scaled-osd draw only used parts of image (looks weird with equalizer controls otherwise) clear borders when switching to fullscreen when using -nodouble git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16585 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix crashes and green border when using YV12 input formatreimar2005-09-251-11/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16584 b3059339-0415-0410-9bf9-f77b7e298cf2
* texture units do not need to be explicitly enabled when using a fragmentreimar2005-09-251-14/+10
| | | | | | | program. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16583 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.1114wight2005-09-251-13/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16582 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1114gpoirier2005-09-251-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16581 b3059339-0415-0410-9bf9-f77b7e298cf2
* German man page review part VIkraymer2005-09-241-7/+12
| | | | | | | | ("OPTIONEN FÜR DIE AUDIOAUSGABE (NUR BEI MPLAYER)") added option: -softvol-max git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16580 b3059339-0415-0410-9bf9-f77b7e298cf2
* German man page review part Vkraymer2005-09-241-58/+62
| | | | | | | ("OSD-/\:UNTERTITEL-OPTIONEN") git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16579 b3059339-0415-0410-9bf9-f77b7e298cf2
* German man page review part IVkraymer2005-09-241-24/+24
| | | | | | | (finishing "DEMUXER-/\:STREAM-OPTIONEN") git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16578 b3059339-0415-0410-9bf9-f77b7e298cf2
* The nth attempt to come up with correct a description of -frameno-file...diego2005-09-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16577 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.183kraymer2005-09-241-4/+8
| | | | | | | small spelling change git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16576 b3059339-0415-0410-9bf9-f77b7e298cf2
* wrap around 80...ods152005-09-241-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16575 b3059339-0415-0410-9bf9-f77b7e298cf2
* compress back_ptr better by multiplying by 8ods152005-09-241-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16574 b3059339-0415-0410-9bf9-f77b7e298cf2
* "LIVE.COM Streaming Media" is now called "LIVE555 Streaming Media".rsf2005-09-239-31/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16573 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo, noticed by Julian Sikorski <lordzanon at poczta dot onet dot pl>rathann2005-09-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16572 b3059339-0415-0410-9bf9-f77b7e298cf2
* More appropriatte sectionods152005-09-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16571 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.14jheryan2005-09-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16570 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.70jheryan2005-09-231-22/+131
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16569 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.92jheryan2005-09-231-8/+183
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16568 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove duplicate entrygpoirier2005-09-231-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16567 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1113gpoirier2005-09-231-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16566 b3059339-0415-0410-9bf9-f77b7e298cf2
* Symlinks are not needed any more.jheryan2005-09-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16565 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.24jheryan2005-09-231-5/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16564 b3059339-0415-0410-9bf9-f77b7e298cf2
* Screenshots can now be taken with -vf screenshot, based on a patch by Oded.diego2005-09-231-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16563 b3059339-0415-0410-9bf9-f77b7e298cf2
* better (hopefully correct) explanation of -frameno-filediego2005-09-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16562 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording fix suggested by the Wandererdiego2005-09-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16561 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixes and additionsdiego2005-09-231-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16560 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nits and fixesgpoirier2005-09-232-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16559 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.58jheryan2005-09-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16558 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.22jheryan2005-09-231-4/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16557 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.93jheryan2005-09-231-285/+219
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16556 b3059339-0415-0410-9bf9-f77b7e298cf2
* last file translated, synced with 1.21jheryan2005-09-231-10/+397
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16555 b3059339-0415-0410-9bf9-f77b7e298cf2
* last file translated, synced with 1.79jheryan2005-09-231-0/+2547
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16554 b3059339-0415-0410-9bf9-f77b7e298cf2
* CONFIG_RISKY is long gone from FFmpeg.diego2005-09-231-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16553 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavformat now requires CONFIG_(DE)MUXERS #defines.diego2005-09-231-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16552 b3059339-0415-0410-9bf9-f77b7e298cf2
* Creating a MPEG-1 file suitable for exchange, taken from the example posted ↵gpoirier2005-09-221-0/+10
| | | | | | by James Courtier-Dutton on mplayer-users git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16551 b3059339-0415-0410-9bf9-f77b7e298cf2
* What means AVC, more consistencygpoirier2005-09-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16550 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.70gabrov2005-09-221-11/+101
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16549 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prints the numbers of start and end tracks and MSF length for eachgpoirier2005-09-224-12/+132
| | | | | | | | | | | track of a VCD when -identify is given. Patch by kiriuja < mplayer TIREH patches AH en TIREH directo POIS net > Original Thread: Date: Sep 11, 2005 3:30 AM Subject: [MPlayer-dev-eng] [PATCH] -identify VCD tracks git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16548 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1112gpoirier2005-09-221-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16547 b3059339-0415-0410-9bf9-f77b7e298cf2
* frameno.avi is an audio file, not a statistics file, wording fix.diego2005-09-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16546 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prints the number of titles, DVD disk ID, the numbers of chapters andgpoirier2005-09-221-0/+57
| | | | | | | | | | | | angles for each title, and the time length of each title if -identify is given when playing a DVD. Patch by kiriuja < mplayer TIREH patches AH en TIREH directo POIS net > Original thread at: Date: Sep 16, 2005 12:24 AM Subject: [MPlayer-dev-eng] [PATCH] -identify DVD titles git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16545 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some very weird people are apperantely scared of reading GPL code. :/ods152005-09-221-1/+1
| | | | | | | | Michael agreed to licence change on this blurb.. is there anyone else who wrote it and objects?.. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16544 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.70paszczi2005-09-211-8/+106
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16543 b3059339-0415-0410-9bf9-f77b7e298cf2
* add some internal links between "codecs supported by mencoder" andgpoirier2005-09-202-9/+28
| | | | | | | | | "codecs featured by lavc". Added an audio encoding example. Moved the "codecs featured by lavc" in 2 shiny new sections (to allow the internal links to work) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16542 b3059339-0415-0410-9bf9-f77b7e298cf2
* bah, it's been there all night, and still noone fixed it...ods152005-09-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16541 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor spelling/wording/grammar fixesdiego2005-09-191-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16540 b3059339-0415-0410-9bf9-f77b7e298cf2
* better wording for -frameno-filediego2005-09-191-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16539 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disassemble comments and pass it to the demux_info interfacealex2005-09-191-17/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16538 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix my email addressalex2005-09-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16537 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document lavc audio codecsgpoirier2005-09-191-1/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16536 b3059339-0415-0410-9bf9-f77b7e298cf2
* Lists main A/V codecs supported by MEncoder, talks about how to select an ↵gpoirier2005-09-191-4/+145
| | | | | | | | | imput file for encoding. Taken from D. Richard Felker III The Great's encoding guide git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16535 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1109gpoirier2005-09-191-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16534 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes formatting issuesgpoirier2005-09-191-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16533 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1108gpoirier2005-09-191-72/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16532 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the description of the newly introduced "-frameno-file" have all its ↵gpoirier2005-09-191-1/+2
| | | | | | sentences start in a newline to make groff and Diego happy :-) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16531 b3059339-0415-0410-9bf9-f77b7e298cf2
* feel free to fix this as you see fit...ods152005-09-191-0/+9
| | | | | | | | | i want to be sure people will not take interest in this option and look it up and try using it. just enough for those already know it and still stubborn enough to use it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16530 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make frameno.avi not turn on by default. this is deprecated and this entireods152005-09-193-9/+15
| | | | | | | feature should be removed anyway. manpage update in a bit... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16529 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.14wight2005-09-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16528 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.22wight2005-09-191-1/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16527 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.72wight2005-09-191-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16526 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prints the number of tracks and MSF length for each track of an audio CD,gpoirier2005-09-192-7/+50
| | | | | | | | | | | | | prints ID_CDDA_TRACK=N output showing the currently played track number when -identify is given. Patch by kiriuja < mplayer TIRET patches CHEZ en TIRET directo POIS net > Doxygen comments by Guillaume POIRIER Original thread: Date: Sep 11, 2005 10:49 PM Subject: Re: [MPlayer-dev-eng] [PATCH] -identify audio CD tracks git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16525 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.1106wight2005-09-191-141/+453
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16524 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prints -identify output for:gpoirier2005-09-192-0/+7
| | | | | | | | | | - video codec of the current file; - signal numbers; - demuxer help header. Patch by kiriuja <mplayer DATH patches AH en DATH directo POIS net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16523 b3059339-0415-0410-9bf9-f77b7e298cf2
* Break up all long lines that were missed during the last reformatting round.diego2005-09-191-4/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16522 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: the directories specified with --with-xvid*dir were ignored.gpoirier2005-09-191-1/+1
| | | | | | | | | | | | | | | Patch by Diego Bug reported here: http://mplayerhq.hu/pipermail/mplayer-users/2005-September/055541.html [MPlayer-users] CVS fails to compile (xvid related) Giacomo Comes comes at naic.edu Wed Sep 14 16:36:33 CEST 2005 Patch available here: Date: Sep 10, 2005 8:45 PM Subject: [MPlayer-dev-eng] [PATCH] XviD profile support git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16521 b3059339-0415-0410-9bf9-f77b7e298cf2
* change obsolete -waveheader to -ao pcm:waveheader in hintinfo messageivo2005-09-1911-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16520 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo noticed by Torinthieldiego2005-09-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16519 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.182jheryan2005-09-191-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16518 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed dependency on glibc's %a in sscanf()nicodvb2005-09-181-22/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16517 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: fully working DXN profile support require XviD 1.1.x. Earlier version ↵gpoirier2005-09-181-0/+4
| | | | | | will work but will lack VBV support git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16516 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/grammar fixesdiego2005-09-181-54/+54
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16515 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reflect recent changes to the the pan audio filter syntax and behavior indiego2005-09-181-42/+37
| | | | | | | the documentation, patch by Reimar Doeffinger with some fixes by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16514 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove very obsolate draft...iive2005-09-181-583/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16513 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove info frame repeating its problematic and controversicalmichael2005-09-171-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16512 b3059339-0415-0410-9bf9-f77b7e298cf2
* add FreeBSD default cd/dvd devicesnexus2005-09-172-9/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16511 b3059339-0415-0410-9bf9-f77b7e298cf2
* The s key is now used for taking screenshots.diego2005-09-171-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16510 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify the descriptions of vo_gl and vo_gl2 including some fixes.diego2005-09-171-34/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16509 b3059339-0415-0410-9bf9-f77b7e298cf2
* add FreeBSD default cd/dvd devicesnexus2005-09-171-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16508 b3059339-0415-0410-9bf9-f77b7e298cf2
* add back_ptrmichael2005-09-171-23/+27
| | | | | | | | | | add info_frames require sync_point after headers require info packets to be between headers and frames (or you could say they are headers now) add userdata stream type git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16507 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix H264 packetizer. Might not work with arbitrary slice order.reimar2005-09-171-1/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16506 b3059339-0415-0410-9bf9-f77b7e298cf2
* add a demux_peekc function that allows to just "have a look" at the nextreimar2005-09-171-0/+3
| | | | | | | byte of data from the demuxer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16505 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo, probably..ods152005-09-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16504 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nitsgpoirier2005-09-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16503 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1102gpoirier2005-09-161-7/+90
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16502 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l bug fix: The CONFIG_LIBAVUTIL variable needs to be passed the valuediego2005-09-161-1/+1
| | | | | | | of the libavutil test, not some random temporary variable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16501 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing break for WM_SYSCOMMAND handling.reimar2005-09-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16500 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.181 and misc fixesdiego2005-09-161-11/+11
| | | | | | | patch by Paul TT < paultt -- at -- hackerjournal -- dot -- it > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16499 b3059339-0415-0410-9bf9-f77b7e298cf2
* print the first 16 bytes of frame data with -v -v, helps detect whenreimar2005-09-161-0/+2
| | | | | | | the demuxer messes up packetizing (-dumpvideo does not help here :-( ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16498 b3059339-0415-0410-9bf9-f77b7e298cf2
* Wrong editlist handling: end pts must be included.reimar2005-09-161-1/+1
| | | | | | | | Fixes another BBC sample (why is it always BBC samples that break MPlayer??): http://images.apple.com/movies/us/hd_gallery/gl1800/720p/bbc-africa_m720p.mov git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16497 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix expanding of $_ld_dl when needed by iconvaurel2005-09-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16496 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention af_pan changereimar2005-09-151-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16495 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix af_pan commandline mess and (hopefully) improve description.reimar2005-09-152-9/+16
| | | | | | | | It should now output the right number of channels and it doesn't silently clamp values to the too restrictive [0, 1] range. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16494 b3059339-0415-0410-9bf9-f77b7e298cf2
* When compiled with gui, bind ESC to gui_stop so that s is free for screenshot.reimar2005-09-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16493 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small wording/spelling fixes, one duplicate entry removed.diego2005-09-151-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16492 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add comments to a few #endif statements in order to make clear whichdiego2005-09-151-21/+21
| | | | | | | #ifdef they belong to. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16491 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency fix: OSD bar for gamma changes should only appear when gammareimar2005-09-141-1/+2
| | | | | | | changing gamma is supported (like all other equalizer controls). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16490 b3059339-0415-0410-9bf9-f77b7e298cf2
* hardware color-space conversion for vo_gl and vo_gl2reimar2005-09-148-8/+900
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16489 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor wording fix in the advanced audio guidewanderer2005-09-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16488 b3059339-0415-0410-9bf9-f77b7e298cf2
* Illustrate by a nice table what each profiles supported by XviD features.gpoirier2005-09-141-0/+273
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16487 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1100gpoirier2005-09-141-4/+55
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16486 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typosgpoirier2005-09-141-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16485 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix MMX accelerated RGB24 OSD, fixes "ugly OSD with -vo gl2".reimar2005-09-131-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16484 b3059339-0415-0410-9bf9-f77b7e298cf2
* reduced verbositynicodvb2005-09-132-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16483 b3059339-0415-0410-9bf9-f77b7e298cf2
* adds Simple, Advanced Simple and DivX profile support for XviD, Patch by ↵gpoirier2005-09-134-18/+246
| | | | | | | | | | | | Robert Swain < robert POUM swain AH gmail POUM com > Nice help from Diego Biurrun, Reimar Döffinger, Guillaume POIRIER Original thread: Date: Sep 10, 2005 8:45 PM Subject: [MPlayer-dev-eng] [PATCH] XviD profile support git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16482 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix -af-adv force description, 1 is default now.reimar2005-09-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16481 b3059339-0415-0410-9bf9-f77b7e298cf2
* The screenshot command is now implemented, wording/spelling fixes.diego2005-09-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16480 b3059339-0415-0410-9bf9-f77b7e298cf2
* screenshot filter entry wording improvementdiego2005-09-131-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16479 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the fourcc output endianness-independent.diego2005-09-131-2/+4
| | | | | | | patch by Luca Barbato < lu_zero -- at -- gentoo -- at -- org > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16478 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid duplicated messages from demux_avi.c and demuxer.c.diego2005-09-131-10/+0
| | | | | | | patch by Luca Barbato < lu_zero -- at -- gentoo -- at -- org > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16477 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow disabling the glFinish callreimar2005-09-131-5/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16476 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improved glFindFormatreimar2005-09-132-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16475 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nits suggested by Diegogpoirier2005-09-132-38/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16474 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove incorrect information about gcc 2.95.x on PPC, mention vo_macosx.diego2005-09-131-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16473 b3059339-0415-0410-9bf9-f77b7e298cf2
* pp_postprocess reads from target image, so request a readable one.reimar2005-09-131-1/+2
| | | | | | | | | Discussed here: Date: Wed, 27 Jul 2005 18:33:42 +0200 Subject: [MPlayer-dev-eng] [PATCH] mp_image flags in filters git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16472 b3059339-0415-0410-9bf9-f77b7e298cf2
* - improved performance on truecolor modesdiego2005-09-131-127/+134
| | | | | | | | - fixed all known bugs, i.e. palette mode works right again patch by Christoph Egger < Christoph_Egger -- at -- gmx -- dot -- de > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16471 b3059339-0415-0410-9bf9-f77b7e298cf2
* cycle through tv channels (patch by Andrew Calkin < calkina at geexbox.org >)aurel2005-09-121-6/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16470 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix maximum frame size, could lead to crashes when changing playback speed.reimar2005-09-121-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16469 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1096gpoirier2005-09-121-2/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16468 b3059339-0415-0410-9bf9-f77b7e298cf2
* start new sentences on a new linegpoirier2005-09-121-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16467 b3059339-0415-0410-9bf9-f77b7e298cf2
* XviD supports "turbo" mode.gpoirier2005-09-122-1/+7
| | | | | | | This is the last undocumented feature of XviD, so remove the TODO entry. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16466 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix multiple issues: No picture at all, broken pictures, only every secondreimar2005-09-121-58/+34
| | | | | | | | | picture displayed, compile warnings because of undefined functions and a compile error on MinGW because of redefinition of open(). Or in short: I didn't find a case where the old version worked?!? git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16465 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds the script psnr-video.sh to calculate the PSNR between two existing ↵gpoirier2005-09-121-0/+1
| | | | | | | | | | | | video files. Script by Matthias Wieser < mwieser AH gmx POUM de > Original thread: Date: Aug 25, 2005 1:54 PM Subject: [MEncoder-users] [Script] PSNR between two video files git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16464 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds the script psnr-video.sh to calculate the PSNR between two existing ↵gpoirier2005-09-122-0/+195
| | | | | | | | | | | | video files. Script by Matthias Wieser < mwieser AH gmx POUM de > Original thread: Date: Aug 25, 2005 1:54 PM Subject: [MEncoder-users] [Script] PSNR between two video files git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16463 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use GL_CLAMP_TO_EDGE instead of GL_CLAMP to avoid border texels being sampled.reimar2005-09-121-2/+4
| | | | | | | | This avoids some ugly effects when vo_gl2 uses multiple textures. (Note to self: read the specs instead of just copying the old code!). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16462 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix border color (forgot to divide by 255.0).reimar2005-09-122-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16461 b3059339-0415-0410-9bf9-f77b7e298cf2
* echores cleanup, introduce _res_comment variable to easily output additionalreimar2005-09-121-134/+92
| | | | | | | information. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16460 b3059339-0415-0410-9bf9-f77b7e298cf2
* Respect -nodouble even though it looks very bad.reimar2005-09-111-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16459 b3059339-0415-0410-9bf9-f77b7e298cf2
* do nothing if no free filenames are availablehenry2005-09-111-4/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16458 b3059339-0415-0410-9bf9-f77b7e298cf2
* use slices if DR isn't availablehenry2005-09-111-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16457 b3059339-0415-0410-9bf9-f77b7e298cf2
* only make the check for osx api if system is darwinnplourde2005-09-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16456 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed dep for perl_check on osxnplourde2005-09-111-43/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16455 b3059339-0415-0410-9bf9-f77b7e298cf2
* better _comment in echoresiive2005-09-111-8/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16454 b3059339-0415-0410-9bf9-f77b7e298cf2
* forgotten MP_IMGFLAG_READABLEhenry2005-09-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16453 b3059339-0415-0410-9bf9-f77b7e298cf2
* Separate _freetype=no from the comment, this fixes the fontconfig bug ↵iive2005-09-111-6/+7
| | | | | | without need of forcing "no" git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16452 b3059339-0415-0410-9bf9-f77b7e298cf2
* DR and slice supporthenry2005-09-111-21/+99
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16451 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1094gpoirier2005-09-111-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16450 b3059339-0415-0410-9bf9-f77b7e298cf2
* screenshot filterhenry2005-09-112-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16449 b3059339-0415-0410-9bf9-f77b7e298cf2
* screenshot filterhenry2005-09-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16448 b3059339-0415-0410-9bf9-f77b7e298cf2
* screenshot filterhenry2005-09-114-1/+246
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16447 b3059339-0415-0410-9bf9-f77b7e298cf2
* key_down_eventnplourde2005-09-101-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16446 b3059339-0415-0410-9bf9-f77b7e298cf2
* perl check for macosxnplourde2005-09-101-3/+43
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16445 b3059339-0415-0410-9bf9-f77b7e298cf2
* use system videodev2.h insteadhenry2005-09-101-862/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16444 b3059339-0415-0410-9bf9-f77b7e298cf2
* - remove useless /dev/video* checkshenry2005-09-102-14/+13
| | | | | | | | - add a proper configure check for v4l2 - prepare for videodev2.h removal git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16443 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure _freetype is either yes or no, otherwise fontconfig might be enabledreimar2005-09-101-0/+3
| | | | | | | even without iconv (and thus freetype) support git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16442 b3059339-0415-0410-9bf9-f77b7e298cf2
* CONFIG_GPL for lavcmichael2005-09-101-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16441 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mac OS X section reviewed for wording/spelling/grammar and content.diego2005-09-101-29/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16440 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore movi_end (except on error) to allow playing growing files.reimar2005-09-091-3/+6
| | | | | | | | Also adds a check if stream_read read the requested length. This and the movi_end check on error help not accidently playing ID3 tags. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16439 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set texture border color to avoid weird border colors in some rare cases.reimar2005-09-091-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16438 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing doxygen comment for clearOSD()reimar2005-09-091-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16437 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix a typo in a commentreimar2005-09-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16436 b3059339-0415-0410-9bf9-f77b7e298cf2
* gl_buffer should be unsignedreimar2005-09-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16435 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add an uninit function.reimar2005-09-091-15/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16434 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1093gpoirier2005-09-091-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16433 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless spacereimar2005-09-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16432 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing .REss in -vo gl descriptionreimar2005-09-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16431 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updates to NUT spec:ods152005-09-091-71/+87
| | | | | | | | | | | | | | | | | | | | | | | | 1. remove average_bitrate 2. add other_stream_header, for subtitles and metadata 3. add max_pts to index 4. index_ptr - a 64 bit integer to say the total length of all index packets 5. specify how to write "multiple" indexes 6. change forward_ptr behavior, starts right after forward_ptr, ends after checksum 7. remove stream_id <-> stream_class limitation. 8. time_base_nom must also be non zero. 9. rename time_base_nom and time_base_denom, now timebase means the length of a tick, not amounts of ticks 10. remove (old?) sample_rate_mul stuff. 11. specify what exactly the checksum covers. 12. specify that stream classes which have multiple streams must have an info packet.. (in new Semantic requirements section) 13. Rename 'timestamp' to pts. 14. Change date of draft... 15. Add myself to authors... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16430 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/grammar/wordingdiego2005-09-091-31/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16429 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1091gpoirier2005-09-091-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16428 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace remaining tabs by spaces.diego2005-09-081-14/+14
| | | | | | | patch by Christoph Egger <Christoph_Egger -- at -- gmx -- dot -- de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16427 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not define NO_FREE, it causes a giant memleak with -loop 0 and a short file.reimar2005-09-071-1/+1
| | | | | | | If this causes problems these should be fixed instead of using this hack. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16426 b3059339-0415-0410-9bf9-f77b7e298cf2
* We can not seek, so set seekable to 0reimar2005-09-061-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16425 b3059339-0415-0410-9bf9-f77b7e298cf2
* When specifying a VIDIX subdevice the name needs to be written outdiego2005-09-061-3/+3
| | | | | | | including the .so. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16424 b3059339-0415-0410-9bf9-f77b7e298cf2
* small wording fixesdiego2005-09-061-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16423 b3059339-0415-0410-9bf9-f77b7e298cf2
* memleak fix, escfilename was not freed for an invalid urlreimar2005-09-061-23/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16422 b3059339-0415-0410-9bf9-f77b7e298cf2
* New section about sync and remuxing issues.gpoirier2005-09-061-1/+38
| | | | | | | Also tell that AVI and MPEG are only natively supported containers while more can be supported through libavformat git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16421 b3059339-0415-0410-9bf9-f77b7e298cf2
* memleak fixes when using an http proxyreimar2005-09-061-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16420 b3059339-0415-0410-9bf9-f77b7e298cf2
* check4proxies always creates a copy, so url should be freedreimar2005-09-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16419 b3059339-0415-0410-9bf9-f77b7e298cf2
* memleak fixes when invalid http url specified.reimar2005-09-062-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16418 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for GeForce FX Go5200 (newer Apple PowerBooks)diego2005-09-062-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16417 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use bitrate from demuxerreimar2005-09-061-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16416 b3059339-0415-0410-9bf9-f77b7e298cf2
* better bitrate calculationreimar2005-09-061-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16415 b3059339-0415-0410-9bf9-f77b7e298cf2
* execute the check function even when a demuxer is forced, to avoid crashes.reimar2005-09-061-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16414 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forgotten mpc demuxerreimar2005-09-061-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16413 b3059339-0415-0410-9bf9-f77b7e298cf2
* Changes forgotten during demuxer API change, introduce a check function.reimar2005-09-061-9/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16412 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore libdha test program.diego2005-09-061-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16411 b3059339-0415-0410-9bf9-f77b7e298cf2
* Switch indentation over to K&R style, replace all tabs by spaces.diego2005-09-061-296/+275
| | | | | | | patch by Christoph Egger <Christoph_Egger -- at -- gmx -- dot -- de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16410 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only older card version seem to make problems with y < 8 in text mode.reimar2005-09-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16409 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid some short forms, some consistency, wording and typo fixes.diego2005-09-061-49/+49
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16408 b3059339-0415-0410-9bf9-f77b7e298cf2
* A few more details and grammar updates.diego2005-09-061-4/+7
| | | | | | | patch by Corey Hickey <bugfood-ml -- at -- fatooh -- dot -- org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16407 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10livo2005-09-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16406 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce unnecessary swscaler verbosity.diego2005-09-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16405 b3059339-0415-0410-9bf9-f77b7e298cf2
* Obsoleted...ods152005-09-061-658/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16404 b3059339-0415-0410-9bf9-f77b7e298cf2
* clear OSD when playing new filereimar2005-09-051-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16403 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistency fixgpoirier2005-09-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16402 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1088gpoirier2005-09-051-25/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16401 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1076 - patch by Paul TT <paultt - at - hackerjournal - dot - ↵danny2005-09-051-20/+72
| | | | | | it> with some improvement ;) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16400 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix up cqm section.diego2005-09-051-23/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16399 b3059339-0415-0410-9bf9-f77b7e298cf2
* Properly initialize osdtexCntreimar2005-09-051-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16398 b3059339-0415-0410-9bf9-f77b7e298cf2
* OSD alpha conversion index out of rangereimar2005-09-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16397 b3059339-0415-0410-9bf9-f77b7e298cf2
* Spelling, fix Terminal and Categories entry, add MimeType.diego2005-09-051-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16396 b3059339-0415-0410-9bf9-f77b7e298cf2
* rewrite the little we-want-matrix-files section, patch by Corey Hickey < ↵wanderer2005-09-051-7/+12
| | | | | | bugfood-ml AT fatooh DOT org > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16395 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable vidix on AMD64, at least for nVidia it seems to work.reimar2005-09-041-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16394 b3059339-0415-0410-9bf9-f77b7e298cf2
* a libmpcdec version with our patches was released (but I did not yet test it).reimar2005-09-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16393 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPlayer advanced audio usage guide by Corey Hickey < bugfood-ml AH fatooh ↵gpoirier2005-09-043-0/+637
| | | | | | | | | | | | POUM org> (please make sure the doc builds fine) Original thread: Date: Sep 4, 2005 1:26 AM Subject: [MPlayer-DOCS] [PATCH] mplayer advanced audio usage guide git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16392 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1087gpoirier2005-09-041-2/+63
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16391 b3059339-0415-0410-9bf9-f77b7e298cf2
* equalizer fixes: changing one attribute reset the others,reimar2005-09-041-16/+24
| | | | | | | brightness control for NV03/NV04 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16390 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support equalizer.reimar2005-09-041-0/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16389 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes suggested by Diegogpoirier2005-09-041-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16388 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reorder slave mode commands to appear in alphabetical order with a fewdiego2005-09-041-149/+151
| | | | | | | exceptions for commands that are very closely related. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16387 b3059339-0415-0410-9bf9-f77b7e298cf2
* mplayer osx shared video buffernplourde2005-09-041-30/+88
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16386 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo, and fixed missing wordgpoirier2005-09-041-8/+8
| | | | | | | too many avc encoding! :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16385 b3059339-0415-0410-9bf9-f77b7e298cf2
* In order to make sure A/V sync is preserved, MEncoder really has to be fed ↵gpoirier2005-09-041-8/+47
| | | | | | | | | with an audio track. Added a paragraph that explains why, and nuked all the occurences of "-nosound". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16384 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1084gpoirier2005-09-041-9/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16383 b3059339-0415-0410-9bf9-f77b7e298cf2
* Suggestions by of The Wanderergpoirier2005-09-031-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16382 b3059339-0415-0410-9bf9-f77b7e298cf2
* equalizer supportreimar2005-09-031-2/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16381 b3059339-0415-0410-9bf9-f77b7e298cf2
* improve colorizationmichael2005-09-031-4/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16380 b3059339-0415-0410-9bf9-f77b7e298cf2
* 64 bit fix: do not cast pointers to uint32_treimar2005-09-031-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16379 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make MTRR setup work on AMD64 and simplify some #ifdefsreimar2005-09-031-13/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16378 b3059339-0415-0410-9bf9-f77b7e298cf2
* vidix support for nVidix FX Go 5700reimar2005-09-032-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16377 b3059339-0415-0410-9bf9-f77b7e298cf2
* Capitalize sentences.gpoirier2005-09-031-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16376 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove many annoying GTK includes in every compile line and remove GTKods152005-09-034-22/+26
| | | | | | | stuff from mp_msg by using a wrapper function. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16375 b3059339-0415-0410-9bf9-f77b7e298cf2
* Lotsa cool stuff new with -pre8gpoirier2005-09-031-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16374 b3059339-0415-0410-9bf9-f77b7e298cf2
* replace sleep with usec_sleep, required for recent mingw versions, patch by ↵faust32005-09-033-3/+3
| | | | | | Robert Swain <robert.swain at gmail.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16373 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial endianess fixesfaust32005-09-031-16/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16372 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplificationfaust32005-09-031-25/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16371 b3059339-0415-0410-9bf9-f77b7e298cf2
* faster mpg and much faster gxf demuxingreimar2005-09-033-33/+71
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16370 b3059339-0415-0410-9bf9-f77b7e298cf2
* likely() and unlikely() macros to help (newer) compilers optimize correctlyreimar2005-09-031-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16369 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix window position adjustmentfaust32005-09-031-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16368 b3059339-0415-0410-9bf9-f77b7e298cf2
* custom quantization matrix for x264, original patch by Robert Swain < robert ↵gpoirier2005-09-023-0/+120
| | | | | | | | | | | | POUM swain AH gmail POUM com> Lots of nits and improvement by the MPlayer team Original thread: Date: Jul 12, 2005 5:04 PM Subject: [MPlayer-dev-eng] [PATCH] CQMs in x264 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16367 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updatesrtognimp2005-09-021-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16366 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hopefully better advices about A/V syncgpoirier2005-09-021-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16365 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, typo in last commitreimar2005-09-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16364 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support D-Cinema audio demuxer and decoder from FFmpeg.reimar2005-09-022-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16363 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention the MEncoder configuration files along with the MPlayer ones.diego2005-09-021-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16362 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace bps by B/s when it means bytes per second to avoid ambiguity sincediego2005-09-0224-58/+58
| | | | | | | | bps can mean any combination of bits/bytes per second/sample. patch by a.guru - at - sympatico - dot - ca git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16361 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l bps != fps, noticed by a.guru - at - sympatico - dot - cadiego2005-09-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16360 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improve -idle description.diego2005-09-021-8/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16359 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.1083gpoirier2005-09-021-17/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16358 b3059339-0415-0410-9bf9-f77b7e298cf2
* GUI MPlayer --> GMPlayerdiego2005-09-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16357 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplication between vo_directfb and vo_dfbmga entries.diego2005-09-021-14/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16356 b3059339-0415-0410-9bf9-f77b7e298cf2
* Wording fixes: Avoid short forms.diego2005-09-021-23/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16355 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1081gpoirier2005-09-021-12/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16354 b3059339-0415-0410-9bf9-f77b7e298cf2
* update -channels to match observed behavior, patch by Corey Hickey < ↵gpoirier2005-09-021-11/+4
| | | | | | | | | | | bugfood-ml AH fatooh POUM org > From Thread: Date: Sep 2, 2005 5:25 AM Subject: Re: [MPlayer-DOCS] [PATCH] update -channels to match observed behavior git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16353 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with with 1.1080gpoirier2005-09-021-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16352 b3059339-0415-0410-9bf9-f77b7e298cf2
* and again.. sorry :/ods152005-09-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16351 b3059339-0415-0410-9bf9-f77b7e298cf2
* spacingods152005-09-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16350 b3059339-0415-0410-9bf9-f77b7e298cf2
* -idle Documentation.ods152005-09-021-0/+10
| | | | | | | Diego, please be your pedantic self and fix whatever is necessary. :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16349 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds -idle, an option to make MPlayer wait for input ('loadfile' orods152005-09-023-3/+59
| | | | | | | | | | 'loadlist') commands when it's done playing all files or there are no files on the command line. When used with -fixed-vo, you get a "frozen" vo window, but it can still accept input commands from there (clicking 'q' from the xv window will cause MPlayer to close..) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16348 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make -identify's 'ID_LENGTH=' print a float and not an integer.. Theods152005-09-0216-20/+20
| | | | | | | | accuracey may be totally fake for some demuxers (mpg), but accurate for others.. (avi) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16347 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow multiple help clauses on the command line, Patch by kiriuja " ↵gpoirier2005-09-025-21/+42
| | | | | | | | | | | | | | | | | mplayer-patches AH en-directo POUM net " This one makes mplayer -vo help -ao help -ac help -vc help -pphelp -af help -vfm help -vf help -afm help -fstype help produce the desired output. From the thread: Date: Jul 16, 2005 8:25 PM Subject: [MPlayer-dev-eng] [PATCH] allow multiple help clauses on the command line git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16346 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-09-022-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16345 b3059339-0415-0410-9bf9-f77b7e298cf2
* description typo fixesdiego2005-09-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16344 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates, typosdiego2005-09-021-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16343 b3059339-0415-0410-9bf9-f77b7e298cf2
* aRts, ESD consistent spellingdiego2005-09-012-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16342 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid short forms.diego2005-09-011-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16341 b3059339-0415-0410-9bf9-f77b7e298cf2
* New section: Notes on Audio/Video synchronization, taken from Rich's ↵gpoirier2005-09-011-0/+42
| | | | | | | | | encoding guide NOTE: someone please make sure the doc is cleanly generated. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16340 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support On2 VP7 via binary decoder by implementing ↵reimar2005-09-012-0/+46
| | | | | | | | | | USER32.RegisterClipboardFormatA, SHLWAPI.PathFindExtensionA and SHLWAPI.PathFindFileNameA. Tested with http://www.on2.com/vp7_samples/potter-40.vp7. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16339 b3059339-0415-0410-9bf9-f77b7e298cf2
* * really keep track on how many samples were decoded last round (fix 10l)attila2005-09-011-4/+7
| | | | | | | | * leave loop if more than 10 faad errors were detected since the last call of decode_audio git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16338 b3059339-0415-0410-9bf9-f77b7e298cf2
* stop trying to decode faad audio, when last decoded length is <0attila2005-09-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16337 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.12jheryan2005-09-011-9/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16336 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1077jheryan2005-09-011-13/+64
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16335 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1077gpoirier2005-09-011-5/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16334 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1076gpoirier2005-09-011-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16333 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add -I../libavutil to the includes to fix building vo_zr[2].diego2005-09-011-0/+6
| | | | | | | patch by Corey Hickey <bugfood-ml - at - fatooh - dot - org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16332 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix longstanding typo - "patentend"wanderer2005-08-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16331 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264 fourccfaust32005-08-311-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16330 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing parts of the force codecs/demuxers documentationreimar2005-08-311-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16329 b3059339-0415-0410-9bf9-f77b7e298cf2
* support Pinnacle VideoXLalex2005-08-311-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16328 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix move playlists (control must be returned to mplayer.c, with the demuxerreimar2005-08-312-1/+5
| | | | | | | returning the real URL as a packet). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16327 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lattila2005-08-311-1/+1
| | | | | | | variables have to be declared before any command. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16326 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1075gpoirier2005-08-311-1/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16325 b3059339-0415-0410-9bf9-f77b7e298cf2
* add key_down_eventto slave mode, used to inject key down event with ↵nplourde2005-08-313-1/+5
| | | | | | mplayer_put_key git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16324 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sparcs do not like wild pointer typecasting (unaligned access).reimar2005-08-301-1/+4
| | | | | | | Fixes bugzilla bug #365. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16323 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow forcing of demuxers and codecs by prepending '+'reimar2005-08-307-29/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16322 b3059339-0415-0410-9bf9-f77b7e298cf2
* extra size checks for samples array to avoid crashes in some rare cases.reimar2005-08-301-0/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16321 b3059339-0415-0410-9bf9-f77b7e298cf2
* multiplying fps by 10000 is no more necessary (when determining mp4v and ↵nicodvb2005-08-301-2/+2
| | | | | | h264 framerate) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16320 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix nsv detection with new demuxer structurertognimp2005-08-301-47/+30
| | | | | | | | | | | | With old method there was an hack to skip detection for streamed nsv, because demuxer did the chek only on first 4 bytes and live nsv streams starts at random place in the file. The detection code was changed to search for nsv signature in the first 64k of the file. The check was changed to "unsafe" and thus moved later because now is more expensive. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16319 b3059339-0415-0410-9bf9-f77b7e298cf2
* How to build MPlayerOSXgpoirier2005-08-301-1/+74
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16318 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.12gabrov2005-08-291-8/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16317 b3059339-0415-0410-9bf9-f77b7e298cf2
* adds 'ID_DEMUXER=avi' to -identify...ods152005-08-271-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16316 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mpeg-pes playbackrtognimp2005-08-262-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16315 b3059339-0415-0410-9bf9-f77b7e298cf2
* ENCA uses -lmhenry2005-08-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16314 b3059339-0415-0410-9bf9-f77b7e298cf2
* X11 can use pthread (fixes --enable-static)henry2005-08-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16313 b3059339-0415-0410-9bf9-f77b7e298cf2
* more thorough aalib test (needed for --enable-static)henry2005-08-261-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16312 b3059339-0415-0410-9bf9-f77b7e298cf2
* support MPEG in GXF container with extension-based detection.reimar2005-08-265-1/+60
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16311 b3059339-0415-0410-9bf9-f77b7e298cf2
* reordered bps calculationhenry2005-08-251-34/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16310 b3059339-0415-0410-9bf9-f77b7e298cf2
* set the nearest number of channels, return(0) upon errorshenry2005-08-251-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16309 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid reading more than maxlen bytes.reimar2005-08-251-2/+2
| | | | | | | | Has the sideeffect that the amount read will be close to maxlen instead of minlen as before. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16308 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, missing returnfaust32005-08-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16307 b3059339-0415-0410-9bf9-f77b7e298cf2
* Wrong scale conversion from VFCTRL_SET_EQUALIZER, priv->saturation shouldreimar2005-08-251-1/+1
| | | | | | | be in [0, 2] range, not [99, 101] range. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16306 b3059339-0415-0410-9bf9-f77b7e298cf2
* ffwmv3 does not work, use "status crashing" so it is not auto-selected.reimar2005-08-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16305 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix texture format variable types. Internal format is GLint, others are GLenumreimar2005-08-254-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16304 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed seeking for AVC-in-Matroska (wrong assumption of what kind of ↵mosu2005-08-241-2/+2
| | | | | | references may be present for a non-I-frame). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16303 b3059339-0415-0410-9bf9-f77b7e298cf2
* Slightly reduce unnecessary verbosity.diego2005-08-242-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16302 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos, cosmeticsdiego2005-08-241-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16301 b3059339-0415-0410-9bf9-f77b7e298cf2
* Documents x264 visualization during encodinggpoirier2005-08-231-0/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16300 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add D-Cinema Audio and Video conversion programsreimar2005-08-234-0/+189
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16299 b3059339-0415-0410-9bf9-f77b7e298cf2
* compile fix, vobsub.c needs identify variable.reimar2005-08-231-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16298 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1. -cache-prefil has not been renamed, it's been removed (-cache-seek-minrathann2005-08-231-2/+2
| | | | | | | | | | is a new option) 2. the default value is 50 not 5 noticed by iive git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16297 b3059339-0415-0410-9bf9-f77b7e298cf2
* More typos. One noticed by Nico. Added an empty line at the end to make ↵gpoirier2005-08-231-7/+8
| | | | | | syncmail happy git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16296 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo :)gpoirier2005-08-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16295 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correction pointed by Nicodanny2005-08-231-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16294 b3059339-0415-0410-9bf9-f77b7e298cf2
* Crash fix for: "[MPlayer-users] Crash of mencoder in demux_ts.c line 2728"gpoirier2005-08-231-0/+3
| | | | | | | | | "The code which crashes looks like its trying to parse the subtitle stream, and failing, I assume because dvbsub_lang is a invalid pointer, or null." Patch by Nico Sabi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16293 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not free demuxer before using demuxer->desc->type (happened when using ↵reimar2005-08-232-7/+2
| | | | | | -audiofile). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16292 b3059339-0415-0410-9bf9-f77b7e298cf2
* ensure that audio-only files are decoded till the end by not onlyreimar2005-08-231-3/+8
| | | | | | | waiting for eof but also checking that the a_in_buffer is empty. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16291 b3059339-0415-0410-9bf9-f77b7e298cf2
* mode fps int vs. float woeshenry2005-08-221-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16290 b3059339-0415-0410-9bf9-f77b7e298cf2
* DestroyWindow must be used when -wid was not given, so for WinID < 0, not >=0reimar2005-08-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16289 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1074gpoirier2005-08-221-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16288 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo, grammardiego2005-08-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16287 b3059339-0415-0410-9bf9-f77b7e298cf2
* The thread "Call for video encoding settings" has to be easily found until ↵gpoirier2005-08-211-0/+1
| | | | | | its infos make it to our docs git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16286 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, video_out.h is now needed for some vo_ variables.reimar2005-08-212-0/+2
| | | | | | | This is ugly, but interface.c already does it like that, so why bother... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16285 b3059339-0415-0410-9bf9-f77b7e298cf2
* How to encode with soft 3:2 pullup, patch by Brendan McCarthygpoirier2005-08-211-8/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16284 b3059339-0415-0410-9bf9-f77b7e298cf2
* -wid support for windows. Not well tested, might still behave a bit weird.reimar2005-08-213-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16283 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.88gabrov2005-08-211-1/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16282 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove extern for variables that are already in headers.reimar2005-08-2110-38/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16281 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.11gabrov2005-08-211-13/+74
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16280 b3059339-0415-0410-9bf9-f77b7e298cf2
* cache-prefill has been renamed to cache-seek-min, example config shouldrathann2005-08-201-1/+1
| | | | | | | reflect this git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16279 b3059339-0415-0410-9bf9-f77b7e298cf2
* Encoding setting examples for x264gpoirier2005-08-201-0/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16278 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove broken shared libpostproc stuffrfelker2005-08-192-17/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16277 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1073gpoirier2005-08-191-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16276 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000000000000000lrfelker2005-08-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16275 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100lrfelker2005-08-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16274 b3059339-0415-0410-9bf9-f77b7e298cf2
* less weird OSD alpha transformation.reimar2005-08-191-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16273 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not set SwapInterval for values < 0.reimar2005-08-192-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16272 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix crash in windowsreimar2005-08-192-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16271 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1072gpoirier2005-08-191-4/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16270 b3059339-0415-0410-9bf9-f77b7e298cf2
* automatic vsync enabling for vo_gl.reimar2005-08-194-2/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16269 b3059339-0415-0410-9bf9-f77b7e298cf2
* Aconvert allows mencoder to (easily) encode from an audio only file (hack).jonas2005-08-182-0/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16268 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix warnings and decoding on CYGWIN (produced only noise before this change)faust32005-08-182-2/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16267 b3059339-0415-0410-9bf9-f77b7e298cf2
* gtk2 is supported, next step is pure gtk without X.reimar2005-08-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16266 b3059339-0415-0410-9bf9-f77b7e298cf2
* gtf.{c,h} is used by vesa onlyalex2005-08-183-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16265 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.72jheryan2005-08-181-7/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16264 b3059339-0415-0410-9bf9-f77b7e298cf2
* new, synced with 1.10jheryan2005-08-181-0/+3660
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16263 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.25jheryan2005-08-181-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16262 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.1071gpoirier2005-08-181-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16261 b3059339-0415-0410-9bf9-f77b7e298cf2
* code reduction and less error prone, use the same tablealex2005-08-181-66/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16260 b3059339-0415-0410-9bf9-f77b7e298cf2
* some entries are donealex2005-08-181-5/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16259 b3059339-0415-0410-9bf9-f77b7e298cf2
* these wishes are donealex2005-08-181-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16258 b3059339-0415-0410-9bf9-f77b7e298cf2
* use libvbe from vesautilsalex2005-08-188-2035/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16257 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.87jheryan2005-08-181-2606/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16256 b3059339-0415-0410-9bf9-f77b7e298cf2
* Further clarify loadfile/loadlist description.diego2005-08-181-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16255 b3059339-0415-0410-9bf9-f77b7e298cf2
* name suboption for jack to set client namereimar2005-08-182-1/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16254 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary subshell invocations.diego2005-08-171-28/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16253 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix MEncoder build with shared libavcodec.diego2005-08-172-0/+5
| | | | | | | patch by Panagiotis Issaris <takis - at - lumumba - dot - uhasselt - dot - be> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16252 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify loadfile/loadlist description.diego2005-08-171-6/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16251 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for latest changes.diego2005-08-171-3/+97
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16250 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1070gpoirier2005-08-171-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16249 b3059339-0415-0410-9bf9-f77b7e298cf2
* "recent" noteworthy featuresgpoirier2005-08-171-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16248 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for GTK 2.x.reimar2005-08-174-2/+66
| | | | | | | Patch by Onur Kucuk (onur . delipenguen net). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16247 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording/spellingdiego2005-08-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16246 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes suggested by Diegogpoirier2005-08-171-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16245 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set block_align in header, seems MatLab can not handle files without.reimar2005-08-171-0/+1
| | | | | | | Patch by Pedro Larroy Tovar (pedro at larroy dot com). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16244 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1068jheryan2005-08-171-93/+324
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16243 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added entry for checktree.shivo2005-08-171-0/+12
| | | | | | | Feel free to modify, enhance, spell-check, etc... :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16242 b3059339-0415-0410-9bf9-f77b7e298cf2
* Script to check (CVS) source-tree for anomalies, like MSDOS line endings etc..ivo2005-08-171-0/+253
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16241 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get events from -wid window.reimar2005-08-162-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16240 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1069gpoirier2005-08-161-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16239 b3059339-0415-0410-9bf9-f77b7e298cf2
* Our buffer usage actually fits better to GL_DYNAMIC_DRAW than GL_STREAM_DRAW.reimar2005-08-162-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16238 b3059339-0415-0410-9bf9-f77b7e298cf2
* OSD textures can be deleted with one function call...reimar2005-08-161-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16237 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make glFinish optionalreimar2005-08-162-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16236 b3059339-0415-0410-9bf9-f77b7e298cf2
* silly printf() is the onyl reason avi-fix was so slow, a printf forods152005-08-161-7/+14
| | | | | | | EVERY byte is pretty hefty... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16235 b3059339-0415-0410-9bf9-f77b7e298cf2
* use GenBuffers to get a buffer number instead of hardcoding 1.reimar2005-08-163-3/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16234 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1063 - patch by Paul TT <paultt - at - hackerjournal - dot - it>danny2005-08-161-20/+66
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16233 b3059339-0415-0410-9bf9-f77b7e298cf2
* added libavutil, removed linuxalex2005-08-161-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16232 b3059339-0415-0410-9bf9-f77b7e298cf2
* prefer FIXED_POINT for ARM - patch by AGAWA Koji <i at atty.sakura.ne.jp>alex2005-08-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16231 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar/phrasing fixes on the recent NTSC and telecine commitwanderer2005-08-151-8/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16230 b3059339-0415-0410-9bf9-f77b7e298cf2
* -fafmttag can be needed while steam copying.gpoirier2005-08-151-0/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16229 b3059339-0415-0410-9bf9-f77b7e298cf2
* loadfile/loadlist can now also add files to the playlistreimar2005-08-153-4/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16228 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, initializers don't work without a declaration :-(reimar2005-08-141-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16227 b3059339-0415-0410-9bf9-f77b7e298cf2
* NTSC sources are hard to encode. How to identify telecine content reliably.gpoirier2005-08-141-3/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16226 b3059339-0415-0410-9bf9-f77b7e298cf2
* use glUploadTex helper functionreimar2005-08-141-12/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16225 b3059339-0415-0410-9bf9-f77b7e298cf2
* extra check for glUploadTex to avoid a possible hang.reimar2005-08-141-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16224 b3059339-0415-0410-9bf9-f77b7e298cf2
* textures smaller 64x64 might not be supportedreimar2005-08-141-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16223 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove/move some unused headers/variables/codereimar2005-08-143-23/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16222 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, texture_width/height initialization was removed, so usereimar2005-08-141-2/+2
| | | | | | | image_width/height here git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16221 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor punctuation fixwanderer2005-08-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16220 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar/phrasing fix, still less than idealwanderer2005-08-141-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16219 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes short form, better wordinggpoirier2005-08-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16218 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes bf_threshold description.gpoirier2005-08-142-12/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16217 b3059339-0415-0410-9bf9-f77b7e298cf2
* typogpoirier2005-08-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16216 b3059339-0415-0410-9bf9-f77b7e298cf2
* Helper function for drawing texture and general cleanup of vo_gl2.creimar2005-08-144-168/+66
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16215 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cleanup, move declarations to beginning of block.reimar2005-08-141-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16214 b3059339-0415-0410-9bf9-f77b7e298cf2
* libaf/config.mak is generated, so mention itwight2005-08-141-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16213 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l: fix avi demuxing for ni and nini cases, allow forcing ni and ninirtognimp2005-08-131-0/+39
| | | | | | | demuxers git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16212 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert -std=gnu99 usage, -D_GNU_SOURCE is enough for lrintf supporthenry2005-08-131-16/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16211 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.7gabrov2005-08-121-28/+51
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16210 b3059339-0415-0410-9bf9-f77b7e298cf2
* Formatting fixgpoirier2005-08-122-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16209 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consitency fixgpoirier2005-08-122-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16208 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1062gpoirier2005-08-121-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16207 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL updategpoirier2005-08-121-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16206 b3059339-0415-0410-9bf9-f77b7e298cf2
* lavc also supports H.261, and Snow is FFmpeg-only. Patch by Compngpoirier2005-08-121-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16205 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing codecs that libavcodec supports.gpoirier2005-08-121-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16204 b3059339-0415-0410-9bf9-f77b7e298cf2
* Why multipass is better in a nutshell. Taken from Rich's encoding guide.gpoirier2005-08-121-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16203 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavutil should be be in "PARTS" so that 'make distclean' cleans that ↵gpoirier2005-08-111-0/+1
| | | | | | | | | directory too. A cup of coffee to beastd for forgetting it :) Patch idea by Steven Schultz git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16202 b3059339-0415-0410-9bf9-f77b7e298cf2
* video fourcc fixmichael2005-08-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16201 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux_avi_control() missing in avi's demuxer struct.ods152005-08-111-2/+2
| | | | | | | patch by Uoti Urpala (urpala BANG cc MEEP helsinki MEEP fi) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16200 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix brokeness caused by demuxer patch, this code is useless forods152005-08-111-1/+0
| | | | | | | | any case other than avi and should not be run even then. patch by Uoti Urpala (urpala BANG cc MEEP helsinki MEEP fi) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16199 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo, must be ld_dl instead of ld_ldreimar2005-08-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16198 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, patch found in geexboxalex2005-08-111-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16197 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed in-filter int to float conversion. af_ladspa now demands floats asivo2005-08-101-13/+9
| | | | | | | | that's what LADSPA filters use internally too. conversion from int, if needed, is done by af_format as it's supposed to. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16196 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove stray MSDOS linebreaksivo2005-08-102-6/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16195 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.178jheryan2005-08-101-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16194 b3059339-0415-0410-9bf9-f77b7e298cf2
* reconcile with earlier fps fix in mpeg header parserrfelker2005-08-101-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16193 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync liba52_amd64_changes.diff with latest fixaurel2005-08-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16192 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1061gpoirier2005-08-091-14/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16191 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes segfault on IA-32 machines caused by the ASM patch for AMD-64 for a52.gpoirier2005-08-091-1/+1
| | | | | | | Patch by Aurelien Jacobs < aurel AH gnuage POUM org > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16190 b3059339-0415-0410-9bf9-f77b7e298cf2
* Various fixes, addition and removal of entries related to functions that ↵gpoirier2005-08-081-4/+8
| | | | | | come from the FFmpeg project git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16189 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing libavcodec supported codecs and adds (hopefully) all libavformat ↵gpoirier2005-08-081-1/+38
| | | | | | | | | muxers Please check if this is correct git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16188 b3059339-0415-0410-9bf9-f77b7e298cf2
* take into account that VIDIOC_S_FMT might return updated parametersfaust32005-08-061-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16187 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not crash when /dev/video0 is not presentfaust32005-08-061-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16186 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l to whoever wrote this crap using 1/10000 units. it caused framerates to ↵rfelker2005-08-063-23/+23
| | | | | | get trashed from 30000/1001 to 2997/100, etc.! git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16185 b3059339-0415-0410-9bf9-f77b7e298cf2
* tremor uses integer typesrathann2005-08-061-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16184 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing includerathann2005-08-061-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16183 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forgot to actually enable vo_gl on Windows...reimar2005-08-062-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16182 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove stray DOS linebreaks.diego2005-08-060-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16181 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove stray DOS linebreaks.diego2005-08-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16180 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid short forms and libavcodec should not the that much singled outgpoirier2005-08-051-19/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16179 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.72gabrov2005-08-051-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16178 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.87gabrov2005-08-051-13/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16177 b3059339-0415-0410-9bf9-f77b7e298cf2
* Demuxer modularizationrtognimp2005-08-0542-1328/+1424
| | | | | | | Demuxer selection by name with -demuxer command (bakward compatible) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16176 b3059339-0415-0410-9bf9-f77b7e298cf2
* add the liba52 amd64 changes in a separate diff fileaurel2005-08-051-0/+2189
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16175 b3059339-0415-0410-9bf9-f77b7e298cf2
* liba52 asm optimizations ported to amd64aurel2005-08-055-608/+624
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16174 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missed one uint32_t declaration.ivo2005-08-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16173 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the return types of all (six) libvo API functions. Used to be uint32_t, butivo2005-08-0546-261/+261
| | | | | | | | return values can be negative (VO_ERROR, VO_NOTAVAIL and VO_NOTIMPL), so it's changed to int now. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16172 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavutidiego2005-08-011-10/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16171 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavutil is now part of MPlayer.diego2005-08-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16170 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavutil compile fix (working also with old libavcodec)reimar2005-08-012-3/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16169 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l to beastd due to new libavutil introductiongpoirier2005-08-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16168 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavutil is now needed, too.reimar2005-08-011-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16167 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support new static libavcodec (depends on libavutil).al2005-08-016-8/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16166 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support more MythTV nuv files, based on Gentoo portage patchreimar2005-08-012-10/+170
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16165 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support more MythTV nuv filesreimar2005-08-012-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16164 b3059339-0415-0410-9bf9-f77b7e298cf2
* set i_bps in demux_audio for WAV and MP3 to avoid division by zero beforereimar2005-08-014-15/+39
| | | | | | | decoder sets it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16163 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync to 1.055 - last commit contains also update ;-(danny2005-08-011-9/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16162 b3059339-0415-0410-9bf9-f77b7e298cf2
* Man page cleanup and corrections - patch by Paul TT <paultt - at - ↵danny2005-08-011-1287/+1377
| | | | | | hackerjournal - dot - it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16161 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1032 - patch by Paul TT <paultt - at - hackerjournal - dot - it>danny2005-08-011-3/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16160 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1058gpoirier2005-08-011-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16159 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix outdated "Encoding to MPEG format" (MEncoder improved a lot :-) )gpoirier2005-07-311-11/+6
| | | | | | | Patch by Jeff Clagg git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16158 b3059339-0415-0410-9bf9-f77b7e298cf2
* Needs the previous mpi (pmpi), so request a readable one and requestreimar2005-07-311-1/+2
| | | | | | | the following filters not to modify it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16157 b3059339-0415-0410-9bf9-f77b7e298cf2
* vBlur reads from dmpi, so request a readable onereimar2005-07-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16156 b3059339-0415-0410-9bf9-f77b7e298cf2
* when threshold != 0 the dest image must be readablereimar2005-07-311-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16155 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar and possible clarity fix on -cache-seek-minwanderer2005-07-311-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16154 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove unused cache-prefill and create cache-seek-min that controls when ↵iive2005-07-317-16/+19
| | | | | | seek_long is prefered over waiting for cache to fill git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16153 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor grammatical fixeswanderer2005-07-301-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16152 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix detection of iconv implementations which require libdlaurel2005-07-301-51/+54
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16151 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, incorrect usage of le2me_*reimar2005-07-292-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16150 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.67gabrov2005-07-291-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16149 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.22gabrov2005-07-291-1/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16148 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.178 and fixed typosgabrov2005-07-291-13/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16147 b3059339-0415-0410-9bf9-f77b7e298cf2
* exit kiosk mode and show mouse cursor in uninitnplourde2005-07-281-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16146 b3059339-0415-0410-9bf9-f77b7e298cf2
* properly release windownplourde2005-07-281-2/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16145 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync wirh 1.1055gpoirier2005-07-281-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16144 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed ugly cellphone jargon shortnicodvb2005-07-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16143 b3059339-0415-0410-9bf9-f77b7e298cf2
* Little fixeswight2005-07-281-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16142 b3059339-0415-0410-9bf9-f77b7e298cf2
* reset estimation also on too negative diffreimar2005-07-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16141 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync w/ 1.178 + misc fixes by Paul TT <paultt - at - hackerjournal - dot - it>diego2005-07-281-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16140 b3059339-0415-0410-9bf9-f77b7e298cf2
* If scaleh == 1 our destination image must be readablereimar2005-07-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16139 b3059339-0415-0410-9bf9-f77b7e298cf2
* we do not read from dmpi, so it doesn't have to be readablereimar2005-07-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16138 b3059339-0415-0410-9bf9-f77b7e298cf2
* deghost_plane also reads from destination, so request readable bufferreimar2005-07-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16137 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hopefully finally fix the last commitreimar2005-07-281-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16136 b3059339-0415-0410-9bf9-f77b7e298cf2
* lavf demuxer with raw PCM fix (and a related hang)reimar2005-07-282-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16135 b3059339-0415-0410-9bf9-f77b7e298cf2
* unusedalex2005-07-281-57/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16134 b3059339-0415-0410-9bf9-f77b7e298cf2
* require some up to date codecs.confalex2005-07-282-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16133 b3059339-0415-0410-9bf9-f77b7e298cf2
* some preliminary entries about nut and matroskaalex2005-07-281-0/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16132 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1054gpoirier2005-07-281-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16131 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1053gpoirier2005-07-281-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16130 b3059339-0415-0410-9bf9-f77b7e298cf2
* File list like in termoralex2005-07-281-0/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16129 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo and consistency fix by Paul TT <paultt - at - hackerjournal - dot - it>diego2005-07-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16128 b3059339-0415-0410-9bf9-f77b7e298cf2
* no sense anymorealex2005-07-281-43/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16127 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix crash with large imagesreimar2005-07-281-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16126 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sometimes you have to manually add scale at the end of the filter chain :-(reimar2005-07-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16125 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording/spelling/consistencydiego2005-07-281-6/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16124 b3059339-0415-0410-9bf9-f77b7e298cf2
* gmplayer + arts == bad!reimar2005-07-282-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16123 b3059339-0415-0410-9bf9-f77b7e298cf2
* Amiga port from www.amigasoft.netdiego2005-07-281-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16122 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention the MPlayer-translations mailing list and explain the differencediego2005-07-281-4/+7
| | | | | | | | to MPlayer-DOCS. based on a patch by Paul TT < paultt- at - hackerjournal - dot - it > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16121 b3059339-0415-0410-9bf9-f77b7e298cf2
* msrle in Quicktime FOURCCreimar2005-07-281-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16120 b3059339-0415-0410-9bf9-f77b7e298cf2
* OpenGL needs _ld_dl to get extension functionsreimar2005-07-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16119 b3059339-0415-0410-9bf9-f77b7e298cf2
* More helper functions/defines and bugfixesreimar2005-07-273-65/+153
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16118 b3059339-0415-0410-9bf9-f77b7e298cf2
* Italian help file charsetdiego2005-07-271-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16117 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing license headeralex2005-07-271-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16116 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove unneeded vgagliive2005-07-261-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16115 b3059339-0415-0410-9bf9-f77b7e298cf2
* catch failed buffer allocationreimar2005-07-261-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16114 b3059339-0415-0410-9bf9-f77b7e298cf2
* strncasecmp is not necessary and e.g. strncasecmp(prot, "mms", 3) willreimar2005-07-261-4/+4
| | | | | | | | also match e.g. mmshttp! Thanks to Ian Remmler for noticing. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16113 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use dlsym to get glXGetProcAddress, only way to (hopefully) make itreimar2005-07-261-6/+27
| | | | | | | compile everywhere since the gl/glx headers are such a mess... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16112 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1052: pp7 video filter descriptiongpoirier2005-07-261-0/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16111 b3059339-0415-0410-9bf9-f77b7e298cf2
* OpenGL fixes for windows and vo_gl.c ported to windows.reimar2005-07-265-4/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16110 b3059339-0415-0410-9bf9-f77b7e298cf2
* pp7 video filter descriptiondiego2005-07-261-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16109 b3059339-0415-0410-9bf9-f77b7e298cf2
* restrict to YV12 since the default limit does not work well for anything else.reimar2005-07-261-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16108 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1051gpoirier2005-07-261-6/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16107 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_jack (no)estimate and vo_gl rectangle default value documentedreimar2005-07-261-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16106 b3059339-0415-0410-9bf9-f77b7e298cf2
* improved audio delay estimation, supposed to help make the video smootherreimar2005-07-261-16/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16105 b3059339-0415-0410-9bf9-f77b7e298cf2
* Formatting and wording fixes.diego2005-07-261-11/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16104 b3059339-0415-0410-9bf9-f77b7e298cf2
* rectangular texture and -dr support for vo_glreimar2005-07-261-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16103 b3059339-0415-0410-9bf9-f77b7e298cf2
* build fixdiego2005-07-261-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16102 b3059339-0415-0410-9bf9-f77b7e298cf2
* -dr support for -vo glreimar2005-07-261-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16101 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for rectangular and streaming textures.reimar2005-07-263-30/+213
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16100 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make it possible to use libavcodecs png decoder.reimar2005-07-261-6/+15
| | | | | | | Disable BGR output for binary wmv decoders, since these are slooow. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16099 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1048gpoirier2005-07-261-28/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16098 b3059339-0415-0410-9bf9-f77b7e298cf2
* Less confusing description of -vwanderer2005-07-261-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16097 b3059339-0415-0410-9bf9-f77b7e298cf2
* formatting fixes galorediego2005-07-261-26/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16096 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.176diego2005-07-261-7/+63
| | | | | | | patch by Paul TT < paultt - at - hackerjournal - dot it > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16095 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use a more stable URL.diego2005-07-262-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16094 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use DRAW_IMAGE instead of draw_framereimar2005-07-251-22/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16093 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.25gabrov2005-07-251-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16092 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.86gabrov2005-07-251-3582/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16091 b3059339-0415-0410-9bf9-f77b7e298cf2
* new file, synced with 1.4gabrov2005-07-251-0/+3709
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16090 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing \nreimar2005-07-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16089 b3059339-0415-0410-9bf9-f77b7e298cf2
* General note about filtering from Rich's encoding guidegpoirier2005-07-241-0/+43
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16088 b3059339-0415-0410-9bf9-f77b7e298cf2
* Moves the "audio" section just before the "muxing" section. + fixes ↵gpoirier2005-07-241-74/+76
| | | | | | suggested by Jeff git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16087 b3059339-0415-0410-9bf9-f77b7e298cf2
* New item: "Choosing resolution and bitrate", from Rich's encoding guidegpoirier2005-07-241-0/+71
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16086 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo: s/-lavdopts/lavdoptskraymer2005-07-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16085 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixes and sync with 1.175kraymer2005-07-241-8/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16084 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1046gpoirier2005-07-241-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16083 b3059339-0415-0410-9bf9-f77b7e298cf2
* restore window shadow when quitting fullscreen modenplourde2005-07-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16082 b3059339-0415-0410-9bf9-f77b7e298cf2
* re-organize MEncoder doc in a more sensible way: splitting "basic mencoder ↵gpoirier2005-07-243-3643/+3652
| | | | | | | | | usage" and "encoding with mencoder". note: if you can't generate the doc on your machine, make sure you run "make distclean" beforehand git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16081 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove untranslatable stringswight2005-07-242-10/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16080 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some ICY servers (e.g. http://broadcast.spnet.net:8000/darikhigh) do not setreimar2005-07-241-1/+1
| | | | | | | the protocol correctly, so look for icy-metaint in the response instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16079 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove non-translatable messageswight2005-07-248-35/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16078 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.71gabrov2005-07-231-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16077 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove -hardframedrop reference and advice -lavdopts instead.reimar2005-07-231-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16076 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow the ffmpeg people to use this code if they want.reimar2005-07-232-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16075 b3059339-0415-0410-9bf9-f77b7e298cf2
* -af-adv force also supports 4-7, this part was missed in the updatereimar2005-07-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16074 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid hang with -af-adv force=3reimar2005-07-231-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16073 b3059339-0415-0410-9bf9-f77b7e298cf2
* use calloc so that mp_cmd_free won't use uninitialized data in case of an errorreimar2005-07-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16072 b3059339-0415-0410-9bf9-f77b7e298cf2
* Multiple unsv/scast bug fixes.reimar2005-07-231-8/+14
| | | | | | | | | * use recv instead of read for MinGW compatibility * detect EOF more reliably * use ultravox only for unsv:// instead of trying autodetection git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16071 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.71wight2005-07-231-41/+157
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16070 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make screen output look betterwight2005-07-231-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16069 b3059339-0415-0410-9bf9-f77b7e298cf2
* the the auto* tools should be inside an <application></application> taggpoirier2005-07-231-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16068 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1045gpoirier2005-07-231-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16067 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l to me. Broke compilation when EDL is disabled.ods152005-07-231-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16066 b3059339-0415-0410-9bf9-f77b7e298cf2
* -nocolorkey now supported by directxwanderer2005-07-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16065 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.85gabrov2005-07-221-8/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16064 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.92gabrov2005-07-221-236/+217
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16063 b3059339-0415-0410-9bf9-f77b7e298cf2
* add some closedir() to fix some opendir() leaksaurel2005-07-222-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16062 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix invalid pointers passed to init_audio_filtersreimar2005-07-221-3/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16061 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.15wight2005-07-221-11/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16060 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.17wight2005-07-221-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16059 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync tag bump to 1.58wight2005-07-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16058 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.66wight2005-07-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16057 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.27wight2005-07-221-1/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16056 b3059339-0415-0410-9bf9-f77b7e298cf2
* Quote and extra \n fixeswight2005-07-221-17/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16055 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.13wight2005-07-221-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16054 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.81wight2005-07-221-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16053 b3059339-0415-0410-9bf9-f77b7e298cf2
* - sync 1.173wight2005-07-221-5/+12
| | | | | | | - deleted non-translatable entries git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16052 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync 1.1044wight2005-07-221-17/+107
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16051 b3059339-0415-0410-9bf9-f77b7e298cf2
* define SIGHUP and SIGPIPE for MinGW and catch SIGPIPE also in mplayerreimar2005-07-222-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16050 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1044gpoirier2005-07-221-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16049 b3059339-0415-0410-9bf9-f77b7e298cf2
* guard against double uninit (reportedly can happen on STRG+C)reimar2005-07-221-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16048 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.58 (increased sync tag after typo fix in English revision)gabrov2005-07-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16047 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixes.ods152005-07-221-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16046 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1043gpoirier2005-07-221-2/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16045 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Paul TT < paultt - at - hackerjournal - dot - it >diego2005-07-221-108/+556
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16044 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording/spelling/grammar/consistency, small updatesdiego2005-07-221-15/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16043 b3059339-0415-0410-9bf9-f77b7e298cf2
* some new stuff worth mentioning.ods152005-07-222-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16042 b3059339-0415-0410-9bf9-f77b7e298cf2
* aspect and round params for vf_dsize.ods152005-07-222-4/+96
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16041 b3059339-0415-0410-9bf9-f77b7e298cf2
* Power5 supportreimar2005-07-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16040 b3059339-0415-0410-9bf9-f77b7e298cf2
* ultravox (unsv://) streaming supportgpoirier2005-07-212-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16039 b3059339-0415-0410-9bf9-f77b7e298cf2
* Too little memory alloced.reimar2005-07-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16038 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix few memleaks on exit.iive2005-07-211-1/+7
| | | | | | | 2 lines inspired by Timothy Lee <timothy.lee <at> siriushk.com> patch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16037 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.1041gpoirier2005-07-211-3/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16036 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l wrong quotingdiego2005-07-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16035 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording/spelling fixediego2005-07-201-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16034 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forgotten doxygen commentsreimar2005-07-201-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16033 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ultravox improvements according to specs (didn't know they existed *g*)reimar2005-07-201-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16032 b3059339-0415-0410-9bf9-f77b7e298cf2
* skiploopfilter IMHO is worth an entry here.reimar2005-07-201-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16031 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document the skip* lavd options.reimar2005-07-201-0/+32
| | | | | | | Thanks to Guillaume for helping me out with the formatting :-). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16030 b3059339-0415-0410-9bf9-f77b7e298cf2
* path updatesdiego2005-07-201-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16029 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, wrong URLdiego2005-07-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16028 b3059339-0415-0410-9bf9-f77b7e298cf2
* path updatediego2005-07-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16027 b3059339-0415-0410-9bf9-f77b7e298cf2
* path updatediego2005-07-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16026 b3059339-0415-0410-9bf9-f77b7e298cf2
* path updatediego2005-07-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16025 b3059339-0415-0410-9bf9-f77b7e298cf2
* path updatediego2005-07-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16024 b3059339-0415-0410-9bf9-f77b7e298cf2
* wrong pathdiego2005-07-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16023 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't point at the German docs, they're far too outdated.diego2005-07-201-8/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16022 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes suggested by Diego and The Wanderergpoirier2005-07-201-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16021 b3059339-0415-0410-9bf9-f77b7e298cf2
* When using --enable-* options you are on your own.reimar2005-07-201-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16020 b3059339-0415-0410-9bf9-f77b7e298cf2
* use stored dimensions instead of visible one when (vf_)get_image is callediive2005-07-204-8/+8
| | | | | | | let's see where does the cola goes :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16019 b3059339-0415-0410-9bf9-f77b7e298cf2
* lacv supports cgop, you can use '.' to watch a video frame-by frame togpoirier2005-07-191-6/+9
| | | | | | | | identify which type it is, and not short forms in the docs. ... now the question is, how many commits to fix this one ? :-) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16018 b3059339-0415-0410-9bf9-f77b7e298cf2
* add (no)visualize optionsiive2005-07-191-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16017 b3059339-0415-0410-9bf9-f77b7e298cf2
* libx264 compiled with visualization requirs xlibiive2005-07-191-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16016 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove delay when setting audio volumenplourde2005-07-191-11/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16015 b3059339-0415-0410-9bf9-f77b7e298cf2
* SHOUTcast and ultravox supportreimar2005-07-193-2/+150
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16014 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable manyfmts by default for vo_glreimar2005-07-192-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16013 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.173jheryan2005-07-191-3/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16012 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.87jheryan2005-07-191-482/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16011 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.69jheryan2005-07-191-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16010 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.15jheryan2005-07-191-12/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16009 b3059339-0415-0410-9bf9-f77b7e298cf2
* FAQ No 1: Fullscreen is not working, black borders around unscaled image.diego2005-07-191-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16008 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplified markup, cosmeticsdiego2005-07-191-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16007 b3059339-0415-0410-9bf9-f77b7e298cf2
* Moved some entries from playback problems to video/audio driver sectiondiego2005-07-191-127/+111
| | | | | | | where they belong. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16006 b3059339-0415-0410-9bf9-f77b7e298cf2
* Big cleanup all over the place; wording/grammar/typo fixes as usual, manydiego2005-07-191-106/+91
| | | | | | | | entries rephrased for better clarity and shortness, a bit of old cruft removed, better semantic markup, consistency... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16005 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-07-192-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16004 b3059339-0415-0410-9bf9-f77b7e298cf2
* catch HUP and PIPE signals aswell. Patch by Sergey Khlutchin (@gmail.com)alex2005-07-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16003 b3059339-0415-0410-9bf9-f77b7e298cf2
* LIBAVFORMAT_BUILD >= 4629michael2005-07-181-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16002 b3059339-0415-0410-9bf9-f77b7e298cf2
* LIBAVFORMAT_BUILD >= 4629michael2005-07-171-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16001 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.88gabrov2005-07-171-58/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@16000 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1038gpoirier2005-07-171-5/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15999 b3059339-0415-0410-9bf9-f77b7e298cf2
* -delay for MEncoder, final step 6.ods152005-07-174-8/+48
| | | | | | | | TODO: make it encode silence instead of cutting video as cutting video is unreliable with -ovc copy. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15998 b3059339-0415-0410-9bf9-f77b7e298cf2
* -delay for MEncoder, step 5.ods152005-07-171-22/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15997 b3059339-0415-0410-9bf9-f77b7e298cf2
* -delay for MEncoder, step 4.ods152005-07-171-23/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15996 b3059339-0415-0410-9bf9-f77b7e298cf2
* -delay for MEncoder, step 3.ods152005-07-171-2/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15995 b3059339-0415-0410-9bf9-f77b7e298cf2
* -delay for MEncoder, step 2.ods152005-07-171-28/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15994 b3059339-0415-0410-9bf9-f77b7e298cf2
* -delay for MEncoder, step 1.ods152005-07-172-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15993 b3059339-0415-0410-9bf9-f77b7e298cf2
* support 10000/1001 frameratereimar2005-07-171-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15992 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1037gpoirier2005-07-171-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15991 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: scene change detecion is deactivated with sc_threshold=1000000000ranma2005-07-173-11/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15990 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l for meranma2005-07-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15989 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix a crash at v4l2 uninitaurel2005-07-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15988 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for skip optionsreimar2005-07-171-0/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15987 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo (aligment -> alignment)ranma2005-07-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15986 b3059339-0415-0410-9bf9-f77b7e298cf2
* cgop does work as long as scene change detection is disabledranma2005-07-161-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15985 b3059339-0415-0410-9bf9-f77b7e298cf2
* cgop does work as long as scene change detection is disabledgpoirier2005-07-162-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15984 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1034gpoirier2005-07-161-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15983 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove rencently added FAQ entry because we now have a much better and ↵gpoirier2005-07-161-59/+3
| | | | | | detailed doc elsewhere. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15982 b3059339-0415-0410-9bf9-f77b7e298cf2
* proper disabling/enabling of console output for vo_vesaaurel2005-07-161-21/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15981 b3059339-0415-0410-9bf9-f77b7e298cf2
* Wording fix by The Wanderergpoirier2005-07-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15980 b3059339-0415-0410-9bf9-f77b7e298cf2
* memcpy and memmove both copy memory, but when using memcpy the source and ↵gpoirier2005-07-151-1/+1
| | | | | | | | | destination must not overlap, but here, they did overlap. Committed with the kind blessing of Richard, patch by uau git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15979 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some fixes suggested by Loren; The Wanderer and Diegogpoirier2005-07-151-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15978 b3059339-0415-0410-9bf9-f77b7e298cf2
* (hopefully) fixing remaining float endianness problemsreimar2005-07-133-6/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15977 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1026danny2005-07-131-130/+512
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15976 b3059339-0415-0410-9bf9-f77b7e298cf2
* wrong command namesdiego2005-07-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15975 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.1032wight2005-07-121-4/+46
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15974 b3059339-0415-0410-9bf9-f77b7e298cf2
* Re-enables the GCC-4 fix for AMD-64 only. Patch by cartman and poirierggpoirier2005-07-121-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15973 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forgotten part of the libmusepack->mpcdec renamingreimar2005-07-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15972 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.82gabrov2005-07-111-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15971 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes, more accurate description of hq_ac, and mention it's always on by defaultgpoirier2005-07-113-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15970 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1031gpoirier2005-07-111-1/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15969 b3059339-0415-0410-9bf9-f77b7e298cf2
* English and consistency fixesgpoirier2005-07-111-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15968 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1/2 l: last patch lacked the option name, so it wasn't activeablegpoirier2005-07-111-0/+1
| | | | | | | ^^^ wasn't breaking CVS ;-) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15967 b3059339-0415-0410-9bf9-f77b7e298cf2
* ensure that dr buffers are readablemichael2005-07-113-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15966 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264 fast first pass, patch by Robert Swain < robert POUM swain AH gmail ↵gpoirier2005-07-113-20/+66
| | | | | | POUM com > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15965 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.81gabrov2005-07-111-2/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15964 b3059339-0415-0410-9bf9-f77b7e298cf2
* #ifdef HAVE_MMXmichael2005-07-111-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15963 b3059339-0415-0410-9bf9-f77b7e298cf2
* One more XviD option documented: hq_ac + a fix + more infos on chroma_megpoirier2005-07-101-2/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15962 b3059339-0415-0410-9bf9-f77b7e298cf2
* The right name is Musepack, not MPC/MpegPlus.reimar2005-07-102-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15961 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for gcc 4 and strict-aliasing. Patch by Uoti A Urpala ( urpala () cc ! ↵mosu2005-07-101-13/+9
| | | | | | helsinki ! fi ). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15960 b3059339-0415-0410-9bf9-f77b7e298cf2
* musepack demuxing and decoding support (demuxing is v7 bitstream only).reimar2005-07-1012-1/+404
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15959 b3059339-0415-0410-9bf9-f77b7e298cf2
* SVCD supports VBR audio and VCD CBR only. Reflects the newest patches of Nicogpoirier2005-07-101-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15958 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print CFLAGS warning last so nobody can miss it.reimar2005-07-101-10/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15957 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1029gpoirier2005-07-101-1/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15956 b3059339-0415-0410-9bf9-f77b7e298cf2
* small warning fix:rathann2005-07-102-2/+2
| | | | | | | function doesn't return anything and the return value is never checked or used git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15955 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l to Nico for this copy&paste bugrathann2005-07-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15954 b3059339-0415-0410-9bf9-f77b7e298cf2
* --Patch by Stefan '1stein' Schuermans <1stein@schuermans.info>:rik2005-07-101-2/+6
| | | | | | | | the bugfix of the "grayscale" output scheme introduced a bug in the header writer for the stream output, this patch corrects that git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15953 b3059339-0415-0410-9bf9-f77b7e298cf2
* vf_pp7 and -af-adv force=1 defaultreimar2005-07-101-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15952 b3059339-0415-0410-9bf9-f77b7e298cf2
* -af-adv force=1 is now default (and thus also lavcresample)reimar2005-07-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15951 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing range/length check for video trak desc (fixes bug #335).reimar2005-07-101-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15950 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic: split the lschunks function in two.reimar2005-07-101-300/+317
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15949 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for vbr audio (frames are parsed individually); fixed small ↵nicodvb2005-07-101-112/+349
| | | | | | bugs in the management of pes_extension git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15948 b3059339-0415-0410-9bf9-f77b7e298cf2
* increased sync tag after wording fix in English versiongabrov2005-07-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15947 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync fourcc for all mpeg12 codecsrtognimp2005-07-091-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15946 b3059339-0415-0410-9bf9-f77b7e298cf2
* pp7 filter (spp=6 filter with 7 point dct where only the center sample is ↵michael2005-07-093-0/+489
| | | | | | | | | | used after idct) these differences from spp lead to a few nice symmetries which significantly reduce the computational cost almost not mmx optimized (iam lazy ...) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15945 b3059339-0415-0410-9bf9-f77b7e298cf2
* Put periods after (behind?..) parentheses.ods152005-07-091-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15944 b3059339-0415-0410-9bf9-f77b7e298cf2
* Last nit for this entry, by "The Wanderer"gpoirier2005-07-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15943 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics.ods152005-07-081-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15942 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typos and fixes by The Wandererods152005-07-071-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15941 b3059339-0415-0410-9bf9-f77b7e298cf2
* add 'aspect' and 'round' params to vf_expand.ods152005-07-072-18/+36
| | | | | | | (my first commit! I hope I did this correctly ;) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15940 b3059339-0415-0410-9bf9-f77b7e298cf2
* -identify variable names should follow [A-Z_][A-Z0-9_]* conventionranma2005-07-071-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15939 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.86gabrov2005-07-071-107/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15938 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.79gabrov2005-07-071-12/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15937 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes fixgpoirier2005-07-071-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15936 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove next round of outdated FAQ entries.diego2005-07-061-106/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15935 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-07-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15934 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert fix v1.3, it breaks streams with cook audio (ex.rtognimp2005-07-061-3/+3
| | | | | | | | | rtsp://mm4.rai.it/raitre/blob/ultimo/blob.rm) Applied a different fix for the first buf[k] (ensure buf size is k+4) The second buf[k] is safe, buf is at least 32 when the code is called git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15933 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes suggested by Diegogpoirier2005-07-061-17/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15932 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do some sanity checks before writing stream informationrtognimp2005-07-061-1/+6
| | | | | | | | Patch by Sergio Gelato >Sergio dot Gelato at astro dot su dot se< and some additions by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15931 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.76gabrov2005-07-061-1/+656
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15930 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.85gabrov2005-07-061-1/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15929 b3059339-0415-0410-9bf9-f77b7e298cf2
* make more patch-friendlyreimar2005-07-061-1/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15928 b3059339-0415-0410-9bf9-f77b7e298cf2
* Documentation for VCD/SVCD/DVD encoding, patch by Brendan McCarthy < ↵gpoirier2005-07-061-0/+604
| | | | | | bmccarthy AH iinet POUM net POUM au> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15927 b3059339-0415-0410-9bf9-f77b7e298cf2
* More fixes by Jeff, Diego, and Andrewgpoirier2005-07-061-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15926 b3059339-0415-0410-9bf9-f77b7e298cf2
* Few fixes and suggestions by Jeff and Diegogpoirier2005-07-061-11/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15925 b3059339-0415-0410-9bf9-f77b7e298cf2
* More options documented in XviD encoding guidegpoirier2005-07-051-0/+51
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15924 b3059339-0415-0410-9bf9-f77b7e298cf2
* Suggestions and fixes by The Wanderer and Richgpoirier2005-07-051-10/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15923 b3059339-0415-0410-9bf9-f77b7e298cf2
* New FAQ entry: Explain why libavcodec now sets FMP4 FourCC, and how to ↵gpoirier2005-07-051-0/+27
| | | | | | enventualy change it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15922 b3059339-0415-0410-9bf9-f77b7e298cf2
* radeon x300 support patch by Christophe Preaud <cpreaud at free.fr>faust32005-07-052-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15921 b3059339-0415-0410-9bf9-f77b7e298cf2
* hardcode SYNC flag, so no problems could rise if first frame is skippediive2005-07-051-1/+1
| | | | | | | | frame skipping is still done by passing NULL buffer to the decoder patch by Shachar Raindel <shacharr at gmail.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15920 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial translation, synced with 1.12gabrov2005-07-041-0/+1125
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15919 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.73gabrov2005-07-041-46/+178
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15918 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.69gabrov2005-07-041-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15917 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update of the x264 encoding guide:gpoirier2005-07-042-46/+182
| | | | | | | | | | | | | | | | | - Reorganized things, options are now divided into "speed vs quality" and "other" (more or less). subq is now where it belongs. - subq=6 is documented - explanation of what 2-pass really does, and why you'd better use it - mention 3-pass (and the fact that it usually doesn't help) - documented qcomp - documented keyint (not like it needed any more explanation, though) - deblocking parameter tweaking no longer categorized as options that "affect speed and quality ;) - updated example cpu requirements for decoding, in codecs.xml (720x480 @ 1500kbps 50%->35%, for my CPU) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15916 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.1026wight2005-07-031-3/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15915 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicate messageswight2005-07-0325-105/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15914 b3059339-0415-0410-9bf9-f77b7e298cf2
* don't read past the end of the selected tracknicodvb2005-07-031-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15913 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.172gabrov2005-07-031-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15912 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix missing taggabrov2005-07-031-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15911 b3059339-0415-0410-9bf9-f77b7e298cf2
* resize video after keep aspect menu item togglenplourde2005-07-032-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15910 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.82gabrov2005-07-031-376/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15909 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.81gabrov2005-07-031-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15908 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.17gabrov2005-07-031-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15907 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency/tcc support patch by Oded Shimonalex2005-07-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15906 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.66gabrov2005-07-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15905 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.68gabrov2005-07-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15904 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix various window resizing bug with menu optionnplourde2005-07-032-6/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15903 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete/outdated entries.diego2005-07-031-363/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15902 b3059339-0415-0410-9bf9-f77b7e298cf2
* some updatesalex2005-07-031-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15901 b3059339-0415-0410-9bf9-f77b7e298cf2
* unneededalex2005-07-031-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15900 b3059339-0415-0410-9bf9-f77b7e298cf2
* QUERY_FORMAT supportalex2005-07-031-1/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15899 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1lalex2005-07-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15898 b3059339-0415-0410-9bf9-f77b7e298cf2
* non working, hence status 'buggy'alex2005-07-031-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15897 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not count skipped/broken frames when using -framesreimar2005-07-032-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15896 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mandrake --> Mandriva name changediego2005-07-024-6/+6
| | | | | | | patch by Christian Korff < christian - dot - korff - at - gmail - dot - com > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15895 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1026gpoirier2005-07-021-1/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15894 b3059339-0415-0410-9bf9-f77b7e298cf2
* more fullscreen behaviour fix for mouse cursornplourde2005-07-021-7/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15893 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only dump to stdoutranma2005-07-021-20/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15892 b3059339-0415-0410-9bf9-f77b7e298cf2
* avisubdumpranma2005-07-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15891 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing escapes, this should now cover all shell special characters AFAICSranma2005-07-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15890 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for WAVEFORMAT.wFormatTag overflows and allow user to override the tag ↵ranma2005-07-026-0/+44
| | | | | | with -fafmttag git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15889 b3059339-0415-0410-9bf9-f77b7e298cf2
* avi vobsub soft subtitle dumperranma2005-07-021-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15888 b3059339-0415-0410-9bf9-f77b7e298cf2
* avi subtitle stream dumperranma2005-07-021-0/+199
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15887 b3059339-0415-0410-9bf9-f77b7e298cf2
* properly redraw fullscreen window with -fs and zoomnplourde2005-07-021-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15886 b3059339-0415-0410-9bf9-f77b7e298cf2
* increased sync tag, synced with 1.67 (typo fix in English version)gabrov2005-07-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15885 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.15gabrov2005-07-021-13/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15884 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix fullscreen menubar item behaviournplourde2005-07-011-14/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15883 b3059339-0415-0410-9bf9-f77b7e298cf2
* auto hide menubar and cursor in fullscreennplourde2005-07-011-2/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15882 b3059339-0415-0410-9bf9-f77b7e298cf2
* drop annoying debug messages from libdvdreadaurel2005-07-011-6/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15881 b3059339-0415-0410-9bf9-f77b7e298cf2
* Slightly restructured, mention more tools, small fixes, cosmetics.diego2005-07-011-9/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15880 b3059339-0415-0410-9bf9-f77b7e298cf2
* libdvdread 0.9.4henry2005-07-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15879 b3059339-0415-0410-9bf9-f77b7e298cf2
* increment libdvdread versionhenry2005-07-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15878 b3059339-0415-0410-9bf9-f77b7e298cf2
* add missing files from libdvdread 0.9.4henry2005-07-013-0/+590
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15877 b3059339-0415-0410-9bf9-f77b7e298cf2
* update mplayer specific libdvdread diff to match v0.9.4aurel2005-06-301-752/+123
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15876 b3059339-0415-0410-9bf9-f77b7e298cf2
* update libdvdread to v0.9.4aurel2005-06-3020-620/+1997
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15875 b3059339-0415-0410-9bf9-f77b7e298cf2
* Be more patch-friendlyaurel2005-06-301-1/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15874 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-06-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15873 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small fixgpoirier2005-06-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15872 b3059339-0415-0410-9bf9-f77b7e298cf2
* add hdv2 fourcc to MPEG2 codecs (used by new Sony HD camera)aurel2005-06-301-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15871 b3059339-0415-0410-9bf9-f77b7e298cf2
* Solaris sed needs the terminating '}' to be on a separate lineranma2005-06-301-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15870 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid hang when playing more than one filereimar2005-06-301-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15869 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1025gpoirier2005-06-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15868 b3059339-0415-0410-9bf9-f77b7e298cf2
* add vo_xv_enable_vsync() to xvmciive2005-06-301-0/+1
| | | | | | | it may not be needed but at least it shouldn't hurt to have it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15867 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing part of the last commit (got merged in on cvs update :-( )reimar2005-06-301-11/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15866 b3059339-0415-0410-9bf9-f77b7e298cf2
* added forgotten xv_enable_vsyncreimar2005-06-301-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15865 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplify osd-status display, and allow e.g. osd -2 to get the old behaviourreimar2005-06-301-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15864 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the OSD display state information when cycling OSD states with 'o'.diego2005-06-301-2/+18
| | | | | | | based on a patch by Paul TT < paulltt - at- hackerjournal - dot - it > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15863 b3059339-0415-0410-9bf9-f77b7e298cf2
* one more nickdiego2005-06-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15862 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-06-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15861 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention -vobsubid more explicitly, JACK seems to use multiple ports.diego2005-06-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15860 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reverts GCC-4.0 "fixe" which broke GCC-3.3 and maybe othersgpoirier2005-06-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15859 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better approach to shell escaping, may not catch all cases yetranma2005-06-301-3/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15858 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing translationsranma2005-06-291-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15857 b3059339-0415-0410-9bf9-f77b7e298cf2
* keep window size when changing aspectnplourde2005-06-292-11/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15856 b3059339-0415-0410-9bf9-f77b7e298cf2
* crash on autorelease, do not add to poolnplourde2005-06-291-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15855 b3059339-0415-0410-9bf9-f77b7e298cf2
* more general ao_macosx cleanup. Patch by Alexander Strange ↵nplourde2005-06-291-17/+18
| | | | | | <astrange@ithinksw.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15854 b3059339-0415-0410-9bf9-f77b7e298cf2
* corrected sync taggabrov2005-06-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15853 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.65paszczi2005-06-291-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15852 b3059339-0415-0410-9bf9-f77b7e298cf2
* unification of the sync taggabrov2005-06-296-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15851 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.80gabrov2005-06-291-12/+72
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15850 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.72gabrov2005-06-291-1/+136
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15849 b3059339-0415-0410-9bf9-f77b7e298cf2
* More fixes by the Wanderer and tip about another SVCD constrain suggested by ↵gpoirier2005-06-291-2/+8
| | | | | | Giacomo Comes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15848 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed leftover tag breaking doc generation. 10l to Jiri.rathann2005-06-281-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15847 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another REG_d -> REG_D fix.reimar2005-06-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15846 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed vf_lavcnicodvb2005-06-281-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15845 b3059339-0415-0410-9bf9-f77b7e298cf2
* restored framerate autodetection based on heightnicodvb2005-06-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15844 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.80jheryan2005-06-281-13/+67
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15843 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.66jheryan2005-06-281-35/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15842 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.13jheryan2005-06-281-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15841 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.1024jheryan2005-06-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15840 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.171jheryan2005-06-281-1/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15839 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1023jheryan2005-06-281-49/+107
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15838 b3059339-0415-0410-9bf9-f77b7e298cf2
* Corrections suggested by The Wanderergpoirier2005-06-281-11/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15837 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing closing taghenry2005-06-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15836 b3059339-0415-0410-9bf9-f77b7e298cf2
* mentioning xorgalex2005-06-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15835 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lalex2005-06-271-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15834 b3059339-0415-0410-9bf9-f77b7e298cf2
* EDL fixes in mencodernicodvb2005-06-271-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15833 b3059339-0415-0410-9bf9-f77b7e298cf2
* -don't encode more audio than needed; -edl_skip is int, not short; -don't ↵nicodvb2005-06-271-11/+19
| | | | | | read audio_data to skip in mux_a->buffer; -edl_seek works on input streams, not output; -one-frame accuracy fix ; patch by Oded Shimon git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15832 b3059339-0415-0410-9bf9-f77b7e298cf2
* New entry: how to make a (S)VCD with MEncoder.gpoirier2005-06-271-12/+60
| | | | | | | Deleted entry: MP2 files are played out of the box. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15831 b3059339-0415-0410-9bf9-f77b7e298cf2
* vobsub time-adjust tool by Gábor Farkas < gabor AH nekomancer POUM net >gpoirier2005-06-273-1/+71
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15830 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1024gpoirier2005-06-271-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15829 b3059339-0415-0410-9bf9-f77b7e298cf2
* -vobsubid works better for DVDs than sidreimar2005-06-271-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15828 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try to set XV_SYNC_TO_VBLANK to enable vsync on non-overlay xv adapters.reimar2005-06-272-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15827 b3059339-0415-0410-9bf9-f77b7e298cf2
* consume empty lirc events at once.reimar2005-06-273-1/+5
| | | | | | | Patch by Lev A. Melnikovsky {leva at kapitza ras ru}. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15826 b3059339-0415-0410-9bf9-f77b7e298cf2
* width % 16 != 0 workaround by (Nicolas Plourde: nicolas plourde, gmail com>)michael2005-06-271-0/+10
| | | | | | | | | | | cleanup by me indention fixed second one must be yv12touyvy instead of yv12toyuy2 replace slow modulo by bitwise and move %16!=0 code before the comment saying the code cant handle %16!=0 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15825 b3059339-0415-0410-9bf9-f77b7e298cf2
* FFmpeg theora decoder supportrtognimp2005-06-262-2/+4
| | | | | | | It works only with libavformat demuxer git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15824 b3059339-0415-0410-9bf9-f77b7e298cf2
* keep aspect when resizing, quit MPlayer when closing the window patch by ↵faust32005-06-261-2/+27
| | | | | | Erik Lunchpail <erik_27can at yahoo.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15823 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l to myself for breaking mingws dll codec support when libpthread is not ↵faust32005-06-261-5/+7
| | | | | | installed git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15822 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux close gets called automaticallyfaust32005-06-261-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15821 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32005-06-261-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15820 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32005-06-261-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15819 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32005-06-262-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15818 b3059339-0415-0410-9bf9-f77b7e298cf2
* set HAVE_LRINTF and C99/GNU_SOURCE during internal FAAD compile testhenry2005-06-251-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15817 b3059339-0415-0410-9bf9-f77b7e298cf2
* support raw ac3 (in private pes packets without the usual dvd 4 bytes ↵nicodvb2005-06-251-2/+18
| | | | | | substream header). Patch by Matthias Scharzott git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15816 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.1023wight2005-06-241-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15815 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes GCC4 fix by using "g" instead of "mp" as some compilers misscompilegpoirier2005-06-241-1/+1
| | | | | | | that code othewisei (leading to segfaults). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15814 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix seeking over http for files larger 2 GBreimar2005-06-241-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15813 b3059339-0415-0410-9bf9-f77b7e298cf2
* make -srate work again, unify audio filter init and preinit.reimar2005-06-246-72/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15812 b3059339-0415-0410-9bf9-f77b7e298cf2
* makes fribidi <= 0.10.4 works againaurel2005-06-231-4/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15811 b3059339-0415-0410-9bf9-f77b7e298cf2
* New codec covered by the encoding guide: XviDgpoirier2005-06-231-0/+141
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15810 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix asm constraints, tested on x86 and x86_64.reimar2005-06-231-20/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15809 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed typo in URLgabrov2005-06-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15808 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing para taggabrov2005-06-231-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15807 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.171gabrov2005-06-231-1/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15806 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.71gabrov2005-06-231-19/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15805 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.66gabrov2005-06-231-39/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15804 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.80gabrov2005-06-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15803 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.77gabrov2005-06-221-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15802 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.13gabrov2005-06-221-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15801 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix fribidi 0.10.5 and greater support (patch by Amir Shalem < amir at ↵aurel2005-06-221-1/+5
| | | | | | boom.org.il >) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15800 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rich's encoding guide (hopefully temporary) added to ↵gpoirier2005-06-221-0/+2
| | | | | | DOCS/tech/encoding-guide.txt git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15799 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix illegal memory accessesreimar2005-06-222-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15798 b3059339-0415-0410-9bf9-f77b7e298cf2
* Encoding guide featured by Richard Felker III, and updated by Jeff Clagg.gpoirier2005-06-221-0/+819
| | | | | | | Part of this guide is already in the XML docs. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15797 b3059339-0415-0410-9bf9-f77b7e298cf2
* M$ puts whole FAQs in these headers, so they can get really big...reimar2005-06-211-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15796 b3059339-0415-0410-9bf9-f77b7e298cf2
* messed up ordering of cases, special delivery of Cola to Tobiashenry2005-06-211-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15795 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1023gpoirier2005-06-211-2/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15794 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-06-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15793 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix mp_msg vs af_msg usage as pointed out by Ivo.diego2005-06-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15792 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l for me. two usages of mp_msg instead of af_msg slipped throughivo2005-06-201-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15791 b3059339-0415-0410-9bf9-f77b7e298cf2
* adds some more -identify output, patch by kiriuja < mplayer DASH patches PAM ↵gpoirier2005-06-209-0/+24
| | | | | | en DASH directo POUM net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15790 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l to whom commited it.iive2005-06-201-1/+1
| | | | | | | | 10l to the one that doesn't eat him own dogfood! Compilation fix git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15789 b3059339-0415-0410-9bf9-f77b7e298cf2
* slightly better parameter namediego2005-06-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15788 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix illegal readreimar2005-06-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15787 b3059339-0415-0410-9bf9-f77b7e298cf2
* split PARTS into multiple lines alsohenry2005-06-201-1/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15786 b3059339-0415-0410-9bf9-f77b7e298cf2
* A bug? Don't panic.ranma2005-06-202-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15785 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid bad memory accessreimar2005-06-201-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15784 b3059339-0415-0410-9bf9-f77b7e298cf2
* Core-dumps are a known problem :)ranma2005-06-201-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15783 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add vrc_init_occupancy to lavcoptsranma2005-06-203-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15782 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix memleak when playing mov filesreimar2005-06-202-0/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15781 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1019gpoirier2005-06-201-14/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15780 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-06-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15779 b3059339-0415-0410-9bf9-f77b7e298cf2
* typosdiego2005-06-201-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15778 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.16jheryan2005-06-201-0/+223
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15777 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.12jheryan2005-06-201-0/+1118
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15776 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix off_t on OSX, thanks to Steven M. Schultzranma2005-06-201-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15775 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid overly long lines to conform with the new general Makefile style.diego2005-06-192-12/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15774 b3059339-0415-0410-9bf9-f77b7e298cf2
* Be more patch-friendlyranma2005-06-196-45/+470
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15773 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.1019wight2005-06-191-10/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15772 b3059339-0415-0410-9bf9-f77b7e298cf2
* Formatting the suboption stringescape paragraphwight2005-06-191-9/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15771 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.1018wight2005-06-191-5/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15770 b3059339-0415-0410-9bf9-f77b7e298cf2
* and some more formatting fixeswight2005-06-191-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15769 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make default values and ranges match the source code.gpoirier2005-06-191-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15768 b3059339-0415-0410-9bf9-f77b7e298cf2
* -wid now works with OpenGL, formatting fixesdiego2005-06-191-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15767 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.1015wight2005-06-191-75/+211
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15766 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix to previous commitwight2005-06-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15765 b3059339-0415-0410-9bf9-f77b7e298cf2
* A few structural fixeswight2005-06-191-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15764 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l. Previous GCC4 commit broke compilation with gcc-3.4 and maybe others ia-32gpoirier2005-06-191-1/+1
| | | | | | | tested with gcc-2.95, 3.3, 3.4, 4.0 on ia-32 and 3.4, 4.0, 3.3 on amd64 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15763 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some subtitles that didn't show.reimar2005-06-191-0/+2
| | | | | | | Sample: http://mplayerhq.hu/MPlayer/samples/sub/starwarssub2.vob git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15762 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix wrong usage of select() (based on patch by Selwyn Tang selwyn hectrix com),reimar2005-06-191-11/+18
| | | | | | | add missing closesocket calls. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15761 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo ^^;ranma2005-06-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15760 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2005-06-191-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15759 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1013: rawaudio muxergpoirier2005-06-191-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15758 b3059339-0415-0410-9bf9-f77b7e298cf2
* some typos in the english partsranma2005-06-191-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15757 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix email addressranma2005-06-196-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15756 b3059339-0415-0410-9bf9-f77b7e298cf2
* rawaudio muxerranma2005-06-1910-1/+116
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15755 b3059339-0415-0410-9bf9-f77b7e298cf2
* correct urlalex2005-06-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15754 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1012gpoirier2005-06-181-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15753 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, -march=k8 was used with cpu detection even when compiler did notreimar2005-06-181-2/+2
| | | | | | | support it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15752 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make dfbopts a suboption, use suboption parserreimar2005-06-183-97/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15751 b3059339-0415-0410-9bf9-f77b7e298cf2
* GCC-4 fix for AMD-64gpoirier2005-06-181-4/+4
| | | | | | | Warning: high cola-affinity here) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15750 b3059339-0415-0410-9bf9-f77b7e298cf2
* support -widreimar2005-06-183-5/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15749 b3059339-0415-0410-9bf9-f77b7e298cf2
* osx 10.3 dont like to have a window init with no sizenplourde2005-06-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15748 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_macosx now supports setting alpha as well, typo.diego2005-06-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15747 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1010gpoirier2005-06-171-6/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15746 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 rev264 (lossless)lorenm2005-06-172-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15745 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix crash with e.g. -vf scale=::reimar2005-06-171-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15744 b3059339-0415-0410-9bf9-f77b7e298cf2
* when somebody specifies e.g. --loop, the message says that a -loop optionreimar2005-06-172-2/+2
| | | | | | | does not exist. So add an extra - to the message. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15743 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing range checks so we won't overflow the buffers, thanks to Erik ↵ranma2005-06-171-11/+24
| | | | | | Auerswald for noticing this problem git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15742 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove useless includehenry2005-06-161-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15741 b3059339-0415-0410-9bf9-f77b7e298cf2
* another piece of guesswork...reimar2005-06-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15740 b3059339-0415-0410-9bf9-f77b7e298cf2
* memleak fix by bryanwilkerson WHIRLPOOL yahoo SPOT comhenry2005-06-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15739 b3059339-0415-0410-9bf9-f77b7e298cf2
* set nsapp and setup cocoa with NSApplicationLoadnplourde2005-06-161-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15738 b3059339-0415-0410-9bf9-f77b7e298cf2
* proper init of NSAppnplourde2005-06-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15737 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some people confuse vidix with kernel drivers, so let's add a note about itattila2005-06-161-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15736 b3059339-0415-0410-9bf9-f77b7e298cf2
* helper functions for comparing strarg_t "strings".reimar2005-06-163-6/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15735 b3059339-0415-0410-9bf9-f77b7e298cf2
* support lenght-quoting of strings in subopt parser.reimar2005-06-162-1/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15734 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove code that is already done by fixup_network_stream_cache.reimar2005-06-161-9/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15733 b3059339-0415-0410-9bf9-f77b7e298cf2
* set window alphanplourde2005-06-161-2/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15732 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264 section: French fixes. Explains some "non-trivial things".gpoirier2005-06-151-8/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15731 b3059339-0415-0410-9bf9-f77b7e298cf2
* new texture framenplourde2005-06-152-15/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15730 b3059339-0415-0410-9bf9-f77b7e298cf2
* device_id flag force fullscreen devicenplourde2005-06-151-48/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15729 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix gcc warningnplourde2005-06-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15728 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not realloc window while playing playlistnplourde2005-06-152-33/+49
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15727 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo, patch by Jeff Clagg <snacky - at -ikaruga - dot - co - dot - uk>diego2005-06-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15726 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 rev263 (RDO)lorenm2005-06-152-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15725 b3059339-0415-0410-9bf9-f77b7e298cf2
* draw resize boxnplourde2005-06-141-2/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15724 b3059339-0415-0410-9bf9-f77b7e298cf2
* removes the use of AudioConverters. patch by Alexander Strange ↵nplourde2005-06-141-40/+5
| | | | | | <alexander.strange@ithinksw.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15723 b3059339-0415-0410-9bf9-f77b7e298cf2
* small change to field-matching metrics which hopefully makes a bigrfelker2005-06-142-7/+90
| | | | | | | | | | | | | | | improvement to results. inter-field comparison is now counterbalanced with intra-field total (vertical) variation. this means that areas of extreme high frequency content, which become aliased within individual fields, will not interfere with field matching. examples: white noise effects, small kanji, very small latin text, ... may still need tweaking. please report regressions. this change will likely be made optional in the future (right now it's enclosed in "if (1)"... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15722 b3059339-0415-0410-9bf9-f77b7e298cf2
* added AAC ADTS demuxernicodvb2005-06-135-2/+281
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15721 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix OSD handling, DVD subtitles work now. Will be a bit slower though.reimar2005-06-131-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15720 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1006gpoirier2005-06-131-11/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15719 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l! fix10l! fix10l! fix10l! fix10l! fix10l! fix10l! fix10l! fix10l! fix10l! fixgpoirier2005-06-131-36/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15718 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistency fixesgpoirier2005-06-131-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15717 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1003gpoirier2005-06-131-6/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15716 b3059339-0415-0410-9bf9-f77b7e298cf2
* tweak x264 option descriptionslorenm2005-06-132-16/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15715 b3059339-0415-0410-9bf9-f77b7e298cf2
* small roff fixesdiego2005-06-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15714 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2005-06-121-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15713 b3059339-0415-0410-9bf9-f77b7e298cf2
* Win32 codecs --> binary codecs, references to avifile are pointless nowadays.diego2005-06-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15712 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typogpoirier2005-06-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15711 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updated description of XviD codecgpoirier2005-06-121-36/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15710 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed wrong binary mask: it precluded the syncword of adts-4 from being ↵nicodvb2005-06-121-1/+1
| | | | | | recognized as valid git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15709 b3059339-0415-0410-9bf9-f77b7e298cf2
* AMD-64's version of Suse ships a version of 3.3 hacked with brokengpoirier2005-06-091-8/+7
| | | | | | | | backported patches from gcc 3.4, which broke CPU + GCC version detection. Patch by Corey Hickey < bugfood - ml WOOP fatooh POUM org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15708 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add sub_load and sub_remove slave commands.reimar2005-06-095-0/+77
| | | | | | | Patch by kiriuja [mplayer-patches at en-directo dot net] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15707 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document install-divx5.sh and install-w32codecs.sh.diego2005-06-091-0/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15706 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fixesdiego2005-06-091-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15705 b3059339-0415-0410-9bf9-f77b7e298cf2
* And an intendation fixwight2005-06-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15704 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix Live Resize to match vo_macosx behaviornplourde2005-06-091-69/+101
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15703 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux_stream_t.pts should not be assigned by the demuxer. Fixes playback of ↵mosu2005-06-091-1/+1
| | | | | | VFR files. Patch by Sam Dennis <sam () malfunction ! screaming ! net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15702 b3059339-0415-0410-9bf9-f77b7e298cf2
* toolame/twolame typo, 10lnicodvb2005-06-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15701 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better description of XviD's keyframe_boost and kfthreshold.gpoirier2005-06-081-6/+12
| | | | | | | Consitency fixes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15700 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.1002gpoirier2005-06-081-15/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15699 b3059339-0415-0410-9bf9-f77b7e298cf2
* forgotten reference to remove-logo, 10l for Richhenry2005-06-081-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15698 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing dot at start of macro descriptionwight2005-06-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15697 b3059339-0415-0410-9bf9-f77b7e298cf2
* Wording and roff fixes as suggested by the Wanderer.diego2005-06-081-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15696 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l for mehenry2005-06-081-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15695 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove_logo filter by yartrebo, committed with fixes for c++ variable ↵rfelker2005-06-083-1/+923
| | | | | | declarations git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15694 b3059339-0415-0410-9bf9-f77b7e298cf2
* merge the mingw gcc 4.1 difffaust32005-06-071-2/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15693 b3059339-0415-0410-9bf9-f77b7e298cf2
* mingw and maybe other system define the __int* types to char, short..., so ↵faust32005-06-071-0/+16
| | | | | | the typedefs become typedef char char; etc. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15692 b3059339-0415-0410-9bf9-f77b7e298cf2
* match the declaration in the includes to make it compile with gcc 4.1, patch ↵faust32005-06-071-2/+2
| | | | | | by Gianluigi Tiesi <mplayer at netfarm.it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15691 b3059339-0415-0410-9bf9-f77b7e298cf2
* mingw gcc 4.1 support patch by Gianluigi Tiesi <mplayer at netfarm.it>faust32005-06-072-7/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15690 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.999: small formattinggpoirier2005-06-071-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15689 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL updatesdiego2005-06-072-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15688 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL updates, sync by removing a few outdated FAQ entries.diego2005-06-072-26/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15687 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.65diego2005-06-071-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15686 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL updates, sync by removing outdated FAQ entries.diego2005-06-072-25/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15685 b3059339-0415-0410-9bf9-f77b7e298cf2
* correcting the previous draw_slice fixhenry2005-06-071-2/+4
| | | | | | | | - don't draw slices beyond sh->disp_h - draw slices sh->disp_w wide to avoid buffer overflow in VO git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15684 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync URL updatediego2005-06-071-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15683 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL update, Windows port is no longer beta.diego2005-06-071-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15682 b3059339-0415-0410-9bf9-f77b7e298cf2
* better vf_ditc description by Ville Saari <114263 - @ - vs - . - iki - . - fi>diego2005-06-071-12/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15681 b3059339-0415-0410-9bf9-f77b7e298cf2
* small formatting and wording fixesdiego2005-06-071-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15680 b3059339-0415-0410-9bf9-f77b7e298cf2
* check for display height when drawing sliceshenry2005-06-071-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15679 b3059339-0415-0410-9bf9-f77b7e298cf2
* SPARC section translationjheryan2005-06-071-39/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15678 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.27jheryan2005-06-071-2/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15677 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.70jheryan2005-06-071-12/+327
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15676 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.76jheryan2005-06-071-1/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15675 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.64jheryan2005-06-071-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15674 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.997jheryan2005-06-071-75/+241
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15673 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.169jheryan2005-06-071-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15672 b3059339-0415-0410-9bf9-f77b7e298cf2
* moved mpeg-ps/es probing code to demux_mpg.cnicodvb2005-06-062-116/+111
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15671 b3059339-0415-0410-9bf9-f77b7e298cf2
* pass along audio extradata if presentnicodvb2005-06-061-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15670 b3059339-0415-0410-9bf9-f77b7e298cf2
* MinGW supportdiego2005-06-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15669 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.998.gpoirier2005-06-061-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15668 b3059339-0415-0410-9bf9-f77b7e298cf2
* BSD/OS works same as the other BSDs, tested by Steven M. Schultz.diego2005-06-061-11/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15667 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling, some more uniformitydiego2005-06-061-9/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15666 b3059339-0415-0410-9bf9-f77b7e298cf2
* gcc-2.95.3 fix, patch inspired by Steven M. Schultziive2005-06-061-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15665 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos/grammar/wordingdiego2005-06-061-22/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15664 b3059339-0415-0410-9bf9-f77b7e298cf2
* pthreads support for mingw, patch by Gianluigi Tiesi <mplayer at netfarm.it>faust32005-06-061-3/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15663 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2005-06-061-3/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15662 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove long obsolete -fb option.diego2005-06-062-6/+0
| | | | | | | patch by Oded Shimon <ods15 - at - ods15 - dot - dyndns - dot - org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15661 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes x264's "lumi_mask" option and improves lavc's "nr" option.gpoirier2005-06-051-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15660 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.996gpoirier2005-06-051-5/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15659 b3059339-0415-0410-9bf9-f77b7e298cf2
* show window only after texture creation (look better).nplourde2005-06-051-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15658 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rephrase vf_fspp parameter description.diego2005-06-051-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15657 b3059339-0415-0410-9bf9-f77b7e298cf2
* roff fixesdiego2005-06-051-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15656 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r252 (8x8dct)lorenm2005-06-053-11/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15655 b3059339-0415-0410-9bf9-f77b7e298cf2
* -vf fspp updatehenry2005-06-051-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15654 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better vf_spp description, one grammar fix.diego2005-06-051-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15653 b3059339-0415-0410-9bf9-f77b7e298cf2
* sanity checks for options; treat quality > 5 as 5, not 4henry2005-06-051-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15652 b3059339-0415-0410-9bf9-f77b7e298cf2
* tabs --> spaces indentation cosmeticsdiego2005-06-051-32/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15651 b3059339-0415-0410-9bf9-f77b7e298cf2
* Generate the version string with awk on BSD systems and work around wrongdiego2005-06-051-8/+11
| | | | | | | | day/month order in the ls output. based on a patch by Chris Roccati <roccati - at - pobox - dot - com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15650 b3059339-0415-0410-9bf9-f77b7e298cf2
* FFmpeg mjpeg decoder can decode dmb1rtognimp2005-06-051-0/+1
| | | | | | | "Patch" by compn git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15649 b3059339-0415-0410-9bf9-f77b7e298cf2
* Pure cosmeticnplourde2005-06-051-12/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15648 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mac OS X Audio with AudioUnits and AudioToolbox format converters, Patch by ↵nplourde2005-06-051-177/+171
| | | | | | Chris Roccati<roccati@pobox.com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15647 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mac OS X Audio with AudioUnits and AudioToolbox format convertersnplourde2005-06-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15646 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a note to the --help output that explains how our configure works,diego2005-06-051-0/+5
| | | | | | | especially the --enable case that is different from autoconf. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15645 b3059339-0415-0410-9bf9-f77b7e298cf2
* Days should be two digits.diego2005-06-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15644 b3059339-0415-0410-9bf9-f77b7e298cf2
* -vf fspp docshenry2005-06-051-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15643 b3059339-0415-0410-9bf9-f77b7e298cf2
* Create a unique client name so that multiple instances work.reimar2005-06-051-1/+4
| | | | | | | Patch by Jason Tackaberry (tack sault org) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15642 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.990gpoirier2005-06-041-13/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15641 b3059339-0415-0410-9bf9-f77b7e298cf2
* More gcc-4.0 fixesgpoirier2005-06-041-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15640 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add XviD's luminance masking (option name: lumi_mask)gpoirier2005-06-043-1/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15639 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document ao_jack suboption, ChangeLog update for ao_jack and vo_gl*reimar2005-06-042-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15638 b3059339-0415-0410-9bf9-f77b7e298cf2
* -vf fspphenry2005-06-041-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15637 b3059339-0415-0410-9bf9-f77b7e298cf2
* less confusing wordingdiego2005-06-041-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15636 b3059339-0415-0410-9bf9-f77b7e298cf2
* x86-64 fixes by Reimarhenry2005-06-041-289/+283
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15635 b3059339-0415-0410-9bf9-f77b7e298cf2
* disable mmx code for x86-64henry2005-06-041-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15634 b3059339-0415-0410-9bf9-f77b7e298cf2
* move unchanged registers back to input spechenry2005-06-041-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15633 b3059339-0415-0410-9bf9-f77b7e298cf2
* faster spp filter by Nikolaj Poroshin <porosh3 at psu ru>henry2005-06-043-1/+2116
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15632 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix latency calculation and buffersize setting.reimar2005-06-031-3/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15631 b3059339-0415-0410-9bf9-f77b7e298cf2
* modified X11 check to use correct libs on mixed 32/64 bit systemsreimar2005-06-031-27/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15630 b3059339-0415-0410-9bf9-f77b7e298cf2
* some debugging codealex2005-06-031-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15629 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention stream layer restructuring and cleanupnicodvb2005-06-031-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15628 b3059339-0415-0410-9bf9-f77b7e298cf2
* printf converted to mp_msg; made static many unnecessarily global symbolsnicodvb2005-06-034-126/+115
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15627 b3059339-0415-0410-9bf9-f77b7e298cf2
* compare resource url with bundle url, if its the same path do not use has ↵nplourde2005-06-031-16/+30
| | | | | | conf file location. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15626 b3059339-0415-0410-9bf9-f77b7e298cf2
* Spelling/wording/grammar fixes, convert mixed tabs and spaces indentation todiego2005-06-031-108/+109
| | | | | | | spaces, some cosmetics. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15625 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain some more -lavdopts debug options.diego2005-06-031-1/+5
| | | | | | | patch by Jeff Clagg <snacky - at - ikaruga - dot - co - dot - uk> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15624 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.986: XviD zones + fixesgpoirier2005-06-031-1/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15623 b3059339-0415-0410-9bf9-f77b7e298cf2
* regain window focus in fullscreen, patch by Erik Lunchpail <enik_27can at ↵faust32005-06-031-1/+1
| | | | | | yahoo.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15622 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording/markup fixesdiego2005-06-021-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15621 b3059339-0415-0410-9bf9-f77b7e298cf2
* XviD zones support. Patch by Doom9: < feedback123 GROOVY doom9 STEADY org >gpoirier2005-06-023-2/+97
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15620 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux high profile H.264 ESlorenm2005-06-021-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15619 b3059339-0415-0410-9bf9-f77b7e298cf2
* one bugfix and a few gcc4 bug workaorunds by (Gianluigi Tiesi: mplayer, ↵michael2005-06-023-5/+14
| | | | | | netfarm it) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15618 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.70gabrov2005-06-021-1/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15617 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264 check needs -lpthreadlorenm2005-06-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15616 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change header order to avoid compile error because of STREAM_SEEKreimar2005-06-022-13/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15615 b3059339-0415-0410-9bf9-f77b7e298cf2
* memory leak fixes, patch by Gianluigi Tiesi <mplayer at netfarm.it>faust32005-06-021-5/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15614 b3059339-0415-0410-9bf9-f77b7e298cf2
* Moved event update inside cocoa openglview classnplourde2005-06-021-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15613 b3059339-0415-0410-9bf9-f77b7e298cf2
* Function name cleanupnplourde2005-06-022-20/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15612 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync swap with VBL.nplourde2005-06-021-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15611 b3059339-0415-0410-9bf9-f77b7e298cf2
* better quoteswight2005-06-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15610 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix wrong \n at beggining/end of messagewight2005-06-015-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15609 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.984 + minor fixeswight2005-06-011-14/+60
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15608 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.984gpoirier2005-06-011-3/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15607 b3059339-0415-0410-9bf9-f77b7e298cf2
* New ao_jack without bio2jack dependency.reimar2005-06-014-234/+310
| | | | | | | Since I rewrote ao_jack.c from scratch, the diff is unreadable, sorry. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15606 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set stack non-executable where supported.reimar2005-06-011-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15605 b3059339-0415-0410-9bf9-f77b7e298cf2
* strdup subtitle filename at a more appropriate place, fixing memleaks andreimar2005-06-014-10/+18
| | | | | | | double frees. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15604 b3059339-0415-0410-9bf9-f77b7e298cf2
* Tab to space conversion to prevent the ASCII diagram to be messed up when adiego2005-05-311-7/+7
| | | | | | | non-standard tab size is used. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15603 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_macosx now supports (almost) the same keys as vo_quartz.diego2005-05-311-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15602 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace cosmeticsdiego2005-05-311-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15601 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixesdiego2005-05-311-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15600 b3059339-0415-0410-9bf9-f77b7e298cf2
* new x264 entries: me (motion estimation search algorithm) and 4x4mv options. ↵gpoirier2005-05-311-0/+32
| | | | | | Patch by Jeff Clagg (snacky BLAM ikaruga POUM co POUM uk) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15599 b3059339-0415-0410-9bf9-f77b7e298cf2
* geometry support for gl2 under win, default window pos centered for gl, gl2gpoirier2005-05-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15598 b3059339-0415-0410-9bf9-f77b7e298cf2
* - correct the argument in configure check for lrintf() to avoid a warninghenry2005-05-303-4/+4
| | | | | | | | - add -D_GNU_SOURCE where lrintf() is used, for the cases when -std=gnu99 isn't available git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15597 b3059339-0415-0410-9bf9-f77b7e298cf2
* -geometry support for gl2 under win, default window pos centered for gl, gl2reimar2005-05-304-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15596 b3059339-0415-0410-9bf9-f77b7e298cf2
* check for -std=gnu99 to make lrintf() work on gcc 3.3/3.4henry2005-05-301-2/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15595 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid lrintf redeclarationhenry2005-05-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15594 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a variable for the codec directory and set it to /usr/lib/codecs insteaddiego2005-05-291-6/+8
| | | | | | | of the old /usr/lib/win32. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15593 b3059339-0415-0410-9bf9-f77b7e298cf2
* The default CFLAGS settings include -ffast-math and GCC 3.4.3 thereforediego2005-05-291-1/+1
| | | | | | | | | optimizes the lrintf call in the test away, effectively turning it into a NOP. The attached patch forces -ffast-math of for this test. patch by Joerg Sonnenberger <joerg - at -britannica - dot - bec - dot - de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15592 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r240 (threads)lorenm2005-05-293-1/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15591 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implement -geometry for vo gl and gl2.reimar2005-05-293-7/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15590 b3059339-0415-0410-9bf9-f77b7e298cf2
* an ancient doc, maybe has use, but at least will be available in Attic once ↵alex2005-05-291-0/+28
| | | | | | removed :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15589 b3059339-0415-0410-9bf9-f77b7e298cf2
* very dummy script, written for a friendalex2005-05-291-0/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15588 b3059339-0415-0410-9bf9-f77b7e298cf2
* old scripts from early debian packagealex2005-05-292-0/+187
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15587 b3059339-0415-0410-9bf9-f77b7e298cf2
* ported all network streams to the new APInicodvb2005-05-2915-872/+927
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15586 b3059339-0415-0410-9bf9-f77b7e298cf2
* keep vo_fps and vo_mouse_timer_const in sync with sh_video->fps, otherwisereimar2005-05-281-0/+5
| | | | | | | mouse pointer autohide and the volume OSD from the gui break (with e.g. asf). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15585 b3059339-0415-0410-9bf9-f77b7e298cf2
* last patch broke skin reading completely, becasue last line of skinreimar2005-05-281-5/+5
| | | | | | | file is empty. Fix and simplify, since fgets can do feof's job, too... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15584 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.169gabrov2005-05-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15583 b3059339-0415-0410-9bf9-f77b7e298cf2
* a cleaned-up version of ty demuxer improvements found in tivo-mplayer fork.joey2005-05-281-95/+413
| | | | | | | this represents the last work done on the demuxer by its original author. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15582 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix audio init crashjoey2005-05-281-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15581 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.64gabrov2005-05-281-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15580 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for AMD64 compiler optimizations flags in 32-bit mode. Patch by ↵gpoirier2005-05-281-1/+9
| | | | | | Corey Hickey git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15579 b3059339-0415-0410-9bf9-f77b7e298cf2
* not used anymorereimar2005-05-271-9/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15578 b3059339-0415-0410-9bf9-f77b7e298cf2
* setting sh_audio to NULL is nonsense, since it is only a local variable,reimar2005-05-271-6/+6
| | | | | | | | | use d_audio->sh instead. Fixes crash for incoming/VTS_01_1_orig.VOB, though it still doesn't select the other audio stream automatically. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15577 b3059339-0415-0410-9bf9-f77b7e298cf2
* Athlon 64 optimization flags, in 32 and 64-bit mode.gpoirier2005-05-271-4/+43
| | | | | | | | Patch by Corey Hickey < bugfood-ml YO fatooh POUM org >, based on Robert Swain's patch <robert POUM swain YO gmail POUM com > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15576 b3059339-0415-0410-9bf9-f77b7e298cf2
* This currently sends control characters to the terminal instead ofrtognimp2005-05-261-14/+18
| | | | | | | | | meaningful names. Since some names are longer than 4 characters, I propose the following approach. Patch by + a ! guru #at# sympatico ! ca + git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15575 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix pan-scan in fullscreen modenplourde2005-05-261-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15574 b3059339-0415-0410-9bf9-f77b7e298cf2
* support DVR formatreimar2005-05-262-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15573 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix signess warningnplourde2005-05-251-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15572 b3059339-0415-0410-9bf9-f77b7e298cf2
* create menunplourde2005-05-252-0/+177
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15571 b3059339-0415-0410-9bf9-f77b7e298cf2
* quicktime fix updatehenry2005-05-251-3/+7
| | | | | | | | - check for existence of sh->ImageDesc instead of h263 fourcc - honor -lavdopts lowres git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15570 b3059339-0415-0410-9bf9-f77b7e298cf2
* Specify the padding instead of expecting the compiler to align correctlyreimar2005-05-251-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15569 b3059339-0415-0410-9bf9-f77b7e298cf2
* prefer width&height from bitmapinfoheader for h263 streamshenry2005-05-251-4/+12
| | | | | | | | fixes playback of some MOV files (http://mplayerhq.hu/pipermail/mplayer-dev-eng/2004-July/027777.html) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15568 b3059339-0415-0410-9bf9-f77b7e298cf2
* DragonFly BSD supportdiego2005-05-2513-20/+28
| | | | | | | patch by Joerg Sonnenberger <joerg - at - britannica - dot - bec - dot - de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15567 b3059339-0415-0410-9bf9-f77b7e298cf2
* restored preinit_audio_filters() but set the final sample_rate to the value ↵nicodvb2005-05-241-6/+1
| | | | | | of -srate, if specified: the source sample_rate is sped up or down while the destination can be resampled at will; 1 aboundant liter to me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15566 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.980:gpoirier2005-05-241-3/+27
| | | | | | | | 1.980: Fix paragraph indentation. 1.979: sync to x264 r239 (zoned ratecontrol and UMHex ME) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15565 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix paragraph indentation.diego2005-05-241-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15564 b3059339-0415-0410-9bf9-f77b7e298cf2
* more paranoid return value checkinghenry2005-05-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15563 b3059339-0415-0410-9bf9-f77b7e298cf2
* disable preinit until it's fixed (it breaks -speed...codec is initialized ↵rfelker2005-05-241-0/+5
| | | | | | with wrong samplerate) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15562 b3059339-0415-0410-9bf9-f77b7e298cf2
* No overlap allowed in memcpy, use memmovehzoli2005-05-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15561 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make sure that samplesize is at least 2, as some demuxers set it to 1hzoli2005-05-241-0/+1
| | | | | | | | (demux_ogg for ac3 in ogm) or possibly even 0, and it causes preinit to set audio_out_minsize too low, which causes overflow (assert). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15560 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix ADCTRL_SKIP_FRAME and add ADCTRL_RESYNC_STREAMhzoli2005-05-242-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15559 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r239 (zoned ratecontrol and UMHex ME)lorenm2005-05-243-7/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15558 b3059339-0415-0410-9bf9-f77b7e298cf2
* patch by oded to fix edl hang when end of audio is reachedrfelker2005-05-241-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15557 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the public sys/kbio.h header instead of messing with the MI headers, whichdiego2005-05-231-4/+1
| | | | | | | | doesn't exist anymore on DragonFly. Approved by the FreeBSD ports maintainer. patch by Joerg Sonnenberger <joerg - at - britannica - bec - de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15556 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print error when skin file is not readable (e.g. a directory) instead of hangingreimar2005-05-232-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15555 b3059339-0415-0410-9bf9-f77b7e298cf2
* Speedup asf descrambling (avoid one memcpy and use our fastmemcpy).reimar2005-05-231-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15554 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use memmove instead of memcpy for overlapping areas.reimar2005-05-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15553 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce senseless spamminess of DVD playback in verbose mode.diego2005-05-221-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15552 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.978: Only one of -dumpstream, -dumpvideo, -dumpaudio works at a ↵gpoirier2005-05-221-1/+10
| | | | | | time. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15551 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.977.gpoirier2005-05-221-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15550 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only one of -dumpstream, -dumpvideo, -dumpaudio works at a time.diego2005-05-221-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15549 b3059339-0415-0410-9bf9-f77b7e298cf2
* LC_ALL overrides LANG, so use it instead.diego2005-05-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15548 b3059339-0415-0410-9bf9-f77b7e298cf2
* preinit audio filters in order to determine the final samplerate and number ↵nicodvb2005-05-221-2/+17
| | | | | | of channels, or audio encoders will be initialized with the wrong parameters git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15547 b3059339-0415-0410-9bf9-f77b7e298cf2
* vb_strategy only works in pass one.diego2005-05-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15546 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_macosx does not yet support command keys.diego2005-05-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15545 b3059339-0415-0410-9bf9-f77b7e298cf2
* More correct -lavfopts description.diego2005-05-211-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15544 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention the MinGW HOWTO.diego2005-05-211-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15543 b3059339-0415-0410-9bf9-f77b7e298cf2
* Surround lavf in the '-of help' output by #ifdef USE_LIBAVFORMAT.diego2005-05-211-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15542 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make -wid behave more consistent.al2005-05-216-0/+20
| | | | | | | Original patch by kiriuja |mplayer-patches >ta< en-directo >tod< net| git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15541 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.974: Document lavf muxers.gpoirier2005-05-211-3/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15540 b3059339-0415-0410-9bf9-f77b7e298cf2
* sanity checksalex2005-05-211-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15539 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lalex2005-05-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15538 b3059339-0415-0410-9bf9-f77b7e298cf2
* LANG=C ensures month/day order and English language in the date string fordiego2005-05-211-5/+6
| | | | | | | | | more reliable operation in diverse environments. Tested on OpenBSD, NetBSD, FreeBSD, Darwin 10.2 and Darwin 10.1. Darwin 10.4 should work as well, 10.3 does not due to broken ls. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15537 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for latest Cygwin-related changes.diego2005-05-211-2/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15536 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support playing DVDs from harddrive directories.diego2005-05-211-4/+4
| | | | | | | idea from Björn Hermansson < Bjorn dot Hermansson at teliasonera dot com > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15535 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not switch to audio tracks whose codec private data differs from the main ↵mosu2005-05-211-0/+4
| | | | | | audio track's as this will most likely result in messed up audio output. Patch by Michael Behrisch <list () behrisch ! de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15534 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document lavf muxers.diego2005-05-202-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15533 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling cosmeticsdiego2005-05-201-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15532 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.168gabrov2005-05-201-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15531 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.27gabrov2005-05-201-1/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15530 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.69gabrov2005-05-201-7/+299
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15529 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.973: macosx T behavior is standard, vo_macosx (will) have same special keykraymer2005-05-201-7/+4
| | | | | | | + little typo/wording fix git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15528 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.76 (increased sync tag after English consistency fix)gabrov2005-05-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15527 b3059339-0415-0410-9bf9-f77b7e298cf2
* macosx T behavior is standard, vo_macosx (will) have same special keynplourde2005-05-202-7/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15526 b3059339-0415-0410-9bf9-f77b7e298cf2
* Toggle only between ontop and normal.nplourde2005-05-201-20/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15525 b3059339-0415-0410-9bf9-f77b7e298cf2
* Should fix altivec detection for g3 system.nplourde2005-05-201-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15524 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hopefully correct and non-confusing phrasing for the most talked-aboutdiego2005-05-201-3/+3
| | | | | | | sentence of the year. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15523 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove inclusion of stdio.hnicodvb2005-05-191-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15522 b3059339-0415-0410-9bf9-f77b7e298cf2
* ported smb:// to the new stream apinicodvb2005-05-193-104/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15521 b3059339-0415-0410-9bf9-f77b7e298cf2
* ported smb:// to the new stream api, patch by Matthieu Tourne [matthieu ↵nicodvb2005-05-191-0/+153
| | | | | | puntum tourne ab gmail puntum com] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15520 b3059339-0415-0410-9bf9-f77b7e298cf2
* ported dvd:// to the new stream apinicodvb2005-05-195-714/+800
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15519 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reset the saved max_pts used for timecode reordering after seeking. ↵mosu2005-05-191-0/+1
| | | | | | Otherwise playback is broken after seeking back in a file that needs the timecodes to be reordered. Patch by Sam Dennis <sam () malfunction ! screaming !net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15518 b3059339-0415-0410-9bf9-f77b7e298cf2
* Shorten a few lines to avoid ugly linebreaks.diego2005-05-181-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15517 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore codecs-status.html.diego2005-05-181-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15516 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix overly long lines that mess up output.diego2005-05-181-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15515 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplificationdiego2005-05-181-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15514 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc updates, Snow spellingdiego2005-05-181-12/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15513 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make version string depend of the last change of CVS/Entries for Darwin.diego2005-05-181-2/+9
| | | | | | | loosely based on a patch by Chris Roccati <roccati at pobox dot com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15512 b3059339-0415-0410-9bf9-f77b7e298cf2
* charset as reported, please fix if this is wrongreimar2005-05-181-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15511 b3059339-0415-0410-9bf9-f77b7e298cf2
* 8bit palette mode support for pnghenry2005-05-181-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15510 b3059339-0415-0410-9bf9-f77b7e298cf2
* The Quicktime headers have changed slightly from 10.3.x to 10.4. Steven ↵nplourde2005-05-181-0/+2
| | | | | | Schultz <sms@2BSD.COM> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15509 b3059339-0415-0410-9bf9-f77b7e298cf2
* include get_path.c before avcodec.h, fix error on osx + gcc4 where defined ↵nplourde2005-05-181-2/+2
| | | | | | macro always_inline in libavcodec/common.h already exist in math.h and used for something else. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15508 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify that -dumpstream works for video as well as audio and mentiondiego2005-05-181-4/+8
| | | | | | | -dumpaudio and -dumpvideo as well. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15507 b3059339-0415-0410-9bf9-f77b7e298cf2
* 8bit palette mode support for pnghenry2005-05-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15506 b3059339-0415-0410-9bf9-f77b7e298cf2
* new get_time_pos slave mode commandoreimar2005-05-185-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15505 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.972: Remove capitalization and period from non-sentencesgpoirier2005-05-181-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15504 b3059339-0415-0410-9bf9-f77b7e298cf2
* 8bit palette mode support (and spurious ^M removal)henry2005-05-181-3/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15503 b3059339-0415-0410-9bf9-f77b7e298cf2
* wrong memcpy of extradata; 10l to whomever wrote that broken codenicodvb2005-05-171-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15502 b3059339-0415-0410-9bf9-f77b7e298cf2
* mux extradatanicodvb2005-05-171-0/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15501 b3059339-0415-0410-9bf9-f77b7e298cf2
* Saving streamed contentgpoirier2005-05-171-0/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15500 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync 1.972 + spelling mistakewight2005-05-171-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15499 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove capitalization and period from non-sentenceswight2005-05-171-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15498 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced to 1.60jheryan2005-05-171-0/+597
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15497 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced to 1.2jheryan2005-05-171-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15496 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced to 1.16jheryan2005-05-171-0/+136
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15495 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistency fixesgpoirier2005-05-161-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15494 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes the vobsub extraction examplegpoirier2005-05-161-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15493 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.971gpoirier2005-05-161-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15492 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.971wight2005-05-161-59/+102
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15491 b3059339-0415-0410-9bf9-f77b7e298cf2
* * some more \- in exampleswight2005-05-161-9/+8
| | | | | | | * move parenthesis before period for consistency. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15490 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.970gpoirier2005-05-161-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15489 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix imprecise fps numbers, patch by Corey Hickey <bugfood-ml at fatooh dot org>.diego2005-05-162-17/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15488 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplifies the format matching logic. Chris Roccati <roccati@pobox.com>nplourde2005-05-161-47/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15487 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hopefully this phrasing is now correct English :-)gpoirier2005-05-151-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15486 b3059339-0415-0410-9bf9-f77b7e298cf2
* restore vcd_tracknicodvb2005-05-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15485 b3059339-0415-0410-9bf9-f77b7e298cf2
* set define for apple gcc altivecnplourde2005-05-154-18/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15484 b3059339-0415-0410-9bf9-f77b7e298cf2
* better implementation of read()nicodvb2005-05-151-9/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15483 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.25gabrov2005-05-151-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15482 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.63gabrov2005-05-151-11/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15481 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.75gabrov2005-05-151-1/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15480 b3059339-0415-0410-9bf9-f77b7e298cf2
* ftp is handled by the modular stream managernicodvb2005-05-151-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15479 b3059339-0415-0410-9bf9-f77b7e298cf2
* more efficient read() without memcpy()nicodvb2005-05-151-36/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15478 b3059339-0415-0410-9bf9-f77b7e298cf2
* ported cue:// to the new stream api; note: this stream must still be ↵nicodvb2005-05-154-63/+113
| | | | | | optimized in its read() and seek() functions git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15477 b3059339-0415-0410-9bf9-f77b7e298cf2
* Frapsrtognimp2005-05-141-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15476 b3059339-0415-0410-9bf9-f77b7e298cf2
* FRAPS decoder (FPS1) with binary dllrtognimp2005-05-142-0/+13
| | | | | | | Patch by Gianluigi Tiesi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15475 b3059339-0415-0410-9bf9-f77b7e298cf2
* If we use .m suffix we really should include it in .SUFFIXESwight2005-05-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15474 b3059339-0415-0410-9bf9-f77b7e298cf2
* comment out useless/nonexistent variable breaking compile on gcc4rfelker2005-05-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15473 b3059339-0415-0410-9bf9-f77b7e298cf2
* some more fixes suggested by The Wanderer and Richgpoirier2005-05-141-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15472 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.63paszczi2005-05-141-11/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15471 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.969: Document new file:// syntax.gpoirier2005-05-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15470 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for stereo filesrtognimp2005-05-141-0/+22
| | | | | | | Patch by KAICHO > s_naray at yahoo dot co dot jp <, forwarded by mike git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15469 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nits and corrections suggested by The Wanderergpoirier2005-05-141-30/+43
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15468 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.969: Document new file:// syntax.kraymer2005-05-141-5/+5
| | | | | | | + small fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15467 b3059339-0415-0410-9bf9-f77b7e298cf2
* German man page review part IIIkraymer2005-05-141-75/+90
| | | | | | | added missing option '-loadidx' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15466 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not modify tv_param_noaudiohenry2005-05-141-37/+55
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15465 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document new file:// syntax.diego2005-05-142-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15464 b3059339-0415-0410-9bf9-f77b7e298cf2
* cleanups of the mutex usagehenry2005-05-141-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15463 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed file:// syntax using newly introduced -string- urlpartnicodvb2005-05-141-7/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15462 b3059339-0415-0410-9bf9-f77b7e298cf2
* introduced -string- parameter to match everything after :// syntaxnicodvb2005-05-141-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15461 b3059339-0415-0410-9bf9-f77b7e298cf2
* German man page review part II (finishes "PLAYER-SPEZIFISCHE OPTIONEN")kraymer2005-05-141-52/+58
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15460 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain how to drop movies on desktop shortcuts, other updates.diego2005-05-141-9/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15459 b3059339-0415-0410-9bf9-f77b7e298cf2
* German man page review part Ikraymer2005-05-141-35/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15458 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make FAAC detection follow standard enable/disable/auto semantics.diego2005-05-141-8/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15457 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update with Jindrich's latest change.diego2005-05-141-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15456 b3059339-0415-0410-9bf9-f77b7e298cf2
* v4l2 updatehenry2005-05-141-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15455 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation/link fix with --disable-qtx --disable-dshowdiego2005-05-141-0/+2
| | | | | | | patch by Gianluigi Tiesi <mplayer at netfarm dot it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15454 b3059339-0415-0410-9bf9-f77b7e298cf2
* make file:// prefix worknicodvb2005-05-142-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15453 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l forgotten commenthenry2005-05-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15452 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed unused variablesnicodvb2005-05-141-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15451 b3059339-0415-0410-9bf9-f77b7e298cf2
* improve playback with mplayer -tv immediatemode=0henry2005-05-141-17/+73
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15450 b3059339-0415-0410-9bf9-f77b7e298cf2
* indicate the number of channels required, patch by Chris Roccati ↵nplourde2005-05-141-0/+1
| | | | | | <roccati@pobox.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15449 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.961: vo_quartz and vo_macosx support -ontop as well.kraymer2005-05-131-25/+69
| | | | | | | | | | | | | | | 1.962: vo_ggi now supports ontop. 1.963: sync to x264 rev223 (options: ratetol, vbv_*) + also added: qp_step 1.964: Document -vf pp=ac. 1.965: Document -hr-edl-seek, based on a description by Oded Shimon. 1.966: added some hyphens in quoted examples 1.967: -edl works with MEncoder as well. 1.968: wording fix (skipped) + That key is really called 'Apfel'. happily fixed git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15448 b3059339-0415-0410-9bf9-f77b7e298cf2
* Preparing to encode: Identifying source material and framerate + how to ↵gpoirier2005-05-131-0/+286
| | | | | | encode interlaced content git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15447 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording fix by diego(tm)kraymer2005-05-131-27/+94
| | | | | | | | | | | | | | | | | | | added x264 option subq (necessary to apply patches ;) ) 1.949: Replace duplicate and wrong -sws parameter description with a pointer. 1.950: macosx vo 1.951: On a Mac, option is Alt, the keys with the Apple logo are called command. 1.952: macosx 1.953: expose x264 options 'me' and 'me_range'. 1.954: documented twolameopts 1.955: updated t[wo]olameopts's psycho range 1.956: Add border masking support for lavc 1.957: 10l and more precise description of border_mask 1.958: Nits - better description for border_mask 1.959: vstrict=-1 is now less "dangerous", make it default and remove m/ljpeg encoding colorspace hack 1.960: wording/spelling git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15446 b3059339-0415-0410-9bf9-f77b7e298cf2
* added toolame optskraymer2005-05-131-10/+76
| | | | | | | | | | | | | 1.942: faac options 1.943: faac section review 1.944: better slave mode description, spelling/grammar 1.945: Document replacing , by . for -vo ggi: 1.946: explain how to use toolame in VBR mode 1.947: wording improvents 1.948: af_volnorm method suboption git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15445 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.936: noluma suboption for vf_ppkraymer2005-05-131-5/+40
| | | | | | | | | | | 1.937: af_center, af_sweep parameter, misc fixes 1.938: af_comp, af_center parameter, some af fixes 1.939: Document af_gate, put af_gate and af_comp at the end, they're untested (broken). 1.940: 10l typo 1.941: Correct description for -tv adevice=... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15444 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.968gpoirier2005-05-131-14/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15443 b3059339-0415-0410-9bf9-f77b7e298cf2
* added x264enc options: direct_pred, log, (no)deblock deblock{alpha,beta}, ↵kraymer2005-05-131-8/+93
| | | | | | | | | | | (no)cabac, qp_{min,max} 1.933: misc corrections and clarifications in x264 options. 1.934: remove x264 option "cabacidc", because the default is always best. 1.935: Online audio switching now supports Matroska too git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15442 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable hintinghenry2005-05-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15441 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording fixkraymer2005-05-131-3/+3
| | | | | | | 1.927 missed to remove the old "(default)"-note git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15440 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.924: windows priority support patchkraymer2005-05-131-16/+41
| | | | | | | | | | | | | | 1.925: Added support of audio stream switching in the MPEG demuxer using the #-key 1.926: Online audio switching is for MPEG files only at the moment. 1.927: Better defaults encoding settings for XviD 1.928: changed :vaspect option to float type 1.929: HRTF update 1.930: Use | for alternatives and - for ranges in option parameter descriptions. 1.931: Make the -priority warning obey the standard formatting. 1.932: hrtf typo fix git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15439 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.917: precise framerate values everywherekraymer2005-05-131-14/+38
| | | | | | | | | | | | 1.918: -speed is now available for MEncoder as well. 1.919: nitpicks (skipped) 1.920: -speed and -oac copy may fail together. 1.921: MEncoder now supports multiple files. 1.922: Mark tfields default mode as such. (skipped) 1.923: Fixes and improves the description of vqcomp. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15438 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.907: Update xv and xvmc documentation to reflect recent colorkey changes.kraymer2005-05-131-21/+86
| | | | | | | | | | | | | | | 1.908: Typos (skipped) 1.909: restrictions on muxer's telecine option 1.910: sync to x264 r150: new option 'b_pyramid' 1.911: Typos (skipped) 1.912: documented scale=-n where n <= -9 1.913: Convert vo_aa suboption parser to using the subopt-helper. 1.914: sync to x264 171: chroma_me, chroma_qp_offset 1.915: Small fixes. (skipped) 1.916: Some missing \ before - (skipped) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15437 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix the range and type of -tv immediatemode optionhenry2005-05-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15436 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.900: typo (skipped)kraymer2005-05-131-12/+12
| | | | | | | | | | | | 1.901: added a stream module for the vstream client library (skipped) 1.902: fix outdated/incorrect info about -srate. others (skipped, wasn't outdated) 1.903: stupid mistake i made when writing about divtc.. (skipped) 1.904: Remove -noxv and -forcexv command line options and replace them by suboptions to -vo sdl. 1.905: 10l Don't set SDL to X11 by default. (skipped) 1.906: mention telecine in mpeg muxer section git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15435 b3059339-0415-0410-9bf9-f77b7e298cf2
* -edl works with MEncoder as well.diego2005-05-131-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15434 b3059339-0415-0410-9bf9-f77b7e298cf2
* added some hyphens in quoted exampleskraymer2005-05-131-9/+10
| | | | | | | formatting git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15433 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.894: Move audio filter descriptions to the man page.kraymer2005-05-131-25/+294
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15432 b3059339-0415-0410-9bf9-f77b7e298cf2
* How can I dump a full DVD title to a file?gpoirier2005-05-131-0/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15431 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document -hr-edl-seek, based on a description by Oded Shimon.diego2005-05-131-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15430 b3059339-0415-0410-9bf9-f77b7e298cf2
* multifile leak fixes by Timothy Lee <timothy.lee at siriushk.com> +some more ↵faust32005-05-131-27/+51
| | | | | | -fixed-vo fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15429 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only 2 consecutive bframes are needed for pyramid reorderinggpoirier2005-05-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15428 b3059339-0415-0410-9bf9-f77b7e298cf2
* prevent possible exploitnicodvb2005-05-131-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15427 b3059339-0415-0410-9bf9-f77b7e298cf2
* initialize vorbis structure before calling ERROR()nicodvb2005-05-121-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15426 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixup the correct sh_anicodvb2005-05-121-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15425 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed too few parameters to mp_msg(); silence compilation warnings, removed ↵nicodvb2005-05-121-5/+5
| | | | | | unused variable git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15424 b3059339-0415-0410-9bf9-f77b7e298cf2
* don't call fixup_audio if there's no audionicodvb2005-05-121-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15423 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix segfaults caused by socket and file descriptor mismatches on windowsfaust32005-05-121-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15422 b3059339-0415-0410-9bf9-f77b7e298cf2
* vorbis extradata is now passed from demuxer to decoder in matroska's waynicodvb2005-05-123-68/+145
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15421 b3059339-0415-0410-9bf9-f77b7e298cf2
* BGR formats are ok, toohenry2005-05-121-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15420 b3059339-0415-0410-9bf9-f77b7e298cf2
* v4l2 RGB15/16 is actually BGRhenry2005-05-121-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15419 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.964gpoirier2005-05-121-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15418 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document -vf pp=ac.diego2005-05-111-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15417 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.891: vstrict vs mjpeg update, typokraymer2005-05-111-5/+17
| | | | | | | | | | | | | 1.892: sync to x264 r137: adaptive B-frame decision, flush delayed frames 1.893: missing linebreak (skipped) 1.894: Move audio filter descriptions to the man page. 1.895: changed noreorder to reorder in mpegopts (ordering disabled by default) (skipped) 1.897: both reorder and noreorder flags are now available (skipped) 1.898: Document reorder and noreorder as (no)reorder. (skipped, last three were fixed prviously) 1.899: where the hell they got these infos from (native-endianness) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15416 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.963gpoirier2005-05-111-35/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15415 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 rev223 (options: ratetol, vbv_*)lorenm2005-05-113-38/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15414 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.888: renamed init_adelay to vdelay with opposite rangekraymer2005-05-111-7/+19
| | | | | | | | | 1.889: List the 'context' option for the ffvhuff codec. 1.890: indentation fix + small MPEG-1/2 spelling fix git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15413 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.886: Sync -channels and -srate options with the XML docs.kraymer2005-05-111-23/+30
| | | | | | | 1.887: spelling, wording and consistency fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15412 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.883: fixes for previous commits (checked)kraymer2005-05-111-10/+27
| | | | | | | | 1.884: Mention that vstrict is necessary for some codecs, add ffvhuff. 1.885: Finish incomplete -af-adv documentation. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15411 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.882: Sync to x264 r134: weighted prediction for B-frames.kraymer2005-05-111-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15410 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.962: vo_ggi now supports ontop.kraymer2005-05-111-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15409 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_ggi now supports ontop.diego2005-05-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15408 b3059339-0415-0410-9bf9-f77b7e298cf2
* - make use of libggiwmh if found by configurediego2005-05-111-18/+69
| | | | | | | | | | | * For now use it to set the window title * Implement "Window-On-Top" (experimental) - Improved dirty region handling introduced in rev 1.33. - other minor fixes patch by Christoph Egger <Christoph_Egger at gmx dot de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15407 b3059339-0415-0410-9bf9-f77b7e298cf2
* If libggi has been found, search for the libggiwmh extensiondiego2005-05-111-0/+26
| | | | | | | | w/o relying on it. patch by Christoph Egger <Christoph_Egger at gmx dot de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15406 b3059339-0415-0410-9bf9-f77b7e298cf2
* large update patch by Mirco Macrelli (pigaz@pigaz.org) with some correction ↵nicodvb2005-05-111-948/+948
| | | | | | by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15405 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.881: added new mpeg muxer optionskraymer2005-05-101-0/+84
| | | | | | | (it's not in sync but does only add the lines from this patch) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15404 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.879: man page review part XVIkraymer2005-05-101-23/+26
| | | | | | | + small fix git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15403 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.877: x264: expose option "level_idc".kraymer2005-05-101-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15402 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.896: -format description updated to match current behavior.kraymer2005-05-101-49/+23
| | | | | | | | 1.878: Description of -af format was outdated. (these two fit perfectly together) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15401 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.874: Fix -sstep description.kraymer2005-05-101-5/+8
| | | | | | | | 1.875: mention udp:// streaming 1.876: Corrected/improved usage example for -af pan git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15400 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.872: vf_detc parameter names fixed. (already in prev commit)kraymer2005-05-101-8/+16
| | | | | | | 1.873: better explanation of N-pass encoding git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15399 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.870: man page review page XIVkraymer2005-05-101-121/+187
| | | | | | | 1.871: man page review page XV git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15398 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not define HAVE_ALTIVEC_H on osx with gcc4nplourde2005-05-101-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15397 b3059339-0415-0410-9bf9-f77b7e298cf2
* mcpu & mtune work on gcc4nplourde2005-05-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15396 b3059339-0415-0410-9bf9-f77b7e298cf2
* if define HAVE_ROUND do not define round again. patch by Steven M. Schultz ↵nplourde2005-05-101-0/+3
| | | | | | <sms@2BSD.COM> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15395 b3059339-0415-0410-9bf9-f77b7e298cf2
* look if round function exist in math.h & define HAVE_ROUND. patch by Steven ↵nplourde2005-05-101-0/+16
| | | | | | M. Schultz <sms@2BSD.COM> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15394 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.16, initial translationgabrov2005-05-101-0/+234
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15393 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_quartz and vo_macosx support -ontop as well.diego2005-05-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15392 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording/spellingdiego2005-05-091-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15391 b3059339-0415-0410-9bf9-f77b7e298cf2
* end of the locale nightmare, foreverrfelker2005-05-091-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15390 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.959: border_mask and vstrict=-1 isn't so dangerous after allgpoirier2005-05-091-3/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15389 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.64gabrov2005-05-091-1/+142
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15388 b3059339-0415-0410-9bf9-f77b7e298cf2
* update vstrict descriptionreimar2005-05-092-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15387 b3059339-0415-0410-9bf9-f77b7e298cf2
* vstrict=-1 is now less "dangerous", make it default and remove m/ljpeg ↵reimar2005-05-092-9/+7
| | | | | | encoding colorspace hack git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15386 b3059339-0415-0410-9bf9-f77b7e298cf2
* actually output 2 channel audio (instead of 6 channel with 4 empty channels)reimar2005-05-091-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15385 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.61gabrov2005-05-091-1/+302
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15384 b3059339-0415-0410-9bf9-f77b7e298cf2
* strdup() of a NULL pointer, truckload of cola for mehenry2005-05-091-3/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15383 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nits - better description for border_maskgpoirier2005-05-091-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15382 b3059339-0415-0410-9bf9-f77b7e298cf2
* dcbzl instruction is only for 64-bit implementations. define NO_DCBZL for ↵nplourde2005-05-091-1/+7
| | | | | | ffmpeg. patch by Steven M. Schultz <sms@2BSD.COM> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15381 b3059339-0415-0410-9bf9-f77b7e298cf2
* small updates/fixesdiego2005-05-091-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15380 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow more gcc 3.x and 4.x versions.diego2005-05-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15379 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.58jheryan2005-05-091-4/+651
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15378 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.74jheryan2005-05-091-15/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15377 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.24jheryan2005-05-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15376 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.63jheryan2005-05-091-2/+136
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15375 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.11jheryan2005-05-091-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15374 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.953jheryan2005-05-091-76/+218
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15373 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l and more precise description of border_maskgpoirier2005-05-081-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15372 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes suggested by Diegogpoirier2005-05-082-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15371 b3059339-0415-0410-9bf9-f77b7e298cf2
* lavc's border processing adaptive quantgpoirier2005-05-081-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15370 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add border masking support for lavcgpoirier2005-05-082-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15369 b3059339-0415-0410-9bf9-f77b7e298cf2
* MinGW compilation fix by Erik Lunchpail <erik_27can at yahoo dot com>diego2005-05-082-4/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15368 b3059339-0415-0410-9bf9-f77b7e298cf2
* explains what ARa is and a tries to improve the readability of thegpoirier2005-05-081-0/+4
| | | | | | | paragraph about X and Y resolution git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15367 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.955: updated t[wo]olameopts's psycho rangegpoirier2005-05-081-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15366 b3059339-0415-0410-9bf9-f77b7e298cf2
* ljpeg codec needs YUVJ colorspace, tooreimar2005-05-081-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15365 b3059339-0415-0410-9bf9-f77b7e298cf2
* updated t[wo]olameopts's psycho rangenicodvb2005-05-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15364 b3059339-0415-0410-9bf9-f77b7e298cf2
* updated psycho model range; made a parameter file-static in ae_toolame.cnicodvb2005-05-082-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15363 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.954: documented twolameoptsgpoirier2005-05-071-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15362 b3059339-0415-0410-9bf9-f77b7e298cf2
* documented twolameoptsnicodvb2005-05-071-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15361 b3059339-0415-0410-9bf9-f77b7e298cf2
* added twolame mp2 audio encodernicodvb2005-05-079-1/+294
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15360 b3059339-0415-0410-9bf9-f77b7e298cf2
* Minor fixes by Jeff Clagggpoirier2005-05-071-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15359 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix audio playback for no-sound-3gp.3gp (amr nb)rtognimp2005-05-061-1/+1
| | | | | | | Patch by Richard van der Hoff * richardv * mxtelecom * com * git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15358 b3059339-0415-0410-9bf9-f77b7e298cf2
* Decode "d263" and "damr" atoms in 3gp filesrtognimp2005-05-051-0/+16
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15357 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.953: expose x264 options 'me' and 'me_range'.gpoirier2005-05-051-5/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15356 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention the doc updates about x264 and some nitsgpoirier2005-05-051-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15355 b3059339-0415-0410-9bf9-f77b7e298cf2
* expose x264 options 'me' and 'me_range'.lorenm2005-05-051-4/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15354 b3059339-0415-0410-9bf9-f77b7e298cf2
* expose x264 options 'me' and 'me_range'.lorenm2005-05-052-1/+11
| | | | | | | patch by Guillaume Poirier. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15353 b3059339-0415-0410-9bf9-f77b7e298cf2
* bandaid build fixdiego2005-05-051-0/+143
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15352 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.37: about mixed téléciné and progressivegpoirier2005-05-051-69/+80
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15351 b3059339-0415-0410-9bf9-f77b7e298cf2
* set pix_fmtmichael2005-05-051-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15350 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.36gpoirier2005-05-051-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15349 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not define video_out_macosx if corevideo is not presentnplourde2005-05-052-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15348 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove nonexisting dependency.diego2005-05-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15347 b3059339-0415-0410-9bf9-f77b7e298cf2
* readability cosmeticsdiego2005-05-041-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15346 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for new vssh dll, patch by adlandrtognimp2005-05-043-1/+25
| | | | | | | Use new dll only for new files, it can't decode old files (patch by me) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15345 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l for Andoni Zubimendinauj272005-05-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15344 b3059339-0415-0410-9bf9-f77b7e298cf2
* 5l to me, i didn't notice the extra quotes breaking thingsrfelker2005-05-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15343 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove nonportable and replace with proper quotingrfelker2005-05-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15342 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000000000l for using nonportable, obfuscated, and evenrfelker2005-05-041-2/+2
| | | | | | | | | locale-dependent commands to do the equivalent of the most basic unix text processing command, tr. finally this is fixed in a way that works on all systems with no hacks. *sigh* git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15341 b3059339-0415-0410-9bf9-f77b7e298cf2
* draw resize boxnplourde2005-05-041-1/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15340 b3059339-0415-0410-9bf9-f77b7e298cf2
* force C locale to assure consistent behavior of toupper()henry2005-05-041-2/+2
| | | | | | | Signed off by Ismail Donmez - ismail at kde org tr git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15339 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.952wight2005-05-041-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15338 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix sed for syntax to work on gnu & bsdnplourde2005-05-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15337 b3059339-0415-0410-9bf9-f77b7e298cf2
* Build fix, 1000l to Guillaumewight2005-05-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15336 b3059339-0415-0410-9bf9-f77b7e298cf2
* proper list of libav codecnplourde2005-05-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15335 b3059339-0415-0410-9bf9-f77b7e298cf2
* per (libav)codec enable/disable fixmichael2005-05-031-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15334 b3059339-0415-0410-9bf9-f77b7e298cf2
* macosxnplourde2005-05-022-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15333 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable panscannplourde2005-05-021-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15332 b3059339-0415-0410-9bf9-f77b7e298cf2
* Credits for Jeff Clang's x264 encoding guide and for me.gpoirier2005-05-021-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15331 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removes all English's short forms.gpoirier2005-05-022-104/+104
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15330 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_macosx authornplourde2005-05-022-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15329 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable rootwinnplourde2005-05-022-7/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15328 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264's encoding and install guidegpoirier2005-05-022-0/+443
| | | | | | | Based on Jeff Clagg's "preliminary x264 encoding help text" git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15327 b3059339-0415-0410-9bf9-f77b7e298cf2
* close button exit mplayer with esc keynplourde2005-05-021-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15326 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added charset file for lang es by Andoni Zubimendinauj272005-05-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15325 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with v1.167 by Andoni Zubimendi <andoni@lpsat.net>nauj272005-05-021-9/+186
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15324 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.951wight2005-05-021-20/+96
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15323 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the memleak fix: in case of error, demux_close_ogg should be calledreimar2005-05-021-4/+1
| | | | | | | only once and demuxer->priv be freed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15322 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ontopnplourde2005-05-021-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15321 b3059339-0415-0410-9bf9-f77b7e298cf2
* syntax fixes by Mirco Macrelli <pigaz at pigaz dot org>diego2005-05-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15320 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.74gabrov2005-05-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15319 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.60gabrov2005-05-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15318 b3059339-0415-0410-9bf9-f77b7e298cf2
* codecs-status.html now resides in DOCS/.diego2005-05-012-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15317 b3059339-0415-0410-9bf9-f77b7e298cf2
* codecs-status.html should be written to an existing path.diego2005-05-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15316 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix timestampsmichael2005-05-011-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15315 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nasty workaround for codec initialization data. In _at least_ one case (AAC) ↵mosu2005-05-011-1/+14
| | | | | | the stream_header.size element seems to be four bytes off. Skip those bytes but only for known cases (again AAC) and not for all. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15314 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prevent segfault when filter chain is empty (e.g. because allreimar2005-05-011-0/+5
| | | | | | | filters returned AF_DETACH). Fixes bugzilla bug #293. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15313 b3059339-0415-0410-9bf9-f77b7e298cf2
* Error out when invalid format is specifiedreimar2005-05-011-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15312 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fix (libavcodec sync)rik2005-05-012-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15311 b3059339-0415-0410-9bf9-f77b7e298cf2
* at lest this fixes build.. there's no way muxer_lavf is working right yet ↵rfelker2005-05-011-0/+5
| | | | | | tho with mencoder's broken timestamps git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15310 b3059339-0415-0410-9bf9-f77b7e298cf2
* LIBAVFORMAT_BUILD >= 4624michael2005-05-011-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15309 b3059339-0415-0410-9bf9-f77b7e298cf2
* LIBAVCODEC_BUILD >= 4754michael2005-04-302-0/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15308 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo quartz use command keynplourde2005-04-301-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15307 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fix for codecs2htmldiego2005-04-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15306 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l typodiego2005-04-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15305 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix wrong compilation instructions.diego2005-04-301-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15304 b3059339-0415-0410-9bf9-f77b7e298cf2
* On a Mac, option is Alt, the keys with the Apple logo are called command.diego2005-04-301-5/+5
| | | | | | | Insane amounts of Cola go to Nicolas for mixing this up. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15303 b3059339-0415-0410-9bf9-f77b7e298cf2
* mac osx changenplourde2005-04-301-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15302 b3059339-0415-0410-9bf9-f77b7e298cf2
* macosx vonplourde2005-04-302-9/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15301 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.949: Replace duplicate and wrong -sws parameter description with ↵gpoirier2005-04-301-5/+4
| | | | | | a pointer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15300 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes double import of avs_create_script_environment.gpoirier2005-04-301-1/+0
| | | | | | | Patch by Gianluigi Tiesi < mplayer & netfarm * it > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15299 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert one line of version 1.182 patch (caused use of already-freedrfelker2005-04-291-1/+1
| | | | | | | | | | memory and multiple double-free errors). i am fairly confident that all the relevant memory is now freed once and exactly once, but it's better than corrupting the heap in any case. 100l to reimar :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15298 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.56gabrov2005-04-291-1/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15297 b3059339-0415-0410-9bf9-f77b7e298cf2
* unused definealex2005-04-291-6/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15296 b3059339-0415-0410-9bf9-f77b7e298cf2
* recommended flags on osxnplourde2005-04-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15295 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace duplicate and wrong -sws parameter description with a pointer.diego2005-04-291-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15294 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable vo_macosx if corevideo availablenplourde2005-04-291-8/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15293 b3059339-0415-0410-9bf9-f77b7e298cf2
* macosx core video modulenplourde2005-04-293-2/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15292 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.948: af_volnorm method suboptiongpoirier2005-04-291-3/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15291 b3059339-0415-0410-9bf9-f77b7e298cf2
* macosx core video modulenplourde2005-04-292-0/+715
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15290 b3059339-0415-0410-9bf9-f77b7e298cf2
* use darwin accurate timernplourde2005-04-291-3/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15289 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_volnorm method suboptiondiego2005-04-281-1/+14
| | | | | | | patch by Thierry Reding < thierry at doppeltgemoppelt dot de > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15288 b3059339-0415-0410-9bf9-f77b7e298cf2
* Also '3g2a' can be used for 3GPP Profile 2rtognimp2005-04-281-0/+1
| | | | | | | Based on patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15287 b3059339-0415-0410-9bf9-f77b7e298cf2
* adds a parameter to the switch_audio command to directly select a track.reimar2005-04-287-23/+49
| | | | | | | Patch by kiriuja mplayer-patches at en-directo net git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15286 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.947: explain how to use toolame in VBR mode + Diegos nitsgpoirier2005-04-271-3/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15285 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording improventsdiego2005-04-271-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15284 b3059339-0415-0410-9bf9-f77b7e298cf2
* explain how to use toolame in VBR modenicodvb2005-04-271-2/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15283 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed variability rangenicodvb2005-04-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15282 b3059339-0415-0410-9bf9-f77b7e298cf2
* add mpeg demuxers maintenernicodvb2005-04-271-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15281 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.945: Document replacing , by . for -vo ggi:gpoirier2005-04-271-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15280 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for AAC; moved most of MSGL_V to MSGL_DBG2 to reduce verbositynicodvb2005-04-271-41/+53
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15279 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix palette8tobgr32/palette8torgb32 on big endiannplourde2005-04-271-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15278 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, fix wrong byterate in waveformatnicodvb2005-04-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15277 b3059339-0415-0410-9bf9-f77b7e298cf2
* use sleep_accurate darwin timernplourde2005-04-271-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15276 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo, memset 0 was done on desc instead of cdesc, see bug #288reimar2005-04-271-1/+1
| | | | | | | Patch by Marcus Meissner [ meissner at suse de ] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15275 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document replacing , by . for -vo ggi:reimar2005-04-271-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15274 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make it possible to use a ggi device string that contains a ',' by writingreimar2005-04-271-0/+8
| | | | | | | a '.' instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15273 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the pattern that wasn't repeated every 4 lines.gpoirier2005-04-261-0/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15272 b3059339-0415-0410-9bf9-f77b7e298cf2
* not all Windows version have ABOVE_NORMAL and BELOW_NORMAL priorities...reimar2005-04-261-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15271 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.944: better slave mode description, spelling/grammargpoirier2005-04-261-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15270 b3059339-0415-0410-9bf9-f77b7e298cf2
* better slave mode description, spelling/grammardiego2005-04-261-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15269 b3059339-0415-0410-9bf9-f77b7e298cf2
* (hopefully) better description of slave modediego2005-04-261-6/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15268 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.943: faac optionsgpoirier2005-04-251-3/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15267 b3059339-0415-0410-9bf9-f77b7e298cf2
* toolame now works in vbr mode, toonicodvb2005-04-252-11/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15266 b3059339-0415-0410-9bf9-f77b7e298cf2
* better slave mode descriptiondiego2005-04-251-5/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15265 b3059339-0415-0410-9bf9-f77b7e298cf2
* faac section reviewdiego2005-04-251-13/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15264 b3059339-0415-0410-9bf9-f77b7e298cf2
* faac optionsnicodvb2005-04-251-1/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15263 b3059339-0415-0410-9bf9-f77b7e298cf2
* added format 0x706D for faac, compatible with ffmpegnicodvb2005-04-251-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15262 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention audio encoding modularization and faacnicodvb2005-04-251-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15261 b3059339-0415-0410-9bf9-f77b7e298cf2
* added faac audio encodernicodvb2005-04-258-0/+267
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15260 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed wrong function pointers definitionsnicodvb2005-04-252-9/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15259 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.79gabrov2005-04-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15258 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.24gabrov2005-04-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15257 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.73gabrov2005-04-241-1/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15256 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.55 (initial translation)gabrov2005-04-241-0/+2336
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15255 b3059339-0415-0410-9bf9-f77b7e298cf2
* explains how to fix the aspect ratio of an AVI filegpoirier2005-04-241-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15254 b3059339-0415-0410-9bf9-f77b7e298cf2
* - preserve ordering of the sliceshenry2005-04-241-8/+37
| | | | | | | - make sure that the black buffer is actually allocated to avoid sig11 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15253 b3059339-0415-0410-9bf9-f77b7e298cf2
* wrong framesize calculation for layers 1 and 2 with lsf setnicodvb2005-04-241-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15252 b3059339-0415-0410-9bf9-f77b7e298cf2
* update to libogg 1.1.2 (needed for Theora)henry2005-04-244-44/+610
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15251 b3059339-0415-0410-9bf9-f77b7e298cf2
* check for negative strides before memcpyhenry2005-04-241-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15250 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for both orderings of the slices (top->down / bottom->up)henry2005-04-242-4/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15249 b3059339-0415-0410-9bf9-f77b7e298cf2
* 16-bit unsigned (needed by Theora exp.)henry2005-04-241-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15248 b3059339-0415-0410-9bf9-f77b7e298cf2
* use the documented default video device /dev/video0 instead of /dev/video ↵iive2005-04-231-1/+1
| | | | | | that is missing on most systems git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15247 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make "mplayer -- --a" play the file --a instead of bailing out with a uselessreimar2005-04-232-2/+2
| | | | | | | error message git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15246 b3059339-0415-0410-9bf9-f77b7e298cf2
* restore old lavc_find_atag to be used when compiling mplayer without libavformatnicodvb2005-04-221-0/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15245 b3059339-0415-0410-9bf9-f77b7e298cf2
* Credits for Michael Behrischgpoirier2005-04-221-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15244 b3059339-0415-0410-9bf9-f77b7e298cf2
* gcc 2.95 compilation fixreimar2005-04-221-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15243 b3059339-0415-0410-9bf9-f77b7e298cf2
* Apply -srate and -channels only to the start of the filter chain, notreimar2005-04-221-3/+3
| | | | | | | to both start and end (made downmixing to 2 channels impossible). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15242 b3059339-0415-0410-9bf9-f77b7e298cf2
* macosx compilation fixnicodvb2005-04-225-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15241 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention vrc_eq, vrc_override. remove duplicate warning about 9/7 in lossless.lorenm2005-04-221-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15240 b3059339-0415-0410-9bf9-f77b7e298cf2
* FreeBSD fixnexus2005-04-225-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15239 b3059339-0415-0410-9bf9-f77b7e298cf2
* replace Carbon.h by coreFoundation.h, fix build with x11 enable on mac osx ↵nplourde2005-04-221-1/+1
| | | | | | with --enable-macosx-bundle enable git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15238 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove § (paragraph) symbol, it's unavailable in non-latin charsets.diego2005-04-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15237 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2005-04-221-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15236 b3059339-0415-0410-9bf9-f77b7e298cf2
* audio encoding reworkednicodvb2005-04-2214-747/+948
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15235 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some fixes. Patch by Bougiz.gpoirier2005-04-211-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15234 b3059339-0415-0410-9bf9-f77b7e298cf2
* reversed broken linker option, it breaks compile on some systems. add a ↵rfelker2005-04-211-2/+2
| | | | | | configure check for this nonsense if it's important.. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15233 b3059339-0415-0410-9bf9-f77b7e298cf2
* More fixes by The Wandererrtognimp2005-04-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15232 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.941:gpoirier2005-04-201-8/+6
| | | | | | | Correct description for -tv adevice=... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15231 b3059339-0415-0410-9bf9-f77b7e298cf2
* Start changelog for next releasertognimp2005-04-201-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15230 b3059339-0415-0410-9bf9-f77b7e298cf2
* Indeo2 (fourcc "RT21") decoder via lavcrtognimp2005-04-201-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15229 b3059339-0415-0410-9bf9-f77b7e298cf2
* 'cvs admin -o' is dangerous and should be handled with extra care.diego2005-04-201-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15228 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.167rathann2005-04-201-20/+41
| | | | | | | patch by plazmus at gmail.com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15227 b3059339-0415-0410-9bf9-f77b7e298cf2
* proper fixrfelker2005-04-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15226 b3059339-0415-0410-9bf9-f77b7e298cf2
* undo dominik's 1000l cvs admin -o (recommitting bad patch)rfelker2005-04-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15225 b3059339-0415-0410-9bf9-f77b7e298cf2
* Link with -z noexecstack, fixes bug #258. Please test on all platforms!reimar2005-04-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15224 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correct description for -tv adevice=...reimar2005-04-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15223 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rich's tips regarding cropping and scalinggpoirier2005-04-201-1/+359
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15222 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l build fixesdiego2005-04-201-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15221 b3059339-0415-0410-9bf9-f77b7e298cf2
* Translation synced with 1.52jheryan2005-04-201-0/+1961
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15220 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l to Jindrich! Changing the parameter name in the body, too.rathann2005-04-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15219 b3059339-0415-0410-9bf9-f77b7e298cf2
* integer overflow when reading fps from h264 vui.lorenm2005-04-192-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15218 b3059339-0415-0410-9bf9-f77b7e298cf2
* typowight2005-04-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15217 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix MP3 detection (list of found MP3 headers was not kep sorted).reimar2005-04-181-2/+3
| | | | | | | Also remove code that only fixed the symptoms. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15216 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention the generic ratecontrol options (lmin,lmax,vqcomp,vratetol)lorenm2005-04-181-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15215 b3059339-0415-0410-9bf9-f77b7e298cf2
* check the result of poll() before read()ing; 100lnicodvb2005-04-181-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15214 b3059339-0415-0410-9bf9-f77b7e298cf2
* replace VO and VF numeric flags with #defined identifiershenry2005-04-1845-113/+117
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15213 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compile fix when XF86VM is not definediive2005-04-181-0/+2
| | | | | | | patch by Ismail Donmez <ismail at kde org tr> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15212 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some fixeswight2005-04-181-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15211 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not force real demuxer on x-pn-realaudio mimetypertognimp2005-04-171-1/+1
| | | | | | | | | Real and realaudio share the same mimetype, forcing real demuxer prevent realaudio files from being played. Fixes http://www.bbc.co.uk/romanian/rom.ra git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15210 b3059339-0415-0410-9bf9-f77b7e298cf2
* synpaszczi2005-04-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15209 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes suggested by The Wandererrtognimp2005-04-171-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15208 b3059339-0415-0410-9bf9-f77b7e298cf2
* Snow supports 3-pass mode and 9/7 wavelet doesn't work lossless mode.gpoirier2005-04-171-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15207 b3059339-0415-0410-9bf9-f77b7e298cf2
* nico partially fixed the bug i reported; here's the rest of the fix.rfelker2005-04-171-0/+1
| | | | | | | | | | | | basically demux_audio was mixing data in its header buffer in a bogus manner, whereby it could sometimes "make up" valid mpeg headers where no such header actually occurred in the file. it should be correct now. btw these changes also fix the bug where mplayer reports huge initial cpu usage for sound when playing mp3 files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15206 b3059339-0415-0410-9bf9-f77b7e298cf2
* skip framelen-4 bytes after having successfully detected an mpeg audio framenicodvb2005-04-171-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15205 b3059339-0415-0410-9bf9-f77b7e298cf2
* First attempt to bring this howto closer to realityrtognimp2005-04-171-2/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15204 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.940: 10l typogpoirier2005-04-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15203 b3059339-0415-0410-9bf9-f77b7e298cf2
* newer versions of mingws gcc do not like terminating slahes when specifying ↵faust32005-04-171-1/+1
| | | | | | extra include paths git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15202 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l typodiego2005-04-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15201 b3059339-0415-0410-9bf9-f77b7e298cf2
* assign correct tag, dwScale and dwBlockAlign to mpeg audio; optionally ↵nicodvb2005-04-173-12/+25
| | | | | | assign layer and samples_per_frame when parsing mpa header git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15200 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing initializer in URLProtocolo; mux packets only if len > 0; ↵nicodvb2005-04-171-12/+14
| | | | | | second mencoder's a/v sync model git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15199 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix suggested by Diegogpoirier2005-04-161-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15198 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for snow decoderrtognimp2005-04-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15197 b3059339-0415-0410-9bf9-f77b7e298cf2
* GPL §2diego2005-04-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15196 b3059339-0415-0410-9bf9-f77b7e298cf2
* FreeBSD compilation fix by Bohdan Horst <nexus at hoth dot amu dot edu dot pl>diego2005-04-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15195 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.24paszczi2005-04-161-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15194 b3059339-0415-0410-9bf9-f77b7e298cf2
* more colorkey w/ panscan woeshenry2005-04-161-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15193 b3059339-0415-0410-9bf9-f77b7e298cf2
* change list traversal so the loop begins at the first filter after removinghenry2005-04-161-13/+12
| | | | | | | one, instead at the second git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15192 b3059339-0415-0410-9bf9-f77b7e298cf2
* redraw colorkey on panscan changehenry2005-04-161-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15191 b3059339-0415-0410-9bf9-f77b7e298cf2
* Snow 1.55 (and up) allows 2pass ratecontrol.gpoirier2005-04-161-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15190 b3059339-0415-0410-9bf9-f77b7e298cf2
* bump up sync taggpoirier2005-04-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15189 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.939.gpoirier2005-04-161-9/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15188 b3059339-0415-0410-9bf9-f77b7e298cf2
* - fix black screen problem on reinital2005-04-162-2/+9
| | | | | | | - disable colorkey autopainting when painting it manually git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15187 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.939paszczi2005-04-161-5/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15186 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document af_gate, put af_gate and af_comp at the end, they're untested (broken).diego2005-04-161-7/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15185 b3059339-0415-0410-9bf9-f77b7e298cf2
* All audio filters documented.diego2005-04-161-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15184 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_comp, af_center parameter, some af fixesdiego2005-04-161-5/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15183 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use define instead of hardcodec value for max streams numberrtognimp2005-04-161-2/+3
| | | | | | | Pathc by Dominik 'Rathann' Mierzejewski git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15182 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_center, af_sweep parameter, misc fixesdiego2005-04-161-3/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15181 b3059339-0415-0410-9bf9-f77b7e298cf2
* We are using parts of mpg123 outside of the LGPL mpglib subdir.diego2005-04-161-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15180 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark modified imported files as such to comply more closely with GPL §2a.diego2005-04-166-1/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15179 b3059339-0415-0410-9bf9-f77b7e298cf2
* noluma suboption for vf_ppdiego2005-04-161-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15178 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify/correct TTF font usage description.diego2005-04-161-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15177 b3059339-0415-0410-9bf9-f77b7e298cf2
* Security updatertognimp2005-04-151-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15176 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/wording fixesdiego2005-04-151-10/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15175 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix potential buffer overflow for urls with more than 20 streamsrtognimp2005-04-151-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15174 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix potential buffer overflow if server answers with too many linesrtognimp2005-04-151-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15173 b3059339-0415-0410-9bf9-f77b7e298cf2
* releaseclean should now work as expected, crate of Coke going in my direction.diego2005-04-151-3/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15172 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-04-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15171 b3059339-0415-0410-9bf9-f77b7e298cf2
* nits and more missing entriesrathann2005-04-151-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15170 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing ChangeLog entries, release name and daterathann2005-04-151-3/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15169 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark modified imported files as such to comply with (L)GPL §2a.diego2005-04-1513-0/+74
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15168 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark modified imported files as such to comply with GPL §2a.diego2005-04-1529-0/+164
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15167 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark unrarlib imported files as changed to comply with GPL §2a.diego2005-04-152-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15166 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark imported files from uCIFS library as changed for GPL §2a compliance.diego2005-04-152-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15165 b3059339-0415-0410-9bf9-f77b7e298cf2
* cross-compilation fix: don't use target CFLAGS to compile host toolsaurel2005-04-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15164 b3059339-0415-0410-9bf9-f77b7e298cf2
* when parsing one cmd argument, only un-escape _this_ argument, not the ↵aurel2005-04-151-1/+1
| | | | | | following ones git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15163 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix OSD when switching subtitles - set the osd buffer to Subtitle: offhenry2005-04-151-15/+15
| | | | | | | | | first, and then eventually set it to other values if some kind of subtitles is on. Otherwise 1) spudec stuff stomps on the buffer after vobsub, 2) Subtitle: off isn't displayed when cycling text subtitles. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15162 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some fixups and clarificationswight2005-04-151-12/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15161 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.935paszczi2005-04-141-36/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15160 b3059339-0415-0410-9bf9-f77b7e298cf2
* --Patch by Stefan '1stein' Schuermans <1stein@schuermans.info>:rik2005-04-141-6/+12
| | | | | | | | bugfix of the "grayscale" output scheme; the height and width of the movie were written als -1 and -1 into the resulting *.bml file git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15159 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nits suggested by The Wanderergpoirier2005-04-141-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15158 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.935danny2005-04-141-34/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15157 b3059339-0415-0410-9bf9-f77b7e298cf2
* Online audio switching now supports Matroska toogpoirier2005-04-133-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15156 b3059339-0415-0410-9bf9-f77b7e298cf2
* Online audio switching now supports Matroska too. Patch by Michael Behrischgpoirier2005-04-131-0/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15155 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nits, better formating and missed suggestionsgpoirier2005-04-131-9/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15154 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.934gpoirier2005-04-131-41/+27
| | | | | | | | 1.934: remove x264 option "cabacidc", because the default is always best. 1.933: misc corrections and clarifications in x264 options. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15153 b3059339-0415-0410-9bf9-f77b7e298cf2
* messed ordering of switch branches, 10l for Ivanhenry2005-04-131-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15152 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make string_utf16 code behave almost the same with or without iconvrtognimp2005-04-131-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15151 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove x264 option "cabacidc", because the default is always best.lorenm2005-04-132-20/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15150 b3059339-0415-0410-9bf9-f77b7e298cf2
* New section: "menc-feat-dvd-mpeg4-muxing" about how to mux a videogpoirier2005-04-131-0/+136
| | | | | | | | | obtained with MEncoder into different containers. Based on Rich's guide and some tips by Nico Sabi. Reviewed by The Wanderer, Dominik 'Rathann' Mierzejewski and Diego Biurrun git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15149 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc corrections and clarifications in x264 options.lorenm2005-04-131-17/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15148 b3059339-0415-0410-9bf9-f77b7e298cf2
* osx bundle optionnplourde2005-04-131-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15147 b3059339-0415-0410-9bf9-f77b7e298cf2
* allows the Mac OS X version of MPlayer to look for its data files inside the ↵nplourde2005-04-132-0/+63
| | | | | | Resources directory of the appwrapper. patch by Chris Roccati <roccati@pobox.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15146 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.62wight2005-04-131-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15145 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.72wight2005-04-131-1/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15144 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.932wight2005-04-131-11/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15143 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.932danny2005-04-131-441/+1166
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15142 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Jeff Claggdiego2005-04-131-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15141 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing <replaceable> tags.gpoirier2005-04-121-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15140 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.72gabrov2005-04-121-20/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15139 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.62gabrov2005-04-121-6/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15138 b3059339-0415-0410-9bf9-f77b7e298cf2
* update site link and supported distributions listrathann2005-04-121-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15137 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo fixgpoirier2005-04-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15136 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Luca Barbatodiego2005-04-121-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15135 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use wildcards to make path detection less version-specific, fixes Gentoo.diego2005-04-121-4/+2
| | | | | | | patch by Luca Barbato (lu_zero at gentoo dot org) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15134 b3059339-0415-0410-9bf9-f77b7e298cf2
* Break overly long lines into something more manageable.diego2005-04-111-7/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15133 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix HTML generation, <equation> is more elaborate in most DTDs.diego2005-04-111-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15132 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typogpoirier2005-04-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15131 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo noticed by Richgpoirier2005-04-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15130 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow sub_select and vobsub_lang to select particular subtitlehenry2005-04-113-7/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15129 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.932gpoirier2005-04-111-12/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15128 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support syntax checking onlywight2005-04-112-3/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15127 b3059339-0415-0410-9bf9-f77b7e298cf2
* hrtf typo fixhenry2005-04-111-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15126 b3059339-0415-0410-9bf9-f77b7e298cf2
* More HRTF enhancementshenry2005-04-112-21/+56
| | | | | | | | | | | | | | | | | | | | | - a passive locking mechanism to enable the matrix to switch between active and passive mode, which enhances the stereo image. - a center front cancellation algorithm that damps the cross-talk if the sound is coming predominantly from center (e.g. if there is dialogue). These two new features should enhance the quality of surround downmix noticeably. Also a correction to the active gain control is included. The previous implementation of Lt + Rt/Lt - Rt AGC should be fine in most cases, but the calculation was inconsistent (gain unitarity is not guaranteed to be preserved). Signed off by Yue Shi Lai <ylai@users.sourceforge.net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15125 b3059339-0415-0410-9bf9-f77b7e298cf2
* colorkey,xvmc panscan, obsolete audioiive2005-04-111-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15124 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes suggested by The Wanderer.gpoirier2005-04-111-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15123 b3059339-0415-0410-9bf9-f77b7e298cf2
* VMndiego2005-04-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15122 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a starting point for people to implement stream quality selection.diego2005-04-111-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15121 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the -priority warning obey the standard formatting.diego2005-04-111-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15120 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use | for alternatives and - for ranges in option parameter descriptions.diego2005-04-111-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15119 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initial commit.gpoirier2005-04-101-0/+58
| | | | | | | Encoding tips about experimental codec snow. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15118 b3059339-0415-0410-9bf9-f77b7e298cf2
* -pre7 features an improved guide based on Rich's draft, and a guide writtengpoirier2005-04-101-0/+1
| | | | | | | by Olivier Lorillu and Éric Fernandez. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15117 b3059339-0415-0410-9bf9-f77b7e298cf2
* better wording, suggested by Diegogpoirier2005-04-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15116 b3059339-0415-0410-9bf9-f77b7e298cf2
* New section "Constraints for efficient encoding",gpoirier2005-04-101-0/+119
| | | | | | | extracted from D Richard Felker III's "Encoding guide draft". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15115 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removes the section "menc-feat-fix-avi" as part of it was wrong and the othergpoirier2005-04-101-53/+24
| | | | | | | | belonged to the faq. Does a bit of reformating and spellings fixes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15114 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move here the entry "How can I fix an AVIs with broken index or interleaving?"gpoirier2005-04-101-0/+16
| | | | | | | that was previously on mencoder.xml git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15113 b3059339-0415-0410-9bf9-f77b7e298cf2
* silence gcc warning:rathann2005-04-101-2/+2
| | | | | | | | | pullup.c:681: warning: suggest parentheses around + or - inside shift pullup.c:682: warning: suggest parentheses around + or - inside shift approved by Rich git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15112 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.929wight2005-04-101-2/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15111 b3059339-0415-0410-9bf9-f77b7e298cf2
* override memory size detection bug on rage 128 RL/VRaurel2005-04-101-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15110 b3059339-0415-0410-9bf9-f77b7e298cf2
* add support for one more radeon 9200 model (the one included in the Mac Mini)aurel2005-04-102-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15109 b3059339-0415-0410-9bf9-f77b7e298cf2
* HRTF updatehenry2005-04-101-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15108 b3059339-0415-0410-9bf9-f77b7e298cf2
* update for hrtf and mp3lib layer1henry2005-04-101-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15107 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.69wight2005-04-101-137/+83
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15106 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support WMware video (fourcc VMnc) via binary dllrtognimp2005-04-101-0/+8
| | | | | | | Patch by Tomas Simonaitis || haden |at| homelan |dot| lt || git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15105 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use proper parameter range in stereo testhenry2005-04-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15104 b3059339-0415-0410-9bf9-f77b7e298cf2
* incorporate all image drawing in single function and use fixed ↵iive2005-04-101-12/+16
| | | | | | | | | vo_xv_draw_colorkey() for proper key drawing. This time panscan should be really bugfree (blackbars used to stay) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15103 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add releaseclean target to remove generated files but keep the HTML.diego2005-04-101-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15102 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix vo_xv_draw_colorkey to a workable stateiive2005-04-102-12/+13
| | | | | | | (using panscan makes x,y negative, so it is very bad idea they to be unsigned) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15101 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix displaying of the subtitles when using sliceshenry2005-04-101-3/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15100 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.12wight2005-04-101-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15099 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.79wight2005-04-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15098 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.61wight2005-04-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15097 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.21wight2005-04-101-1/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15096 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.11wight2005-04-101-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15095 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.167wight2005-04-101-4/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15094 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove some ^M at end-of-linewight2005-04-100-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15093 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove invalid character, causing compile to failwight2005-04-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15092 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistency run on 'default' and 'see also'.wight2005-04-101-119/+119
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15091 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.928wight2005-04-101-7/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15090 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.928: Changed :vaspect option to float typegpoirier2005-04-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15089 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reviev, part Iwight2005-04-103-16/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15088 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert the previous commit, gl needs to reload the font immediatelyhenry2005-04-101-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15087 b3059339-0415-0410-9bf9-f77b7e298cf2
* defer loading of the font after display size change to avoid uselesshenry2005-04-101-4/+26
| | | | | | | | reloading - hack, but needed because for most of the vo's the panscan information and screen size are updated asynchronously git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15086 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed :vaspect option to float typenicodvb2005-04-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15085 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed :vaspect option to CONF_TYPE_FLOATnicodvb2005-04-101-8/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15084 b3059339-0415-0410-9bf9-f77b7e298cf2
* HRTF filter updates:henry2005-04-102-76/+316
| | | | | | | | | | | | | | | | - Bass compensation gain corrected (which was set too low), now the sound should be even more transparent - A (unified) dual axes active matrix decoder with adaptive steering - capable of decoding matrix surround encoded inputs, with stereo rear - capable of decoding matrix encoded rear center - Purely stereo mixing without unneccessary rear filter calculations - The decoding structure message is moved, because at the old place it gave incorrect messages. Patch by Yue Shi Lai <ylai@users.sourceforge.net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15083 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for pnmrtognimp2005-04-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15082 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove force_load_font stuff moved to sub.chenry2005-04-091-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15081 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove force_load_font stuff moved to sub.chenry2005-04-091-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15080 b3059339-0415-0410-9bf9-f77b7e298cf2
* reload font on each change of the display sizehenry2005-04-091-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15079 b3059339-0415-0410-9bf9-f77b7e298cf2
* "Fix" for pnm EOF detection (stop on read errors)rtognimp2005-04-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15078 b3059339-0415-0410-9bf9-f77b7e298cf2
* Stop streaming if we got a server error or message on pnm streaming.rtognimp2005-04-091-4/+8
| | | | | | | | This is needed to stop playback for pnm streams where mplayer can't authenticate, and avoid an endless list of "input pnm: read error". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15077 b3059339-0415-0410-9bf9-f77b7e298cf2
* set width, height and biCompression when the video stream contains avc1; ↵nicodvb2005-04-091-13/+65
| | | | | | reuse a private member rather than a in-stack packet[204]; set pes_es->is_synced =1 when au_start=1 (SL); update PMT when setting mp4es codec (SL); fix tss->is_synced assignment (don't forget the value when it was previously set) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15076 b3059339-0415-0410-9bf9-f77b7e298cf2
* reload font on fullscreen change when panscan is enabledhenry2005-04-091-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15075 b3059339-0415-0410-9bf9-f77b7e298cf2
* assign picture->(width,height) when parsing h264nicodvb2005-04-091-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15074 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove flip form LOCOrtognimp2005-04-081-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15073 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better defaults encoding settings for XviD, intended to be a good tradeoff ↵gpoirier2005-04-082-11/+14
| | | | | | CPU/PSNR. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15072 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better defaults encoding settings for XviD, intended to be a good tradeoff ↵gpoirier2005-04-081-4/+4
| | | | | | CPU/PSNR. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15071 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for negative strides (fixes -vf spp,flip crash)henry2005-04-081-2/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15070 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove nonsense code left from copy&paste from another filter (it was never ↵rfelker2005-04-081-5/+0
| | | | | | used) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15069 b3059339-0415-0410-9bf9-f77b7e298cf2
* obvious gcc warning fix, approved by Nicorathann2005-04-081-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15068 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.11gabrov2005-04-071-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15067 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for AASC and LOCOrtognimp2005-04-071-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15066 b3059339-0415-0410-9bf9-f77b7e298cf2
* LOCO support via lavcrtognimp2005-04-072-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15065 b3059339-0415-0410-9bf9-f77b7e298cf2
* Spelling corrections part II. Patch by Bougiz (getting ready for -pre7 ;-) )gpoirier2005-04-0713-84/+89
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15064 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux ac3 by means of lavf by defaultnicodvb2005-04-071-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15063 b3059339-0415-0410-9bf9-f77b7e298cf2
* demux ac3 by means of lavf by defaultnicodvb2005-04-071-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15062 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix blackscreen when changing panscan.iive2005-04-071-18/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15061 b3059339-0415-0410-9bf9-f77b7e298cf2
* Autodesk RLE decoder via lavcrtognimp2005-04-061-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15060 b3059339-0415-0410-9bf9-f77b7e298cf2
* - fix gcc warnings, strlcat/strlcpy prototypesrathann2005-04-065-9/+15
| | | | | | | - fix bad sscanf usage in geometry.c git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15059 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix http://bugzilla.mplayerhq.hu/show_bug.cgi?id=260rathann2005-04-061-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15058 b3059339-0415-0410-9bf9-f77b7e298cf2
* Errors that cause MEncoder to exit should be MSGL_FATAL, not MSGL_ERR.diego2005-04-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15057 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change all MSGT_FIXME, MSGL_FIXME to appropiate values.diego2005-04-061-38/+38
| | | | | | | patch by Oded Shimon < ods15 at ods15 dot dyndns dot org > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15056 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, integer overflow. who uses 14 fractional bits?! only faad ↵rfelker2005-04-051-2/+2
| | | | | | developers.... *sigh* git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15055 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, messed up coefficients when improving precision..rfelker2005-04-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15054 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better spelling of charsetwight2005-04-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15053 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another 10l for autror (whoever he was)wight2005-04-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15052 b3059339-0415-0410-9bf9-f77b7e298cf2
* Minor fixeswight2005-04-041-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15051 b3059339-0415-0410-9bf9-f77b7e298cf2
* Online audio switching is for MPEG files only at the moment.gpoirier2005-04-032-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15050 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.925:gpoirier2005-04-031-2/+18
| | | | | | | | | | 1.924: windows priority support patch by Rune Petersen <runner at mail.tele.dk> with the freedom to shoot yourself in the foot 1.925: Added support of audio stream switching in the MPEG demuxer using the #-key git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15049 b3059339-0415-0410-9bf9-f77b7e298cf2
* The online switching patch also features a slave command: switch_audiogpoirier2005-04-031-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15048 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added support of audio stream switching in the MPEG demuxer using the #-keygpoirier2005-04-038-37/+63
| | | | | | | | Patch by Michael Behrisch < behrisch $ informatik * hu-berlin * de > commited with the kind blessing of D. Richard Felker III git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15047 b3059339-0415-0410-9bf9-f77b7e298cf2
* allocate and fill extradata field for video_avc (raw nal units, extradata ↵nicodvb2005-04-031-52/+149
| | | | | | contains sps+pps); fixed payload_size assignment for SL payloads git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15046 b3059339-0415-0410-9bf9-f77b7e298cf2
* Translation reviewwight2005-04-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15045 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l for missing #ifdef in previous commitwight2005-04-021-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15044 b3059339-0415-0410-9bf9-f77b7e298cf2
* windows priority support patch by Rune Petersen <runner at mail.tele.dk> ↵faust32005-04-024-0/+65
| | | | | | with the freedom to shoot yourself in the foot git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15043 b3059339-0415-0410-9bf9-f77b7e298cf2
* better description for mpeg audio demuxer entrynicodvb2005-04-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15042 b3059339-0415-0410-9bf9-f77b7e298cf2
* mpeg audio layers 1 and 2nicodvb2005-04-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15041 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for mpa layers 1 and 2nicodvb2005-04-021-4/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15040 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar fix by the Wandererdiego2005-04-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15039 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l! mplayer's verbose variable is not a flag but a signed numberrfelker2005-04-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15038 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.923wight2005-04-011-4/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15037 b3059339-0415-0410-9bf9-f77b7e298cf2
* filename-based detection for h264 ESlorenm2005-04-011-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15036 b3059339-0415-0410-9bf9-f77b7e298cf2
* misc fixesdiego2005-03-311-20/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15035 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar/spellingdiego2005-03-311-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15034 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2005-03-311-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15033 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes better wording. Suggestions by The Wanderer and Josh Varner.gpoirier2005-03-311-11/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15032 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-03-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15031 b3059339-0415-0410-9bf9-f77b7e298cf2
* correct spelling for mailing list namesdiego2005-03-315-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15030 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling + updatesdiego2005-03-311-4/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15029 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rephrase codecs.conf entry to warn more clearly against using it.diego2005-03-311-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15028 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix memset() usage, patch by Ismail Donmezrathann2005-03-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15027 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.67jheryan2005-03-311-16/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15026 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.923jheryan2005-03-311-8/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15025 b3059339-0415-0410-9bf9-f77b7e298cf2
* mplayer changes notice (take 2, 10l to diego :)rfelker2005-03-311-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15024 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix alac from QTpro (in standard mov file, not in m4a file)rtognimp2005-03-301-0/+11
| | | | | | | | Extradata is in a different place fixes samples/A-codecs/lossless/ALAC/alac.mov git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15023 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support wnv1 natively via lavcrtognimp2005-03-301-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15022 b3059339-0415-0410-9bf9-f77b7e298cf2
* usable downmixing for fixed point mode (take 2, previous patch reversed ↵rfelker2005-03-291-1/+48
| | | | | | immediately on account of 1000l error :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15021 b3059339-0415-0410-9bf9-f77b7e298cf2
* step 1 of fixing ad_faad:rfelker2005-03-291-1/+10
| | | | | | | | | | | | | use internal downmixing just like liba52 does if the output is <= 2 channels actually this is broken since it makes it impossible to manually use af_pan; however liba52 already has that limitation, and without this patch, aac audio comes out TOTALLY wrong on 2-channel systems. hopefully someone will find a better solution later. next up: making ad_faad reorder the channels according to what mplayer expects, so they won't all come out the wrong speakers... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15020 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.923:gpoirier2005-03-281-5/+14
| | | | | | | | 1.923: Fixes and improves the description of vqcomp. 1.922: Mark tfields default mode as such. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15019 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes and improves the description of vqcomp.gpoirier2005-03-281-2/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15018 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark tfields default mode as such.diego2005-03-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15017 b3059339-0415-0410-9bf9-f77b7e298cf2
* Technical explanation of how to use vqcomp, and why, featured by Loren Merrittgpoirier2005-03-281-0/+76
| | | | | | | on the ML: http://mplayerhq.hu/pipermail/mplayer-cvslog/2005-March/021202.html git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15016 b3059339-0415-0410-9bf9-f77b7e298cf2
* Spelling corrections. Patch by Bougizgpoirier2005-03-2618-79/+79
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15015 b3059339-0415-0410-9bf9-f77b7e298cf2
* sane default moderfelker2005-03-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15014 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l, last commit broke qpel interp entirelyrfelker2005-03-261-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15013 b3059339-0415-0410-9bf9-f77b7e298cf2
* various (de)muxer_lavf fixesmichael2005-03-252-4/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15012 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improved encoding guide:gpoirier2005-03-251-22/+280
| | | | | | | | | | | | - explains how to do a smart resize - calculate a bitrate to target a certain size - rip audio and transcode in Ogg/Vorbis - a lot of libavcodec's options to come: muxing in matroska files... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15011 b3059339-0415-0410-9bf9-f77b7e298cf2
* endianness fix by Chris White <chriswhite at gentoo dot org>diego2005-03-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15010 b3059339-0415-0410-9bf9-f77b7e298cf2
* less amateurish-looking mpcf.txt patch by (Jeff >snacky ikaruga co uk<)michael2005-03-251-47/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15009 b3059339-0415-0410-9bf9-f77b7e298cf2
* set i_bpsmichael2005-03-251-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15008 b3059339-0415-0410-9bf9-f77b7e298cf2
* plastik skindiego2005-03-251-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15007 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l (dwSampleSize != nSamplesPerSec)michael2005-03-251-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15006 b3059339-0415-0410-9bf9-f77b7e298cf2
* discard streams we dont needmichael2005-03-251-4/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15005 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.24jheryan2005-03-241-8/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15004 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.13jheryan2005-03-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15003 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.65jheryan2005-03-241-13/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15002 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.23jheryan2005-03-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15001 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.59jheryan2005-03-241-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@15000 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.921jheryan2005-03-241-50/+121
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14999 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.167jheryan2005-03-241-33/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14998 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l to oded.. edl was causing the decoder to get a first broken packetrfelker2005-03-231-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14997 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the codecs.conf entry.gpoirier2005-03-231-32/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14996 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix shared libpostproc installation.diego2005-03-232-0/+5
| | | | | | | based on a patch by Rene Rebe <rene at exactcode dot de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14995 b3059339-0415-0410-9bf9-f77b7e298cf2
* wrong binary operatornicodvb2005-03-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14994 b3059339-0415-0410-9bf9-f77b7e298cf2
* consider parse random_access_point from the adaption_field to determine if ↵nicodvb2005-03-231-28/+25
| | | | | | the payload is an access point (for SL) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14993 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark modified files as such to comply more closely with GPL §2a.diego2005-03-229-0/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14992 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPlayer-specific changes to liba52diego2005-03-221-0/+3023
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14991 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove the MPlayer-specific copyright notices. The diff would not applydiego2005-03-221-95/+0
| | | | | | | | cleanly anyway due to $Id$ expansion shenanigans that are a royal PITA to circumvent. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14990 b3059339-0415-0410-9bf9-f77b7e298cf2
* New FAQ entry: Newer MPlayer can't play Vorbis file with an old codecs.confgpoirier2005-03-221-0/+19
| | | | | | | lying around because the FourCC for Vobis has been changed recently. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14989 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.13gabrov2005-03-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14988 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.65gabrov2005-03-221-14/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14987 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.78gabrov2005-03-221-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14986 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.23gabrov2005-03-221-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14985 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.167gabrov2005-03-221-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14984 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes rgb32to16 conversion for I think all platforms since the int8diego2005-03-221-4/+2
| | | | | | | | | cast should never have worked. Tested on PowerPC and fixes the black GUI to show the content. patch by Rene Rebe <rene at exactcode dot de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14983 b3059339-0415-0410-9bf9-f77b7e298cf2
* SL payloads are pushed to audio and video fifo only when they are flagged ↵nicodvb2005-03-221-7/+27
| | | | | | with random_accesspoint or access_unit_start git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14982 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync 1.13wight2005-03-211-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14981 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative sync with 1.921gpoirier2005-03-211-19/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14980 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pp=tn from the filter chain, it's bad.diego2005-03-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14979 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for ods15, updatesdiego2005-03-211-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14978 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync 1.921wight2005-03-211-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14977 b3059339-0415-0410-9bf9-f77b7e298cf2
* MEncoder now supports multiple files.diego2005-03-212-12/+21
| | | | | | | patch by Oded Shimon <ods15 at ods15 dot dyndns dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14976 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync 1.920 and some random fixeswight2005-03-201-15/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14975 b3059339-0415-0410-9bf9-f77b7e298cf2
* don't buffer more future context that we needrfelker2005-03-202-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14974 b3059339-0415-0410-9bf9-f77b7e298cf2
* alac and othersrtognimp2005-03-201-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14973 b3059339-0415-0410-9bf9-f77b7e298cf2
* new mencoder featuresrfelker2005-03-201-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14972 b3059339-0415-0410-9bf9-f77b7e298cf2
* direct rendering support drastically improves speed, but it's buggy. :( ↵rfelker2005-03-201-1/+1
| | | | | | disabled for now... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14971 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, meaning of strict_breaks was backwards...rfelker2005-03-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14970 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial support for SL packetized data, with certain limitations; partly ↵nicodvb2005-03-201-177/+829
| | | | | | reworked the tables management for a better code reuse git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14969 b3059339-0415-0410-9bf9-f77b7e298cf2
* export getbits() as mp_getbits()nicodvb2005-03-201-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14968 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync 1.78wight2005-03-201-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14967 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync 1.23wight2005-03-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14966 b3059339-0415-0410-9bf9-f77b7e298cf2
* EDL for mencoder, patch by Oded (ods15)rfelker2005-03-194-3/+160
| | | | | | | Committed with a few minor fixes. Needs documentation still. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14965 b3059339-0415-0410-9bf9-f77b7e298cf2
* -speed and -oac copy may fail together.diego2005-03-191-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14964 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replace placeholder message with something sane.diego2005-03-191-1/+2
| | | | | | | 1l to Rich for overlooking this. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14963 b3059339-0415-0410-9bf9-f77b7e298cf2
* nitpicksdiego2005-03-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14962 b3059339-0415-0410-9bf9-f77b7e298cf2
* -speed is now available for MEncoder as well.diego2005-03-191-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14961 b3059339-0415-0410-9bf9-f77b7e298cf2
* wordingdiego2005-03-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14960 b3059339-0415-0410-9bf9-f77b7e298cf2
* precise framerate values everywherediego2005-03-195-68/+103
| | | | | | | patch by Corey Hickey <bugfood-ml at fatooh dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14959 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync 1.916wight2005-03-191-123/+176
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14958 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some missing \ before -wight2005-03-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14957 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing declaration, fixes:rathann2005-03-181-0/+1
| | | | | | | muxer.c:36: warning: implicit declaration of function `muxer_init_muxer_lavf' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14956 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l to me: could break a/v sync and eventually cause buffer exhaustion on ↵rfelker2005-03-171-1/+8
| | | | | | soft-telecined input that's ugly git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14955 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.915: small fixesgpoirier2005-03-161-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14954 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small fixes.jonas2005-03-161-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14953 b3059339-0415-0410-9bf9-f77b7e298cf2
* improve handling of soft-telecined input (faster, fewer mistakes)rfelker2005-03-161-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14952 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.869: pp filter documentationkraymer2005-03-151-10/+104
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14951 b3059339-0415-0410-9bf9-f77b7e298cf2
* completed x264enc options.kraymer2005-03-151-3/+39
| | | | | | | added options: keyint_min, scenecut, frameref, bframes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14950 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with English man page 1.914:gpoirier2005-03-151-2/+14
| | | | | | | sync to x264 171: chroma_me, chroma_qp_offset git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14949 b3059339-0415-0410-9bf9-f77b7e298cf2
* get_space fix by Florian Dietrich <flodt8 at yahoo.de>faust32005-03-151-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14948 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added correct message for -speed.gabrov2005-03-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14947 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.165gabrov2005-03-151-2/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14946 b3059339-0415-0410-9bf9-f77b7e298cf2
* Oded's patch for -speed in mencoder. This can be used for purposesrfelker2005-03-154-21/+41
| | | | | | | | | | like converting back and forth between PAL and FILM (or NTSC-FILM) framerates, or whatever else you like. Doesn't work with -oac copy. Someone give Oded some cola for the error message and fill in a sane one. :)))) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14945 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 171: chroma_me, chroma_qp_offsetlorenm2005-03-143-7/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14944 b3059339-0415-0410-9bf9-f77b7e298cf2
* New translated file. Synced with 1.64jheryan2005-03-141-0/+1445
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14943 b3059339-0415-0410-9bf9-f77b7e298cf2
* patch by ods15:rfelker2005-03-131-0/+2
| | | | | | | | "10000l to me, I forgot that 'vfilter' could be NULL in case of framecopy, so this code always segfaulted when merging files using -ovc copy..." git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14942 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.913:gpoirier2005-03-111-9/+7
| | | | | | | | Convert vo_aa suboption parser to using the subopt-helper. This obsoletes all -aa* commandline options. Use -vo aa:* instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14941 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for multichannel wav files; -aa* is no longer valid and replaced byivo2005-03-111-0/+2
| | | | | | | -vo aa:options git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14940 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark modified files as such to comply more closely with GPL §2a.diego2005-03-1115-0/+60
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14939 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPlayer-specific changes to libdvdreaddiego2005-03-111-0/+961
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14938 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.163: fixes for encoding of multiple fileskraymer2005-03-111-2/+12
| | | | | | | 1.164: Convert vo_aa suboption parser to using the subopt-helper git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14937 b3059339-0415-0410-9bf9-f77b7e298cf2
* Convert vo_aa suboption parser to using the subopt-helper.ivo2005-03-114-105/+108
| | | | | | | This obsoletes all -aa* commandline options. Use -vo aa:* instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14936 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rather simple patch for RAWDV demuxer which lets it say whats the totalrtognimp2005-03-092-0/+25
| | | | | | | | movie length. Patch by Oded Shimon git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14935 b3059339-0415-0410-9bf9-f77b7e298cf2
* New translated file. Synced with 1.12jheryan2005-03-092-0/+330
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14934 b3059339-0415-0410-9bf9-f77b7e298cf2
* New translated file. Synced with 1.21jheryan2005-03-091-0/+490
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14933 b3059339-0415-0410-9bf9-f77b7e298cf2
* New translated file. Synced with 1.31jheryan2005-03-091-0/+60
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14932 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing return statement (1e5l for me)henry2005-03-081-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14931 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clean up properly if preinit() fails.syrjala2005-03-071-2/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14930 b3059339-0415-0410-9bf9-f77b7e298cf2
* set AvgBytesPerSecond to the correct value if encoding with mp3lame in cbr modenicodvb2005-03-071-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14929 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed support for mp3 at <32000 sample_ratenicodvb2005-03-071-2/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14928 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.912:gpoirier2005-03-061-1/+4
| | | | | | | documented scale=-n where n <= -9 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14927 b3059339-0415-0410-9bf9-f77b7e298cf2
* documented scale=-n where n <= -9nicodvb2005-03-061-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14926 b3059339-0415-0410-9bf9-f77b7e298cf2
* subtracting 8 from negative w and h rounds the dimension to the closest ↵nicodvb2005-03-061-2/+17
| | | | | | multiple of 16 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14925 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for other codecs (mpeg4/h264/aac) in mpeg-ps parsing the PSMnicodvb2005-03-062-7/+109
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14924 b3059339-0415-0410-9bf9-f77b7e298cf2
* alac support via lavc decoderrtognimp2005-03-063-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14923 b3059339-0415-0410-9bf9-f77b7e298cf2
* add a short note about how to use ttf fontsattila2005-03-061-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14922 b3059339-0415-0410-9bf9-f77b7e298cf2
* use inttypes.h for checks instead of less spread-ed stdint.hiive2005-03-061-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14921 b3059339-0415-0410-9bf9-f77b7e298cf2
* returning to the old index at the end system, alternatives are too complex ↵michael2005-03-041-32/+14
| | | | | | with questionable advantages git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14920 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typosgpoirier2005-03-041-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14919 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.910:gpoirier2005-03-041-2/+24
| | | | | | | | | 1.910: sync to x264 r150: new option 'b_pyramid'. 1.909: restrictions on muxer's telecine option. 1.9.8: English-manpage specific fixes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14918 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r150: new option 'b_pyramid'lorenm2005-03-043-1/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14917 b3059339-0415-0410-9bf9-f77b7e298cf2
* restrictions on muxer's telecine optionnicodvb2005-03-041-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14916 b3059339-0415-0410-9bf9-f77b7e298cf2
* converted vframerate to CONF_TYPE_FLOATnicodvb2005-03-041-19/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14915 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typosgpoirier2005-03-041-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14914 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.907paszczi2005-03-041-36/+57
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14913 b3059339-0415-0410-9bf9-f77b7e298cf2
* store local keyframes too so faster seeking is possiblemichael2005-03-041-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14912 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l to reimar.. sh_audio->samplerate and sh_audio->i_bps are not the samerfelker2005-03-041-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14911 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix very old ra files with no fourccrtognimp2005-03-031-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14910 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix some 28.8 ra files with four text stringsrtognimp2005-03-031-3/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14909 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.907:gpoirier2005-03-031-12/+51
| | | | | | | | | 1.907: Update xv and xvmc documentation to reflect recent colorkey changes + some fixes of mine. 1.906: mention telecine in mpeg muxer section git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14908 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial indexesmichael2005-03-031-15/+28
| | | | | | | comments (with alternative suggestions and advantages) welcome git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14907 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update xv and xvmc documentation to reflect recent colorkey changes.al2005-03-031-11/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14906 b3059339-0415-0410-9bf9-f77b7e298cf2
* finished tasksalex2005-03-031-10/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14905 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not always request little-endian despite the actual sound format. by ↵nplourde2005-03-031-1/+2
| | | | | | Alexander Strange - astrange@ithinksw.com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14904 b3059339-0415-0410-9bf9-f77b7e298cf2
* ADTS AAC works now.diego2005-03-031-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14903 b3059339-0415-0410-9bf9-f77b7e298cf2
* libdvdcss is patched, move Tremor up with the other codec libs.diego2005-03-031-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14902 b3059339-0415-0410-9bf9-f77b7e298cf2
* MEncoder now supports multiple files, Jack transport API requested.diego2005-03-031-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14901 b3059339-0415-0410-9bf9-f77b7e298cf2
* better explain where and how to use doxygen commentsdiego2005-03-031-0/+10
| | | | | | | patch by Oded Shimon <ods15 at ods15 dot dyndns dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14900 b3059339-0415-0410-9bf9-f77b7e298cf2
* Patches should not be sent as replies to unrelated threads.diego2005-03-031-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14899 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix rm files with a really big index chunk.reimar2005-03-031-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14898 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make nuv files work on bigendian (but old nuv files created with mencoderreimar2005-03-035-4/+32
| | | | | | | wont play anymore - before they would have worked with mplayer on be) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14897 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention telecine in mpeg muxer sectionnicodvb2005-03-031-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14896 b3059339-0415-0410-9bf9-f77b7e298cf2
* recalculate frame duration after soft telecinenicodvb2005-03-031-19/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14895 b3059339-0415-0410-9bf9-f77b7e298cf2
* options in config file have been using '-' instead of '_' for agesrathann2005-03-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14894 b3059339-0415-0410-9bf9-f77b7e298cf2
* 35% faster turbo mode with 0.01dB drop. Based Loren Merritt's suggestions.gpoirier2005-03-021-4/+2
| | | | | | | | Next step would be to make turbo mode accept a "quality" argument to control the speed vs quality tradeoff. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14893 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.905:gpoirier2005-03-021-16/+118
| | | | | | | Finished translations of revision 1.894 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14892 b3059339-0415-0410-9bf9-f77b7e298cf2
* libsmbclient is sometimes built with ssl support. This takes it into accountwight2005-03-021-0/+5
| | | | | | | and tests if -lsmbclient needs -lssl. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14891 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some more translations of 1.894 revisiongpoirier2005-03-021-9/+93
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14890 b3059339-0415-0410-9bf9-f77b7e298cf2
* configurable field parity (default from source); bugfixes; speed up mode 0rfelker2005-03-021-91/+73
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14889 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix:rathann2005-03-012-6/+6
| | | | | | | | | | | | | | | | mpeg_hdr.c:212: warning: no return statement in function returning non-void mpeg_hdr.c:262: warning: suggest parentheses around assignment used as truth value mpeg_hdr.c:264: warning: suggest parentheses around assignment used as truth value mpeg_hdr.c:270: warning: suggest parentheses around assignment used as truth value mpeg_hdr.c:275: warning: suggest parentheses around assignment used as truth value mpeg_hdr.c:212: warning: control reaches end of non-void function mp4_header_process_vop() return value isn't used anywhere anyway. Approved by Nico. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14888 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing #include (for malloc and free)rathann2005-03-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14887 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing #includerathann2005-03-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14886 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing externs (fixes implicit declaration warnings)rathann2005-03-011-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14885 b3059339-0415-0410-9bf9-f77b7e298cf2
* obvious typorathann2005-03-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14884 b3059339-0415-0410-9bf9-f77b7e298cf2
* all synced up to 1.905, except the part of the translation of 1.894gpoirier2005-03-011-10/+85
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14883 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l wrong binary operator when setting progressive framenicodvb2005-03-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14882 b3059339-0415-0410-9bf9-f77b7e298cf2
* telecine now works in display order (rather than decoding), as far as there ↵nicodvb2005-03-011-26/+44
| | | | | | are no more than 4 consecutive b-frames; added support for FMP4 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14881 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.893:gpoirier2005-03-011-11/+122
| | | | | | | | | | | | | | | | | | | 1.881: added new mpeg muxer options 1.882: done in a previous commit 1.883: fixes for previous commits 1.884: Mention that vstrict is necessary for some codecs, add ffvhuff. 1.885: Finish incomplete -af-adv documentation. 1.886: Sync -channels and -srate options with the XML docs. 1.887: spelling, wording and consistency fixes 1.888: renamed init_adelay to vdelay with opposite range 1.889: List the 'context' option for the ffvhuff codec. 1.890: indentation fix 1.891: vstrict vs mjpeg update, typo 1.892: done in a previous commit 1.893: done in a previous commit git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14880 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes for encoding of multiple fileshenry2005-03-0116-29/+81
| | | | | | | | | | - do not uninitialize video encoder between files - checks for image size & format change moved from mencoder.c to vfilters by Oded Shimon <ods15@ods15.dyndns.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14879 b3059339-0415-0410-9bf9-f77b7e298cf2
* set sh_audio->delay ins audio-only case so that correct time is displayedreimar2005-03-011-0/+2
| | | | | | | after seeking. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14878 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l Don't set SDL to X11 by default.ivo2005-03-012-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14877 b3059339-0415-0410-9bf9-f77b7e298cf2
* From Eng man page 1.902: fix outdated/incorrect info about -srate.gpoirier2005-03-011-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14876 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.159: fix missing check against lame_init_params that was leading to video ↵kraymer2005-03-011-2/+8
| | | | | | | | | | only files on low (under 32) audio bitrates 1.161: MEncoder multiple files patch by Oded Shimon (ods15) 1.162: Have OSS audio out fall back to s16ne instead of u8 if... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14875 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo noticed by Diego: it's mmap, not nmap.gpoirier2005-03-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14874 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.21gabrov2005-03-011-1/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14873 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.880:gpoirier2005-03-011-18/+18
| | | | | | | | 1.879: man page review part XVI 1.880: done in a previous commit git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14872 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.64gabrov2005-03-011-1/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14871 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.162jheryan2005-03-011-2/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14870 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.903jheryan2005-03-011-15/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14869 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.162gabrov2005-03-011-2/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14868 b3059339-0415-0410-9bf9-f77b7e298cf2
* From Eng manpage 1.892:gpoirier2005-03-011-3/+15
| | | | | | | sync to x264 r137: adaptive B-frame decision, flush delayed frames. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14867 b3059339-0415-0410-9bf9-f77b7e298cf2
* We should match end of token as well, to prevent MSGTR_FOO2 matching instead ofwight2005-03-011-1/+1
| | | | | | | MSGTR_FOO. Helps compilation in case of some changes to help*.h files. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14866 b3059339-0415-0410-9bf9-f77b7e298cf2
* From Eng manpage 1.882:gpoirier2005-03-011-0/+9
| | | | | | | Sync to x264 r134: weighted prediction for B-frames. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14865 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.878: Updates -af formatgpoirier2005-03-011-16/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14864 b3059339-0415-0410-9bf9-f77b7e298cf2
* From Eng manpage 1.904:gpoirier2005-03-011-11/+7
| | | | | | | | | Remove -noxv and -forcexv command line options and replace them by suboptions to -vo sdl. Renamed noxv to nohwaccel to better reflect the meaning of the option. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14863 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPlayer-specific changes to libdvdcssdiego2005-03-011-0/+596
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14862 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark modified files as such to comply more closely with GPL §2a.diego2005-03-018-0/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14861 b3059339-0415-0410-9bf9-f77b7e298cf2
* Preserve $Id$ keyword from upstream on unmodified files.diego2005-03-011-0/+4
| | | | | | | Keyword expansion disabled with the -ko sticky flag. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14860 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics: Make diff -R apply without offsets.diego2005-03-011-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14859 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove -noxv and -forcexv command line options and replace them byivo2005-03-013-26/+31
| | | | | | | | | | | suboptions to -vo sdl. Renamed noxv to nohwaccel to better reflect the meaning of the option. Updated manual page. Original patch by < ods15 at ods15 dot dyndns dot org> Modified by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14858 b3059339-0415-0410-9bf9-f77b7e298cf2
* Arpi prefers root@mphq for CVS problems.diego2005-03-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14857 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove left-over from old -z command line switch.ivo2005-03-011-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14856 b3059339-0415-0410-9bf9-f77b7e298cf2
* some comments and whitespace changes by (Luca Barbato <lu_zero gentoo org>)michael2005-03-011-57/+101
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14855 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.898jheryan2005-02-281-241/+674
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14854 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't print (stupid) message if output directory is .ivo2005-02-281-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14853 b3059339-0415-0410-9bf9-f77b7e298cf2
* stupid mistake i made when writing about divtc..rfelker2005-02-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14852 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compile warningsivo2005-02-283-26/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14851 b3059339-0415-0410-9bf9-f77b7e298cf2
* aos should respect the immed uninit flag (quit immediatly vs waiting till filereimar2005-02-274-2/+6
| | | | | | | is played to end). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14850 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l fix. misplaced ;ivo2005-02-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14849 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_jpeg now uses the generic int_pos() from subopt-helper.civo2005-02-271-10/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14848 b3059339-0415-0410-9bf9-f77b7e298cf2
* memory leaklorenm2005-02-271-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14847 b3059339-0415-0410-9bf9-f77b7e298cf2
* Multifile 10l bugfix by Oded:rfelker2005-02-271-0/+2
| | | | | | | | | "I never checked merging 2 complete files... at_eof stays non-zero when starting the second file, and doesn't encode a single frame..." git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14846 b3059339-0415-0410-9bf9-f77b7e298cf2
* cumulative sync with 1.877 + some fixes and misc.gpoirier2005-02-271-82/+164
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14845 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the ogg fourcc nightmare!!!rfelker2005-02-273-16/+19
| | | | | | | | | | | | | | | | | The problem: once upon a time, windows idiots decided to try to store vorbis-in-ogg-in-avi. Of course this failed miserably, but they used the audio format tag 0xfffe for "extended" to do this. Later someone working on MPlayer somehow decided 0xfffe was the format for vorbis, which is nonsense, and now that's conflicting with real wav files with extended audio format. This patch changes demux_ogg (and mkv) to use sane fourcc's for vorbis and theora and gets rid of the 0xfffe nonsense so hopefully wav files with extended audio will work now. If there are problems, we'll have to find workarounds...and drive an 18-wheeler full of cola thru the house of whoever wrote this 0xfffe nonsense in MPlayer to begin with... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14844 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.870: man page review page XIVgpoirier2005-02-271-65/+71
| | | | | | | (I'm back in business :-) ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14843 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move native RealAudio 1.0 / 2.0 up in the list to prefer it over the binarydiego2005-02-271-7/+7
| | | | | | | | codecs from Real and made the info line fit 80 characters. blessed by Roberto git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14842 b3059339-0415-0410-9bf9-f77b7e298cf2
* soft telecine support! :)) patch by nicorfelker2005-02-271-2/+73
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14841 b3059339-0415-0410-9bf9-f77b7e298cf2
* reversed, as this breaks vorbis decoding! 1000l! someone figure out why this ↵rfelker2005-02-271-1/+0
| | | | | | is the case and fix it before re-committing git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14840 b3059339-0415-0410-9bf9-f77b7e298cf2
* more on tivo vstream support.. 1000l to Joey for forgetting this file and ↵rfelker2005-02-271-0/+184
| | | | | | breaking MPlayer build! :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14839 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix outdated/incorrect info about -srate. others, feel free to improve this ↵rfelker2005-02-271-5/+3
| | | | | | more...i did the bare minimum to make it non-misleading git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14838 b3059339-0415-0410-9bf9-f77b7e298cf2
* added a stream module for the vstream client libraryjoey2005-02-2713-3/+171
| | | | | | | allows MPlayer to stream video from a properly equipped Tivo git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14837 b3059339-0415-0410-9bf9-f77b7e298cf2
* Yet another fourcc for mpeg-4 (files should be made with Xvid)rtognimp2005-02-271-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14836 b3059339-0415-0410-9bf9-f77b7e298cf2
* Have OSS audio out fall back to s16ne instead of u8 if it can't open theivo2005-02-262-3/+4
| | | | | | | soundcard for 3+ channels and do it for all audio streams (not only AC3). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14835 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for 32-bit float WAV files and support for extended WAV filesivo2005-02-262-0/+6
| | | | | | | with 4, 6, 8, ... channels of audio. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14834 b3059339-0415-0410-9bf9-f77b7e298cf2
* some more "guessed" encodings, please check themreimar2005-02-265-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14833 b3059339-0415-0410-9bf9-f77b7e298cf2
* helper files for charset conversion.reimar2005-02-264-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14832 b3059339-0415-0410-9bf9-f77b7e298cf2
* --charset configure option to convert help messages charsetreimar2005-02-262-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14831 b3059339-0415-0410-9bf9-f77b7e298cf2
* Recommend using a stable gcc version or upgrading frequently, suggested by Rich.diego2005-02-261-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14830 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar fix by Corey Hickey <bugfood-ml at fatooh dot org>diego2005-02-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14829 b3059339-0415-0410-9bf9-f77b7e298cf2
* cleanups of the Multiple files patchhenry2005-02-251-8/+4
| | | | | | | by Oded Shimon <ods15@ods15.dyndns.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14828 b3059339-0415-0410-9bf9-f77b7e298cf2
* auto-fps for h264 and better wordingnicodvb2005-02-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14827 b3059339-0415-0410-9bf9-f77b7e298cf2
* 50000l: fixed various memleaks; CC discontibuities aren't necessarily error ↵nicodvb2005-02-251-16/+35
| | | | | | conditions git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14826 b3059339-0415-0410-9bf9-f77b7e298cf2
* general gcc bug FAQ entrydiego2005-02-251-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14825 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-02-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14824 b3059339-0415-0410-9bf9-f77b7e298cf2
* compile fixhenry2005-02-251-10/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14823 b3059339-0415-0410-9bf9-f77b7e298cf2
* where the hell they got these infos fromalex2005-02-251-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14822 b3059339-0415-0410-9bf9-f77b7e298cf2
* swf adpcmalex2005-02-251-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14821 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove file-global mpadec, add ad_driver member to sh_audio_t instead.hzoli2005-02-252-8/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14820 b3059339-0415-0410-9bf9-f77b7e298cf2
* finally remove the refences to bps outside libaf. also simplification of ↵alex2005-02-255-49/+41
| | | | | | some messages and removed redundants git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14819 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add float output support. Add ADCTRL_QUERY_FORMAT control to report thehzoli2005-02-251-4/+85
| | | | | | | supported output formats. Add ADCTRL_SET_VOLUME (not yet used). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14818 b3059339-0415-0410-9bf9-f77b7e298cf2
* better infolinealex2005-02-251-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14817 b3059339-0415-0410-9bf9-f77b7e298cf2
* If -af-adv force=4 is in effect, use ADCTRL_QUERY_FORMAT to query thehzoli2005-02-251-0/+8
| | | | | | | ad codec about float support and set floatne format if supported. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14816 b3059339-0415-0410-9bf9-f77b7e298cf2
* more verbose messagealex2005-02-251-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14815 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not hide frame skips/dups! if they happen it's very bad!!rfelker2005-02-251-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14814 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document reorder and noreorder as (no)reorder.diego2005-02-251-5/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14813 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.31paszczi2005-02-251-725/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14812 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.897paszczi2005-02-251-112/+393
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14811 b3059339-0415-0410-9bf9-f77b7e298cf2
* both reorder and noreorder flags are now availablenicodvb2005-02-252-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14810 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always print dup/skip messages when !quiet.hzoli2005-02-251-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14809 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some to-be-redundant EDL code moved to edl.c with mencoder's edl in mind. ↵reynaldo2005-02-253-111/+61
| | | | | | Stack handling improvements, Patch by Oded Shimon git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14808 b3059339-0415-0410-9bf9-f77b7e298cf2
* mphq uses ssh.com, explain RSA key generation for it.diego2005-02-251-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14807 b3059339-0415-0410-9bf9-f77b7e298cf2
* UDP support implemented.diego2005-02-251-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14806 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2005-02-251-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14805 b3059339-0415-0410-9bf9-f77b7e298cf2
* -format description updated to match current behavior.diego2005-02-251-34/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14804 b3059339-0415-0410-9bf9-f77b7e298cf2
* MEncoder multiple files patch by Oded Shimon (ods15)rfelker2005-02-253-47/+219
| | | | | | | | | Seems to work, or at least not to cause problems with existing functionality (encoding single files). Please test and report bugs, if there are any! git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14803 b3059339-0415-0410-9bf9-f77b7e298cf2
* documentation for the tools in the TOOLS directorydiego2005-02-251-0/+404
| | | | | | | contributed by Miklos Vajna <mamajom at axelero dot hu> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14802 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed noreorder to reorder in mpegopts (ordering disabled by default)nicodvb2005-02-241-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14801 b3059339-0415-0410-9bf9-f77b7e298cf2
* disabled by default frame reorderingnicodvb2005-02-241-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14800 b3059339-0415-0410-9bf9-f77b7e298cf2
* framerate autodetection for H264 in raw/ts streamsnicodvb2005-02-243-0/+173
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14799 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always use vo_x11_sizehint function ( even when going fullscreen ) toal2005-02-241-3/+1
| | | | | | | reflect at least the window aspect behaviour. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14798 b3059339-0415-0410-9bf9-f77b7e298cf2
* strides should always be signedrfelker2005-02-241-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14797 b3059339-0415-0410-9bf9-f77b7e298cf2
* no effect in practice, but strides should always be signedrfelker2005-02-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14796 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l to me: bugfix for negative striderfelker2005-02-241-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14795 b3059339-0415-0410-9bf9-f77b7e298cf2
* bugfix for negative striderfelker2005-02-241-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14794 b3059339-0415-0410-9bf9-f77b7e298cf2
* stride must be signed! otherwise negative stride is broken on 64bit systemsrfelker2005-02-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14793 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l for me, lrintf is better. now fixed so it should be prototyped, and ↵rfelker2005-02-241-12/+23
| | | | | | should work even if there is no prototype git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14792 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.883wight2005-02-241-43/+133
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14791 b3059339-0415-0410-9bf9-f77b7e298cf2
* quick solution for making an option less braindeadalex2005-02-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14790 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.31gabrov2005-02-241-692/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14789 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move audio filter descriptions to the man page.diego2005-02-242-735/+299
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14788 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l to michael :))))rfelker2005-02-241-2/+2
| | | | | | | | vi_qoffset/vb_qoffset have been broken ever since the qp2lambda stuff went in, which is a LONG time ago..... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14787 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing linebreakdiego2005-02-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14786 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r137: adaptive B-frame decision, flush delayed frames.lorenm2005-02-233-12/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14785 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, forgot to change an ifdef on last commitreimar2005-02-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14784 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't change buffers when paused and redrawing.al2005-02-231-19/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14783 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert the flip part of vd_theora fixhenry2005-02-231-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14782 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert the flip part of vd_theora fixhenry2005-02-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14781 b3059339-0415-0410-9bf9-f77b7e298cf2
* replace bzero() with memset()nicodvb2005-02-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14780 b3059339-0415-0410-9bf9-f77b7e298cf2
* vstrict vs mjpeg update, typodiego2005-02-231-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14779 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make vd message fit 80 character displays.diego2005-02-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14778 b3059339-0415-0410-9bf9-f77b7e298cf2
* a helpful new message about vd.joey2005-02-231-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14777 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use PIX_FMT_YUVJ420P for mjpeg so that vstrict=-1 is not necessaryreimar2005-02-231-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14776 b3059339-0415-0410-9bf9-f77b7e298cf2
* indentation fixdiego2005-02-221-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14775 b3059339-0415-0410-9bf9-f77b7e298cf2
* List the 'context' option for the ffvhuff codec.lorenm2005-02-221-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14774 b3059339-0415-0410-9bf9-f77b7e298cf2
* renamed init_adelay to vdelay with opposite rangenicodvb2005-02-222-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14773 b3059339-0415-0410-9bf9-f77b7e298cf2
* The MPEG muxer now supports MPEG-2 as well.diego2005-02-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14772 b3059339-0415-0410-9bf9-f77b7e298cf2
* typosdiego2005-02-221-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14771 b3059339-0415-0410-9bf9-f77b7e298cf2
* rids ao_macosx of the buffer mutex by using the same buffering scheme as ↵nplourde2005-02-221-98/+76
| | | | | | ao_sdl - Patch by Reimar Doffinger git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14770 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling, wording and consistency fixesdiego2005-02-221-21/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14769 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync -channels and -srate options with the XML docs.diego2005-02-221-5/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14768 b3059339-0415-0410-9bf9-f77b7e298cf2
* switch from DIVX -> FMP4 fourcc for libavcodecmichael2005-02-223-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14767 b3059339-0415-0410-9bf9-f77b7e298cf2
* Finish incomplete -af-adv documentation.diego2005-02-221-2/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14766 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention that vstrict is necessary for some codecs, add ffvhuff.diego2005-02-221-4/+5
| | | | | | | based on patch by Oded Shimon <ods15 at ods15 dot dyndns dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14765 b3059339-0415-0410-9bf9-f77b7e298cf2
* Theora fixes:henry2005-02-223-15/+21
| | | | | | | | | - do not use negative stride (fixes -vf pp crash) - pass true image dimensions to VO, not the aligned ones (fixes incorrect aspect ratio bug & black bar under video) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14764 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix missing check against lame_init_params that was leading to video only ↵reynaldo2005-02-223-1/+10
| | | | | | files on low (under 32) audio bitrates git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14763 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix for MAP_ANON vs. MAP_ANONYMOUS fix...reimar2005-02-222-5/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14762 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes for previous commitswight2005-02-221-30/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14761 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync to x264 r134: weighted prediction for B-frames.lorenm2005-02-223-1/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14760 b3059339-0415-0410-9bf9-f77b7e298cf2
* finally the dreaded white-noise-with-floats bug is fixed!!!!rfelker2005-02-221-16/+8
| | | | | | | | | | | | | | the problem is that lrintf was not prototyped on some systems, but it's easier and faster just not to use it at all. looks like the cola goes to our friends the glibc developers for forgetting to put lrintf in math.h in some versions. :))) i'm sure there are other broken libcs too though. also fixed a minor bug in the int->float conversion where the range for float samples was exceeded... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14759 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial, extremely experimental, libavformat muxer; don't expect anything to ↵nicodvb2005-02-216-0/+328
| | | | | | work yet git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14758 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention new mpeg muxernicodvb2005-02-211-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14757 b3059339-0415-0410-9bf9-f77b7e298cf2
* added new mpeg muxer optionsnicodvb2005-02-211-0/+75
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14756 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo, missing _noreimar2005-02-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14755 b3059339-0415-0410-9bf9-f77b7e298cf2
* new mpeg muxer compatible with dvd/[s]vcd; small changes in the muxer layer ↵nicodvb2005-02-216-358/+2370
| | | | | | (sanity checks in the muxer_init functions) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14754 b3059339-0415-0410-9bf9-f77b7e298cf2
* proper output formats for ffduckalex2005-02-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14753 b3059339-0415-0410-9bf9-f77b7e298cf2
* swf and flv through libavformatalex2005-02-211-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14752 b3059339-0415-0410-9bf9-f77b7e298cf2
* filter for adding a center channel, adding a high pass filter would be nicealex2005-02-211-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14751 b3059339-0415-0410-9bf9-f77b7e298cf2
* filter for adding a center channel, adding a high pass filter would be nicealex2005-02-213-1/+124
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14750 b3059339-0415-0410-9bf9-f77b7e298cf2
* move the format related stuff to format.calex2005-02-213-202/+210
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14749 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove a lot of duplicate codereimar2005-02-213-66/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14748 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add OpenDoh and changuito skin authors.diego2005-02-211-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14747 b3059339-0415-0410-9bf9-f77b7e298cf2
* small updatesdiego2005-02-211-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14746 b3059339-0415-0410-9bf9-f77b7e298cf2
* -af surround delay default is 20ms, not 15ms.diego2005-02-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14745 b3059339-0415-0410-9bf9-f77b7e298cf2
* We should not crash, only because we couldn't hide the cursor.al2005-02-201-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14744 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unified colorkey code for vo xv and vo xvmc.al2005-02-204-131/+417
| | | | | | | | | | | | Made the code also more flexible. Colorkey drawing is now by default done as proposed by Marko Macek. Patch also approved by iive. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14743 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part XVIdiego2005-02-201-29/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14742 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix sync tag after update by Reynaldogabrov2005-02-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14741 b3059339-0415-0410-9bf9-f77b7e298cf2
* Description of -af format was outdated. This updates it. Feel free to changeivo2005-02-201-13/+15
| | | | | | | | | | | spelling or phrasing :) Note: There's no official spelling of endianness. Personally I prefer a single n, but the majority seems to use double n. Since I'm not a native speaker, I used 'endianness' here. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14740 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264: expose option "level_idc".lorenm2005-02-203-1/+12
| | | | | | | patch by Jeff Clagg <snacky at ikaruga dot co dot uk>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14739 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.876paszczi2005-02-191-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14738 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move generic tests to a common place.al2005-02-194-17/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14737 b3059339-0415-0410-9bf9-f77b7e298cf2
* Corrected/improved usage example for -af panreimar2005-02-191-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14736 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update the MEncoder telecine documentation.diego2005-02-191-76/+82
| | | | | | | patch by Corey Hickey <bugfood-ml at fatooh dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14735 b3059339-0415-0410-9bf9-f77b7e298cf2
* correct filenamewight2005-02-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14734 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark locally modified files as such to comply more closely with GPL 2a.diego2005-02-1913-0/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14733 b3059339-0415-0410-9bf9-f77b7e298cf2
* Point to local_changes.diff.diego2005-02-192-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14732 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update patch with missing changes.diego2005-02-191-14/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14731 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync missing cosmetics from the 2004-07-12 CVS snapshot.diego2005-02-1913-41/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14730 b3059339-0415-0410-9bf9-f77b7e298cf2
* Correct CVS snapshot date and provide a little more detail.diego2005-02-191-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14729 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove modification notice from files that have not been locally modified.diego2005-02-1984-245/+83
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14728 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove modification notice from files that have not been locally modified.diego2005-02-1913-39/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14727 b3059339-0415-0410-9bf9-f77b7e298cf2
* - sync 1.77wight2005-02-181-829/+839
| | | | | | | | - trailing whitespace removed - reindent file git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14726 b3059339-0415-0410-9bf9-f77b7e298cf2
* trailing whitespace cosmeticswight2005-02-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14725 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.875wight2005-02-181-140/+301
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14724 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move x264 version check into configure.lorenm2005-02-182-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14723 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention udp:// streamingnicodvb2005-02-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14722 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for raw udp:// streamingnicodvb2005-02-171-3/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14721 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r129: modified ratecontrol equation.lorenm2005-02-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14720 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make seek command parameter float.reimar2005-02-172-3/+4
| | | | | | | Patch by Oded Shimon [ods15 at ods15 dot dyndns dot org]. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14719 b3059339-0415-0410-9bf9-f77b7e298cf2
* confusing mixture of typecasts and casted variable, removed typecastsreimar2005-02-171-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14718 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added NV12/NV21 support.syrjala2005-02-171-9/+53
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14717 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improved NV12/NV21 support.syrjala2005-02-167-9/+108
| | | | | | | | | | | - Fixed PlanarToNV12Wrapper() and made it handle NV21. - Added yuv2nv12XinC() to handle software scaling. - Added NV12/NV21 handling to various places. - Removed NV12 from vf_hue and vf_spp as they don't look like they can actually handle it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14716 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync tag bump to 1.24wight2005-02-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14715 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.59wight2005-02-161-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14714 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPlayer-specific changes to libfaaddiego2005-02-161-0/+107
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14713 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2005-02-161-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14712 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-02-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14711 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for my latest commitsrtognimp2005-02-151-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14710 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for RealPlayer10 cook.so decoder in Linuxrtognimp2005-02-151-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14709 b3059339-0415-0410-9bf9-f77b7e298cf2
* outdated EDL limit referencereynaldo2005-02-156-37/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14708 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mp3On4 demuxer supportrtognimp2005-02-152-0/+9
| | | | | | | Patch by Larry Ruedisueli lwr at audioresearchlabs dot com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14707 b3059339-0415-0410-9bf9-f77b7e298cf2
* Should be in sync with 1.874, except both man pages reviews which will be donegpoirier2005-02-151-17/+122
| | | | | | | later (therefore sync tag not bumped) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14706 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.158gabrov2005-02-151-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14705 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.59gabrov2005-02-151-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14704 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.62 & fixed mis-spellinggabrov2005-02-151-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14703 b3059339-0415-0410-9bf9-f77b7e298cf2
* ./postproc contains libswscale.a not libpostproc.awight2005-02-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14702 b3059339-0415-0410-9bf9-f77b7e298cf2
* Simplify FAAD instructions.diego2005-02-151-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14701 b3059339-0415-0410-9bf9-f77b7e298cf2
* set device id to 0 if the device selected on startup do not existnplourde2005-02-141-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14700 b3059339-0415-0410-9bf9-f77b7e298cf2
* FreeBSD fixnexus2005-02-141-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14699 b3059339-0415-0410-9bf9-f77b7e298cf2
* Another files translatedjheryan2005-02-143-0/+910
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14698 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix -sstep description.diego2005-02-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14697 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32005-02-131-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14696 b3059339-0415-0410-9bf9-f77b7e298cf2
* avisynth demuxerfaust32005-02-132-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14695 b3059339-0415-0410-9bf9-f77b7e298cf2
* avisynth demuxer patch by Gianluigi Tiesi <mplayer at netfarm.it>faust32005-02-136-3/+632
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14694 b3059339-0415-0410-9bf9-f77b7e298cf2
* always take the focus in fullscreen mode patch by Gianluigi Tiesi <mplayer ↵faust32005-02-131-0/+1
| | | | | | at netfarm.it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14693 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document missing slave mode commands.diego2005-02-131-6/+8
| | | | | | | patch by Oded Shimon <ods15 at ods15 dot dyndns dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14692 b3059339-0415-0410-9bf9-f77b7e298cf2
* better explanation of N-pass encodingdiego2005-02-121-7/+13
| | | | | | | based on a patch by Oded Shimon <ods15 at ods15 dot dyndns dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14691 b3059339-0415-0410-9bf9-f77b7e298cf2
* vf_detc parameter names fixed.diego2005-02-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14690 b3059339-0415-0410-9bf9-f77b7e298cf2
* Put general note at the top of the file.diego2005-02-121-5/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14689 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.158: ESD configuration dialog and software volume control option for Guikraymer2005-02-121-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14688 b3059339-0415-0410-9bf9-f77b7e298cf2
* ESD configuration dialog and software volume control option for Guireimar2005-02-126-0/+60
| | | | | | | Patch by Paul Wilhelm Elsinghorst ( paul [at] uni-bonn de ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14687 b3059339-0415-0410-9bf9-f77b7e298cf2
* small reordering to make future 'multiple files' changes more modular, puts ↵reynaldo2005-02-121-22/+22
| | | | | | single file loading separate from global option loading in the begginning. patch by Oded Shimon git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14686 b3059339-0415-0410-9bf9-f77b7e298cf2
* command to log current subtitle to filehenry2005-02-124-2/+54
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14685 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment and info field spelling/grammar corrections.diego2005-02-121-78/+78
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14684 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part XVdiego2005-02-111-59/+127
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14683 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix "Unknown argument" with cmd containing spacesaurel2005-02-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14682 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed bug near line 761.jheryan2005-02-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14681 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review page XIVdiego2005-02-101-62/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14680 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix the behaviour of -geometry according to the documentation.al2005-02-091-5/+6
| | | | | | | Patch by Bjorn Danielsson <mplayer-mail ta dax tod nu> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14679 b3059339-0415-0410-9bf9-f77b7e298cf2
* translation maintainer updatesdiego2005-02-091-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14678 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2005-02-092-259/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14677 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.57jheryan2005-02-081-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14676 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.58jheryan2005-02-081-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14675 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.869jheryan2005-02-081-14/+104
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14674 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.157wight2005-02-071-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14673 b3059339-0415-0410-9bf9-f77b7e298cf2
* DGA works only with x11reimar2005-02-061-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14672 b3059339-0415-0410-9bf9-f77b7e298cf2
* pp filter documentationdiego2005-02-061-10/+103
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14671 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.868 + small fixgpoirier2005-02-061-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14670 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.58wight2005-02-061-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14669 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.57wight2005-02-061-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14668 b3059339-0415-0410-9bf9-f77b7e298cf2
* Memleak fixes. Based on patch by Timothy Lee (timothy lee at siriushk com).reimar2005-02-062-11/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14667 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.77gabrov2005-02-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14666 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.60gabrov2005-02-061-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14665 b3059339-0415-0410-9bf9-f77b7e298cf2
* X11 headers must be included also when X11_FULLSCREEN is not defined (althoughreimar2005-02-061-2/+2
| | | | | | | it is not really beautiful that their are included here in the first place) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14664 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.57gabrov2005-02-061-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14663 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.61gabrov2005-02-061-1/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14662 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.58gabrov2005-02-061-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14661 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.30gabrov2005-02-061-239/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14660 b3059339-0415-0410-9bf9-f77b7e298cf2
* The included libfaad is at version 2.1 beta.diego2005-02-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14659 b3059339-0415-0410-9bf9-f77b7e298cf2
* XvMC is not yet autodetected, don't claim otherwise in the help output,diego2005-02-051-1/+1
| | | | | | | noticed by James Lancaster <james at kirk dot math dot twsu dot edu>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14658 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed forgotten old license clausehenry2005-02-051-6/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14657 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing spacewight2005-02-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14656 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add Reimar's hint for building 32 bit MPlayer on Athlon64.diego2005-02-051-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14655 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2005-02-051-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14654 b3059339-0415-0410-9bf9-f77b7e298cf2
* small updates and typo fixesdiego2005-02-051-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14653 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove inaccurate guess about keyframe intervals.diego2005-02-051-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14652 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.867gpoirier2005-02-051-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14651 b3059339-0415-0410-9bf9-f77b7e298cf2
* link fixdiego2005-02-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14650 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unnecessary options from the -dumpmicrodvdsub command line and adddiego2005-02-051-1/+1
| | | | | | | a few <replaceable> tags as appropiate. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14649 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some systems (e.g. FreeBSD 5.3) only define MAP_ANON, not MAP_ANONYMOUSreimar2005-02-051-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14648 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove outdated and hard to maintain sound driver table.diego2005-02-041-218/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14647 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.876: -alang suppots many languageskraymer2005-02-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14646 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid null pointer dereference with .ssa subtitles when the video codec is ↵faust32005-02-041-1/+1
| | | | | | missing patch by Philip Chong <pchong at ic.eecs.berkeley.edu> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14645 b3059339-0415-0410-9bf9-f77b7e298cf2
* bzero is deprecated patch by  Gianluigi Tiesi <mplayer at netfarm.it>faust32005-02-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14644 b3059339-0415-0410-9bf9-f77b7e298cf2
* bzero is deprecated patch by Gianluigi Tiesi <mplayer at netfarm.it>faust32005-02-045-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14643 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.867wight2005-02-041-16/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14642 b3059339-0415-0410-9bf9-f77b7e298cf2
* -alang suppots many languages, guessing by the exampleswight2005-02-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14641 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix for streams that do not send a bitratereimar2005-02-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14640 b3059339-0415-0410-9bf9-f77b7e298cf2
* makes --enable-*-faad really enable without any further check and drop ↵aurel2005-02-033-43/+5
| | | | | | support for old external faad2 versions (<= 1.1) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14639 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.57 by Savchenko Andrew <Bircoph at list dot ru>diego2005-02-031-18/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14638 b3059339-0415-0410-9bf9-f77b7e298cf2
* Separate XF86 video mode extension check from XF86 keysym check asdiego2005-02-022-4/+32
| | | | | | | | XFree 3.x does not have the latter. based on a patch by Trent Piepho <xyzzy at speakeasy dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14637 b3059339-0415-0410-9bf9-f77b7e298cf2
* Query XV_COLORKEY only when listed in attribute list, fixes displaying with ↵iive2005-02-021-17/+9
| | | | | | non overlay ports git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14636 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.55 by Savchenko Andrew <Bircoph at list dot ru>diego2005-02-021-138/+576
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14635 b3059339-0415-0410-9bf9-f77b7e298cf2
* pass wave extradata to the codec..alex2005-02-011-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14634 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updated the outdated audio section somewhat.diego2005-02-012-22/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14633 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print which of Tremor, internal Tremor or libvorbis has been enabled.diego2005-02-011-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14632 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compile fix on non-x86reimar2005-02-011-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14631 b3059339-0415-0410-9bf9-f77b7e298cf2
* BGR32 is now supported also by lavc tscc decoderrtognimp2005-01-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14630 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for 32 bit Camtasia samplesdiego2005-01-311-1/+1
| | | | | | | hint by Florian Mickler <deathmk at gmx dot net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14629 b3059339-0415-0410-9bf9-f77b7e298cf2
* Yet another memleak...reimar2005-01-311-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14628 b3059339-0415-0410-9bf9-f77b7e298cf2
* - Don't advertise IMGFMT_RGBxxsyrjala2005-01-311-9/+1
| | | | | | | - Updated copyright line git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14627 b3059339-0415-0410-9bf9-f77b7e298cf2
* makes funnyCode pages executable (for CPU with NX bit)aurel2005-01-312-2/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14626 b3059339-0415-0410-9bf9-f77b7e298cf2
* now supports float based operation aswellalex2005-01-311-5/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14625 b3059339-0415-0410-9bf9-f77b7e298cf2
* using af_softclipalex2005-01-311-8/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14624 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_softclipalex2005-01-311-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14623 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_softclipalex2005-01-311-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14622 b3059339-0415-0410-9bf9-f77b7e298cf2
* added ecx to clobber listalex2005-01-311-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14621 b3059339-0415-0410-9bf9-f77b7e298cf2
* adding proper parenthesingalex2005-01-311-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14620 b3059339-0415-0410-9bf9-f77b7e298cf2
* unused definitions removedalex2005-01-311-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14619 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.157gabrov2005-01-311-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14618 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.60gabrov2005-01-311-97/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14617 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove overly outdated entries, update a few others.diego2005-01-301-95/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14616 b3059339-0415-0410-9bf9-f77b7e298cf2
* Expose support for 444P and 422P raw video.diego2005-01-301-0/+18
| | | | | | | patch by Stuart Cunningham <stuart_hc at yahoo dot com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14615 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow monitoraspect > 3 (up to 9)reimar2005-01-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14614 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo in hwac3 stringreimar2005-01-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14613 b3059339-0415-0410-9bf9-f77b7e298cf2
* discard lavf packets with wrong idsnicodvb2005-01-301-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14612 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print CPUflags and extension support on x86_64, tooreimar2005-01-292-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14611 b3059339-0415-0410-9bf9-f77b7e298cf2
* print "Unknown/not supported internal format" message only with -v as itreimar2005-01-291-1/+1
| | | | | | | is not an error. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14610 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix possible hang when playing broken MP3 from linear stream and removereimar2005-01-291-29/+26
| | | | | | | duplicate code. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14609 b3059339-0415-0410-9bf9-f77b7e298cf2
* several sets of headers declare global variables in them, which causes ↵iive2005-01-296-11/+23
| | | | | | | | | multiple definition errors with gcc 4.x patch by Alexander Strange <astrange ithinksw.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14608 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed the syntax of the spdif device string.reimar2005-01-281-1/+1
| | | | | | | Thanks to Takashi Iwai for the hint. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14607 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.866jheryan2005-01-281-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14606 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.157jheryan2005-01-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14605 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.864jheryan2005-01-281-22/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14604 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.866:gpoirier2005-01-271-2/+4
| | | | | | | | 1.866: matroska capitalized 1.865: NUT doesn't contain subtitles so the example with the nutfile had to be changed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14603 b3059339-0415-0410-9bf9-f77b7e298cf2
* matroska capitalizedkraymer2005-01-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14602 b3059339-0415-0410-9bf9-f77b7e298cf2
* synckraymer2005-01-271-16/+19
| | | | | | | | | | | 1.861: Fix -alang and -slang descriptions, they should be similar. 1.862: NUT does not contain subtitles, correct -sid description. 1.863: Unify some option descriptions. 1.864: Force missing linebreak (pcm). 1.865: NUT doesn't contain subtitles so the example with the nutfile had to be changed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14601 b3059339-0415-0410-9bf9-f77b7e298cf2
* NUT doesn't contain subtitles so the example with the nutfile had to be changed.kraymer2005-01-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14600 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.157: Add half size entry to the GMPlayer menu.kraymer2005-01-271-4/+5
| | | | | | | small fixes: replaced some tabs with spaces, removed unneeded spaces git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14599 b3059339-0415-0410-9bf9-f77b7e298cf2
* "support" YUVJ colorspaces added to libavcodec, makes mjpeg decoding work againreimar2005-01-261-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14598 b3059339-0415-0410-9bf9-f77b7e298cf2
* Always select correct descramblig matrix for sipr audiortognimp2005-01-251-1/+1
| | | | | | | Fixes brokenaudio.rmvb git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14597 b3059339-0415-0410-9bf9-f77b7e298cf2
* free MSTRZ args also if parser failsrik2005-01-251-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14596 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_zr2 moved to OPT_ARG_MSTRZ from OPT_ARG_STRrik2005-01-251-19/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14595 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.864: Force missing linebreak.gpoirier2005-01-251-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14594 b3059339-0415-0410-9bf9-f77b7e298cf2
* small updates by <plazmus at gmail dot com>diego2005-01-251-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14593 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add translator mail address.diego2005-01-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14592 b3059339-0415-0410-9bf9-f77b7e298cf2
* Force missing linebreak.diego2005-01-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14591 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add half size entry to the GMPlayer menu.diego2005-01-257-3/+175
| | | | | | | | patch by Pierre Marc Dumuid <pierre dot dumuid at adelaide dot edu dot au> approved by Pontscho git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14590 b3059339-0415-0410-9bf9-f77b7e298cf2
* x1 and y1 give last used position, must be < width/heightreimar2005-01-251-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14589 b3059339-0415-0410-9bf9-f77b7e298cf2
* small updatesdiego2005-01-251-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14588 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not read any more data at eof: if got eof in the middle of an audiortognimp2005-01-241-0/+1
| | | | | | | | block, ad_realaudio requests more data even if sh->audio->eof Fixes sig11 at eof of hotel_california_ra5.1_640x480_30s.rmvb git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14587 b3059339-0415-0410-9bf9-f77b7e298cf2
* Be less verbose with -v (do not print a line for each demuxed packet)rtognimp2005-01-241-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14586 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.863: Unify some option descriptions.gpoirier2005-01-241-8/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14585 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain how to include libavcodec in cvs updates.diego2005-01-241-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14584 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify some option descriptions.diego2005-01-231-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14583 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reset stream eof after parsing header, fixes bug #218reimar2005-01-231-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14582 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for the Linux RealPlayer 10 RV30/40 codec.diego2005-01-221-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14581 b3059339-0415-0410-9bf9-f77b7e298cf2
* The test to check for working pthreads fails if the system can supportdiego2005-01-221-1/+1
| | | | | | | | pthreads without any gcc options (for instance, Darwin). patch by Alexander Strange <astrange at ithinksw dot com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14580 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce excessive verbosity.diego2005-01-221-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14579 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid using vo_subdevicealex2005-01-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14578 b3059339-0415-0410-9bf9-f77b7e298cf2
* wmv3 needs extradataalex2005-01-221-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14577 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete options.diego2005-01-221-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14576 b3059339-0415-0410-9bf9-f77b7e298cf2
* More user-friendly stream, -xid and -slang info output even in non-verbose ↵mosu2005-01-221-8/+6
| | | | | | mode part 2. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14575 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make configure check for aalib dependency on libX11 if it fails without.diego2005-01-221-3/+7
| | | | | | | | Necessary to link against aalib from the OpenBSD ports tree. patch by Ian Lindsay <iml at formicary dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14574 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, missing () around *valpreimar2005-01-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14573 b3059339-0415-0410-9bf9-f77b7e298cf2
* replaced bzero() with memset(); stream_type 0x0f is AACnicodvb2005-01-221-13/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14572 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with the English description of "-alang".gpoirier2005-01-221-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14571 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make this file compile with gcc-4.0.0:gpoirier2005-01-221-3/+3
| | | | | | | | It's syntacticly incorrect to use the "&" operand to take the address of a variable that is declared as "register" as a register has no address. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14570 b3059339-0415-0410-9bf9-f77b7e298cf2
* Play RV30 with 8-elements cmsg24rtognimp2005-01-222-6/+19
| | | | | | | Fixes rv30_cmsg24_test.rmvb (now in samples) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14569 b3059339-0415-0410-9bf9-f77b7e298cf2
* openbsd xf86 aperture supportalex2005-01-211-0/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14568 b3059339-0415-0410-9bf9-f77b7e298cf2
* better test for MAP_FAILED by Ian Lindsayalex2005-01-211-5/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14567 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make this file compile with gcc-4.0.0. The old code was invalid C.gpoirier2005-01-211-6/+6
| | | | | | | (with the blessing of Rich) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14566 b3059339-0415-0410-9bf9-f77b7e298cf2
* tries to sync to ADTS/ADIF header before initializing the decoder; implement ↵nicodvb2005-01-211-3/+51
| | | | | | SYNC git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14565 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative sync with 1.862:gpoirier2005-01-211-14/+17
| | | | | | | | 1.862: NUT does not contain subtitles, correct -sid description. 1.861: Fix -alang and -slang descriptions, they should be similar. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14564 b3059339-0415-0410-9bf9-f77b7e298cf2
* More user-friendly stream, -xid and -slang info output even in non-verbose mode.mosu2005-01-211-5/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14563 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle missing palettes in the info part of VobSubs in Matroska files ↵mosu2005-01-213-1/+4
| | | | | | correctly by giving mplayer a NULL pointer. This way it will use a default palette instead of black only. Patch by Csillag Kristof (fenwick () freemail ! hu) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14562 b3059339-0415-0410-9bf9-f77b7e298cf2
* NUT does not contain subtitles, correct -sid description.diego2005-01-211-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14561 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.59gabrov2005-01-211-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14560 b3059339-0415-0410-9bf9-f77b7e298cf2
* "Synced with 1.XXX" commit message rule.diego2005-01-211-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14559 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix -alang and -slang descriptions, they should be similar.diego2005-01-211-7/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14558 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix few x86_64 registers handlingaurel2005-01-212-6/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14557 b3059339-0415-0410-9bf9-f77b7e298cf2
* support immed flag, always initialize write_offset, min_free_space doesn't ↵faust32005-01-211-3/+10
| | | | | | seem to be required anymore after Florian Dietrichs patches git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14556 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.860wight2005-01-211-11/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14555 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixesdiego2005-01-211-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14554 b3059339-0415-0410-9bf9-f77b7e298cf2
* Next file done.jheryan2005-01-211-0/+928
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14553 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.859: Split examples into MPlayer and MEncoder examples, fix -aspect ↵kraymer2005-01-211-11/+12
| | | | | | description, small fixes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14552 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed wrong deinterleaving of channelsnicodvb2005-01-211-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14551 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialized BITMAPINFOHEADER to 0 to avoid problems, esp. windows has problemsreimar2005-01-208-8/+8
| | | | | | | when unused parts have bogus values. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14550 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.860:gpoirier2005-01-201-13/+16
| | | | | | | | Split examples into MPlayer and MEncoder examples, fix -aspect description, small fixes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14549 b3059339-0415-0410-9bf9-f77b7e298cf2
* Split examples into MPlayer and MEncoder examples, fix -aspect description,diego2005-01-201-12/+13
| | | | | | | small fixes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14548 b3059339-0415-0410-9bf9-f77b7e298cf2
* Minor bugfixeswight2005-01-201-9/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14547 b3059339-0415-0410-9bf9-f77b7e298cf2
* this shouldn't be here in the first placewight2005-01-201-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14546 b3059339-0415-0410-9bf9-f77b7e298cf2
* Omission from previous commit.wight2005-01-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14545 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.859wight2005-01-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14544 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove all setlocale calls, they break the behaviour of sscanf andreimar2005-01-2010-102/+1
| | | | | | | | strcasecmp, especially with tr_TR locale - and do not seem to be good for anything. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14543 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify confusing error message.diego2005-01-192-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14542 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print warning message when using -dvd-device without libdvdread support.diego2005-01-191-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14541 b3059339-0415-0410-9bf9-f77b7e298cf2
* use MSTRZ suboption typereimar2005-01-191-12/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14540 b3059339-0415-0410-9bf9-f77b7e298cf2
* New suboption type: malloc'ed, zero terminated stringreimar2005-01-196-58/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14539 b3059339-0415-0410-9bf9-f77b7e298cf2
* initialize modify_ldt struct to 0.reimar2005-01-191-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14538 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, fix broken AMD64 patch. To whoever applied it: Did you actually _try_reimar2005-01-191-2/+2
| | | | | | | to check if it's correct?? git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14537 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, completely broken pointer arithmetic causing crashes.reimar2005-01-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14536 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.859. Some cosmetic appearance changes ignored for typographic ↵jheryan2005-01-181-107/+124
| | | | | | reasons. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14535 b3059339-0415-0410-9bf9-f77b7e298cf2
* Binary codecs and Windows section overhauled to reflect recent changes.diego2005-01-181-12/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14534 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording, spelling, small updatesdiego2005-01-171-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14533 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatefaust32005-01-171-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14532 b3059339-0415-0410-9bf9-f77b7e298cf2
* print the actual commandline to stdout, toofaust32005-01-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14531 b3059339-0415-0410-9bf9-f77b7e298cf2
* WAVE_FORMAT_DIRECT seems to cause problems with certain os/driver ↵faust32005-01-171-1/+1
| | | | | | combinations and seems to be useless anyway git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14530 b3059339-0415-0410-9bf9-f77b7e298cf2
* preload quicktime.qts, this allows us to ignore the hardcoded path inside ↵faust32005-01-173-2/+27
| | | | | | the dlls so that quicktime.qts doesn't need to be in the windows system dir, patch by Gianluigi Tiesi <mplayer at netfarm.it>, comments by myself git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14529 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revert sh_audio->wf freeing.iive2005-01-171-2/+0
| | | | | | | | Freeing should be done elsewhere, as it prevents second codec to access the same structure. Reported by elupus at ecce.se git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14528 b3059339-0415-0410-9bf9-f77b7e298cf2
* added section for x264enc options.kraymer2005-01-161-0/+84
| | | | | | | added options so far: bitrate, qp_constant, pass, keyint git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14527 b3059339-0415-0410-9bf9-f77b7e298cf2
* If asf/tcp fails, asf/http used a wrong portrtognimp2005-01-161-0/+3
| | | | | | | Fixes mms://mms.thestreet.com/cramer011205.wma git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14526 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with: 1.859gpoirier2005-01-161-6/+8
| | | | | | | some minor formatting changes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14525 b3059339-0415-0410-9bf9-f77b7e298cf2
* detect and use the codecs paths instead of win32.reimar2005-01-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14524 b3059339-0415-0410-9bf9-f77b7e298cf2
* added video encoding options for nuppel video (nuvopts)kraymer2005-01-161-1/+43
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14523 b3059339-0415-0410-9bf9-f77b7e298cf2
* Good news everyone! I finally managed to sync all lavcenc options :)kraymer2005-01-161-2/+81
| | | | | | | synced options: ibias, pbias, nr, qns, inter_matrix, intra_matrix, vqmod_amp, vqmod_freq, dc, cgop. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14522 b3059339-0415-0410-9bf9-f77b7e298cf2
* some minor formatting changeskraymer2005-01-161-7/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14521 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced (wording, formatting) the following lavc options: trell, cbp, mv0, ↵kraymer2005-01-161-37/+94
| | | | | | | | | qprd, last_pred, preme, subq, psnr, mpeg_quant, aic, aiv, umv git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14520 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.55gabrov2005-01-161-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14519 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced (wording, formatting) the following lavc options: naq, ildct, ilme, ↵kraymer2005-01-161-71/+218
| | | | | | | | | | alt, top, format, pred, coder, context, qpel, mbcmp, ildctcmp, precmp, cmp, subcmp, nssew, predia, dia added one line break after "!" git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14518 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced (wording, formatting) the following lavc options: tcplx_mask, ↵kraymer2005-01-161-11/+52
| | | | | | scplx_mask, p_mask git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14517 b3059339-0415-0410-9bf9-f77b7e298cf2
* More support for AVC in Matroska.mosu2005-01-161-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14516 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced (wording, formatting) the following lavc options: vpsize, ss, gray, ↵kraymer2005-01-161-61/+122
| | | | | | | | | vfdct, idct, lumi_mask, dark_mask wording (finally got 'man page' right) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14515 b3059339-0415-0410-9bf9-f77b7e298cf2
* set sub_utf8 only when actually using mkv subtitles, will break externalreimar2005-01-161-2/+1
| | | | | | | subtitles (-sub) otherwise. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14514 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync:kraymer2005-01-161-3/+3
| | | | | | | | 1.854: better vf_lavcdeint description 1.855: Force linebreak (png) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14513 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced (wording, formatting) the following lavc options: vrc_override, ↵kraymer2005-01-161-57/+107
| | | | | | | | | vrc_init_cplx, vqsquish, vlelim, vcelim, vstrict, vdpart also changed some other wording (diego) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14512 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2005-01-161-12/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14511 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.156paszczi2005-01-161-15/+175
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14510 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replaced suboption parser by call to suboption helper.ivo2005-01-152-242/+103
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14509 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2005-01-151-13/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14508 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l. parser can work with pnm_maxfiles directlyivo2005-01-151-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14507 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.858paszczi2005-01-151-109/+111
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14506 b3059339-0415-0410-9bf9-f77b7e298cf2
* Transition of suboption parser to subopt-helper parser.ivo2005-01-151-128/+82
| | | | | | | Removal of stupid malloc_failed function. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14505 b3059339-0415-0410-9bf9-f77b7e298cf2
* print why waveOutOpen failedfaust32005-01-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14504 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move generic length and percent pos calculation to demuxer.creimar2005-01-156-26/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14503 b3059339-0415-0410-9bf9-f77b7e298cf2
* mms-over-http related fixes by mereimar2005-01-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14502 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing escaping for "reimar2005-01-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14501 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updatertognimp2005-01-151-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14500 b3059339-0415-0410-9bf9-f77b7e298cf2
* Decode MP3 in rm filesrtognimp2005-01-152-4/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14499 b3059339-0415-0410-9bf9-f77b7e298cf2
* Codec packages now have different names, try to be less confusing about it.diego2005-01-151-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14498 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing \ in multiline define.reimar2005-01-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14497 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.858:gpoirier2005-01-141-10/+8
| | | | | | | | | 1.858: disambiguate wording of -aspect 1.857: more on H.264's quantization parameter 1.856: (was already corrected on previous version) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14496 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lattila2005-01-141-1/+1
| | | | | | | useless use of test git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14495 b3059339-0415-0410-9bf9-f77b7e298cf2
* disambiguate wording of -aspectdiego2005-01-141-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14494 b3059339-0415-0410-9bf9-f77b7e298cf2
* icc support by Darek Ostolski <ostolski at kwantum dot gda dot pl>diego2005-01-141-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14493 b3059339-0415-0410-9bf9-f77b7e298cf2
* set ss_mul to number of channels. Works with all samples I found.reimar2005-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14492 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, no endian conversion on floats!reimar2005-01-131-16/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14491 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not access word-sized elements on potentially unaligned memory addresses. ↵mosu2005-01-131-1/+1
| | | | | | RISC processors usually do not like that. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14490 b3059339-0415-0410-9bf9-f77b7e298cf2
* more on H.264's quantization parameterlorenm2005-01-131-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14489 b3059339-0415-0410-9bf9-f77b7e298cf2
* \- instead of -wight2005-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14488 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.855: Force linebreak.gpoirier2005-01-131-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14487 b3059339-0415-0410-9bf9-f77b7e298cf2
* Force linebreak.diego2005-01-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14486 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.854: better vf_lavcdeint descriptiongpoirier2005-01-131-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14485 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.54gabrov2005-01-131-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14484 b3059339-0415-0410-9bf9-f77b7e298cf2
* better vf_lavcdeint descriptiondiego2005-01-131-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14483 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative sync with 1.853: (NB: new CVS log commentation acknoledged)gpoirier2005-01-121-45/+61
| | | | | | | | | | | | | 1.853: sync to x264 r93: Change the mechanics of option "keyint": Now controls the GOP size directly and allows variable numbers of non-IDR I-frames within a GOP. Remove option "idrint" and replace it with "keyint_min". Add option "8x8mv" for the sake of completeness. 1.852: man page review part XIII git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14482 b3059339-0415-0410-9bf9-f77b7e298cf2
* actually mp_msg.h includes config.h, but for consistency better include itreimar2005-01-121-1/+1
| | | | | | | explicitly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14481 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_format.h needs config.h to be included first.reimar2005-01-1210-4/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14480 b3059339-0415-0410-9bf9-f77b7e298cf2
* ensure null-termination after snprintfreimar2005-01-121-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14479 b3059339-0415-0410-9bf9-f77b7e298cf2
* automatic fps calculation for mpeg4 in raw stream/mpeg-tsnicodvb2005-01-123-2/+166
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14478 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.156gabrov2005-01-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14477 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.28gabrov2005-01-121-292/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14476 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync. Long lines' shortening.jheryan2005-01-121-154/+215
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14475 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.76gabrov2005-01-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14474 b3059339-0415-0410-9bf9-f77b7e298cf2
* Format correction in microdvdsub section.jheryan2005-01-121-7/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14473 b3059339-0415-0410-9bf9-f77b7e298cf2
* Here is an updated draft with the bits discussed previously merged:michael2005-01-121-89/+34
| | | | | | | | | | | | | | | - short startcode removed - QT/Microsoft codec_specific_data removed, reverted to a neutral format - meta packet removed, merged in the info packet. - stream class simplified, added metadata stream patch by (Luca Barbato <lu_zero gentoo org>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14472 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync.jheryan2005-01-122-10/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14471 b3059339-0415-0410-9bf9-f77b7e298cf2
* sun grep doesn't like binary files, thus the compiled fileattila2005-01-121-1/+1
| | | | | | | has to be passed trough strings first. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14470 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r93:lorenm2005-01-122-15/+34
| | | | | | | | | Change the mechanics of option "keyint": Now controls the GOP size directly and allows variable numbers of non-IDR I-frames within a GOP. Remove option "idrint" and replace it with "keyint_min". Add option "8x8mv" for the sake of completeness. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14469 b3059339-0415-0410-9bf9-f77b7e298cf2
* Bugfix and improve microdvd conversion and bugfix section.jheryan2005-01-121-8/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14468 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.850:gpoirier2005-01-111-26/+13
| | | | | | | | 1.849: documentation for ao dsound. 1.850: Audio plugins have been removed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14467 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.848 (and 1.847): more detail on x264's subqgpoirier2005-01-111-14/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14466 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2005-01-111-2/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14465 b3059339-0415-0410-9bf9-f77b7e298cf2
* Translation section created, small additions and fixes.diego2005-01-111-33/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14464 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part XIIIdiego2005-01-111-32/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14463 b3059339-0415-0410-9bf9-f77b7e298cf2
* Call subcp_close when closing the demuxerreimar2005-01-111-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14462 b3059339-0415-0410-9bf9-f77b7e298cf2
* free http field_name to fix memleakreimar2005-01-111-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14461 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.842, trailing spacesdanny2005-01-111-50/+54
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14460 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for AVC in Matroska.mosu2005-01-112-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14459 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2005-01-101-287/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14458 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.851paszczi2005-01-101-31/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14457 b3059339-0415-0410-9bf9-f77b7e298cf2
* assume OS support SSE on x86_64aurel2005-01-101-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14456 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced (wording, formatting) the following lavc options: vqblur (pass 1 and ↵kraymer2005-01-101-75/+96
| | | | | | 2), vqcomp, vrc_eq git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14455 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos :(kraymer2005-01-101-32/+64
| | | | | | | | synced (wording, formatting) the following lavc options: vrc_maxrate, vrc_minrate, vrc_buf_size, vrc_buf_aggressivity, vrc_strategy, vb_qfactor, vi_qfactor, vb_qoffset, vi_qoffset git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14454 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.851: Implementation of vo_png suboption parser with subopt-helper and removalkraymer2005-01-101-6/+8
| | | | | | | | of -z command line option. ---------------------------------------------------------------------- git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14453 b3059339-0415-0410-9bf9-f77b7e298cf2
* Implementation of vo_png suboption parser with subopt-helper and removalivo2005-01-103-20/+26
| | | | | | | of -z command line option. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14452 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.849: documentation for ao dsoundkraymer2005-01-101-50/+74
| | | | | | | | 1.850: Audio plugins have been removed. synced (wording, formatting) the following lavc options: turbo, aspect, autoaspect, vbitrate, vratetol git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14451 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore autogenerated filewight2005-01-101-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14450 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.156jheryan2005-01-101-2/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14449 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.846, remove trailing spaces, minor bugfix.jheryan2005-01-101-426/+556
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14448 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove autogenerated.jheryan2005-01-101-29/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14447 b3059339-0415-0410-9bf9-f77b7e298cf2
* Minor bugfix, autogenerated file remove.jheryan2005-01-102-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14446 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove audio output driver table, it's incomplete, does not belong in thatdiego2005-01-101-55/+0
| | | | | | | section and the information is available in the man page. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14445 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo, remove mention of audio plugins.diego2005-01-101-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14444 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move audio filters section up one hierarchy level.diego2005-01-101-26/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14443 b3059339-0415-0410-9bf9-f77b7e298cf2
* Audio plugins have been removed.diego2005-01-103-228/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14442 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2005-01-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14441 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncedpaszczi2005-01-093-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14440 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.849paszczi2005-01-091-12/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14439 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, set inited to 0 in uninit, otherwise only first file will play video.reimar2005-01-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14438 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention ao dsoundfaust32005-01-091-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14437 b3059339-0415-0410-9bf9-f77b7e298cf2
* documentation for ao dsoundfaust32005-01-091-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14436 b3059339-0415-0410-9bf9-f77b7e298cf2
* more detail on x264's subqlorenm2005-01-091-11/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14435 b3059339-0415-0410-9bf9-f77b7e298cf2
* always cancel down fractions (frac_t) to avoid overflows and playbackreimar2005-01-087-28/+59
| | | | | | | | problems (e.g. when using resample and equalizer filters together, see http://mplayerhq.hu/pipermail/mplayer-users/2004-December/050058.html) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14434 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix black line on right of subtitle with -spuaa 4 by setting alpha ofreimar2005-01-081-9/+6
| | | | | | | border pixels to 0 after scaling, not before. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14433 b3059339-0415-0410-9bf9-f77b7e298cf2
* change malloc and free to av_ variants where needed.reimar2005-01-083-49/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14432 b3059339-0415-0410-9bf9-f77b7e298cf2
* set sub_bg_alpha only to 255 when using hardware OSD.reimar2005-01-081-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14431 b3059339-0415-0410-9bf9-f77b7e298cf2
* replace almost obsolete email address: snel@phys.uu.nl -> rsnel@cube.dyndns.orgrik2005-01-086-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14430 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_zr2 moves to subopt-helper (per Alex's request)rik2005-01-081-44/+57
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14429 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.12, initial translationgabrov2005-01-081-0/+204
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14428 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed broken seeking in mpeg-es files; syncword seeking for all 3 video codecsnicodvb2005-01-081-4/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14427 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.52gabrov2005-01-081-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14426 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.22gabrov2005-01-081-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14425 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistent two pass, pass two etc spellingdiego2005-01-071-41/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14424 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistent pass two and pass one spellingdiego2005-01-071-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14423 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistent "two pass" spellingdiego2005-01-073-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14422 b3059339-0415-0410-9bf9-f77b7e298cf2
* typopaszczi2005-01-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14421 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.846 + spelling corrections :gpoirier2005-01-071-17/+16
| | | | | | | | | | | x264: disable subq=0 (the huge bitrate penalty wasn't worth the speed), and set default subq to best. wording. renumber direct_pred (temporal seems to be best) NOTE: the wording of the subq section seems akward: further work needed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14420 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.75gabrov2005-01-071-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14419 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.847paszczi2005-01-071-15/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14418 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.59gabrov2005-01-071-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14417 b3059339-0415-0410-9bf9-f77b7e298cf2
* massive update and retranslation by plazmus at gmail dot comdiego2005-01-071-401/+901
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14416 b3059339-0415-0410-9bf9-f77b7e298cf2
* more information about source fileshenry2005-01-071-0/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14415 b3059339-0415-0410-9bf9-f77b7e298cf2
* Tremor vorbis decoderhenry2005-01-071-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14414 b3059339-0415-0410-9bf9-f77b7e298cf2
* aop has been removedalex2005-01-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14413 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264: disable subq=0 (the huge bitrate penalty wasn't worth the speed),lorenm2005-01-072-14/+12
| | | | | | | | and set default subq to best. wording. renumber direct_pred (temporal seems to be best) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14412 b3059339-0415-0410-9bf9-f77b7e298cf2
* Playback video with multiple windows.reimar2005-01-071-0/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14411 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cleanup, removing internal conversions. Testing welcome.reimar2005-01-061-35/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14410 b3059339-0415-0410-9bf9-f77b7e298cf2
* typokraymer2005-01-061-30/+89
| | | | | | | | synced (wording, formatting) the following lavc options: inter_threshold, keyint, sc_threshold, vb_strategy, vpass git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14409 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording ("Regressionstest")kraymer2005-01-061-3/+73
| | | | | | | | synced (wording, formatting) the following lavc options: vme, me_range, mbd, vhq, v4mv, obmc, loop git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14408 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced (wording, formatting) the following lavc options:kraymer2005-01-061-55/+123
| | | | | | | | atag, bit_exact, threads, vcodec, vqmin, lmax, vqscale, vqmax, mbqmin, mbqmax, vqdiff, vmax_b_frames git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14407 b3059339-0415-0410-9bf9-f77b7e298cf2
* libao2/eq.h was removed, use libaf/equalizer.h instead.reimar2005-01-062-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14406 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use AF_FORMAT_S16_NE instead of #ifdef WORDS_BIGENDIAN ...reimar2005-01-061-7/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14405 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce index verbosityrtognimp2005-01-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14404 b3059339-0415-0410-9bf9-f77b7e298cf2
* Real multirate files supportrtognimp2005-01-061-27/+231
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14403 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed-vo/libmpeg2 aspect change fixfaust32005-01-061-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14402 b3059339-0415-0410-9bf9-f77b7e298cf2
* 256 color mode support, use -vm to get better output when overlay is not ↵faust32005-01-061-1/+20
| | | | | | supported git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14401 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_fmt2str fixes (remove trailing space, call with size of buffer, not size-1)reimar2005-01-061-10/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14400 b3059339-0415-0410-9bf9-f77b7e298cf2
* device selection supportfaust32005-01-061-2/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14399 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check for every 24 and 32 bit AFMT_ separately if it is defined.reimar2005-01-061-4/+28
| | | | | | | Patch by Walter Haidinger walter dot haidinger at gmx dot at git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14398 b3059339-0415-0410-9bf9-f77b7e298cf2
* license issues clarifiedhenry2005-01-062-9/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14397 b3059339-0415-0410-9bf9-f77b7e298cf2
* Print waveheader only when verbosereimar2005-01-061-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14396 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync.jheryan2005-01-062-7/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14395 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added cs subdirectory.jheryan2005-01-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14394 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.845:gpoirier2005-01-061-6/+10
| | | | | | | | | 1.845: typo/wording 1.844: mention ATSC in the dvb section 1.843: 6-channel raw acc on stereo speakers playback example git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14393 b3059339-0415-0410-9bf9-f77b7e298cf2
* RTC check should no longer be Linux-only.diego2005-01-061-9/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14392 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, mp_msg instead af_msgalex2005-01-061-55/+43
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14391 b3059339-0415-0410-9bf9-f77b7e298cf2
* unused parts removedalex2005-01-0617-3463/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14390 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixes and wordingkraymer2005-01-061-12/+16
| | | | | | | | 1.843: 6-channel raw acc on stereo speakers playback example 1.844: mention ATSC in the dvb section git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14389 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo/wordingdiego2005-01-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14388 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixesdiego2005-01-061-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14387 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing ","diego2005-01-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14386 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention ATSC in the dvb sectionnicodvb2005-01-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14385 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention ATSC tools and conf.file (dvb section)nicodvb2005-01-061-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14384 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for ATSC tuner and conf.filenicodvb2005-01-063-3/+58
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14383 b3059339-0415-0410-9bf9-f77b7e298cf2
* RTC support on FreeBSD, inspired by a patch from Michael Johnsondiego2005-01-062-3/+14
| | | | | | | <ahze at FreeBSD dot org> and Reimar Döffinger. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14382 b3059339-0415-0410-9bf9-f77b7e298cf2
* adjusted beginning of lavc section, work will go on from herekraymer2005-01-051-8/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14381 b3059339-0415-0410-9bf9-f77b7e298cf2
* lavc is reintegrated, just as it was before removal some commits agokraymer2005-01-051-1/+489
| | | | | | | it hasn't been touched yet (no work done yet) so it's neither reformatted nor up to date git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14380 b3059339-0415-0410-9bf9-f77b7e298cf2
* finished xvid (api4) specific encoding options by adding the following options:kraymer2005-01-051-0/+178
| | | | | | | | | min_iquant max_iquant min_pquant max_pquant min_bquant max_bquant quant_intra_matrix quant_inter_matrix curve_compression_high curve_compression_low overflow_control_strength max_overflow_improvement max_overflow_degradation container_frame_overhead par par_width par_height aspect (no)autoaspect psnr bvhq git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14379 b3059339-0415-0410-9bf9-f77b7e298cf2
* 6-channel raw acc on stereo speakers playback examplereimar2005-01-051-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14378 b3059339-0415-0410-9bf9-f77b7e298cf2
* added new xvid (api4 only) options: frame_drop_ratio, (no)qpel, (no)gmc, ↵kraymer2005-01-051-1/+115
| | | | | | | | | | (no)trellis (no)cartoon, quant_type, (no)chroma_me, (no)chroma_opt, (no)hq_ac vhq added description for PSNR (see (no)chroma_opt) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14377 b3059339-0415-0410-9bf9-f77b7e298cf2
* commit 1.841 changes: mostly small formatting changes for better readabilitygpoirier2005-01-051-18/+22
| | | | | | | (now synced up to 1.842) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14376 b3059339-0415-0410-9bf9-f77b7e298cf2
* rest of sync of xvidenc encoding options that already existedkraymer2005-01-051-21/+98
| | | | | | | | added new options for api4 options removed outdated options git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14375 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2005-01-052-38/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14374 b3059339-0415-0410-9bf9-f77b7e298cf2
* began with sync of xvidenc encoding optionskraymer2005-01-051-45/+115
| | | | | | | this commit contains the options from the beginning down to mod_quant git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14373 b3059339-0415-0410-9bf9-f77b7e298cf2
* Just the sync with 1.842: Remove bogus lines.gpoirier2005-01-051-7/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14372 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove bogus lines.diego2005-01-051-7/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14371 b3059339-0415-0410-9bf9-f77b7e298cf2
* changes against 1.0 + Dec 2004 SVN math codehenry2005-01-051-0/+90
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14370 b3059339-0415-0410-9bf9-f77b7e298cf2
* mostly small formatting changes for better readabilitykraymer2005-01-051-15/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14369 b3059339-0415-0410-9bf9-f77b7e298cf2
* added toolame to codec specific encoding optionskraymer2005-01-051-0/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14368 b3059339-0415-0410-9bf9-f77b7e298cf2
* (re-)added lameopts to codec specific encoding optionskraymer2005-01-041-1/+139
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14367 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed typos and changed wording regarding a few previous commits (courtesy ↵kraymer2005-01-041-20/+14
| | | | | | | | | to diego!) also the bogus about progressive is removed from (no)waveheader option git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14366 b3059339-0415-0410-9bf9-f77b7e298cf2
* creatded section for codec specific encoding optionskraymer2005-01-041-1/+92
| | | | | | | divx4 moved in (as it was completely removed a few commits ago), others are to follow git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14365 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, pointers aren't always 32bitfaust32005-01-041-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14364 b3059339-0415-0410-9bf9-f77b7e298cf2
* further sync in encoding options, ranging from 'ovc' to 'vobsuboutindex'kraymer2005-01-041-30/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14363 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced encoding options from 'info' to 'ofps'kraymer2005-01-041-604/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14362 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative sync with 1.840:gpoirier2005-01-041-13/+15
| | | | | | | | | 1.840: just typos. 1.839: alphabetical order 1.838: small fixes/improvements (by Sebastian Kraemer, except the hyphen stuff) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14361 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed single typokraymer2005-01-041-78/+26
| | | | | | | | began work in mencoder options, synced options are: audio-delay, audio-density, audio-preload, endpos, ffourcc git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14360 b3059339-0415-0410-9bf9-f77b7e298cf2
* small changes (formatting, sync) to sections files, examples, bugs, authorskraymer2005-01-041-55/+93
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14359 b3059339-0415-0410-9bf9-f77b7e298cf2
* added video filters: delogo, zrmjpegkraymer2005-01-041-0/+51
| | | | | | | video filters section is now completely translated! git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14358 b3059339-0415-0410-9bf9-f77b7e298cf2
* added video filters: framestep, tilekraymer2005-01-041-0/+58
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14357 b3059339-0415-0410-9bf9-f77b7e298cf2
* updated/synced video filters: boxblur, sab, smartblur, perspectivekraymer2005-01-041-101/+139
| | | | | | | (mostly reformatting, wording) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14356 b3059339-0415-0410-9bf9-f77b7e298cf2
* added video filters: telecine, tinterlace, tfieldskraymer2005-01-041-0/+60
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14355 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix/simplify os_types.h. MPlayer needs inttypes.h anyway to compile.reimar2005-01-042-69/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14354 b3059339-0415-0410-9bf9-f77b7e298cf2
* copyright changekraymer2005-01-041-2/+130
| | | | | | | | "stuck mouse button" wording change (still not perfect and on my todo) added video filters: softpulldown, divtc, phase git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14353 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adding new files to czech translation.jheryan2005-01-046-0/+1570
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14352 b3059339-0415-0410-9bf9-f77b7e298cf2
* Tremor licensehenry2005-01-041-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14351 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.837, typos form 1.831danny2005-01-041-101/+138
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14350 b3059339-0415-0410-9bf9-f77b7e298cf2
* Extend copyright to 2005, typos.diego2005-01-041-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14349 b3059339-0415-0410-9bf9-f77b7e298cf2
* anti-10l pepsi (removed english stuff from where it didn't belong)kraymer2005-01-031-6/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14348 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.838: bump (was already fixed)kraymer2005-01-031-4/+4
| | | | | | | 1.389: alphabetical order (-cdrom-device) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14347 b3059339-0415-0410-9bf9-f77b7e298cf2
* alphabetical orderdiego2005-01-031-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14346 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixes/improvementskraymer2005-01-031-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14345 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.832: small improvementkraymer2005-01-031-13/+21
| | | | | | | | | | | | 1.833: bump (left out since it's not in synced part) (x264) 1.834: Add -ao pcm suboptions and remove -aofile and -waveheader options. 1.835 & 1.836: bump (left out since it's not in synced part) (x264) 1.837: Default to audiodump.pcm with nowaveheader again finally added 'synced-to-here'-flag ---------------------------------------------------------------------- git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14344 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2005-01-032-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14343 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.827: Better -lavdopts option descriptions.kraymer2005-01-031-7/+33
| | | | | | | | | | | 1.828: Remove spurious .RE macro. 1.829: added colorkey support for vo_directx. 1.830: added -wid support for vo_directx. 1.831: Adds support for LADSPA (Linux Audio Developer's Simple Plugin API) plugins. ---------------------------------------------------------------------- git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14342 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.837paszczi2005-01-031-77/+98
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14341 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.826: Created audio filters section to replace -af description.kraymer2005-01-031-123/+174
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14340 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.821: Clarify vo_yuv4mpeg filename handling. (bump, was already corrected)kraymer2005-01-031-3/+9
| | | | | | | | | | | 1.822: y420 vs i420 typo (already done, thanks diego) 1.823: Mention how to concatenate files with -vo yuv4mpeg and -fixed-vo. 1.824: added conditional lowres description 1.825: Fix paragraph indentation. ---------------------------------------------------------------------- git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14339 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.814: sstep is usually inaccurate.kraymer2005-01-031-37/+52
| | | | | | | | | | | | | 1.815: use a configurable-size ringbuffer instead of a pipe for buffering key events. 1.816: better explain -nodouble. 1.817: Add a file= suboption to set output file. (md5sum) 1.818: keyframes are more like 10 - 20 seconds apart, not 120 (was already corrected) 1.819: Some fixes and better wording, remove alsa9 and alsa1x audio output drivers and make some numeric options line up properly. 1.820: better mention -vo yuv4mpeg can change output filename git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14338 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.812: -double is now default, thus -nodouble needs to be documented instead.kraymer2005-01-031-22/+105
| | | | | | | | | 1.813: -identify now prints subtitle/audio track information. wording: Pullup -> pullup added video filter filmident git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14337 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_bits2fmt and af_str2fmt_short, also removed the extra FORMAT_BPS control ↵alex2005-01-034-46/+67
| | | | | | in format.c git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14336 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore .dependivo2005-01-031-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14335 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed wording enkodier* to encode* to be consistant with manpagekraymer2005-01-031-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14334 b3059339-0415-0410-9bf9-f77b7e298cf2
* trivial: added [cfg]-tag in cfg.c sectionkraymer2005-01-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14333 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.154: printf --> mp_msg conversion, less verbositykraymer2005-01-031-1/+65
| | | | | | | 1.155: Adds support for LADSPA (Linux Audio Developer's Simple Plugin API) plugins. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14332 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync to 1.837:gpoirier2005-01-031-1/+3
| | | | | | | | Default to audiodump.pcm with nowaveheader again, but document it in the manpage this time. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14331 b3059339-0415-0410-9bf9-f77b7e298cf2
* More commands documented, based on Reimar's findings.diego2005-01-031-11/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14330 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the subopt-helper for parsing suboptions.reimar2005-01-031-109/+57
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14329 b3059339-0415-0410-9bf9-f77b7e298cf2
* Default to audiodump.pcm with nowaveheader again, but document it in the ↵reimar2005-01-032-2/+8
| | | | | | manpage this time. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14328 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use lavcresample only when libavcodec is compiled in.reimar2005-01-031-8/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14327 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add missing break that caused an irritating error message all the time when ↵reimar2005-01-031-0/+1
| | | | | | using slave mode. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14326 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.836:gpoirier2005-01-031-9/+8
| | | | | | | x264: clarify 4x4mv, b8x8mv (thanks to Bond) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14325 b3059339-0415-0410-9bf9-f77b7e298cf2
* grab_frame, osd_show_text, sub_step, screenshot documented.diego2005-01-031-6/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14324 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.74 (typo fix)gabrov2005-01-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14323 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.835gpoirier2005-01-031-78/+79
| | | | | | | x264: group together the primary ratecontrol options. misc clarifications. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14322 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarification as suggested by Alexander Strasser.diego2005-01-031-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14321 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fixesgabrov2005-01-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14320 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace fixesgabrov2005-01-031-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14319 b3059339-0415-0410-9bf9-f77b7e298cf2
* many 10ls fixed... also better debuggingarpi2005-01-031-27/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14318 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.21gabrov2005-01-031-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14317 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.51gabrov2005-01-031-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14316 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.58gabrov2005-01-031-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14315 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264: clarify 4x4mv, b8x8mv (thanks to Bond)lorenm2005-01-031-9/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14314 b3059339-0415-0410-9bf9-f77b7e298cf2
* Framestepping does not require pause mode.diego2005-01-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14313 b3059339-0415-0410-9bf9-f77b7e298cf2
* happy new yeardiego2005-01-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14312 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document minimum required ALSA version.diego2005-01-021-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14311 b3059339-0415-0410-9bf9-f77b7e298cf2
* Forward framestepping is now implemented.diego2005-01-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14310 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264: group together the primary ratecontrol options. misc clarifications.lorenm2005-01-021-66/+73
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14309 b3059339-0415-0410-9bf9-f77b7e298cf2
* change rc_init_buffer to be a fraction of total buffer size.lorenm2005-01-021-6/+7
| | | | | | | disallow qp_step=0. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14308 b3059339-0415-0410-9bf9-f77b7e298cf2
* Decode WV1F version of MPEG4 with libavcodecrtognimp2005-01-021-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14307 b3059339-0415-0410-9bf9-f77b7e298cf2
* more credits, some wording consistencydiego2005-01-021-3/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14306 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.834: Add -ao pcm suboptions and remove -aofile and -waveheader ↵gpoirier2005-01-021-14/+19
| | | | | | options. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14305 b3059339-0415-0410-9bf9-f77b7e298cf2
* Raw encoder does not support stride.reimar2005-01-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14304 b3059339-0415-0410-9bf9-f77b7e298cf2
* win95 fix fix by Rune Petersen <rune.mail-list at mail.tele.dk>faust32005-01-021-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14303 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use strndup, it is missing on MinGW.reimar2005-01-021-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14302 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing ;faust32005-01-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14301 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mingw compile fix, hm doesn't the inttypes solution always work?faust32005-01-021-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14300 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add -ao pcm suboptions and remove -aofile and -waveheader options.reimar2005-01-025-22/+39
| | | | | | | Base on idea by Olivier Rolland (billl at users dot sf dot net) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14299 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use libc qsort to sort ODML index.reimar2005-01-021-40/+5
| | | | | | | Based on patch by phillip at phdcam dot com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14298 b3059339-0415-0410-9bf9-f77b7e298cf2
* happy new yeardiego2005-01-022-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14297 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.58gabrov2005-01-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14296 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix string argument parsing (e.g. one char strings were not accepted)reimar2005-01-011-14/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14295 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.14gabrov2005-01-011-12/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14294 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make af_control_any_rev return the matching filterreimar2005-01-012-7/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14293 b3059339-0415-0410-9bf9-f77b7e298cf2
* Install libdha into LIBDIR.reimar2005-01-011-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14292 b3059339-0415-0410-9bf9-f77b7e298cf2
* rate/format matching and volume get/set supportarpi2005-01-011-28/+151
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14291 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.72, initial translationgabrov2005-01-011-0/+2556
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14290 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.833paszczi2004-12-311-12/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14289 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix quicksort to avoid stack overflow and extreme runtimesreimar2004-12-311-6/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14288 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use subopt helper to parse argumentsreimar2004-12-311-50/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14287 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a type name for the test functionreimar2004-12-311-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14286 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use subopt parserreimar2004-12-311-36/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14285 b3059339-0415-0410-9bf9-f77b7e298cf2
* faster packed<->planar conversationmichael2004-12-311-6/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14284 b3059339-0415-0410-9bf9-f77b7e298cf2
* replaced deprecated FE_GET_EVENT with FE_READ_STATUS (only for DVB_HEAD); ↵nicodvb2004-12-311-29/+31
| | | | | | added a workaround for drivers that don't support FE_TIMEDOUT git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14283 b3059339-0415-0410-9bf9-f77b7e298cf2
* suboption parser for vo and ao modulesal2004-12-313-1/+296
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14282 b3059339-0415-0410-9bf9-f77b7e298cf2
* internal Tremor decoder for Ogg/Vorbishenry2004-12-3034-7/+8942
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14281 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix channels, sample rate and sample size for 3gp filesrtognimp2004-12-291-8/+26
| | | | | | | Patch by Richard van der Hoff [ richardv at mxtelecom dot com ] git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14280 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support amr_nb and amr_wb via libavcodecrtognimp2004-12-292-0/+113
| | | | | | | Add fourcc for H.263 used in 3gp files (s263) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14279 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for after-pre6 changesrtognimp2004-12-291-0/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14278 b3059339-0415-0410-9bf9-f77b7e298cf2
* TwinVQ decoder and demuxerrtognimp2004-12-299-3/+976
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14277 b3059339-0415-0410-9bf9-f77b7e298cf2
* less namespace pollution #2 (prefixed globals in filter.c with af_filter_)alex2004-12-296-28/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14276 b3059339-0415-0410-9bf9-f77b7e298cf2
* less namespace pollutionalex2004-12-293-22/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14275 b3059339-0415-0410-9bf9-f77b7e298cf2
* more verbose messagesalex2004-12-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14274 b3059339-0415-0410-9bf9-f77b7e298cf2
* accelerated conversionsalex2004-12-291-6/+98
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14273 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updated with a reminder for mplayer-announcertognimp2004-12-291-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14272 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove unused definesreimar2004-12-291-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14271 b3059339-0415-0410-9bf9-f77b7e298cf2
* Doxygen comments improvedreimar2004-12-292-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14270 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording/spellingdiego2004-12-291-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14269 b3059339-0415-0410-9bf9-f77b7e298cf2
* last draft with some insignificant changesrathann2004-12-291-0/+199
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14268 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.833gpoirier2004-12-281-8/+41
| | | | | | | | | new x264 options: b8x8mv, direct_pred changed explanation: 4x4mv changed defaults: subq, pb_factor git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14267 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try http if pnm connection failsrtognimp2004-12-281-3/+7
| | | | | | | Fixes pnm://www.darrelbowen.com/videos/commercials256.rm git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14266 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_fmt2str_shortalex2004-12-2810-27/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14265 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_fmt2str_shortalex2004-12-282-0/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14264 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, variable declarations must be before mp_msg.reimar2004-12-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14263 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l use right mask type when checking for input formatrtognimp2004-12-281-9/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14262 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l set default format for AF_FORMATs not supported by sound cardrtognimp2004-12-281-3/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14261 b3059339-0415-0410-9bf9-f77b7e298cf2
* new x264 options: b8x8mv, direct_predlorenm2004-12-281-9/+41
| | | | | | | | changed explanation: 4x4mv changed defaults: subq, pb_factor git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14260 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make af_ladspa use new AF_FORMAT define that was introduced by Alex'sivo2004-12-281-1/+1
| | | | | | | mega-patch. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14259 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r72.lorenm2004-12-281-5/+14
| | | | | | | | new options: b8x8mv, direct_pred changed defaults: pb_factor=1.3, subq=3 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14258 b3059339-0415-0410-9bf9-f77b7e298cf2
* ensure af_fmt2str always return a 0 terminated stringreimar2004-12-271-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14257 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, buf etc. in af_fmt2str call are already pointers...reimar2004-12-277-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14256 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use audio plugins anymorereimar2004-12-276-36/+77
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14255 b3059339-0415-0410-9bf9-f77b7e298cf2
* win95 does not support GetMonitorInfofaust32004-12-271-1/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14254 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, nasty ao driversalex2004-12-271-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14253 b3059339-0415-0410-9bf9-f77b7e298cf2
* maybe now..alex2004-12-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14252 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, patch by Martin Braun <braun12@gmx.de>faust32004-12-271-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14251 b3059339-0415-0410-9bf9-f77b7e298cf2
* hopefully final fixalex2004-12-276-20/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14250 b3059339-0415-0410-9bf9-f77b7e298cf2
* removing AFMT_ dependancyalex2004-12-271-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14249 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lalex2004-12-271-30/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14248 b3059339-0415-0410-9bf9-f77b7e298cf2
* CONF_TYPE_AFMT similar to CONF_TYPE_IMGFMTalex2004-12-272-0/+91
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14247 b3059339-0415-0410-9bf9-f77b7e298cf2
* removing AFMT_ dependancyalex2004-12-2765-585/+483
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14246 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix ontop for some WMs that lose ontop state after fullscreen event.al2004-12-271-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14245 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use lavcresample when accuracy-optimized audio filter chain is requested.reimar2004-12-261-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14244 b3059339-0415-0410-9bf9-f77b7e298cf2
* Demuxer was fixed, so do not skip the first frame anymorereimar2004-12-261-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14243 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set message level of the added subtitle message to INFO, fixes bug #139reimar2004-12-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14242 b3059339-0415-0410-9bf9-f77b7e298cf2
* big syncpaszczi2004-12-256-595/+1333
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14241 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.832paszczi2004-12-251-2/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14240 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-12-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14239 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix memleak in idx parser. patch by elupus [elupus {at] ecce <dot) se]reimar2004-12-251-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14238 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix stream selection and -bandwidth for mms-over-http.reimar2004-12-252-186/+336
| | | | | | | | Modifies header parsing to do a brute-force scan for known guids, to avoid having to analyze and parse the whole property-tree structure. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14237 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.832: small improvementsgpoirier2004-12-241-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14236 b3059339-0415-0410-9bf9-f77b7e298cf2
* small improvementsdiego2004-12-241-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14235 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.155gabrov2004-12-241-10/+73
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14234 b3059339-0415-0410-9bf9-f77b7e298cf2
* even more ffmpeg changesdiego2004-12-231-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14233 b3059339-0415-0410-9bf9-f77b7e298cf2
* some more FFmeg changesdiego2004-12-231-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14232 b3059339-0415-0410-9bf9-f77b7e298cf2
* release namediego2004-12-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14231 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.831:gpoirier2004-12-231-0/+29
| | | | | | | Adds support for LADSPA (Linux Audio Developer's Simple Plugin API) plugins. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14230 b3059339-0415-0410-9bf9-f77b7e298cf2
* one more itemdiego2004-12-231-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14229 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixesdiego2004-12-231-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14228 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not use pthreads on hpux (broken, hardly useful).reimar2004-12-231-0/+2
| | | | | | | | | | For reference, I get the following when starting a version compiled with it: Pthread internal error: message: __libc_reinit() failed, file: /ux/core/kern/pthreads/pthread.c, line: 1093 Return Pointer is 0xc0e29273 Quit git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14227 b3059339-0415-0410-9bf9-f77b7e298cf2
* When setting HAVE_PTHREADS, set HAVE_THREADS also to avoid linking problems ↵reimar2004-12-231-0/+5
| | | | | | with lavc (because utils.c defines a stub otherwise) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14226 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for Real codecs on OS Xdiego2004-12-231-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14225 b3059339-0415-0410-9bf9-f77b7e298cf2
* forgot to remove now useless extern monitor_aspectreimar2004-12-231-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14224 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording, spelling, new categories, reordered entriesdiego2004-12-231-47/+54
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14223 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_screenwidth/vo_screenheight is _not_ monitor_aspect.reimar2004-12-231-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14222 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.830wight2004-12-231-125/+177
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14221 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.831danny2004-12-231-0/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14220 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.830danny2004-12-231-128/+184
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14219 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds support for LADSPA (Linux Audio Developer's Simple Plugin API) plugins.ivo2004-12-239-2/+1095
| | | | | | | | | | Compilation is optional and can be controled by configure. You need to have the LADSPA SDK installed in order to have it autodetected by configure. Manual page is updated. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14218 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds support for LADSPA (Linux Audio Developer's Simple Plugin API) plugins.ivo2004-12-231-0/+1
| | | | | | | | | | Compilation is optional and can be controled by configure. You need to have the LADSPA SDK installed in order to have it autodetected by configure. Manual page is updated. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14217 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l misplaced variable declarationrtognimp2004-12-221-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14216 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix a segfault when calling loadfile during v4l2 playbackaurel2004-12-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14215 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make filters request a supported input format instead of failing.reimar2004-12-225-20/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14214 b3059339-0415-0410-9bf9-f77b7e298cf2
* add missing registers in clobber list, fixes bug #169reimar2004-12-212-0/+2
| | | | | | | Patch by basic basic (at) mozdev [dot] org git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14213 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative sync:gpoirier2004-12-211-4/+7
| | | | | | | | 1.830: added -wid support for vo_directx. 1.829: added colorkey support for vo_directx. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14212 b3059339-0415-0410-9bf9-f77b7e298cf2
* Last round French corrections for this file (spelling, corrects wronggpoirier2004-12-211-190/+219
| | | | | | | translations and cuts overly long lines) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14211 b3059339-0415-0410-9bf9-f77b7e298cf2
* French corrections:gpoirier2004-12-211-84/+84
| | | | | | | | My video compression teachers calls "quants" (in English) "quantum" in French. Also corrects some differents spellings of "quantification" for comprehensiveness. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14210 b3059339-0415-0410-9bf9-f77b7e298cf2
* additional fixes by Torinthiel and Rathannpaszczi2004-12-213-10/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14209 b3059339-0415-0410-9bf9-f77b7e298cf2
* added -wid support for vo_directx.joey2004-12-215-8/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14208 b3059339-0415-0410-9bf9-f77b7e298cf2
* automatic monitoraspect calculation for vo_directx.joey2004-12-211-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14207 b3059339-0415-0410-9bf9-f77b7e298cf2
* added colorkey support for vo_directx.joey2004-12-212-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14206 b3059339-0415-0410-9bf9-f77b7e298cf2
* savage_vid addedfaust32004-12-211-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14205 b3059339-0415-0410-9bf9-f77b7e298cf2
* experimental savage vidix driver by Reza Jelveh <reza.jelveh at tu-harburg.de>faust32004-12-213-1/+1788
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14204 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.828: Remove spurious .RE macrogpoirier2004-12-211-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14203 b3059339-0415-0410-9bf9-f77b7e298cf2
* sumulative sync with 1.827:gpoirier2004-12-211-123/+176
| | | | | | | | 1.827: Better -lavdopts option descriptions. 1.826: Created audio filters section to replace -af description. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14202 b3059339-0415-0410-9bf9-f77b7e298cf2
* small updates, spellingdiego2004-12-211-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14201 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove spurious .RE macro.diego2004-12-211-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14200 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix position bar and length display for mov filesreimar2004-12-212-6/+51
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14199 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use demuxer_get_percent_pos for the OSD position barreimar2004-12-212-7/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14198 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.825danny2004-12-211-64/+81
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14197 b3059339-0415-0410-9bf9-f77b7e298cf2
* Radeon R200 QM (Radeon 9100) support patch by Simone <beniamino.scanzoni at ↵faust32004-12-202-0/+3
| | | | | | fastwebnet.it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14196 b3059339-0415-0410-9bf9-f77b7e298cf2
* patches suggested by rathannpaszczi2004-12-204-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14195 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better -lavdopts option descriptions.diego2004-12-201-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14194 b3059339-0415-0410-9bf9-f77b7e298cf2
* Created audio filters section to replace -af description.diego2004-12-201-111/+161
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14193 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.822jheryan2004-12-201-32/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14192 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.154jheryan2004-12-201-1/+43
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14191 b3059339-0415-0410-9bf9-f77b7e298cf2
* More French correctionsgpoirier2004-12-191-61/+68
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14190 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hopefully fixes problems with non-working vobsubs.reimar2004-12-191-1/+3
| | | | | | | Applied so it gets some testing before release. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14189 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l fix I hope, reverse if notalex2004-12-191-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14188 b3059339-0415-0410-9bf9-f77b7e298cf2
* Initialize cutoff, too. Fixes crash when AF_CONTROL_COMMAND_LINE is not set.reimar2004-12-191-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14187 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.825wight2004-12-181-4/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14186 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync to 1.825gpoirier2004-12-181-4/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14185 b3059339-0415-0410-9bf9-f77b7e298cf2
* add the flip filter at the end of the filter chain.reimar2004-12-183-1/+23
| | | | | | | Fixes -vf pp -flip and the flip option in the Gui. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14184 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix paragraph indentation.diego2004-12-181-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14183 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes the bug that after opening the preferences panel gmplayer plays filesreimar2004-12-181-1/+2
| | | | | | | very slowly. Seems this was because it used a 4 byte cache afterwards... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14182 b3059339-0415-0410-9bf9-f77b7e298cf2
* added conditional lowres descriptionnicodvb2004-12-181-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14181 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle raw yv12 video as I420 to fix some Broadcast 2000 created samples.diego2004-12-181-0/+3
| | | | | | | patch by Reza Jelveh, approval by Roberto git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14180 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.823: Mention how to concatenate files with -vo yuv4mpeg and ↵gpoirier2004-12-171-2/+4
| | | | | | | | | -fixed-vo. + back to my way of maintaining the date field (for now) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14179 b3059339-0415-0410-9bf9-f77b7e298cf2
* Somebody obviously took a course "coding non-portable".reimar2004-12-171-1/+1
| | | | | | | Pointers are not always 4 bytes! git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14178 b3059339-0415-0410-9bf9-f77b7e298cf2
* Christoph Egger is now the vo_ggi maintainer.diego2004-12-172-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14177 b3059339-0415-0410-9bf9-f77b7e298cf2
* - Fixed mode setting, so any video can be played on all supported ggi targets.diego2004-12-171-84/+154
| | | | | | | | | | - Fixed and enabled draw_slice(). - Only perform flushes in flip_page(). - implemented a primitive dirty region handling to only flush changed area. patch by Christoph Egger <Christoph_Egger at gmx dot de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14176 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention how to concatenate files with -vo yuv4mpeg and -fixed-vo.diego2004-12-171-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14175 b3059339-0415-0410-9bf9-f77b7e298cf2
* some clarificationdiego2004-12-171-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14174 b3059339-0415-0410-9bf9-f77b7e298cf2
* Set mixer.afilter at a more appropriate place.reimar2004-12-171-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14173 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added rawy800 codec as according to the manpage it should be therereimar2004-12-171-0/+9
| | | | | | | (see -rawvideo). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14172 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow Y8 and Y800 as OUT format in codecs.confreimar2004-12-171-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14171 b3059339-0415-0410-9bf9-f77b7e298cf2
* conditional lowres: activate lowres if frame width >= thresholdnicodvb2004-12-171-2/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14170 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync tag bumpwight2004-12-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14169 b3059339-0415-0410-9bf9-f77b7e298cf2
* pre5try2 releasediego2004-12-171-5/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14168 b3059339-0415-0410-9bf9-f77b7e298cf2
* y420 vs i420 typodiego2004-12-1611-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14167 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes suggested by Diegogpoirier2004-12-151-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14166 b3059339-0415-0410-9bf9-f77b7e298cf2
* Security fixes ported from upstream (xine)rtognimp2004-12-151-2/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14165 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix a problem pointed out by iDEFENSE and several similar ones.reimar2004-12-151-1/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14164 b3059339-0415-0410-9bf9-f77b7e298cf2
* Looks like it was too weird after all ;-)reimar2004-12-151-130/+0
| | | | | | | It is not used anymore and might contain more vulnerabilities, thus removed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14163 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix a vulnerability reported by iDEFENSE.reimar2004-12-151-3/+17
| | | | | | | Just for sake of completeness and in case somebody really needs it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14162 b3059339-0415-0410-9bf9-f77b7e298cf2
* disable demuxer_bmp,iive2004-12-153-24/+1
| | | | | | | | that works with signle image in single file. removing is part of vu1nerabi1ity fix. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14161 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix security vulnerability reported by iDEFENSEreimar2004-12-151-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14160 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative sync to 1.821 (1.821, 1.820, 1.819)gpoirier2004-12-151-38/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14159 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable memalign hack for libavcodec when memalign is not present, hopefully ↵faust32004-12-151-0/+1
| | | | | | the mencoder segfaults on mingw are gone now git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14158 b3059339-0415-0410-9bf9-f77b7e298cf2
* printf --> mp_msg conversion, less verbositydiego2004-12-159-45/+92
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14157 b3059339-0415-0410-9bf9-f77b7e298cf2
* credit Daniele Forghieri's work on lavc audio codenicodvb2004-12-141-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14156 b3059339-0415-0410-9bf9-f77b7e298cf2
* small wording fixesdiego2004-12-141-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14155 b3059339-0415-0410-9bf9-f77b7e298cf2
* more details about the structure of VCDsdiego2004-12-141-10/+31
| | | | | | | patch by R. Bernstein <rocky at panix dot com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14154 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.821paszczi2004-12-131-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14153 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.818jheryan2004-12-131-11/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14152 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.153.jheryan2004-12-131-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14151 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify vo_yuv4mpeg filename handling.diego2004-12-121-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14150 b3059339-0415-0410-9bf9-f77b7e298cf2
* printf --> mp_msgdiego2004-12-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14149 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.820wight2004-12-121-33/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14148 b3059339-0415-0410-9bf9-f77b7e298cf2
* better mention -vo yuv4mpeg can change output filenamewight2004-12-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14147 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix leak with -fixed-vo, allow concatenatingreimar2004-12-122-4/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14146 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix streaming if not mlti_data (for some non-multirate streams)rtognimp2004-12-111-2/+4
| | | | | | | Also closes bug #151 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14145 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some fixes and better wording, remove alsa9 and alsa1x audio output driversdiego2004-12-111-30/+24
| | | | | | | and make some numeric options line up properly. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14144 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improving gl2 under windows, moving some functionality to gl_commonreimar2004-12-115-37/+95
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14143 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove alsa9 and alsa1x entries as well as duplicate video output drivers.diego2004-12-111-146/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14142 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, should check for != NULL before using not after...reimar2004-12-101-1/+2
| | | | | | | fixes speed setting with -nosound, fix by uau on IRC git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14141 b3059339-0415-0410-9bf9-f77b7e298cf2
* language fixpaszczi2004-12-094-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14140 b3059339-0415-0410-9bf9-f77b7e298cf2
* make clean should also clean the native subdirectory.diego2004-12-091-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14139 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.58wight2004-12-081-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14138 b3059339-0415-0410-9bf9-f77b7e298cf2
* - corrected <device< to <device>wight2004-12-081-2/+2
| | | | | | | - option is extralibdir, not extralib git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14137 b3059339-0415-0410-9bf9-f77b7e298cf2
* disable all unknown formats in the windows aosfaust32004-12-082-0/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14136 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync + random fixespaszczi2004-12-084-148/+261
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14135 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for "NONE" audio in MOV files generated by Kodak CX6230rtognimp2004-12-071-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14134 b3059339-0415-0410-9bf9-f77b7e298cf2
* More French fixesgpoirier2004-12-071-25/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14133 b3059339-0415-0410-9bf9-f77b7e298cf2
* Default rescaler is 2; bicubicgpoirier2004-12-071-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14132 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.20gabrov2004-12-071-9/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14131 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.50gabrov2004-12-071-7/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14130 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.57gabrov2004-12-071-11/+123
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14129 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for dvhs and h264 over tsnicodvb2004-12-071-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14128 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL updatesdiego2004-12-071-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14127 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates, typodiego2004-12-071-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14126 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicate includes.diego2004-12-072-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14125 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make include paths consistent.diego2004-12-0721-52/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14124 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove dead link.diego2004-12-071-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14123 b3059339-0415-0410-9bf9-f77b7e298cf2
* link updates, noticed by Nicolas Le Gaillartdiego2004-12-073-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14122 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording fixdiego2004-12-061-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14121 b3059339-0415-0410-9bf9-f77b7e298cf2
* some French fixes here and there: some better translations and better tech wordsgpoirier2004-12-061-30/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14120 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix byteordermichael2004-12-061-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14119 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.56 (link update)gabrov2004-12-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14118 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.57 (link updates)gabrov2004-12-061-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14117 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.22gabrov2004-12-061-4/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14116 b3059339-0415-0410-9bf9-f77b7e298cf2
* More detailed HP-UX instructions, mostly taken from Martin Gansser's HOWTO.diego2004-12-061-10/+121
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14115 b3059339-0415-0410-9bf9-f77b7e298cf2
* link updatesdiego2004-12-054-12/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14114 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_alsa and ao_polyp added, typo.diego2004-12-051-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14113 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.16 (new mailing list)gabrov2004-12-051-2/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14112 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some other fixes. Better wordings and better translations of tech stuffgpoirier2004-12-051-27/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14111 b3059339-0415-0410-9bf9-f77b7e298cf2
* A great deal of French fixes (Nico doesn't seem to be an "audio litterate" ;-)gpoirier2004-12-051-57/+61
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14110 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.16wight2004-12-051-4/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14109 b3059339-0415-0410-9bf9-f77b7e298cf2
* French fixesgpoirier2004-12-051-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14108 b3059339-0415-0410-9bf9-f77b7e298cf2
* some fixes, mainly wrong translationsgpoirier2004-12-051-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14107 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.818:gpoirier2004-12-051-3/+5
| | | | | | | | 1.818: keyframes are more like 10 - 20 seconds apart, not 120. 1.817: Add a file= suboption to set output file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14106 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPlayer-translations mailing list created.diego2004-12-051-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14105 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.818 and vocabulary fixwight2004-12-051-15/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14104 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use common labels.diego2004-12-044-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14103 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a file= suboption to set output file. (stream.yuv -> %s)kraymer2004-12-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14102 b3059339-0415-0410-9bf9-f77b7e298cf2
* new sync, first was fucked upnicolas2004-12-041-70/+118
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14101 b3059339-0415-0410-9bf9-f77b7e298cf2
* content moved to usage.xml, file no more needednicolas2004-12-041-71/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14100 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync, typo fixes, better wordingnicolas2004-12-0318-1133/+1590
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14099 b3059339-0415-0410-9bf9-f77b7e298cf2
* keyframes are more like 10 - 20 seconds apart, not 120.reimar2004-12-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14098 b3059339-0415-0410-9bf9-f77b7e298cf2
* yuv4mpeg now has file suboptionreimar2004-12-031-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14097 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add a file= suboption to set output file.reimar2004-12-033-23/+45
| | | | | | | Patch by Olivier Rolland (( billl |at| users <dot> sf <dot> net )). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14096 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove old buggy workaround. kerneltwosix.h itself will be removed soon if ↵rfelker2004-12-033-3/+0
| | | | | | this doesn't cause problems git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14095 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify all image encoding examples and fix a typo (*.jpg vs *.png) noticeddiego2004-12-031-4/+4
| | | | | | | by Nicolas Tourmentine. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14094 b3059339-0415-0410-9bf9-f77b7e298cf2
* dvd_aid_from_lang() should return -1 if lang was not foundaurel2004-12-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14093 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.17gabrov2004-12-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14092 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move selection of internal texture format to appropriate place, shouldreimar2004-12-031-59/+51
| | | | | | | be at texture initialization as visual might change. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14091 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the context not current before destroying it.reimar2004-12-021-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14090 b3059339-0415-0410-9bf9-f77b7e298cf2
* mention new -key-fifo-size optionreimar2004-12-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14089 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable the run slave commande even without libmenuaurel2004-12-024-6/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14088 b3059339-0415-0410-9bf9-f77b7e298cf2
* better labeldiego2004-12-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14087 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add "Available video filters:" line to -vf help.diego2004-12-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14086 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.8.16: Better wording, better explain -nodouble.gpoirier2004-12-011-4/+2
| | | | | | | + a couple of 10l introduced just minutes ago. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14085 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync withgpoirier2004-12-011-13/+31
| | | | | | | | | | | | 1.815: use a configurable-size ringbuffer instead of a pipe for buffering key events. 1.814: sstep is usually inaccurate. 1.813: -identify now prints subtitle/audio track information. 1.812: -double is now default, thus -nodouble needs to be documented instead. Slightly reworded the description of -nodouble. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14084 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not bring process to front if HAVE_SDLnplourde2004-12-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14083 b3059339-0415-0410-9bf9-f77b7e298cf2
* clear menubar before adding new menunplourde2004-12-011-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14082 b3059339-0415-0410-9bf9-f77b7e298cf2
* suppress dummy frames due to B-frame delay.lorenm2004-12-011-5/+21
| | | | | | | flush delayed frames. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14081 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better wording, better explain -nodouble.diego2004-12-011-12/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14080 b3059339-0415-0410-9bf9-f77b7e298cf2
* More similar code from gl and gl2 moved to gl_commonreimar2004-12-014-159/+177
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14079 b3059339-0415-0410-9bf9-f77b7e298cf2
* use a configurable-size ringbuffer instead of a pipe for buffering key events.reimar2004-12-014-7/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14078 b3059339-0415-0410-9bf9-f77b7e298cf2
* sstep is usually inaccurate.reimar2004-12-011-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14077 b3059339-0415-0410-9bf9-f77b7e298cf2
* reserve enough memory for imagehenry2004-12-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14076 b3059339-0415-0410-9bf9-f77b7e298cf2
* call draw_slice in top-down order (fixes crash with -vf expand=...,scale)henry2004-12-011-9/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14075 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix image dimensions at filter config timehenry2004-12-013-2/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14074 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.152, minor bugfix.jheryan2004-12-011-7/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14073 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync to 1.811, bugfixjheryan2004-12-011-58/+94
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14072 b3059339-0415-0410-9bf9-f77b7e298cf2
* -identify now prints subtitle/audio track information.diego2004-11-301-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14071 b3059339-0415-0410-9bf9-f77b7e298cf2
* -double is now default, thus -nodouble needs to be documented instead.diego2004-11-301-10/+10
| | | | | | | Slightly reworded the description of -nodouble. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14070 b3059339-0415-0410-9bf9-f77b7e298cf2
* very old 10l, discussed a long time ago but never fixed (default should be ↵rfelker2004-11-301-1/+1
| | | | | | same vol, not -10 dB) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14069 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncedpaszczi2004-11-302-13/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14068 b3059339-0415-0410-9bf9-f77b7e298cf2
* it's stupid for the default to be something both slower (for xv+dr) and ↵rfelker2004-11-301-1/+1
| | | | | | visually incorrect.. use -nodouble if you want old behavior git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14067 b3059339-0415-0410-9bf9-f77b7e298cf2
* more verbosity spam fixesrfelker2004-11-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14066 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.55 (better label, new entry)gabrov2004-11-301-2/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14065 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.56 (better label)gabrov2004-11-301-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14064 b3059339-0415-0410-9bf9-f77b7e298cf2
* build fix, reflection English doc changewight2004-11-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14063 b3059339-0415-0410-9bf9-f77b7e298cf2
* better labeldiego2004-11-292-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14062 b3059339-0415-0410-9bf9-f77b7e298cf2
* FAQ about audio-only encoding (approved by Diego)rathann2004-11-291-0/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14061 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain how (not) to handle execute permissions and binary files.diego2004-11-291-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14060 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make use of the default duration for one frame if it is present in the file. ↵mosu2004-11-281-0/+3
| | | | | | This produces much smoother timecodes for laced audio frames. And I REALLY don't know why I missed that before... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14059 b3059339-0415-0410-9bf9-f77b7e298cf2
* new lavc codec: ffvhufflorenm2004-11-283-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14058 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compile fixranma2004-11-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14057 b3059339-0415-0410-9bf9-f77b7e298cf2
* fl32: BE float32 PCM audio in mov filesrtognimp2004-11-272-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14056 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added support for MPEG-1 and MPEG-2 in Matroska.mosu2004-11-262-4/+137
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14055 b3059339-0415-0410-9bf9-f77b7e298cf2
* rescale the fonts with hidden OSD toohenry2004-11-261-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14054 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove the rest of fb_dev_name + directfb usage.syrjala2004-11-261-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14053 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.49gabrov2004-11-261-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14052 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.55gabrov2004-11-261-9/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14051 b3059339-0415-0410-9bf9-f77b7e298cf2
* fb_dev_name no longer user in vo directfbzdar2004-11-261-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14050 b3059339-0415-0410-9bf9-f77b7e298cf2
* We now only support directfb >= 0.9.13.diego2004-11-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14049 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Philippe De Swert <philippedeswert at pi dot be>diego2004-11-251-2/+375
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14048 b3059339-0415-0410-9bf9-f77b7e298cf2
* Output more information about vids, aids, sids, alangs and slangs with ↵mosu2004-11-259-1/+103
| | | | | | -identify. Patch by kiriuja <mplayer-patches@en-directo.net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14047 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l for me => is not >=zdar2004-11-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14046 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL update, more concise descriptiondiego2004-11-251-9/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14045 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removal of vo_directfb.c. From now DirectFB => 0.9.13 is required for vo ↵zdar2004-11-251-1872/+0
| | | | | | directfb. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14044 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removal of vo_directfb.c (configure part). From now DirectFB => 0.9.13 is ↵zdar2004-11-251-5/+9
| | | | | | required for vo directfb. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14043 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l initial patch by Oded Shimon <ods15 at ods15.dyndns.org>faust32004-11-251-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14042 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.811 using gvim find/replace option. Hope I got them all...gpoirier2004-11-251-22/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14041 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.802: Mention unichrome_vid in the list of VIDIX driverskraymer2004-11-241-12/+33
| | | | | | | | | | | 1.805: allow forcing of software volume control and setting maximum amplification 1.806: various (partly) 1.809: head related transfer function 1.810: updates in -tv - section 1.811: MPEG-X spelling git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14040 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-11-243-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14039 b3059339-0415-0410-9bf9-f77b7e298cf2
* further updates in video filters sectionkraymer2004-11-241-44/+204
| | | | | | | wording: Schwellwert -> Schwellenwert git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14038 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fix :)paszczi2004-11-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14037 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.811 + some small language fixpaszczi2004-11-241-21/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14036 b3059339-0415-0410-9bf9-f77b7e298cf2
* merged DEMUXER_TYPE_MPEG4_ES in the ordinary TS; added support for H264 in TSnicodvb2004-11-244-42/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14035 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.48 (MPEG-X spelling)gabrov2004-11-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14034 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.12 (MPEG-X spelling)gabrov2004-11-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14033 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.16 (MPEG-X spelling)gabrov2004-11-241-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14032 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.53 (MPEG-X spelling)gabrov2004-11-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14031 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.20 (MPEG-X spelling) and small fixgabrov2004-11-241-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14030 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.55 (MPEG-X spelling)gabrov2004-11-241-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14029 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.810danny2004-11-241-214/+400
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14028 b3059339-0415-0410-9bf9-f77b7e298cf2
* Separate XML and man page translation maintainers.diego2004-11-241-8/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14027 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPEG-X spellingdiego2004-11-243-42/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14026 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPEG-X spellingdiego2004-11-249-77/+77
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14025 b3059339-0415-0410-9bf9-f77b7e298cf2
* set sample aspect ratiolorenm2004-11-241-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14024 b3059339-0415-0410-9bf9-f77b7e298cf2
* removing strange csp matching code (was copy&pasted from vf_pp where it ↵michael2004-11-231-12/+2
| | | | | | | | | originated from arpi 2.5 years ago) -> fixes spp+scale+x11 crash dont disable the filter by default (100l for iive) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14023 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove broken support for directbuffer and including frame-handling use.iive2004-11-231-178/+8
| | | | | | | | | Allows using of directrendering for hw acceleration, with fallbacl to directbuffer. No more black frames. No more flickering. patch by Christoph Egger, approved by al3x git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14022 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2004-11-232-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14021 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling and small updatesdiego2004-11-231-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14020 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.54gabrov2004-11-221-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14019 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try port 7070 if 554 fails for realrtsp streamsrtognimp2004-11-221-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14018 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix segfault with (height|width)%6!=0henry2004-11-221-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14017 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert useless uyvy planar->packed converterhenry2004-11-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14016 b3059339-0415-0410-9bf9-f77b7e298cf2
* check for __builtin_expect (used by libmpeg2)henry2004-11-221-0/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14015 b3059339-0415-0410-9bf9-f77b7e298cf2
* revert useless uyvy planar->packed converterhenry2004-11-222-128/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14014 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1e6l fix (use 422P instead of UYVY)henry2004-11-221-32/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14013 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added maintainer of czech translation related filesjheryan2004-11-222-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14012 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.149 and retranslations of some messages for consistency with ↵jheryan2004-11-221-187/+440
| | | | | | manpage by Jiri Heryan. Applied some suggestions of Tomas Blaha and Jiri Svoboda. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14011 b3059339-0415-0410-9bf9-f77b7e298cf2
* *** empty log message ***jheryan2004-11-221-430/+491
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14010 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.810: wordinggpoirier2004-11-211-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14009 b3059339-0415-0410-9bf9-f77b7e298cf2
* typorathann2004-11-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14008 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore normal/double size GUI functionality ( broken since EWMH fs support ).al2004-11-211-12/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14007 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.810 + some wordingwight2004-11-211-4/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14006 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain what you need to read to add a codec yourself, patch bydiego2004-11-211-0/+6
| | | | | | | Compn <tempn at twmi dot rr dot com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14005 b3059339-0415-0410-9bf9-f77b7e298cf2
* wordingdiego2004-11-211-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14004 b3059339-0415-0410-9bf9-f77b7e298cf2
* forced autodetection of file format when content-type is video-x-mpeg to ↵nicodvb2004-11-211-3/+3
| | | | | | give mpeg-ts a chance git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14003 b3059339-0415-0410-9bf9-f77b7e298cf2
* The GUI shouldn't handle key events at two places.al2004-11-211-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14002 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.809, with a different phrasing than original English one.gpoirier2004-11-211-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14001 b3059339-0415-0410-9bf9-f77b7e298cf2
* should be \$ not $\wight2004-11-201-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@14000 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some fixes by myself and compn <tempn at twmi dot rr dot com>diego2004-11-201-23/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13999 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for debianized LIVE.COM libraryhenry2004-11-202-17/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13998 b3059339-0415-0410-9bf9-f77b7e298cf2
* head related transfer functionhenry2004-11-205-1/+902
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13997 b3059339-0415-0410-9bf9-f77b7e298cf2
* libmpeg2 4:2:2 decodinghenry2004-11-204-31/+194
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13996 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for 192 packet size, remove junk data after 188 bytes. Patch ↵nicodvb2004-11-201-10/+28
| | | | | | by Marcus Metzler (mocm@mocm.de) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13995 b3059339-0415-0410-9bf9-f77b7e298cf2
* 4 and 8 bit formats use a palette, so we cannot really support them (atm).reimar2004-11-201-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13994 b3059339-0415-0410-9bf9-f77b7e298cf2
* 4 and 8 bit formats work with a palette.reimar2004-11-201-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13993 b3059339-0415-0410-9bf9-f77b7e298cf2
* add "pausing" prefix for MPlayer commandsreimar2004-11-204-1/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13992 b3059339-0415-0410-9bf9-f77b7e298cf2
* - sync 1.808wight2004-11-201-120/+164
| | | | | | | - some random language fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13991 b3059339-0415-0410-9bf9-f77b7e298cf2
* declare check_format and check_bps static, they are used nowhere else.reimar2004-11-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13990 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with latest versionspaszczi2004-11-193-25/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13989 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.13gabrov2004-11-191-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13988 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.15 (URL update)gabrov2004-11-191-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13987 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.52 (URL update)gabrov2004-11-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13986 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.53 (URL update)gabrov2004-11-191-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13985 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.21 (URL update)gabrov2004-11-191-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13984 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.808: v4l2 norm settinggpoirier2004-11-191-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13983 b3059339-0415-0410-9bf9-f77b7e298cf2
* correct encodingdiego2004-11-192-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13982 b3059339-0415-0410-9bf9-f77b7e298cf2
* 24bit LPCM is signed...reimar2004-11-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13981 b3059339-0415-0410-9bf9-f77b7e298cf2
* v4l2 norm settinghenry2004-11-191-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13980 b3059339-0415-0410-9bf9-f77b7e298cf2
* setting the norm using text ID instead of numerichenry2004-11-193-12/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13979 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL updatesdiego2004-11-196-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13978 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL updates with some help by Gabor Mizdadiego2004-11-191-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13977 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar fix by the Wandererdiego2004-11-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13976 b3059339-0415-0410-9bf9-f77b7e298cf2
* one more DivX --> MPEG4 changediego2004-11-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13975 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo patch by Gabor Mizdadiego2004-11-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13974 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync to 1.807:gpoirier2004-11-181-10/+23
| | | | | | | | sync to x264 r61 (improved 2pass ratecontrol) rename option 'fullinter' to '4x4mv' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13973 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.13gabrov2004-11-181-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13972 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.50gabrov2004-11-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13971 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.19gabrov2004-11-181-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13970 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial translation, synced to 1.11gabrov2004-11-181-0/+326
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13969 b3059339-0415-0410-9bf9-f77b7e298cf2
* Language fixeswight2004-11-181-16/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13968 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.19 + some language fixeswight2004-11-181-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13967 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to x264 r61 (improved 2pass ratecontrol)lorenm2004-11-182-13/+31
| | | | | | | rename option 'fullinter' to '4x4mv' git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13966 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.806: various fixes, and some long standing french fixesgpoirier2004-11-171-13/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13965 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed missing para taggabrov2004-11-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13964 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.12, fixed headergabrov2004-11-171-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13963 b3059339-0415-0410-9bf9-f77b7e298cf2
* DivX is MPEG4, so let's call it MPEG4 to avoid confusion.diego2004-11-174-13/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13962 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better explanation of how to build an MPlayer that runs on differentdiego2004-11-171-1/+5
| | | | | | | machine types, based on a patch by Gabor Mizda. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13961 b3059339-0415-0410-9bf9-f77b7e298cf2
* miscellaneous fixesdiego2004-11-171-18/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13960 b3059339-0415-0410-9bf9-f77b7e298cf2
* Audio plugins are now audio filters, noticed by Gabor Mizda.diego2004-11-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13959 b3059339-0415-0410-9bf9-f77b7e298cf2
* added language identifier (if any) to the caller during probing phasenicodvb2004-11-151-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13958 b3059339-0415-0410-9bf9-f77b7e298cf2
* free freetype descriptor and library and mconfig data right before exitiive2004-11-151-6/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13957 b3059339-0415-0410-9bf9-f77b7e298cf2
* Free WAVEFORMATEX in sh_audio when all other sh_audio members are freed.iive2004-11-151-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13956 b3059339-0415-0410-9bf9-f77b7e298cf2
* Extended support for other object type IDs in the ESDS. This enables e.g. ↵mosu2004-11-152-1/+38
| | | | | | MPEG2 video in the MP4 container. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13955 b3059339-0415-0410-9bf9-f77b7e298cf2
* 3 memory leaks fixediive2004-11-152-2/+8
| | | | | | | Xlib funtions allocate memory that should be freed appropriately git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13954 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial translation, synced to 1.10gabrov2004-11-151-0/+183
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13953 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to 1.23gabrov2004-11-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13952 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to 1.54gabrov2004-11-151-1/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13951 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to 1.49, little fixgabrov2004-11-151-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13950 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixdiego2004-11-151-8/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13949 b3059339-0415-0410-9bf9-f77b7e298cf2
* wordingdiego2004-11-151-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13948 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce excessive verbosity.diego2004-11-1511-23/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13947 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for Lsvc codecrtognimp2004-11-141-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13946 b3059339-0415-0410-9bf9-f77b7e298cf2
* Vianet Lsvx video decoderrtognimp2004-11-141-0/+10
| | | | | | | Patch by Cesar Ramos Lopez ( x-files at telefonica dot net ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13945 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update for WVP2, fixed codec name from picture to imagertognimp2004-11-141-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13944 b3059339-0415-0410-9bf9-f77b7e298cf2
* Windows media video 9 image v2 supportrtognimp2004-11-141-0/+1
| | | | | | | Patch by Cesar Ramos Lopez git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13943 b3059339-0415-0410-9bf9-f77b7e298cf2
* My e-mail address has changedgpoirier2004-11-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13942 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.805:gpoirier2004-11-141-12/+24
| | | | | | | | | | | | 1.805: allow forcing of software volume control and setting maximum amplification. 1.804: update description of lavc's keyint, vb_strategy, and mbqmin. 1.803 (done by Diego) 1.802: Mention unichrome_vid in the list of VIDIX drivers patch by Timothy Lee <timothy dot lee at siriushk dot com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13941 b3059339-0415-0410-9bf9-f77b7e298cf2
* More detailed Debian package building instructions, based on a patch bydiego2004-11-141-0/+18
| | | | | | | Guillaume Poirier <guillaume dot poirier at ifsic dot univ-rennes1 dot fr> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13940 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling, wordingdiego2004-11-141-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13939 b3059339-0415-0410-9bf9-f77b7e298cf2
* document last status line entryattila2004-11-141-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13938 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix crash when a "driver" line is missing in codecs.conf.reimar2004-11-141-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13937 b3059339-0415-0410-9bf9-f77b7e298cf2
* keep screensaver off when playing multiple files.reimar2004-11-141-0/+3
| | | | | | | patch by rgselknospam (at) yahoo [dot] com. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13936 b3059339-0415-0410-9bf9-f77b7e298cf2
* -softvol and -softvol-max parametersreimar2004-11-141-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13935 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow forcing of software volume control and setting maximum amplification.reimar2004-11-144-9/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13934 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix: when doing -loop 0 -shuffle, the arg after shuffle was skippedreimar2004-11-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13933 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial translation, synced to 1.10gabrov2004-11-141-0/+340
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13932 b3059339-0415-0410-9bf9-f77b7e298cf2
* update description of lavc's keyint, vb_strategy, and mbqmin.lorenm2004-11-141-9/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13931 b3059339-0415-0410-9bf9-f77b7e298cf2
* MSS2 can decode also MSS1rtognimp2004-11-131-1/+2
| | | | | | | xanim h261 codec does not work git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13930 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix scrolling status line in windowsreimar2004-11-131-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13929 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL update, noticed by Gabor Mizda.diego2004-11-136-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13928 b3059339-0415-0410-9bf9-f77b7e298cf2
* Avoid drawing before transformation matrices are set up.reimar2004-11-131-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13927 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix for negative values for width and height (aspect-preserving scaling).reimar2004-11-121-27/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13926 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync tag bumpwight2004-11-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13925 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with structure changeswight2004-11-115-141/+136
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13924 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.803wight2004-11-111-27/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13923 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing declaration of releaseGlContextreimar2004-11-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13922 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing return for InitGl functionreimar2004-11-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13921 b3059339-0415-0410-9bf9-f77b7e298cf2
* added fourcc of PNG-encoded Quicktime filesreimar2004-11-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13920 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fix for gcc 3.4.2reimar2004-11-112-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13919 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fix and partial syncdiego2004-11-114-54/+51
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13918 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fixdiego2004-11-112-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13917 b3059339-0415-0410-9bf9-f77b7e298cf2
* devices.html is no more, link updated.diego2004-11-1122-25/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13916 b3059339-0415-0410-9bf9-f77b7e298cf2
* devices.html is no more, links updated.diego2004-11-112-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13915 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update links to match the XML docs structure change.diego2004-11-118-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13914 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove pointless devices section, make video and audio top level sections.diego2004-11-115-136/+133
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13913 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial translation, synced to 1.19gabrov2004-11-101-0/+1230
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13912 b3059339-0415-0410-9bf9-f77b7e298cf2
* osx finder supportnplourde2004-11-101-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13911 b3059339-0415-0410-9bf9-f77b7e298cf2
* add support for macosx finder argument support (let you bundle mplayer to be ↵nplourde2004-11-105-0/+140
| | | | | | a finder compliant .app) patch by Chris Roccati <roccati@pobox.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13910 b3059339-0415-0410-9bf9-f77b7e298cf2
* small clarification and syntactic fix (approved by Diego)rathann2004-11-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13909 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix --disable-termios, approved by Diegorathann2004-11-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13908 b3059339-0415-0410-9bf9-f77b7e298cf2
* use get_screen_size from getch2.c instead of ioctl, fixes bug #131.reimar2004-11-091-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13907 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lgpoirier2004-11-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13906 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.23 + language fixeswight2004-11-081-215/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13905 b3059339-0415-0410-9bf9-f77b7e298cf2
* redundant "Note:" removedwight2004-11-081-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13904 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial translation, synced to 1.51gabrov2004-11-081-0/+900
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13903 b3059339-0415-0410-9bf9-f77b7e298cf2
* h/w revision detection patch by Timothy Lee <timothy.lee@siriushk.com>faust32004-11-081-1/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13902 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mention unichrome_vid in the list of VIDIX driversdiego2004-11-083-3/+6
| | | | | | | patch by Timothy Lee <timothy dot lee at siriushk dot com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13901 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.51 and wordingwight2004-11-081-12/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13900 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial translation, synced to 1.12gabrov2004-11-081-0/+479
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13899 b3059339-0415-0410-9bf9-f77b7e298cf2
* Converted printf calls to mp_msg, reduced verbosity.diego2004-11-081-14/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13898 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.53gabrov2004-11-071-16/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13897 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle "tail" and "head" properly. If using "-1" does not work then use "-n ↵mosu2004-11-071-11/+25
| | | | | | 1". Throw away warnings in both cases. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13896 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some work on the XviD section:gpoirier2004-11-072-23/+62
| | | | | | | | | - better divx5bvop description - "new" (no)packed and (no)closed_gop options explained - more appropriate wordings git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13895 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix insane CPU usage with ao_nullreimar2004-11-071-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13894 b3059339-0415-0410-9bf9-f77b7e298cf2
* We no longer provide (int)types.h for obsolete versions of Cygwin/MinGW,diego2004-11-071-12/+6
| | | | | | | links updated. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13893 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mac OS X shlib support has been replaced by support for Helix codecs.diego2004-11-071-10/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13892 b3059339-0415-0410-9bf9-f77b7e298cf2
* more changesdiego2004-11-071-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13891 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improved A-V sync, patch by Ed Wildgoose [lists(at)wildgooses<dot>com].reimar2004-11-071-7/+68
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13890 b3059339-0415-0410-9bf9-f77b7e298cf2
* initial translation, synced to 1.22gabrov2004-11-061-0/+383
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13889 b3059339-0415-0410-9bf9-f77b7e298cf2
* respect immed uninit flag, initialize ao_data.outburst.reimar2004-11-061-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13888 b3059339-0415-0410-9bf9-f77b7e298cf2
* recommit sascha's commit (Lennart Poettering's polyaudio stuff)rfelker2004-11-061-0/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13887 b3059339-0415-0410-9bf9-f77b7e298cf2
* little video filters updatekraymer2004-11-051-5/+63
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13886 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix "last file is always played last" bug.reimar2004-11-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13885 b3059339-0415-0410-9bf9-f77b7e298cf2
* And some corrections approved by frogu.wight2004-11-051-17/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13884 b3059339-0415-0410-9bf9-f77b7e298cf2
* Replaces edl_mute_count with togle making code more understandable, other ↵reynaldo2004-11-051-9/+9
| | | | | | trivial list suggested changes too, Patch by Oded Shimon git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13883 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix member alignment for usage on 64bit processors.mosu2004-11-051-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13882 b3059339-0415-0410-9bf9-f77b7e298cf2
* Changes the word "frontend" to "module"gpoirier2004-11-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13881 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_polypfaust32004-11-051-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13880 b3059339-0415-0410-9bf9-f77b7e298cf2
* polyaudio audio driver patch by Lennart Poettering <mzzcynlre at 0pointer.de>faust32004-11-055-2/+336
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13879 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32004-11-051-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13878 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to 1.46frogu2004-11-051-8/+67
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13877 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to 1.66frogu2004-11-051-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13876 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain how to use custom options while building Debian packages, based on adiego2004-11-051-0/+14
| | | | | | | patch by Guillaume Poirier. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13875 b3059339-0415-0410-9bf9-f77b7e298cf2
* slight grammar/wording/spelling/markup improvementsdiego2004-11-051-18/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13874 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix "stuck mouse button" by setting O_NONBLOCK, instead of using select() to ↵iive2004-11-051-16/+17
| | | | | | | | | check write() blocking on pipe. Marius Gedminas have located the bug as send original patch. Modified version by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13873 b3059339-0415-0410-9bf9-f77b7e298cf2
* more fullscreen fixes and gl2 uses setGlWindow.reimar2004-11-043-56/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13872 b3059339-0415-0410-9bf9-f77b7e298cf2
* added myselfgabrov2004-11-031-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13871 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added Gabor Mizda (myself) as maintainer of the hungarian translationgabrov2004-11-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13870 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix broken seek while on edl and audio only, spoted by Oded Shimonreynaldo2004-11-031-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13869 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix EDL mute behavior, Patch by Oded Shimonreynaldo2004-11-031-29/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13868 b3059339-0415-0410-9bf9-f77b7e298cf2
* add Loren Merritt as ve_x264 maintainerlorenm2004-11-031-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13867 b3059339-0415-0410-9bf9-f77b7e298cf2
* proper gcc4 compile-fix suggested by richardatmos42004-11-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13866 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable mmx support on x86_64 in libmpeg2aurel2004-11-037-77/+163
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13865 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.52gabrov2004-11-031-7/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13864 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced to 1.15gabrov2004-11-031-80/+93
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13863 b3059339-0415-0410-9bf9-f77b7e298cf2
* - the sync with XviD's API-4.1 has beengpoirier2004-11-031-1/+2
| | | | | | | | made both for the decoder and the encoder front-end - x264 and lavc support 3-pass encode git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13862 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove mac shlb support to use new helix codec for realvideo support on osxnplourde2004-11-034-237/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13861 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavcodec.so headers patch by (Glenn Washburn <glenniii at mail dot utexas ↵michael2004-11-031-0/+5
| | | | | | dot edu>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13860 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed some doxygen comments, patch by Oded Shimonreynaldo2004-11-031-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13859 b3059339-0415-0410-9bf9-f77b7e298cf2
* reworked the status line to avoid scrolling and remove duplicate code.reimar2004-11-021-57/+117
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13858 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove window shadow in fullscreennplourde2004-11-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13857 b3059339-0415-0410-9bf9-f77b7e298cf2
* set aqua default themenplourde2004-11-021-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13856 b3059339-0415-0410-9bf9-f77b7e298cf2
* Syncgpoirier2004-11-021-53/+52
| | | | | | | | | 1.800: have each XviD's option flag have its (no)counterpart 1.799: vo_gl should work fine with -fixed-vo + some French fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13855 b3059339-0415-0410-9bf9-f77b7e298cf2
* have each XviD's option flag have its (no)counterpartgpoirier2004-11-022-16/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13854 b3059339-0415-0410-9bf9-f77b7e298cf2
* icons for the GUI context menudiego2004-11-0240-71/+2936
| | | | | | | patch by Piero di Vita <scognito at acaro dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13853 b3059339-0415-0410-9bf9-f77b7e298cf2
* winvidix requires -lgdi32faust32004-11-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13852 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-11-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13851 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling, wording, updatesdiego2004-11-021-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13850 b3059339-0415-0410-9bf9-f77b7e298cf2
* further sync by Carl Furstenberg <azatoth at gmail dot com>diego2004-11-021-155/+219
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13849 b3059339-0415-0410-9bf9-f77b7e298cf2
* several updates in video filters section, almost finished synckraymer2004-11-021-104/+221
| | | | | | | | added a tag to indicate how far the sync process has gone 1.799: vo_gl should work fine with -fixed-vo git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13848 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable vcd support on all based darwin systemnplourde2004-11-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13847 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.799wight2004-11-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13846 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_gl should work fine with -fixed-voreimar2004-11-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13845 b3059339-0415-0410-9bf9-f77b7e298cf2
* fullscreen fixes and GUI support for vo_glreimar2004-11-015-57/+209
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13844 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix build on darwin ppcnplourde2004-11-011-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13843 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not hide mouse and menubar in fulscreen if not using main devicenplourde2004-11-011-4/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13842 b3059339-0415-0410-9bf9-f77b7e298cf2
* more panscan fixnplourde2004-11-011-19/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13841 b3059339-0415-0410-9bf9-f77b7e298cf2
* small compilation fixrathann2004-11-011-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13840 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fix to find DocBook DTD in more exotic locations likerathann2004-11-011-1/+1
| | | | | | | /usr/share/sgml/docbook/xml-dtd-4.1.2-1.0-22.1/docbookx.dtd git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13839 b3059339-0415-0410-9bf9-f77b7e298cf2
* Memleak fix: free index data at demuxer_closertognimp2004-11-011-1/+6
| | | | | | | Patch by Wei Jiang ( jiangw98 at yahoo dot com ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13838 b3059339-0415-0410-9bf9-f77b7e298cf2
* More changesrtognimp2004-11-011-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13837 b3059339-0415-0410-9bf9-f77b7e298cf2
* osx port relatednplourde2004-10-311-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13836 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo, found by Nico Sabbirtognimp2004-10-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13835 b3059339-0415-0410-9bf9-f77b7e298cf2
* more pre6 changes by Roberto and mediego2004-10-311-20/+88
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13834 b3059339-0415-0410-9bf9-f77b7e298cf2
* Different buffering scheme, avoiding possible races (SDL is using threads!).reimar2004-10-311-61/+68
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13833 b3059339-0415-0410-9bf9-f77b7e298cf2
* French fixesgpoirier2004-10-311-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13832 b3059339-0415-0410-9bf9-f77b7e298cf2
* some people have GREP_OPTIONS set to --ignore-case what makes it a bit ↵faust32004-10-311-3/+4
| | | | | | dangerous to rely on the string MPlayer for the big endian check git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13831 b3059339-0415-0410-9bf9-f77b7e298cf2
* gcc-4 compile fix: invalid lvalue in assignmentatmos42004-10-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13830 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix erroneus extern declarations, fix wrong signedness of some varsatmos42004-10-311-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13829 b3059339-0415-0410-9bf9-f77b7e298cf2
* gcc-4.0.0-20041024 compile-fixatmos42004-10-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13828 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update decoders sectionrtognimp2004-10-311-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13827 b3059339-0415-0410-9bf9-f77b7e298cf2
* QuickDraw video decoding support via lavcrtognimp2004-10-311-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13826 b3059339-0415-0410-9bf9-f77b7e298cf2
* a few 10l fixes by Wei Jiang <jiangw98@yahoo.com>faust32004-10-311-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13825 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.15wight2004-10-311-11/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13824 b3059339-0415-0410-9bf9-f77b7e298cf2
* preliminary pre6 changes from Reimardiego2004-10-311-0/+72
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13823 b3059339-0415-0410-9bf9-f77b7e298cf2
* QuickSilver skin author, typodiego2004-10-301-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13822 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with homepagediego2004-10-301-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13821 b3059339-0415-0410-9bf9-f77b7e298cf2
* (re-)synced with 1.798 downto video filters sectionkraymer2004-10-301-23/+94
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13820 b3059339-0415-0410-9bf9-f77b7e298cf2
* window now save is old position when going in fullscreen or while using ↵nplourde2004-10-301-9/+9
| | | | | | resize preset git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13819 b3059339-0415-0410-9bf9-f77b7e298cf2
* (re-)sync downto decoding/filtering optionskraymer2004-10-301-51/+127
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13818 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync tag bump, forgot previouslywight2004-10-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13817 b3059339-0415-0410-9bf9-f77b7e298cf2
* -sync 1.798wight2004-10-301-263/+353
| | | | | | | -some Polish fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13816 b3059339-0415-0410-9bf9-f77b7e298cf2
* -sync 1.52wight2004-10-301-26/+24
| | | | | | | -trailing whitespace cosmetics git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13815 b3059339-0415-0410-9bf9-f77b7e298cf2
* Marillat's homepage has moved.diego2004-10-301-6/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13814 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync tag bumpwight2004-10-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13813 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to 1.151 (but doesn't reflect according changes in help_mp-en.h; it'skraymer2004-10-301-1/+38
| | | | | | | | rather the addition of missing definitions triggered by help-mp.sh script): general and dvd navigation player messages git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13812 b3059339-0415-0410-9bf9-f77b7e298cf2
* little wordingkraymer2004-10-301-21/+83
| | | | | | | continuing sync process git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13811 b3059339-0415-0410-9bf9-f77b7e298cf2
* AMD64 fixes based on patch by Timo Teräs <timo.teras@iki.fi>faust32004-10-301-55/+55
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13810 b3059339-0415-0410-9bf9-f77b7e298cf2
* small memleak fix, based on patch by Wei Jiang <jiangw98@yahoo.com>faust32004-10-301-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13809 b3059339-0415-0410-9bf9-f77b7e298cf2
* Memory Free function Fix, based on patch by Wei Jiang <jiangw98@yahoo.com>faust32004-10-302-11/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13808 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.798 + french fixesgpoirier2004-10-301-7/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13807 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid infinite recursion patch by Bernhard Rosenkraenzer <bero@arklinux.org>faust32004-10-301-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13806 b3059339-0415-0410-9bf9-f77b7e298cf2
* DTS uses the format tag 0x2001. Patch by Joakim Plate (joakim ! plate () ↵mosu2004-10-301-3/+5
| | | | | | ecce ! se) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13805 b3059339-0415-0410-9bf9-f77b7e298cf2
* Declare a prototype for the function before it is used. Otherwise some ↵mosu2004-10-301-0/+2
| | | | | | compiler versions will "optimize" them away, and linking will fail. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13804 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix XVideo misdetection on OSF/1, patch by Gabucino <gabucino at mplayerhq.hu>faust32004-10-301-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13803 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed the assumption user will always give 2+ args to the program.al2004-10-291-3/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13802 b3059339-0415-0410-9bf9-f77b7e298cf2
* ffmpeg mjpeg-b is workingrtognimp2004-10-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13801 b3059339-0415-0410-9bf9-f77b7e298cf2
* continuing updateskraymer2004-10-291-19/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13800 b3059339-0415-0410-9bf9-f77b7e298cf2
* compile fix on G3pontscho2004-10-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13799 b3059339-0415-0410-9bf9-f77b7e298cf2
* panscan now supported in vo_quartznplourde2004-10-292-9/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13798 b3059339-0415-0410-9bf9-f77b7e298cf2
* resize preset now respect movie aspectnplourde2004-10-291-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13797 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable pan-scan + menu optionnplourde2004-10-291-1/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13796 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow attaching gdb on crash automatically.reimar2004-10-284-1/+70
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13795 b3059339-0415-0410-9bf9-f77b7e298cf2
* get proper movie aspectnplourde2004-10-281-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13794 b3059339-0415-0410-9bf9-f77b7e298cf2
* menu option to set desired movie aspect & keep aspect on window resizenplourde2004-10-281-6/+70
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13793 b3059339-0415-0410-9bf9-f77b7e298cf2
* autodetect proper monitor aspectnplourde2004-10-281-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13792 b3059339-0415-0410-9bf9-f77b7e298cf2
* better wordingdiego2004-10-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13791 b3059339-0415-0410-9bf9-f77b7e298cf2
* fs_res desc for vo_quartznplourde2004-10-281-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13790 b3059339-0415-0410-9bf9-f77b7e298cf2
* let you choose fullscreen resolution for slower systemnplourde2004-10-281-0/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13789 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle "xxx.h" vs "../xxx.h" include paths in a consistent way.diego2004-10-2847-89/+89
| | | | | | | Based on a patch by Sebastian Hegler <s_hegler at gmx dot de>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13788 b3059339-0415-0410-9bf9-f77b7e298cf2
* spellingdiego2004-10-282-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13787 b3059339-0415-0410-9bf9-f77b7e298cf2
* vivodump compiles now, so it can be added to OBJS.diego2004-10-281-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13786 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove hardcoded filenames in favor of command line parameters, some errordiego2004-10-281-5/+19
| | | | | | | checking added, patch by Reza Jelveh. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13785 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fix, mostly by Reza Jelvehdiego2004-10-281-4/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13784 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording corrected again..kraymer2004-10-271-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13783 b3059339-0415-0410-9bf9-f77b7e298cf2
* began updates of that part of the manpage that was in sync before (~six ↵kraymer2004-10-271-0/+33
| | | | | | | | | weeks ago) ( was in sync down to line ~3850 of english manpage ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13782 b3059339-0415-0410-9bf9-f77b7e298cf2
* Miro VideoXL support via lavcrtognimp2004-10-271-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13781 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix windows resizing ui glitchnplourde2004-10-271-10/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13780 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.794: vcresample & sweep filtersgpoirier2004-10-271-2/+23
| | | | | | | (should be proofread by a tech geek if possible to check the translation) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13779 b3059339-0415-0410-9bf9-f77b7e298cf2
* lavcresample & sweep filtersmichael2004-10-271-0/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13778 b3059339-0415-0410-9bf9-f77b7e298cf2
* repace call to sleep_accurate to usleep which fix hang while using -cache ↵nplourde2004-10-271-9/+1
| | | | | | option on osx git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13777 b3059339-0415-0410-9bf9-f77b7e298cf2
* make it possible to select the monitor even when in nonexclusive mode, based ↵faust32004-10-271-5/+26
| | | | | | on patch by Anton Ragarsson <anton at infeline.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13776 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed one Edl debug messagereynaldo2004-10-261-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13775 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed 2 debug edl messagesreynaldo2004-10-261-6/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13774 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.147: skipped, typo was fixed earlierkraymer2004-10-261-1/+20
| | | | | | | | | | 1.148: printf --> mp_msg (divx4_vbr.c, fifo.c, m_config.c) 1.149: skipped, typo was fixed earlier 1.150: no changes done (trailing dots already existed.) File is in sync now. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13773 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added dots at end of sentence (m_config.c section)kraymer2004-10-261-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13772 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.145: Translatable messages moved to help_mp-en.h. (codec-cfg.c)kraymer2004-10-261-5/+33
| | | | | | | | 1.146: modified outdated message which was still referring to ALSA 0.5 and 0.9 wording: mplayer -> Mplayer git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13771 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Gabor Mizda <gabrov at freemail dot hu>diego2004-10-261-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13770 b3059339-0415-0410-9bf9-f77b7e298cf2
* cmd can be NULL when leaving the paused mode and using the GUIreimar2004-10-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13769 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removal of help_mp.h on make distclean, as requested by Felix Buenemannwight2004-10-261-1/+1
| | | | | | | <atmosfear -at- users(dot)sourceforge(dot)net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13768 b3059339-0415-0410-9bf9-f77b7e298cf2
* Audio plugins have been superceded by audio filters, noticed by Gabrov.diego2004-10-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13767 b3059339-0415-0410-9bf9-f77b7e298cf2
* further translation and sync by Mizda Gabor <gabrov at freemail dot hu>diego2004-10-263-156/+1631
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13766 b3059339-0415-0410-9bf9-f77b7e298cf2
* further translation by Carl Furstenberg <azatoth at gmail dot com>diego2004-10-251-44/+58
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13765 b3059339-0415-0410-9bf9-f77b7e298cf2
* whitespace fixes by Mizda Gabor <gabrov at freemail dot hu>diego2004-10-252-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13764 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.50paszczi2004-10-251-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13763 b3059339-0415-0410-9bf9-f77b7e298cf2
* It has not written debug information to a file, but it has dumped the core ;)ivo2004-10-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13762 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10livo2004-10-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13761 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.142: removing ao_alsa9.c and ao_alsa1x.ckraymer2004-10-251-2/+7
| | | | | | | | 1.143: printf --> mp_msg conversion (was already done by Diego) 1.144: Support for 24 bit and 20 bit LPCM (support message) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13760 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.134: New translatable messages for vo_pnmkraymer2004-10-251-4/+33
| | | | | | | | | | | | 1.135: printf --> mp_msg transition in vo_yuv4mpeg 1.136: printf --> mp_msg conversion in ao_plugin 1.137: Removal of vo_pgm and vo_md5 1.138 and 1.139 were previously done by Diego (removal of unused messages) 1.140 Remove preceding newline in two lines 1.141 Added missing EOL git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13759 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1.132: MSGTR_EdlCantOpenForWrite updatedkraymer2004-10-251-2/+99
| | | | | | | | 1.133: mp_msg transition of unmaintained audio output drivers (referring to date 2004/09/18!) file isn't yet up to date, will continue updating in steps.. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13758 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Jiri Heryan <technik at domotech dot cz>diego2004-10-251-227/+303
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13757 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync tag bumpwight2004-10-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13756 b3059339-0415-0410-9bf9-f77b7e298cf2
* Marillat's homepage has been down for ages.diego2004-10-251-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13755 b3059339-0415-0410-9bf9-f77b7e298cf2
* translation (yet incomplete) by Carl Furstenberg <azatoth at gmail dot com>diego2004-10-241-0/+7249
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13754 b3059339-0415-0410-9bf9-f77b7e298cf2
* Important typo noticed by Piero di Vita <scognito at libero dot it>diego2004-10-246-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13753 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support wmspdmod.dll version 10.0.0.3646rtognimp2004-10-241-0/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13752 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support WMV Screen Codec 2 (MSS2) with binary codecrtognimp2004-10-241-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13751 b3059339-0415-0410-9bf9-f77b7e298cf2
* print build nummichael2004-10-241-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13750 b3059339-0415-0410-9bf9-f77b7e298cf2
* Decode VDOWave (VDOM) with binary codecrtognimp2004-10-242-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13749 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l (mplayer doesnt like AV_NOPTS_VALUE)michael2004-10-241-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13748 b3059339-0415-0410-9bf9-f77b7e298cf2
* _def_enca should always be set to something! And preferrably correctly..reimar2004-10-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13747 b3059339-0415-0410-9bf9-f77b7e298cf2
* Windows media video advanced profile (wmva) support via binary codecrtognimp2004-10-242-0/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13746 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add --enable and --disable options for vo_pnm and vo_md5sum to configure.ivo2004-10-233-1/+50
| | | | | | | | It's now possible to compile libvo without pnm and/or md5sum support. Default is enable. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13745 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l for playback speed changing in audio-only casereimar2004-10-231-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13744 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, missing playback_speed argument in mp_msg call.reimar2004-10-231-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13743 b3059339-0415-0410-9bf9-f77b7e298cf2
* FreeBSD compilation fixreimar2004-10-231-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13742 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsoleted comment about wma9sp running only on windowsrtognimp2004-10-231-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13741 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for Windows media audio 9 voice codec (format 0x0a)rtognimp2004-10-231-3/+8
| | | | | | | Tested with dll version 9.0.0.2926 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13740 b3059339-0415-0410-9bf9-f77b7e298cf2
* seeking based on the largest timestamp in an mpeg streamaurel2004-10-232-3/+101
| | | | | | | | | It is often more accurate than the current seeking and it has the additional benefit of giving the (almost) precise total time of the movie. patch by Michael Behrisch < behrisch at informatik.hu-berlin.de > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13739 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.793:gpoirier2004-10-221-7/+8
| | | | | | | | | MEncoder needs -srate together with -af resample, hint by Giacomo Comes <comes at naic dot edu>. + some french fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13738 b3059339-0415-0410-9bf9-f77b7e298cf2
* overlay color control support based on patch by Vitos Laszlo <laca <at> evol.ro>faust32004-10-221-0/+108
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13737 b3059339-0415-0410-9bf9-f77b7e298cf2
* ringbuffer variable intialization fix for multifile playback patch by Rune ↵faust32004-10-221-1/+5
| | | | | | Petersen <rune.mail-list at mail.tele.dk> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13736 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable live resizenplourde2004-10-221-23/+35
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13735 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10000l : fix a crash on x86 due to an horrible mistake in my x86_64 patchaurel2004-10-221-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13734 b3059339-0415-0410-9bf9-f77b7e298cf2
* MEncoder needs -srate together with -af resample,diego2004-10-211-0/+1
| | | | | | | hint by Giacomo Comes <comes at naic dot edu>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13733 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Mizda Gabor <gabrov at freemail dot hu>diego2004-10-212-6/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13732 b3059339-0415-0410-9bf9-f77b7e298cf2
* user selectable cutoff frequencymichael2004-10-211-6/+14
| | | | | | | simplify resampling factor if possible, so more then one resampler can be used, libaf will still die if there are too many like it does with the default resampler (2 with sampling rates which are relative prime are too many ...) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13731 b3059339-0415-0410-9bf9-f77b7e298cf2
* crash with Y8 colourspace fixedreimar2004-10-211-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13730 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.792gpoirier2004-10-211-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13729 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.791 + some French fixesgpoirier2004-10-211-16/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13728 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixesdiego2004-10-211-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13727 b3059339-0415-0410-9bf9-f77b7e298cf2
* quartz vo driver specific key binding definitionnplourde2004-10-211-0/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13726 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.18 + linebreakwight2004-10-211-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13725 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing \wight2004-10-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13724 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed typonplourde2004-10-211-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13723 b3059339-0415-0410-9bf9-f77b7e298cf2
* sine sweep generatormichael2004-10-213-1/+98
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13722 b3059339-0415-0410-9bf9-f77b7e298cf2
* adapting existing mmx/mmx2/sse/3dnow optimizations so they work on x86_64aurel2004-10-2127-947/+1019
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13721 b3059339-0415-0410-9bf9-f77b7e298cf2
* move variable declaration at beginning of blocknplourde2004-10-211-7/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13720 b3059339-0415-0410-9bf9-f77b7e298cf2
* The Hungarian translation has been available in XML format for some timediego2004-10-2110-7448/+0
| | | | | | | now, the HTML version is also very outdated. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13719 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove incomplete key list and command list and update the other sectionsdiego2004-10-211-205/+13
| | | | | | | accordingly, commands are documented in DOCS/tech/slave.txt. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13718 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify filters vs plugins.diego2004-10-211-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13717 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better descriptions merged from the XML docs.diego2004-10-211-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13716 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar + indentation cosmeticsdiego2004-10-211-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13715 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavcodec resampling ...michael2004-10-213-1/+160
| | | | | | | libaf doesnt seem to support planar audio, so we need to convert it :( git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13714 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed duplicate case and fixed aspect ratio for window zoom featurenplourde2004-10-201-77/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13713 b3059339-0415-0410-9bf9-f77b7e298cf2
* darwin vcd support creditnplourde2004-10-201-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13712 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow changing playback speed during playback.reimar2004-10-209-8/+108
| | | | | | | | | Based on patch by Steve Mueller (diffusor <at> ugcs (dot) caltech [dot] edu), OSD support by Frank Schertan (scherthan (at) uni-landau <dot> de), several modifications by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13711 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.788: wording/spellinggpoirier2004-10-201-3/+3
| | | | | | | NB: previous commit also featured sync to 1.783, also it wasn't clearly stated git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13710 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix -loop in combination with -shufflereimar2004-10-201-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13709 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed event handling for menubar and window close button.nplourde2004-10-201-48/+111
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13708 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync and fixes by Carl Furstenberg <azatoth at gmail dot com>diego2004-10-201-20/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13707 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small Mp/mp/MP typo fixreynaldo2004-10-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13706 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync with help_mp-en 1.148reynaldo2004-10-201-2/+134
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13705 b3059339-0415-0410-9bf9-f77b7e298cf2
* Move help_mp.h generation to Makefile, so it's easier to maintain onwight2004-10-202-20/+16
| | | | | | | help/*.h changes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13704 b3059339-0415-0410-9bf9-f77b7e298cf2
* make uninstall was leaving vidix, dha, and libmpdvdkit librarieswight2004-10-202-0/+13
| | | | | | | | | and translated manpages as well. This fixes the issue. Resolves bug #9 (hopefully) Based on Bugzilla patch by Evgueni V. Gavrilov (aquatique at rusunix.org) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13703 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Carl Fürstenberg <azatoth at gmail dot com>diego2004-10-201-3/+21
| | | | | | | fixes by Jan Knutar <jknutar at nic dot fi> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13702 b3059339-0415-0410-9bf9-f77b7e298cf2
* Index-Recovery cosmetixatmos42004-10-201-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13701 b3059339-0415-0410-9bf9-f77b7e298cf2
* printf --> mp_msg by the Wanderer <inverseparadox at comcast dot net>diego2004-10-205-15/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13700 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording/spellingdiego2004-10-201-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13699 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo noticed by Reimar Döffinger.diego2004-10-206-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13698 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync and fixes by Carl Fürstenberg <azatoth@gmail.com>diego2004-10-201-442/+459
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13697 b3059339-0415-0410-9bf9-f77b7e298cf2
* translation by Carl Furstenberg <azatoth@gmail.com>diego2004-10-191-0/+981
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13696 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.787:gpoirier2004-10-191-198/+243
| | | | | | | | | | 1.787: lavc is faster than XviD and thus recommended for decoding and PP. 1.786: man page review part XII 1.785: consistent I/P/B-frame spelling 1.784: Spelling/wording/clarity improvements and bug fixes. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13695 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix menu bar support and add new movie zoom option menu a la quicktimenplourde2004-10-191-11/+134
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13694 b3059339-0415-0410-9bf9-f77b7e298cf2
* lavc is faster than XviD and thus recommended for decoding and PP.diego2004-10-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13693 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part XIIdiego2004-10-191-140/+169
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13692 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistent I/P/B-frame spellingdiego2004-10-191-49/+49
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13691 b3059339-0415-0410-9bf9-f77b7e298cf2
* Spelling/wording/clarity improvements and bug fixes.diego2004-10-191-19/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13690 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Mizda Gabor <gabrov at freemail dot hu>diego2004-10-191-25/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13689 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo noticed by Nicolas Plourde.diego2004-10-195-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13688 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove redundant ASF status line, there is another for all formats.diego2004-10-191-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13687 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix playback on big-endian systems.diego2004-10-191-9/+3
| | | | | | | patch by Nicolas Plourde and adland123 <adland123 at yahoo dot com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13686 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, patch by Jan Knutar <jknutar@nic.fi>faust32004-10-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13685 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.783wight2004-10-181-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13684 b3059339-0415-0410-9bf9-f77b7e298cf2
* support function for vcd on darwinnplourde2004-10-181-0/+181
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13683 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable vcd for all darwin based sys not only mac osxnplourde2004-10-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13682 b3059339-0415-0410-9bf9-f77b7e298cf2
* document global variables used with fribidifaust32004-10-181-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13681 b3059339-0415-0410-9bf9-f77b7e298cf2
* correctly display the commas of most hebrew subtitles on the left sidefaust32004-10-184-1/+17
| | | | | | | | of the sentence with fribidi, make the old behaviour optional patch by Shachar Raindel <shacharr <at> gmail.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13680 b3059339-0415-0410-9bf9-f77b7e298cf2
* add vcd support to darwin for ppcnplourde2004-10-182-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13679 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix compilation when LOG is definedrtognimp2004-10-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13678 b3059339-0415-0410-9bf9-f77b7e298cf2
* EOF detection (fix hanging at end of stream)rtognimp2004-10-182-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13677 b3059339-0415-0410-9bf9-f77b7e298cf2
* Bitrate setting option in ve_xvid4.c doesn't follow the rules describedrathann2004-10-181-5/+8
| | | | | | | | in manpage (i.e. if bitrate > 16000, then it's in bits/s, not kbits), unlike lavc and the old ve_xvid.c do. Fixed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13676 b3059339-0415-0410-9bf9-f77b7e298cf2
* channel reorder patch by Florian Dietrich <flodt8 at yahoo.de>faust32004-10-181-10/+40
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13675 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix segfault for unexistant/unreachable rtsp streamsrtognimp2004-10-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13674 b3059339-0415-0410-9bf9-f77b7e298cf2
* Limit Gui redraw rate.reimar2004-10-181-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13673 b3059339-0415-0410-9bf9-f77b7e298cf2
* Recover Keyframe-Index for XviD aswellatmos42004-10-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13672 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.779, some typo from 1.771danny2004-10-181-48/+70
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13671 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l...autoaspect was always applied to muxer aspect if using newer ↵rfelker2004-10-181-1/+2
| | | | | | libavcodec...hope this is ok git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13670 b3059339-0415-0410-9bf9-f77b7e298cf2
* icon now in /usr/share/pixmaps not /usr/share/iconsdiego2004-10-182-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13669 b3059339-0415-0410-9bf9-f77b7e298cf2
* Applications menu entry now handled through the top-level Makefile.diego2004-10-181-3/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13668 b3059339-0415-0410-9bf9-f77b7e298cf2
* Menu entry for all freedesktop.org compliant window managers.diego2004-10-181-0/+6
| | | | | | | patch by Piero di Vita <scognito at libero dot it> uninstall by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13667 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Jiri Heryan <technik at domotech dot cz>diego2004-10-181-63/+115
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13666 b3059339-0415-0410-9bf9-f77b7e298cf2
* bug fixes by Jiri Heryan <technik at domotech dot cz>diego2004-10-181-98/+104
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13665 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.782 + 2 spelling mistakeswight2004-10-171-12/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13664 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.782: Only use S/PDIF output when no other alsa device is set,gpoirier2004-10-171-1/+11
| | | | | | | | allows to use external ac3 decoders. and 1.781: OSD variant for vo_gl.c that behaves more like the one of other vos. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13663 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only use S/PDIF output when no other alsa device is set, allows to usereimar2004-10-172-4/+5
| | | | | | | external ac3 decoders. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13662 b3059339-0415-0410-9bf9-f77b7e298cf2
* OSD variant for vo_gl.c that behaves more like the one of other vos.reimar2004-10-172-7/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13661 b3059339-0415-0410-9bf9-f77b7e298cf2
* compile error fix on PPC/G3pontscho2004-10-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13660 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark I-frames as seekable only if we encode with one reference frame, IDR ↵iive2004-10-171-1/+3
| | | | | | | | | are always seekable patch send by Loren Merritt git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13659 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added new PCI IDS, patch by Benjamin Zores <ben@tutuxclan.org>faust32004-10-171-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13658 b3059339-0415-0410-9bf9-f77b7e298cf2
* I420 support patch by Benjamin Zores <ben@tutuxclan.org>faust32004-10-171-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13657 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.780: Documents two new postprocessing options: "dering-luma"gpoirier2004-10-171-40/+52
| | | | | | | | | | and "dering-chroma". Also moves around a bit the decoder section in order to "factorize" some comments. + some french fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13656 b3059339-0415-0410-9bf9-f77b7e298cf2
* Documents two new postprocessing options: "dering-luma" and "dering-chroma"gpoirier2004-10-171-11/+24
| | | | | | | | Also moves around a bit the decoder section in order to "factorize" some comments. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13655 b3059339-0415-0410-9bf9-f77b7e298cf2
* added gl_common for code used by both vo_gl.c and vo_gl2.c.reimar2004-10-175-30/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13654 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with GomGom's patch-12 version.iive2004-10-161-30/+171
| | | | | | | | | updated copyright two new postprocessing options display aspect ratio support git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13653 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix incompatibility with audio devices with more then 2 channelsnplourde2004-10-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13652 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.779: missing sentence dotsgpoirier2004-10-151-7/+8
| | | | | | | + small french fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13651 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid segfault with -vc dummyreimar2004-10-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13650 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing sentence dotswight2004-10-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13649 b3059339-0415-0410-9bf9-f77b7e298cf2
* - sync 1.778wight2004-10-151-178/+213
| | | | | | | - random fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13648 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.771, drop not necessry \&danny2004-10-151-215/+350
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13647 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.19paszczi2004-10-141-1/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13646 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.778: Make '.' key default for framesteppinggpoirier2004-10-141-4/+5
| | | | | | | + small french fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13645 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.777gpoirier2004-10-141-39/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13644 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make '.' key default for framesteppingreimar2004-10-143-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13643 b3059339-0415-0410-9bf9-f77b7e298cf2
* some memory leaks fixedreimar2004-10-144-19/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13642 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao dsound improvements patch by Florian Dietrich <flodt8 at yahoo.de>faust32004-10-141-20/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13641 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l to me, noticed by Torinthieldiego2004-10-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13640 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added missing toolame to the list of codec specific encoding options.diego2004-10-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13639 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Mizda Gabor <gabrov@freemail.hu>diego2004-10-141-27/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13638 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_gl now supports -panscan as well.diego2004-10-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13637 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part XIdiego2004-10-141-38/+41
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13636 b3059339-0415-0410-9bf9-f77b7e298cf2
* Comment clarified, patch by Sylvain Colinet <scolinet at gmail dot com>.diego2004-10-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13635 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.773: allow to step only one frame forward by pressing s.gpoirier2004-10-131-3/+8
| | | | | | | + a small French correction git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13634 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed small memleaksreimar2004-10-132-8/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13633 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-10-135-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13632 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Mizda Gabor <gabrov at freemail dot hu>diego2004-10-131-2/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13631 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo found by Mizda Gabor <gabrov at freemail dot hu>diego2004-10-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13630 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove CPU speed detection sincediego2004-10-131-42/+4
| | | | | | | | | - it is unreliable - it adds a constant 0.1s to startup time - it is hardly a feature for a movie player git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13629 b3059339-0415-0410-9bf9-f77b7e298cf2
* clarificationdiego2004-10-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13628 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow to step only one frame forward by pressing s.reimar2004-10-126-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13627 b3059339-0415-0410-9bf9-f77b7e298cf2
* Creative ADPCM native decoder from lavcrtognimp2004-10-121-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13626 b3059339-0415-0410-9bf9-f77b7e298cf2
* -fno-PIC will not work on OSX, and it is only useful on x86 anyway.reimar2004-10-121-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13625 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10liive2004-10-121-0/+1
| | | | | | | fix compilation error - NULL not defined git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13624 b3059339-0415-0410-9bf9-f77b7e298cf2
* better component_funcalex2004-10-121-10/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13623 b3059339-0415-0410-9bf9-f77b7e298cf2
* runtime patching vp31vfw.dll, so non-patched dlls can be used aswell. note: ↵alex2004-10-121-0/+11
| | | | | | this does not breaks if the dll is already patched git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13622 b3059339-0415-0410-9bf9-f77b7e298cf2
* modified outdated message which was still referring to ALSA 0.5 and 0.9aurel2004-10-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13621 b3059339-0415-0410-9bf9-f77b7e298cf2
* Translatable messages moved to help_mp-en.h.diego2004-10-122-29/+59
| | | | | | | patch by The Wanderer <inverseparadox at comcast dot net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13620 b3059339-0415-0410-9bf9-f77b7e298cf2
* bug fixes by Jiri Heryan <technik at domotech dot cz>diego2004-10-121-48/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13619 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2004-10-121-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13618 b3059339-0415-0410-9bf9-f77b7e298cf2
* translation by Mizda Gabor <gabrov at freemail dot hu>diego2004-10-121-0/+948
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13617 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Mizda Gabor <gabrov at freemail dot hu>diego2004-10-111-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13616 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.772: XviD's bvhq option descgpoirier2004-10-111-41/+60
| | | | | | | + lots of french corrections. Kudows to Gigi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13615 b3059339-0415-0410-9bf9-f77b7e298cf2
* XviD's bvhq option descriptiongpoirier2004-10-111-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13614 b3059339-0415-0410-9bf9-f77b7e298cf2
* Zeta OS support, mostly working.reimar2004-10-117-38/+122
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13613 b3059339-0415-0410-9bf9-f77b7e298cf2
* too large extradatamichael2004-10-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13612 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with GomGom's patch-12 version.iive2004-10-111-101/+227
| | | | | | | | | | | | | | | updated copyright bvhq options added (xvid 1.1+ api4.1) psnr handling moved in separate functions proper free() on uninit printf -> mp_msg capability to flush delayed frames Changes by me (iive) support for flushing delayed frames at the end suppressed cosmetics and new aspect code changes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13611 b3059339-0415-0410-9bf9-f77b7e298cf2
* set myself (Aurelien Jacobs) as vo_vesa maintaineraurel2004-10-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13610 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed dependency on liba52nicodvb2004-10-111-7/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13609 b3059339-0415-0410-9bf9-f77b7e298cf2
* LIBAVFORMAT_BUILD >= 4619michael2004-10-101-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13608 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compilation on macosx with --enable-qtx patch by Zachary Bedell ↵faust32004-10-102-3/+3
| | | | | | <zaclist@adirondack.net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13607 b3059339-0415-0410-9bf9-f77b7e298cf2
* CLE266 Vidix driver initial patch by Timothy Lee <timothy@siriushk.com>, ↵faust32004-10-104-1/+1594
| | | | | | doxygen comments by Benjamin Zores <ben@tutuxclan.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13606 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix Cyberblade VidiX driver TVOUT patch by Benjamin Zores <ben@tutuxclan.org>faust32004-10-101-4/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13605 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not loose commands while paused.reimar2004-10-103-13/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13604 b3059339-0415-0410-9bf9-f77b7e298cf2
* The full name of the GPL is GNU General Public License.diego2004-10-1019-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13603 b3059339-0415-0410-9bf9-f77b7e298cf2
* aspect scaling and panscan support for vo_gl.creimar2004-10-102-2/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13602 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo noticed by Shixin Zeng <shixinzeng at sjtu dot edu dot cn>diego2004-10-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13601 b3059339-0415-0410-9bf9-f77b7e298cf2
* Variables for OSD support should be staticreimar2004-10-101-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13600 b3059339-0415-0410-9bf9-f77b7e298cf2
* Windows Media Image (WMVP) can be decoded with WMV9 dmo codecrtognimp2004-10-092-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13599 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.770paszczi2004-10-091-23/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13598 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Mizda Gabor <gabrov at dana dot hu>diego2004-10-091-77/+114
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13597 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for 24 bit and 20 bit LPCM (simple and slow :-( )reimar2004-10-092-0/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13596 b3059339-0415-0410-9bf9-f77b7e298cf2
* correct scaling when the screen resolution is smaller than the flat panel ↵faust32004-10-091-1/+20
| | | | | | resolution git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13595 b3059339-0415-0410-9bf9-f77b7e298cf2
* add new control message, that is send after end of stream, to flush all ↵iive2004-10-092-0/+9
| | | | | | | | | remaining frames in the video system required by xvid4 encoder. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13594 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.770: af_extrastereo, af_volnormgpoirier2004-10-091-6/+14
| | | | | | | | 1.769: consistency fix, typos and better wording as suggested by Loren Merritt git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13593 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compilation on mingwfaust32004-10-091-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13592 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_extrastereo, af_volnormdiego2004-10-092-0/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13591 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency fix, typos and better wording as suggested by Loren Merrittdiego2004-10-091-8/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13590 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support ON2 variation of AVI format (.vp5 files)rtognimp2004-10-081-1/+5
| | | | | | | Also closes bug #104 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13589 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.767gpoirier2004-10-081-39/+68
| | | | | | | + more french corrections. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13588 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor revision to improve clearness, add a comprehensive list of allgpoirier2004-10-081-20/+29
| | | | | | | h264's macroblocks, add vrc defaults, and correct scencut decription git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13587 b3059339-0415-0410-9bf9-f77b7e298cf2
* OpenGL OSD rendering for vo_glreimar2004-10-082-4/+154
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13586 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds a parameter 'scenecut', to control the threshold for inserting extra ↵iive2004-10-082-0/+13
| | | | | | | | | I-frames. patch by Loren Merritt git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13585 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hint at FIXED_POINT for better (SBR) performance.diego2004-10-081-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13584 b3059339-0415-0410-9bf9-f77b7e298cf2
* partial sync by Mizda Gabor <gabrov@dana.hu>diego2004-10-071-108/+427
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13583 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed a bug that makes the demuxer loop forever probing a52 audio when ↵nicodvb2004-10-071-0/+2
| | | | | | a52_syncinfo() returns 0 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13582 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some french corrections, mostly "s" on plurial formsgpoirier2004-10-071-11/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13581 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixing --disable for mp3lib, liba52 and libmpeg2, patch by (basic (at) ↵reimar2004-10-073-5/+34
| | | | | | mozdev (dot) org), see also bug #102 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13580 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for the Wanderer, by himselfdiego2004-10-071-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13579 b3059339-0415-0410-9bf9-f77b7e298cf2
* printf --> mp_msg conversiondiego2004-10-0725-110/+97
| | | | | | | patch by the Wanderer <inverseparadox at comcast dot net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13578 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l compilation fixreimar2004-10-061-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13577 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed UNPACK_ALIGNMENT setting.reimar2004-10-062-3/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13576 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make Makefile conform to the general MPlayer style, alaw-gen added.diego2004-10-061-12/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13575 b3059339-0415-0410-9bf9-f77b7e298cf2
* Also ignore alaw-gen and its output.diego2004-10-061-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13574 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing .cvsignore file added.diego2004-10-062-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13573 b3059339-0415-0410-9bf9-f77b7e298cf2
* Made Makefile conform to the general MPlayer style, clean target added.diego2004-10-061-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13572 b3059339-0415-0410-9bf9-f77b7e298cf2
* File filter dropdown box value is now preserved between dialog invocations.diego2004-10-061-9/+17
| | | | | | | patch by Deomid Ryabkov aka Rojer <myself at rojer dot pp dot ru> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13571 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Jiri Heryan <technik@domotech.cz>diego2004-10-061-32/+87
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13570 b3059339-0415-0410-9bf9-f77b7e298cf2
* Currently vbeGetProtModeInfo call the 0x4f0a function of int 10h the getfaust32004-10-062-9/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | a simple 32 bits protected mode interface to some VESA functions. This protected mode interface is interesting because it's quicker than the raw int 10h interface. Unfortunatly, begining with VBE 3.0, the 0x4f0a function is optional, and some video cards don't implement it (3dfx, intel 845/855/865...). This protected mode interface is then only used in vbeSetWindow and vbeSetDisplayStart :  - vbeSetWindow already implement an alternative methode if protected mode interface is not available.  - vbeSetDisplayStart also contain an alternative implementation, but this one is disabled with a #if 0. I don't exactly know why because it works well ! So currently, cards which don't have the 0x4f0a function are not supported. This patch correct this.  - vbeGetProtModeInfo failure is not fatal.  - vbeSetDisplayStart has it's alternative implementation reenabled.    it's used only with cards which don't have the 0x4f0a function    so this won't make any difference for cards which were already    working. This patch also make the failure of vbeGetModeInfo not fatal. The VBE 3.0 standard state that GetModeInfo can fail with some mode which are listed as supported if the mode can't be used in the current situation (not enough video memory for example). So a failure of vbeGetModeInfo don't mean that other modes won't work and should really not be fatal. patch by Aurelien Jacobs <aurel@gnuage.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13569 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.765paszczi2004-10-051-11/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13568 b3059339-0415-0410-9bf9-f77b7e298cf2
* make af_help conform better to the the afm/vfm/etc equivalentsalex2004-10-051-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13567 b3059339-0415-0410-9bf9-f77b7e298cf2
* unsinged 32 and 24bit typesalex2004-10-051-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13566 b3059339-0415-0410-9bf9-f77b7e298cf2
* postproc/yuv2rgb_altivec.c compile fixmichael2004-10-053-96/+238
| | | | | | | | | yuv2rgb_altivec_init_tables does initialize the SwsContext vectors. missing vec_splat. patch by (Luca Barbato <lu_zero at gentoo dot org>) and (Romain Dolbeau <dolbeau at irisa dot fr>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13565 b3059339-0415-0410-9bf9-f77b7e298cf2
* keyframe indexmichael2004-10-051-4/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13564 b3059339-0415-0410-9bf9-f77b7e298cf2
* xvmc clarificationdiego2004-10-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13563 b3059339-0415-0410-9bf9-f77b7e298cf2
* branch field to distinguish mncf from nutmichael2004-10-051-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13562 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove short startcodesmichael2004-10-051-20/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13561 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove non native codec specific datamichael2004-10-051-0/+661
| | | | | | | move lang to the info packet git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13560 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.764: -alang needs a language code, not a country code.gpoirier2004-10-051-3/+3
| | | | | | | + typos pointed out by Diego git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13559 b3059339-0415-0410-9bf9-f77b7e298cf2
* Syntax check, space after apostrophe, i.e. and e.g. translateddanny2004-10-051-466/+465
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13558 b3059339-0415-0410-9bf9-f77b7e298cf2
* -alang needs a language code, not a country code.diego2004-10-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13557 b3059339-0415-0410-9bf9-f77b7e298cf2
* Errors from 1.737 sync, pointed out by Diegodanny2004-10-051-22/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13556 b3059339-0415-0410-9bf9-f77b7e298cf2
* Corrected 'synced with' string, now 1.18reynaldo2004-10-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13555 b3059339-0415-0410-9bf9-f77b7e298cf2
* make use of 24bit afmtalex2004-10-041-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13554 b3059339-0415-0410-9bf9-f77b7e298cf2
* make use of new defines: 24 and 32bit integer typesalex2004-10-041-1/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13553 b3059339-0415-0410-9bf9-f77b7e298cf2
* move the file writers after vo_null so they don't get autoselected - ↵alex2004-10-041-14/+13
| | | | | | following the same logic as in libao2 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13552 b3059339-0415-0410-9bf9-f77b7e298cf2
* reimplementation of the pl_extrastereo and pl_volnorm pluginsalex2004-10-046-2/+474
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13551 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixing authorsalex2004-10-042-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13550 b3059339-0415-0410-9bf9-f77b7e298cf2
* introducing 24bit formats and make the values compliant to OSSalex2004-10-042-6/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13549 b3059339-0415-0410-9bf9-f77b7e298cf2
* How to take a screenshot, how to use dmix, how to choose languages anddiego2004-10-041-0/+44
| | | | | | | subtitle languages, patch by gouchi <gouchi at gmail dot com>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13548 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.763:gpoirier2004-10-041-8/+20
| | | | | | | | Better description of x264's PSNR stats 1.762: -alang description corrected. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13547 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better description of x264 PSNR stats.gpoirier2004-10-041-2/+9
| | | | | | | Patch by Loren Merritt git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13546 b3059339-0415-0410-9bf9-f77b7e298cf2
* -alang is not limited to the libdvdread dependant code anymore but used in ↵mosu2004-10-041-1/+1
| | | | | | other demuxers as well. Therefore it should not be inside a "#ifdef USE_DVDREAD". git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13545 b3059339-0415-0410-9bf9-f77b7e298cf2
* -alang description corrected.diego2004-10-041-5/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13544 b3059339-0415-0410-9bf9-f77b7e298cf2
* removing ao_alsa9.c and ao_alsa1x.c as they are superseded by ao_alsa.creimar2004-10-044-2373/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13543 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added missing EOL.ivo2004-10-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13542 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed memleak, especially for fixed-vo.reimar2004-10-031-1/+7
| | | | | | | Based on a patch by beastd (eclipse7 (at) gmx (dot) net). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13541 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed compilation warnings and errors (previously my network went down)paszczi2004-10-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13540 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed compilation warnings and errorspaszczi2004-10-031-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13539 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with latest english docspaszczi2004-10-022-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13538 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.140paszczi2004-10-021-60/+356
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13537 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typo, pointed out by lu_zerortognimp2004-10-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13536 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.761paszczi2004-10-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13535 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-10-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13534 b3059339-0415-0410-9bf9-f77b7e298cf2
* typosdiego2004-10-022-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13533 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove preceding newline to make -XXX help output consistent.diego2004-10-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13532 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed all obsolete and unused messages.diego2004-10-0224-314/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13531 b3059339-0415-0410-9bf9-f77b7e298cf2
* Obsolete and unused message removed.diego2004-10-0223-23/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13530 b3059339-0415-0410-9bf9-f77b7e298cf2
* support newer gccfaust32004-10-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13529 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.760:gpoirier2004-10-021-18/+26
| | | | | | | | | -sws and -vf scale sections improved, small fixes. + some cut-and-paste from patches fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13528 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.760paszczi2004-10-021-17/+60
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13527 b3059339-0415-0410-9bf9-f77b7e298cf2
* -sws and -vf scale sections improved, small fixes.diego2004-10-021-11/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13526 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fixdiego2004-10-021-0/+3
| | | | | | | idea by Erik Augustson <erik_27can at yahoo dot com> and Ivan Kalvachev git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13525 b3059339-0415-0410-9bf9-f77b7e298cf2
* typosdiego2004-10-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13524 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nroff fixes.gpoirier2004-10-011-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13523 b3059339-0415-0410-9bf9-f77b7e298cf2
* mpi->w and h are set by vf_get_image, do not overwrite them.reimar2004-10-011-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13522 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed small memleakreimar2004-10-012-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13521 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.759:gpoirier2004-10-011-8/+44
| | | | | | | | Documentation of x264 3-pass mode, and fixes on lavc's *_mask options, pointed out by Jiri Heryan git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13520 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Jiri Heryan <technik at domotech dot cz>diego2004-10-011-165/+196
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13519 b3059339-0415-0410-9bf9-f77b7e298cf2
* Documentation of x264 3-pass mode, and typos/fixes on lavc's *_maskgpoirier2004-10-011-7/+41
| | | | | | | options, pointed ou by Jiri Heryan git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13518 b3059339-0415-0410-9bf9-f77b7e298cf2
* typospaszczi2004-09-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13517 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.758paszczi2004-09-301-30/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13516 b3059339-0415-0410-9bf9-f77b7e298cf2
* Syncgpoirier2004-09-301-10/+22
| | | | | | | | | | | | 1.758: consistency between the blur filter descriptions patch by Jiri Heryan <technik at domotech dot cz> 1.757: -dvd-device can point to a directory to play a VOB from the hard disk. patch by Corey Hickey <bugfood-ml at fatooh dot org> + suggestions on The Wanderer regarding English tech words git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13515 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency between the blur filter descriptionsdiego2004-09-301-6/+6
| | | | | | | patch by Jiri Heryan <technik at domotech dot cz> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13514 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Jiri Heryan <technik at domotech dot cz>diego2004-09-301-10/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13513 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explanation how to play a VOB from the hard disk.diego2004-09-291-0/+13
| | | | | | | patch by Corey Hickey <bugfood-ml at fatooh dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13512 b3059339-0415-0410-9bf9-f77b7e298cf2
* -dvd-device can point to a directory to play a VOB from the hard disk.diego2004-09-291-0/+12
| | | | | | | patch by Corey Hickey <bugfood-ml at fatooh dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13511 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.756:gpoirier2004-09-291-42/+18
| | | | | | | | | | | | Removal of vo_pgm and vo_md5 1.755: Better wording/descriptions as suggested by the Wanderer + found a nice equivalent to English "overlay" in French (incrustation) -> Kudows to my Dad! ;-) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13510 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removal of vo_md5 and vo_pgm of MAINTAINERS file.ivo2004-09-291-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13509 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removal of vo_pgm and vo_md5, because they have been replaced by vo_pnmivo2004-09-296-310/+9
| | | | | | | | | | and vo_md5sum. If one tries to use the old video output drivers, a message is printed to direct them to the new drivers. Manual page is updated (or is this called downdated? :-) ). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13508 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Reynaldo H. Verdejo Pinochet <reynaldo at opendot dot cl>diego2004-09-291-114/+109
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13507 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better wording/descriptions as suggested by the Wanderer.diego2004-09-281-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13506 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.754paszczi2004-09-281-50/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13505 b3059339-0415-0410-9bf9-f77b7e298cf2
* better, tuneable (via #define) MP3 detection, limit demux_audio to scanningreimar2004-09-281-27/+118
| | | | | | | only the first 30000 bytes for headers. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13504 b3059339-0415-0410-9bf9-f77b7e298cf2
* show ogg subtitle language on OSD, if availablejoey2004-09-283-2/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13503 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix sub_select fiasco with global sub numbering. now multiple sub sources ↵joey2004-09-283-70/+167
| | | | | | can be managed in essentially one list. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13502 b3059339-0415-0410-9bf9-f77b7e298cf2
* make sure exit_player gets calledjoey2004-09-281-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13501 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-09-281-4/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13500 b3059339-0415-0410-9bf9-f77b7e298cf2
* THE "vf=eq2=1.0:-0.8" fixgpoirier2004-09-281-56/+54
| | | | | | | | Sync with 1.754: better default parameter,added counterpart option, better names for few options, 3-pass support and improved documentation. ( Eng patch by Loren Merritt ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13499 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed include of stdint.h to inttypes.hivo2004-09-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13498 b3059339-0415-0410-9bf9-f77b7e298cf2
* better default parameter,added counterpart option, better names for few ↵iive2004-09-272-46/+54
| | | | | | | | | options, 3-pass support and improved documentation. patch by Loren Merritt git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13497 b3059339-0415-0410-9bf9-f77b7e298cf2
* This reverts the x264 modifications to the man page suggested my Loren, andgpoirier2004-09-271-40/+40
| | | | | | | that should ONLY go along with x264 front-end update when approved by everybody git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13496 b3059339-0415-0410-9bf9-f77b7e298cf2
* identical text for identical suboptionsdiego2004-09-271-10/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13495 b3059339-0415-0410-9bf9-f77b7e298cf2
* I need Cola! -vf=eq2=1.0:-0.8 is the syntax for conf file, -vf eq2=1.0:-0.8 isgpoirier2004-09-272-2/+2
| | | | | | | the runtime syntax... Bummer! git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13494 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sws default setting correction, and random wordingsgpoirier2004-09-272-57/+49
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13493 b3059339-0415-0410-9bf9-f77b7e298cf2
* MEncoder-users mailing list created.diego2004-09-271-2/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13492 b3059339-0415-0410-9bf9-f77b7e298cf2
* Porting of CRTC2 to mga_vid is stalled.diego2004-09-271-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13491 b3059339-0415-0410-9bf9-f77b7e298cf2
* compensate for width/height being picture width/height instead of bitstream ↵michael2004-09-271-3/+3
| | | | | | width/height git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13490 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.749 + random fixespaszczi2004-09-271-79/+128
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13489 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better phrasing suggested by The Wanderergpoirier2004-09-271-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13488 b3059339-0415-0410-9bf9-f77b7e298cf2
* Tons of French correctionsgpoirier2004-09-271-36/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13487 b3059339-0415-0410-9bf9-f77b7e298cf2
* SBR code does NOT work with fixed point (uses floats, slow as hell)rfelker2004-09-271-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13486 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.748: better descriptions for remaining, poorly documented maskinggpoirier2004-09-261-79/+98
| | | | | | | | | | options (many thanks to Loren Merritt) vi_qfactor description HUGE amount of spelling/wording/etc... corrections. These at least amount to 1 million l. No kidding git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13485 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.685nauj272004-09-261-11/+280
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13484 b3059339-0415-0410-9bf9-f77b7e298cf2
* better descriptions for remaining, poorly documented masking options.gpoirier2004-09-261-6/+30
| | | | | | | | vi_qfactor description Kudow to Loren Merrit git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13483 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative sync patch:gpoirier2004-09-261-73/+92
| | | | | | | | 1.746: -lavdopts lowres. 1.747: man page review part X git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13482 b3059339-0415-0410-9bf9-f77b7e298cf2
* use aspect code when used with vidixfaust32004-09-261-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13481 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part Xdiego2004-09-261-58/+59
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13480 b3059339-0415-0410-9bf9-f77b7e298cf2
* detect byte order even for cross-compilingfaust32004-09-261-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13479 b3059339-0415-0410-9bf9-f77b7e298cf2
* --host-cc option for crosscompilingfaust32004-09-262-1/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13478 b3059339-0415-0410-9bf9-f77b7e298cf2
* -lavdopts lowresmichael2004-09-261-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13477 b3059339-0415-0410-9bf9-f77b7e298cf2
* Look for SDL includes in /usr/include as well, use cc instead of gcc.diego2004-09-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13476 b3059339-0415-0410-9bf9-f77b7e298cf2
* Wrong comment, the bitmap is blue, not green.diego2004-09-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13475 b3059339-0415-0410-9bf9-f77b7e298cf2
* low resolution decodingmichael2004-09-261-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13474 b3059339-0415-0410-9bf9-f77b7e298cf2
* Encoding tip regarding x264's deblock filter suggested by Loren Merritt.gpoirier2004-09-262-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13473 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative sync with 1.744gpoirier2004-09-261-18/+17
| | | | | | | | 1.744: quantizer --> quantization as pointed out by Attila 1.743: Hint at examples, better wording, some cosmetics. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13472 b3059339-0415-0410-9bf9-f77b7e298cf2
* -lpthread --> $(ARCH_LIB), helps linking on systems without pthread.diego2004-09-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13471 b3059339-0415-0410-9bf9-f77b7e298cf2
* quantizer --> quantization as pointed out by Attiladiego2004-09-251-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13470 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hint at examples, better wording, some cosmetics.diego2004-09-251-15/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13469 b3059339-0415-0410-9bf9-f77b7e298cf2
* printf --> mp_msg conversion in ao_plugindiego2004-09-252-2/+7
| | | | | | | patch by Reynaldo H. Verdejo Pinochet <reynaldo at opendot dot cl> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13468 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.742paszczi2004-09-251-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13467 b3059339-0415-0410-9bf9-f77b7e298cf2
* almost sync :)nauj272004-09-251-553/+814
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13466 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.742gpoirier2004-09-251-23/+39
| | | | | | | better vme desc, x264 tips, consitency on jpeg section. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13465 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better vme descriptiongpoirier2004-09-251-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13464 b3059339-0415-0410-9bf9-f77b7e298cf2
* printf --> mp_msg transition in vo_yuv4mpegdiego2004-09-252-12/+40
| | | | | | | patch by Sebastian Hegler <s_hegler at gmx dot de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13463 b3059339-0415-0410-9bf9-f77b7e298cf2
* add ao_dsound authorfaust32004-09-251-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13462 b3059339-0415-0410-9bf9-f77b7e298cf2
* directsound audio output plugin, patch by Gabor Szecsi <deje at miki.hu> ↵faust32004-09-253-0/+499
| | | | | | some minor modifications by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13461 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed [no]input suboptions.syrjala2004-09-251-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13460 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.49paszczi2004-09-251-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13459 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.741paszczi2004-09-251-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13458 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better x264 descriptions/fixes based on Loren Merritt's patch (Thu, 23 Sep 2004)gpoirier2004-09-251-7/+9
| | | | | | | Also a wording fixed picked up by Diego git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13457 b3059339-0415-0410-9bf9-f77b7e298cf2
* DirectX 7 or later is needed for -vo directx.diego2004-09-241-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13456 b3059339-0415-0410-9bf9-f77b7e298cf2
* FAAD updated by adland.diego2004-09-242-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13455 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update FAAD to a 2.1 beta CVS snapshot from 2004.07.12.diego2004-09-2452-4607/+20272
| | | | | | | patch by adland <adland123 at yahoo dot com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13454 b3059339-0415-0410-9bf9-f77b7e298cf2
* Same wording of vo_jpeg's outdir option as vo_pnm's.ivo2004-09-241-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13453 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Jiri Heryan <technik@domotech.cz>diego2004-09-241-36/+111
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13452 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing externrathann2004-09-231-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13451 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.739paszczi2004-09-231-4/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13450 b3059339-0415-0410-9bf9-f77b7e298cf2
* roff fixesdiego2004-09-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13449 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.738 and fixesgpoirier2004-09-231-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13448 b3059339-0415-0410-9bf9-f77b7e298cf2
* Encoding tips for x264 + 10lgpoirier2004-09-231-6/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13447 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rroff markup fixes and point out a 10l.diego2004-09-231-9/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13446 b3059339-0415-0410-9bf9-f77b7e298cf2
* roff markup fixdiego2004-09-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13445 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix examples for ao_alsa options dialog and add example for mixer index.reimar2004-09-231-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13444 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.737danny2004-09-231-166/+501
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13443 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.738 + small fixespaszczi2004-09-221-29/+93
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13442 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add comment to remind that voxmsdec.ax requires also msms001.vwprtognimp2004-09-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13441 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixesdiego2004-09-221-8/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13440 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100lfaust32004-09-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13439 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative patchgpoirier2004-09-221-10/+32
| | | | | | | | | 1.736: Better lumi/dark_masking descriptions, tips for 4mv and autoaspect 1.736: Better nssew description. 1.735: allow to select an alsa mixer channel index. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13438 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better lumi/dark_masking descriptions, tips for 4mv and autoaspect and 10l fixgpoirier2004-09-221-6/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13437 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better nssew descriptiongpoirier2004-09-221-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13436 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow to select an alsa mixer channel index.reimar2004-09-222-3/+30
| | | | | | | | Patch by Eric Yagerlener [eyager (at) chartermi (dot) net]. Applied with slight modifications, see also bugzilla bug #69. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13435 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.733: add support for subpel quality refinement option in x264.gpoirier2004-09-221-4/+24
| | | | | | | | | | (Eng patch by Jeff Clagg) Sync with 1.734: fixes on the new portable anymap and md5sum video output drivers (not all are here, I did some fixes while commiting the patch to the French manpage already) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13434 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes, better wordings on the new portable anymap and md5sum video outputgpoirier2004-09-221-11/+8
| | | | | | | | drivers (introduced by revision 1.726) + a small fix on jpeg section git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13433 b3059339-0415-0410-9bf9-f77b7e298cf2
* add support for subpel quality refinement option in x264.iive2004-09-222-1/+23
| | | | | | | patch by Jeff Clagg git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13432 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lrfelker2004-09-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13431 b3059339-0415-0410-9bf9-f77b7e298cf2
* Nobody maintains dvdnav, it's not supported.diego2004-09-221-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13430 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.732: encoding to mp2 with libtoolamegpoirier2004-09-211-1/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13429 b3059339-0415-0410-9bf9-f77b7e298cf2
* setting samplesize to 2 in decoders where neccessary.reimar2004-09-2113-1/+14
| | | | | | | | Needed because initialization of sh_audio was moved from dec_audio to demuxer.c, and some demuxers set samplesize incorrect or to 0. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13428 b3059339-0415-0410-9bf9-f77b7e298cf2
* encoding to mp2 with libtoolamenicodvb2004-09-216-0/+180
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13427 b3059339-0415-0410-9bf9-f77b7e298cf2
* encoding to mp2 with libtoolame - only cbr atmnicodvb2004-09-212-0/+143
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13426 b3059339-0415-0410-9bf9-f77b7e298cf2
* With the latest change to dec_audio.c (1.32) the demuxers have to set ↵mosu2004-09-211-10/+10
| | | | | | sh_a->samplesize to something != 0. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13425 b3059339-0415-0410-9bf9-f77b7e298cf2
* lot of bigendian fixesalex2004-09-211-0/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13424 b3059339-0415-0410-9bf9-f77b7e298cf2
* credit for Loren Merritt, patch by himselfdiego2004-09-211-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13423 b3059339-0415-0410-9bf9-f77b7e298cf2
* clarification about FFmpeg license, typodiego2004-09-211-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13422 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.731: Better description of lavc's dia encoding option, thanksgpoirier2004-09-211-7/+26
| | | | | | | | to Loren Merritt explanations + some typos, fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13421 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better explain why we have no DVD menus and what to do about it (DIY).diego2004-09-211-6/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13420 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo, Xine --> xinediego2004-09-213-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13419 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better description of lavc's dia encoding option, thanks to Loren Merrittgpoirier2004-09-211-1/+12
| | | | | | | explanations git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13418 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes suggested by Diegogpoirier2004-09-211-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13417 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative patch 1.727 and 1.722gpoirier2004-09-211-10/+43
| | | | | | | | Better description of Loren Merritt's 3-pass mode, better qns desc., and a couple of x264 encoding options (based a documentation I read) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13416 b3059339-0415-0410-9bf9-f77b7e298cf2
* split patches up as far as sensibly possible, but no further.diego2004-09-211-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13415 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-09-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13414 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics, start new sentences on a new line.diego2004-09-211-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13413 b3059339-0415-0410-9bf9-f77b7e298cf2
* Roff interprets ' as markup, thus lines should never start with '.diego2004-09-214-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13412 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Jiri Heryan <technik at domotech dot cz>diego2004-09-211-108/+184
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13411 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmeticspaszczi2004-09-201-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13410 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.728 + random fixespaszczi2004-09-201-13/+101
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13409 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reworked description of lavc's 3-pass encoding; patch by its creatorgpoirier2004-09-201-9/+15
| | | | | | | Loren Merritt < lorenm AT NOSPAM u DOT washington DOT edu > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13408 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: Make turbo mode compatible with 3-pass encodinggpoirier2004-09-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13407 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better description of Loren Merritt's 3-pass mode, better qns desc., and agpoirier2004-09-201-6/+28
| | | | | | | couple of x264 encoding options (based a documentation I read) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13406 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added the uCIFS library, of which a part is used by vo_md5sum.ivo2004-09-201-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13405 b3059339-0415-0410-9bf9-f77b7e298cf2
* "partial" sync with 1.726: Document the new portable anymap and md5sum videogpoirier2004-09-201-2/+45
| | | | | | | | output drivers. since I changed some things for consistency reasons git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13404 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't output error when testing for JACK. Also _insist_ on a JACK versional2004-09-201-3/+3
| | | | | | | greater/equal `.3'. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13403 b3059339-0415-0410-9bf9-f77b7e298cf2
* Credit where credit's due :)ivo2004-09-201-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13402 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document the new portable anymap and md5sum video output drivers.ivo2004-09-201-0/+51
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13401 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added myself to AUTHORS and MAINTAINERS for the new vo_pnm and vo_md5sumivo2004-09-202-0/+4
| | | | | | | video output drivers. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13400 b3059339-0415-0410-9bf9-f77b7e298cf2
* This patch enables the compilation and linking of vo_md5sum to libvo.ivo2004-09-202-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13399 b3059339-0415-0410-9bf9-f77b7e298cf2
* This patch enables the compilation and linking of vo_pnm (the portableivo2004-09-202-1/+3
| | | | | | | anymap video output driver) to libvo. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13398 b3059339-0415-0410-9bf9-f77b7e298cf2
* New translatable messages for vo_pnm (the portable anymap video outputivo2004-09-201-0/+7
| | | | | | | driver). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13397 b3059339-0415-0410-9bf9-f77b7e298cf2
* New MD5 sum video output driver. For every frame, it calculates the MD5 sumivo2004-09-203-0/+1062
| | | | | | | | | | | | | | and writes a list of those sums to an, optionally specified, output file. It does not rely on external programs to be installed. The MD5 sum code is borrowed from the uCIFS library, written by Christopher R. Hertel in 2004 and released under the LGPL license. Note: This driver is not yet activated and will not be compiled and linked to libvo. A separate patch will take care of that. This is just for adding the files to the repository. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13396 b3059339-0415-0410-9bf9-f77b7e298cf2
* New generic 'portable anymap' video output driver. It supports portableivo2004-09-201-0/+666
| | | | | | | | | | | | | | | | pixmaps and graymaps in both raw and ASCII mode. Besides PPM and PGM, it can also output PGMYUV files which are PGM files with the U and V plane appended to the bottom of the Y image (bottom left and bottom right). All files can be written to the current directory, to a specified output directory or to multiple subdirectories if the filesystem can't handle the amount of files in one directory anymore. Note: This driver is not yet activated and will not be compiled and linked to libvo. A separate patch will take care of that. This is just for adding the file to the repository. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13395 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l typomichael2004-09-191-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13394 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.725: Better wording and clarity as suggested by the Wanderer.gpoirier2004-09-191-8/+9
| | | | | | | + some further suggestions by the Wanderer on Eng manpage. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13393 b3059339-0415-0410-9bf9-f77b7e298cf2
* handle sigchld in mplayer.cfaust32004-09-192-10/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13392 b3059339-0415-0410-9bf9-f77b7e298cf2
* switch_ratio may not work with some filter chainsfaust32004-09-191-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13391 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better wording and clarity as suggested by the Wanderer.diego2004-09-191-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13390 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics by frogupaszczi2004-09-191-22/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13389 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes indentation around my contributions, and adds lavc's "turbo" mode,gpoirier2004-09-191-2/+3
| | | | | | | inspired by XviD "turbo" mode. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13388 b3059339-0415-0410-9bf9-f77b7e298cf2
* New lavc flag: "turbo" mode which is supposed to speed up 2-pass encodinggpoirier2004-09-193-1/+41
| | | | | | | | while preserving quality as much as possible. Inspired by XviD "turbo" mode. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13387 b3059339-0415-0410-9bf9-f77b7e298cf2
* support generating divx2pass.log on 2nd pass patch by (Loren Merritt <lorenm ↵michael2004-09-181-9/+14
| | | | | | at u dot washington dot edu>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13386 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.723paszczi2004-09-181-56/+72
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13385 b3059339-0415-0410-9bf9-f77b7e298cf2
* mp_msg transition of unmaintained audio output drivers.ivo2004-09-1813-94/+191
| | | | | | | Patch by Reynaldo H. Verdejo Pinochet <reynaldo at opendot dot cl> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13384 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative patch:gpoirier2004-09-181-56/+73
| | | | | | | | | | | | 1.723: man page review part IX 1.722: passing an array or double precission parameters for the scaling function, instead of missusing a few bits of the flags fixing the naming of the scaling functions a little + probably some Diego fixes on French manpage git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13383 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix playback of files with displaysize not set (aspect was set to NaN for these)reimar2004-09-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13382 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use the same names as on mphq for the generated man pages.diego2004-09-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13381 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reduce excessive verbosity a bit.diego2004-09-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13380 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part IXdiego2004-09-181-56/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13379 b3059339-0415-0410-9bf9-f77b7e298cf2
* czech man page translation by Jiri Heryan <technik at domotech dot cz>diego2004-09-181-0/+6861
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13378 b3059339-0415-0410-9bf9-f77b7e298cf2
* compile fixgabucino2004-09-181-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13377 b3059339-0415-0410-9bf9-f77b7e298cf2
* force compilers not to optimize/inline extend_stack_for_dll_allocareimar2004-09-181-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13376 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix reimar's 10l...no actually imho it's arpi's 100l for writing therfelker2004-09-181-0/+1
| | | | | | | | | old bad init_audio_codec code that replaced all the values set by the demuxer with "safe" defaults. no idea where this actually belongs -- here or the various demuxers -- but at least it works again now. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13375 b3059339-0415-0410-9bf9-f77b7e298cf2
* passing an array or double precission parameters for the scaling function, ↵michael2004-09-189-38/+57
| | | | | | | | | instead of missusing a few bits of the flags fixing the naming of the scaling functions a little git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13374 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.40 + random fixespaszczi2004-09-171-66/+77
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13373 b3059339-0415-0410-9bf9-f77b7e298cf2
* A bit of syncnauj272004-09-171-795/+911
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13372 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.721paszczi2004-09-171-21/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13371 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with English manpagegpoirier2004-09-171-18/+16
| | | | | | | | | 1.720: MicroDVD IS a frame-based subtitle format 1.719: wording, spelling and small fixes to the video output driver section + a mistake picked up by Diego git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13370 b3059339-0415-0410-9bf9-f77b7e298cf2
* -menu-startup, based on patch by Aurelien Jacobs <aurel at gnuage dot org>diego2004-09-172-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13369 b3059339-0415-0410-9bf9-f77b7e298cf2
* runtime aspect switching, patch by Aurelien Jacobs <aurel at gnuage . org>diego2004-09-171-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13368 b3059339-0415-0410-9bf9-f77b7e298cf2
* Quit now sends an optional return value, based on patch sent by Aureliendiego2004-09-171-2/+3
| | | | | | | Jacobs <aurel at gnuage dot org>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13367 b3059339-0415-0410-9bf9-f77b7e298cf2
* Translate up to MSGL_STATUS so all normal output is translated.diego2004-09-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13366 b3059339-0415-0410-9bf9-f77b7e298cf2
* MicroDVD IS a frame-based subtitle format, mistake noticed by Jiri Heryandiego2004-09-171-1/+1
| | | | | | | <technik at domotech dot cz>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13365 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording, spelling and small fixes to the video output driver sectiondiego2004-09-171-26/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13364 b3059339-0415-0410-9bf9-f77b7e298cf2
* Made the wording of MSGTR_EdlCantOpenForWrite and MSGTR_EdlCantOpenForWritediego2004-09-171-1/+1
| | | | | | | identical for consistency. Also German translation is easier this way. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13363 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32004-09-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13362 b3059339-0415-0410-9bf9-f77b7e298cf2
* center the image when screenw & height are setfaust32004-09-171-2/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13361 b3059339-0415-0410-9bf9-f77b7e298cf2
* lastes sync with EDL messageskraymer2004-09-171-1/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13360 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hardcoded EDL messages moved to help_mp-en.h, Doxygen comments added, patchdiego2004-09-175-47/+83
| | | | | | | | by "Reynaldo H. Verdejo Pinochet" <reynaldo at opendot dot cl>, spelling and wording corrections by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13359 b3059339-0415-0410-9bf9-f77b7e298cf2
* moved sh_audio initialization from dec_audio to demuxer.c to fixreimar2004-09-163-20/+7
| | | | | | | | -hr-mp3-seek bug (pts was -inf after seeking) and remove the workaround from demux_audio.c. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13358 b3059339-0415-0410-9bf9-f77b7e298cf2
* IBM Ultimotion native decoding via libavcodecrtognimp2004-09-161-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13357 b3059339-0415-0410-9bf9-f77b7e298cf2
* Changed the default again so that the initial video position is infaust32004-09-161-1/+1
| | | | | | | | | | the upper left corner like in vo fbdev[2]. Reason: vo cvidix does not know the screen resolution unlike you specify it with screen[w/h], resulting in the video being displayed on a random position. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13356 b3059339-0415-0410-9bf9-f77b7e298cf2
* nickdiego2004-09-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13355 b3059339-0415-0410-9bf9-f77b7e298cf2
* make it possible to use the run command from a menu config file, based on a ↵faust32004-09-161-0/+10
| | | | | | patch by Aurelien Jacobs <aurel@gnuage.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13354 b3059339-0415-0410-9bf9-f77b7e298cf2
* stdout and stderr are macros --- you can't assign to them. Assignment ↵faust32004-09-161-2/+2
| | | | | | doesn't make sense anyway, because freopen will always return the same FILE * structure that it got in parameter. patch by Mikulas Patocka <mikulas@artax.karlin.mff.cuni.cz> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13353 b3059339-0415-0410-9bf9-f77b7e298cf2
* declare modify_ldt with syscall3 macro for older glibcs patch by Mikulas ↵faust32004-09-161-0/+5
| | | | | | Patocka <mikulas at artax.karlin.mff.cuni.cz> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13352 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support "Creative ADPCM codec" and "Micronas speech codec" audio codecsrtognimp2004-09-151-0/+14
| | | | | | | via windows binary dll git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13351 b3059339-0415-0410-9bf9-f77b7e298cf2
* Depend on bio2jack v0.3 as it fixes an important bug in JACK_Write() ↵faust32004-09-151-1/+1
| | | | | | function patch by ismail donmez <kde@myrealbox.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13350 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.718paszczi2004-09-151-5/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13349 b3059339-0415-0410-9bf9-f77b7e298cf2
* mingw compile fixfaust32004-09-151-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13348 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix not matching prototype, patch by Mikulas Patocka <mikulas at ↵faust32004-09-151-3/+2
| | | | | | artax.karlin.mff.cuni.cz>; remove ^M git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13347 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix a memory corruption and make sure only getch2 handles stdinfaust32004-09-151-2/+2
| | | | | | | | in order to avoid delayed events caused by lost input patch by Mikulas Patocka <mikulas at artax.karlin.mff.cuni.cz> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13346 b3059339-0415-0410-9bf9-f77b7e298cf2
* option to display menu at startup, patch by Aurelien Jacobs <aurel at ↵faust32004-09-152-0/+8
| | | | | | gnuage.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13345 b3059339-0415-0410-9bf9-f77b7e298cf2
* This time is a patch to improve subtitle alignment management. Itfaust32004-09-153-13/+58
| | | | | | | | | | | implements SSA alignment styles; note that alignment for SSA files is not actually supported, but for SAMI files (which use the same alignment codes) it is. patch by Salvatore Falco <sfalco at studenti.ing.uniroma1.it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13344 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative patch:gpoirier2004-09-151-55/+164
| | | | | | | | | | | | 1.718: Audio output driver suboptions documented 1.717: Consistency fixes, spelling 1.716: All video driver suboptions documented, gif and tga examples + Diego suggestions/fixies on above patches, and on previous commit + small Nroff formating fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13343 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix ineffectual video equalizer command line options, patch by kiriuja ↵faust32004-09-152-19/+28
| | | | | | <mplayer-bugs at en-directo.net>, closes #37, some more variable docu by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13342 b3059339-0415-0410-9bf9-f77b7e298cf2
* Audio output driver suboptions documenteddanny2004-09-151-3/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13341 b3059339-0415-0410-9bf9-f77b7e298cf2
* slave mode command to switch aspect ratio, patch by Aurelien Jacobs <aurel ↵faust32004-09-153-0/+9
| | | | | | at gnuage.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13340 b3059339-0415-0410-9bf9-f77b7e298cf2
* quit slave mode command now accepts an exit value, patch by Aurelien Jacobs ↵faust32004-09-152-3/+3
| | | | | | <aurel at gnuage.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13339 b3059339-0415-0410-9bf9-f77b7e298cf2
* add a comment to the Xorg workaroundfaust32004-09-151-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13338 b3059339-0415-0410-9bf9-f77b7e298cf2
* Index must be positive to prevent endless loop on bad datartognimp2004-09-141-6/+6
| | | | | | | Based on an idea by iive git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13337 b3059339-0415-0410-9bf9-f77b7e298cf2
* workaround for Xorg-6.8 not saving the surface registers on bigendianfaust32004-09-141-0/+31
| | | | | | | architectures, patch by Luca Barbato <lu_zero at gentoo.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13336 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compile on gcc 2.95.3iive2004-09-141-2/+4
| | | | | | | patch send by Jan Knutar <jknutar_at_nic_dot_fi> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13335 b3059339-0415-0410-9bf9-f77b7e298cf2
* AVC support moved to libavcodec, avcC atom is now passed in extradatartognimp2004-09-132-101/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13334 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.717wight2004-09-131-53/+180
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13333 b3059339-0415-0410-9bf9-f77b7e298cf2
* random fixes, spelling, vocabularywight2004-09-121-114/+119
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13332 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistency fixes, spellingwight2004-09-121-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13331 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with English mp-v1.715.gpoirier2004-09-121-25/+21
| | | | | | | | 1.714: 2pass encoding support for x264(r46) + changes in default settings 1.715: Small fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13330 b3059339-0415-0410-9bf9-f77b7e298cf2
* All video driver suboptions documented, gif and tga examplesdanny2004-09-121-33/+117
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13329 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixesdiego2004-09-121-12/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13328 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed wording (s/Unteroption/Suboption)kraymer2004-09-121-25/+84
| | | | | | | very few updates in fideo filters section git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13327 b3059339-0415-0410-9bf9-f77b7e298cf2
* 2pass encoding support for x264(r46).iive2004-09-122-34/+42
| | | | | | | patch by Loren Merritt and Jeff Clagg git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13326 b3059339-0415-0410-9bf9-f77b7e298cf2
* Spelling. Patch by Jan Minar <jjminar at fastmail onedot fm>.mosu2004-09-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13325 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.711:gpoirier2004-09-121-16/+69
| | | | | | | | - Video driver null, yuv4mpeg, gif89a, pgm, png and tga documented, jpeg drop from the list to document - minor changes, and typos from 1.710 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13324 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added one more error check. Forgot it last time (grrr :) ).ivo2004-09-121-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13323 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed occurence of work as maintainer (in regard to Diego's email)kraymer2004-09-111-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13322 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates in video output drivers section (update rev 1710 of ↵kraymer2004-09-111-9/+63
| | | | | | en/mplayer.1)\nother minor fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13321 b3059339-0415-0410-9bf9-f77b7e298cf2
* hopefully last format correction regarding prior commit in video output ↵kraymer2004-09-111-1/+3
| | | | | | drivers section git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13320 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes some typos, wording and formattingkraymer2004-09-111-22/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13319 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed typo.ivo2004-09-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13318 b3059339-0415-0410-9bf9-f77b7e298cf2
* * Changed malloc and strncpy to strdup. Less code.ivo2004-09-111-20/+38
| | | | | | | | | | * More error checking. If malloc or strdup fails, print message and exit. * Free malloc'd memory when uninit is called. * Moved default of jpeg_outdir to preinit, so it is always malloc'd and can easily be freed at uninit. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13317 b3059339-0415-0410-9bf9-f77b7e298cf2
* added myself to AUTHORS filekraymer2004-09-111-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13316 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed email addresskraymer2004-09-111-2/+2
| | | | | | | latest sync missed update of revision tag git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13315 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor changes I came across during sync of videofilters sectionkraymer2004-09-111-8/+8
| | | | | | | (hope it's common-sense) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13314 b3059339-0415-0410-9bf9-f77b7e298cf2
* spell-checking done for beginning until player-specific options (mplayer only)kraymer2004-09-111-59/+219
| | | | | | | | minor changes in wording according to Diego's suggestion many updates in videofilters section git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13313 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make --with-x264incdir work, patch by Jan Knutar <jknutar at nic.fi>diego2004-09-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13312 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix seeking in audio-only case (crash when seeking backwards, time reset to 0)reimar2004-09-111-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13311 b3059339-0415-0410-9bf9-f77b7e298cf2
* Video driver null, yuv4mpeg, gif89a, pgm, png and tga documented, jpeg drop ↵danny2004-09-111-4/+48
| | | | | | from the list to document git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13310 b3059339-0415-0410-9bf9-f77b7e298cf2
* info packet is now file global, while meta pakcet is stream specific, as ↵alex2004-09-111-16/+44
| | | | | | discussed with Rich git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13309 b3059339-0415-0410-9bf9-f77b7e298cf2
* output faad error message in case of a decoder errorreimar2004-09-111-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13308 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100lrtognimp2004-09-101-2/+2
| | | | | | | | | sys_errlist[] is deprecated and breaks compilation on some systems, replaced it with strerror() also commented out the printf git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13307 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't prepend basepath to a full unix path. ( 10l to Joey. )al2004-09-101-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13306 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavformatdiego2004-09-101-3/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13305 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes for VirtualAlloc function:rtognimp2004-09-101-15/+48
| | | | | | | | | | | | | | | | | | | * mplayer received a SIGSEGV under Linux after Opening video decoder: [dmo] DMO video codecs VirtualAlloc(0x00400000, 859648, 0x00003000, 0x00000040) because that region was already under use and mmap() with MAP_FIXED has problems under Linux (see code). VirtualAlloc() fixed in "loader/ext.c". * VirtualAlloc() made to conform with win32 documented behavior regarding the alignment of the address and size arguments. * VirtualAlloc() detection of overlap with previous regions fixed. Patch by A. Guru ( a.guru at sympatico dot ca ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13304 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos, wordingdiego2004-09-101-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13303 b3059339-0415-0410-9bf9-f77b7e298cf2
* show video format for all demuxers, not just avi (move this somewhere else ↵rfelker2004-09-101-0/+9
| | | | | | if you prefer) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13302 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed unused variable (leftover of having two instances of directory creationivo2004-09-101-3/+2
| | | | | | | | code, before I moved both and created a function for that). Made code clearer by moving ++variable out of a function call. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13301 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid always skipping first junk with a "sync lost" messagereimar2004-09-091-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13300 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't leave a messed up terminal after a crashrtognimp2004-09-091-2/+12
| | | | | | | | | | | | | | | | | | | | Old way: crash: try uninit + exit (4 times) crash: try exit(1) crash: send self kill -9 With this patch: crash: try uninit + exit (4 times) crash: forget about the normal mplayer uninit codepaths and try restore terminal by force + exit crash: try exit crash: send self kill -9 Patch by Jan Knutar ( jknutar at nic dot fi ) Approved by alex git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13299 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos and wordings picked up by Diegogpoirier2004-09-091-20/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13298 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.709: "some typo, case change"gpoirier2004-09-091-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13297 b3059339-0415-0410-9bf9-f77b7e298cf2
* Encoding options update, most are XviD relatedgpoirier2004-09-091-131/+312
| | | | | | | The manpage is up-to-date, in perfect sync with English 1.708. Yeah! ;-) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13296 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-09-092-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13295 b3059339-0415-0410-9bf9-f77b7e298cf2
* some typo, case changedanny2004-09-091-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13294 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.708 (aka first sync from my laptop;P)paszczi2004-09-091-142/+333
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13293 b3059339-0415-0410-9bf9-f77b7e298cf2
* All video filters are now documented and in sync against English man page.gpoirier2004-09-091-76/+84
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13292 b3059339-0415-0410-9bf9-f77b7e298cf2
* adding the code documentation guide linesattila2004-09-091-0/+124
| | | | | | | now everyone has to follow them git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13291 b3059339-0415-0410-9bf9-f77b7e298cf2
* chunk size fix from Ross Finlayson, ported from xinediego2004-09-081-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13290 b3059339-0415-0410-9bf9-f77b7e298cf2
* CVS policy updated as discussed on dev-eng.diego2004-09-081-54/+72
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13289 b3059339-0415-0410-9bf9-f77b7e298cf2
* Von/van should not determine alphabetical order, email address added.diego2004-09-081-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13288 b3059339-0415-0410-9bf9-f77b7e298cf2
* Typos on the XviD sectiongpoirier2004-09-081-12/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13287 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.707danny2004-09-081-482/+1305
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13286 b3059339-0415-0410-9bf9-f77b7e298cf2
* Renamed some MSGTR_VO_JPEG_* messages to MSGTR_VO_* messages, so they canivo2004-09-084-56/+58
| | | | | | | | | | | | easily be re-used by other video output drivers, without having inapproriate names. To make live easier for the translators, I have made the same changes to the German and Spanish translations (those who already picked up on the MSGTR_VO_* messages). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13285 b3059339-0415-0410-9bf9-f77b7e298cf2
* This patch moves the directory creation code to a separate function. I haveivo2004-09-081-61/+43
| | | | | | | | | tried to re-use as much code as possible, to reduce the size of the patch. All duplicate code is removed, resulting in my first patch that actually decreases the size of the binary by about 700 bytes :-) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13284 b3059339-0415-0410-9bf9-f77b7e298cf2
* Big changes on XviD documentation.gpoirier2004-09-071-48/+211
| | | | | | | | | All options are now _very well_ documented ;-) Some options related to each others have been moved around Deprecated are marked as such git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13283 b3059339-0415-0410-9bf9-f77b7e298cf2
* OpenBSD clarification by Björn Sandell <biorn @ dce . chalmers . se>diego2004-09-071-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13282 b3059339-0415-0410-9bf9-f77b7e298cf2
* newly created videofilters sectionkraymer2004-09-071-85/+90
| | | | | | | \-vf has been moved there from decoding section git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13281 b3059339-0415-0410-9bf9-f77b7e298cf2
* finished translation and review of decoding/filtering sectionkraymer2004-09-071-15/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13280 b3059339-0415-0410-9bf9-f77b7e298cf2
* \-af note addedkraymer2004-09-071-81/+89
| | | | | | | | | | | | typos and expression changes unification of some technical terms macroblock -> makroblock bewegungsvektor -> Motion-Vector Nachbearbeitung -> Postprocessing little general work on decoding/filtering section git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13279 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative patchgpoirier2004-09-071-1/+28
| | | | | | | | "X11 options do not affect SDL", "\-noencodedups", "mplayer -af help now lists all available audio filters", "pullup docs + new feature for slow cpus" git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13278 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with Diego's alphabetical order for lavdoptsgpoirier2004-09-071-55/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13277 b3059339-0415-0410-9bf9-f77b7e298cf2
* disable direct rendering for h264michael2004-09-071-1/+1
| | | | | | | until now we did try with dr, and disabled it if more then 1 reference frame was used, but that rarely resulted in dr+h264 and its not guranteed to work as stride may end up different, and remocing CODEC_CAP_DR1 from h264 in ffmpeg isnt correct either as the h264 codec does support it git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13276 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPlayer X11 options do not affect SDL.diego2004-09-071-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13275 b3059339-0415-0410-9bf9-f77b7e298cf2
* spellingdiego2004-09-071-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13274 b3059339-0415-0410-9bf9-f77b7e298cf2
* reorder lavdopts suboptions to achieve alphabetical orderkraymer2004-09-061-36/+36
| | | | | | | | | fixed the same typo a few times changed macro definition (now in sync) that fixed 'non-compliant' display of suboptions listings git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13273 b3059339-0415-0410-9bf9-f77b7e298cf2
* \-jpeg movedkraymer2004-09-061-114/+180
| | | | | | | | | updates in decoding/filtering section, especially addes lavdopts suboptions changed disclaimer other minor fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13272 b3059339-0415-0410-9bf9-f77b7e298cf2
* finally diego will be happy....this is totally useless but oh well :)rfelker2004-09-061-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13271 b3059339-0415-0410-9bf9-f77b7e298cf2
* mplayer -af help now lists all available audio filters.ivo2004-09-064-0/+19
| | | | | | | Updated manual page. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13270 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not modify d_width and d_height when -xy option was given, otherwise -xy ↵reimar2004-09-061-1/+2
| | | | | | has no effect with e.g. vo_gl git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13269 b3059339-0415-0410-9bf9-f77b7e298cf2
* pullup docs + new feature for slow cpus :)rfelker2004-09-062-3/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13268 b3059339-0415-0410-9bf9-f77b7e298cf2
* Copy-n-Paste bug breaking channel selection in audio configuration dialogreimar2004-09-061-2/+2
| | | | | | | Patch by (eyager at chartermi dot net) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13267 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-09-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13266 b3059339-0415-0410-9bf9-f77b7e298cf2
* pan filter needs number of _input_ channels, ported from the man page.diego2004-09-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13265 b3059339-0415-0410-9bf9-f77b7e298cf2
* List administrators.diego2004-09-061-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13264 b3059339-0415-0410-9bf9-f77b7e298cf2
* mailing lists and german documentation maintainers, spellingdiego2004-09-061-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13263 b3059339-0415-0410-9bf9-f77b7e298cf2
* -lavdopts fast, small fix to -lavdopts ecdiego2004-09-061-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13262 b3059339-0415-0410-9bf9-f77b7e298cf2
* alphabetical order for lavdoptsdiego2004-09-061-44/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13261 b3059339-0415-0410-9bf9-f77b7e298cf2
* MB, QP explanation, some more consistencydiego2004-09-061-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13260 b3059339-0415-0410-9bf9-f77b7e298cf2
* some new patch policy: compression, mail threading, printf vs mp_msgdiego2004-09-061-8/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13259 b3059339-0415-0410-9bf9-f77b7e298cf2
* More information on XviD's "interlaced" and "4mv" options thanks to agpoirier2004-09-061-1/+7
| | | | | | | discution with XviD devs. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13258 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix seeking with -hr-mp3-seek. maybe not the best fix (why is last_ptsrfelker2004-09-051-0/+1
| | | | | | | | | | | | | ever infinite?!?!) but at least it makes it work... :) patch by Balazs KOSSOVICS (tevefeju AT freemail.hu): Hi! When we listening music with "-hr-mp3-seek" option, than there is a negative value at the first rewinds in the statusrange (-52 hours, some minutes). The patch is against this. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13257 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sorry, typokraymer2004-09-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13256 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to latest updates in vo_jpeg.c sectionkraymer2004-09-051-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13255 b3059339-0415-0410-9bf9-f77b7e298cf2
* Pretty much all filters documented and in sync now (up to "phase" filter,gpoirier2004-09-051-123/+260
| | | | | | | | for which I did my best to translate, but as I don't understand what it does, it would be wise for someone to double-check) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13254 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some minor vo_jpeg fixes:ivo2004-09-053-2/+9
| | | | | | | | | | Removed unused variable dst. MPlayer now exits if it is unable to create a file for JPEG output and prints an appropriate message, instead of going on if all is right (which is not). Added line to authors file. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13253 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed --enable-gif bugjoey2004-09-051-0/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13252 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed warning in my patchrfelker2004-09-051-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13251 b3059339-0415-0410-9bf9-f77b7e298cf2
* ensure that avi files have a valid header as soon as possible.rfelker2004-09-051-0/+7
| | | | | | | | | | | | | | without this, the header says 0x0 video size, which works with mplayer when the video size is stored in the codec data, but it does NOT work with other players or with codecs that don't store size (e.g. snow). actually i don't like having seeks in the muxer module, but i don't know any other way to implement this fix without major changes to mencoder. if you have a better fix, please reverse this and commit yours. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13250 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates -vo jpeg:options and minor syncgpoirier2004-09-051-39/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13249 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removal of -jpeg commandline option.ivo2004-09-044-60/+225
| | | | | | | | It's replaced by an options parser in the module itself. Instead of mplayer -vo jpeg -jpeg options one now has to use mplayer -vo jpeg:options. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13248 b3059339-0415-0410-9bf9-f77b7e298cf2
* alignment for SPARC64, second tryreimar2004-09-041-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13247 b3059339-0415-0410-9bf9-f77b7e298cf2
* af_pan wants number of _input_ channels, fixes bugzilla bug #22reimar2004-09-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13246 b3059339-0415-0410-9bf9-f77b7e298cf2
* switch_vsync patch by Aurelien Jacobs <aurel @ gnuage.org>, small fixdiego2004-09-041-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13245 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to latest manpage reviews by Diegokraymer2004-09-031-31/+29
| | | | | | | other marginal fixes git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13244 b3059339-0415-0410-9bf9-f77b7e298cf2
* We don't need to support the old nvidia binary driver bug any longer.al2004-09-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13243 b3059339-0415-0410-9bf9-f77b7e298cf2
* better documentation of not obvious subq default settinggpoirier2004-09-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13242 b3059339-0415-0410-9bf9-f77b7e298cf2
* Diego's man page review part VIII commited, small syncs on video filtersgpoirier2004-09-031-68/+75
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13241 b3059339-0415-0410-9bf9-f77b7e298cf2
* alphabetical orderdiego2004-09-031-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13240 b3059339-0415-0410-9bf9-f77b7e298cf2
* All libavcodec encoding options are now documentedgpoirier2004-09-031-148/+183
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13239 b3059339-0415-0410-9bf9-f77b7e298cf2
* improved suboption parsing, fixes also compiler warningsreimar2004-09-031-13/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13238 b3059339-0415-0410-9bf9-f77b7e298cf2
* first attempt to make 24-bit PCM DVDs workreimar2004-09-031-8/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13237 b3059339-0415-0410-9bf9-f77b7e298cf2
* strictness level -1 to 'almost' ignore breaksrfelker2004-09-031-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13236 b3059339-0415-0410-9bf9-f77b7e298cf2
* just some debugging junk i'd like to have in there for now :)rfelker2004-09-021-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13235 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing initialization of roundreimar2004-09-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13234 b3059339-0415-0410-9bf9-f77b7e298cf2
* hue filter bugfix by ("James Crowson" <jbcrowso at ncsu dot edu>)michael2004-09-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13233 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Andoni Zubimendi <andoni at lpsat.net>nauj272004-09-021-2/+144
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13232 b3059339-0415-0410-9bf9-f77b7e298cf2
* non spec compliant optizations supportmichael2004-09-021-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13231 b3059339-0415-0410-9bf9-f77b7e298cf2
* subtitle autodetection regardles of case (bug #65), patches Michal Svec ↵faust32004-09-021-1/+1
| | | | | | <rebel at atrey.karlin.mff.cuni.cz> and Reynaldo H. Verdejo Pinochet <reynaldo at opendot.cl> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13230 b3059339-0415-0410-9bf9-f77b7e298cf2
* slave mode command to en/disable vsync, patch by Aurelien Jacobs <aurel at ↵faust32004-09-023-0/+5
| | | | | | gnuage.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13229 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix for i420 format, initial patch by Aurelien Jacobs <aurel at gnuage.org> ↵faust32004-09-021-2/+9
| | | | | | from the Geexbox mplayer patchset, some modification by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13228 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync tag bumped to 1.47wight2004-09-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13227 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.65wight2004-09-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13226 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.47wight2004-09-021-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13225 b3059339-0415-0410-9bf9-f77b7e298cf2
* - <screen> -> <command>, improves readibility and sense.wight2004-09-021-2/+2
| | | | | | | - Capitalization, 32bit -> 32-bit git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13224 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-09-024-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13223 b3059339-0415-0410-9bf9-f77b7e298cf2
* - sync 1.45wight2004-09-011-168/+179
| | | | | | | | - break long lines - remove trailing whitespace git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13222 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.694 + additional fixespaszczi2004-09-011-102/+110
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13221 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part VIIIdiego2004-09-011-64/+69
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13220 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixes some upercase/points on sentencesgpoirier2004-09-011-10/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13219 b3059339-0415-0410-9bf9-f77b7e298cf2
* One-time cosmetics update.ivo2004-09-011-154/+236
| | | | | | | | | | | | | | I finally got rid of the horrible one-space indentation. Changed it to four spaces. Also changed all function calls, assignments, et cetera, to conform to a certain 'standard'. Removed all trailing whitespace. No more tabs (width can be different from editor to editor), it's all spaces now. Next semi-cosmetics stop will be doxygen comments. Tested: It compiles to exactly the same object as before. No functional change has been made. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13218 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync against Diego's man page review part VI & VIIgpoirier2004-08-311-85/+87
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13217 b3059339-0415-0410-9bf9-f77b7e298cf2
* Massive updates and sync on filters section.gpoirier2004-08-311-140/+185
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13216 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part VIIdiego2004-08-311-35/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13215 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.692 + random fixespaszczi2004-08-311-70/+81
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13214 b3059339-0415-0410-9bf9-f77b7e298cf2
* cropdetect description updategpoirier2004-08-311-4/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13213 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part VIdiego2004-08-311-71/+69
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13212 b3059339-0415-0410-9bf9-f77b7e298cf2
* cropdetect style fixupdiego2004-08-311-7/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13211 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compn wished for forcing codecs.diego2004-08-311-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13210 b3059339-0415-0410-9bf9-f77b7e298cf2
* The threads lavc option may negatively affect motion estimation.diego2004-08-311-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13209 b3059339-0415-0410-9bf9-f77b7e298cf2
* Modified Files:kraymer2004-08-301-49/+297
| | | | | | | | | DOCS/man/de/mplayer.1 Applied latest readability-patches down to Decoding/Filtering-Options. To this point, the german manpage is in sync. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13208 b3059339-0415-0410-9bf9-f77b7e298cf2
* Using updated colorspace specifications from colorspaces.txt.reimar2004-08-301-9/+9
| | | | | | | All by manyfmts suboption supported formats should display correctly now. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13207 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adds rounding parameter for width and height values returned.reimar2004-08-302-6/+41
| | | | | | | Based on idea from <rcooley (at) spamcop (dot) net>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13206 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.682danny2004-08-301-510/+743
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13205 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow empty assignments, necessary for some weird servers...reimar2004-08-301-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13204 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small sync of just lavc options...gpoirier2004-08-301-59/+75
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13203 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small syncs against english manpage around old-DiviX post-processing filtrers.gpoirier2004-08-301-46/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13202 b3059339-0415-0410-9bf9-f77b7e298cf2
* removal of (hopefully) trailing spaces, small fixes and syncs.gpoirier2004-08-301-134/+135
| | | | | | | | | Introduction of a comment in the nroff code to see up to which point the manpage is guaranteed to be in sync with English manpage (for french maintainers/reviewers). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13201 b3059339-0415-0410-9bf9-f77b7e298cf2
* URL with lavc option descriptions, pointed out by Attila.diego2004-08-301-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13200 b3059339-0415-0410-9bf9-f77b7e298cf2
* unrarlibdiego2004-08-301-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13199 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.64 + fixed previous syncpaszczi2004-08-301-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13198 b3059339-0415-0410-9bf9-f77b7e298cf2
* #ifdef simplification and higher consistencydiego2004-08-301-6/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13197 b3059339-0415-0410-9bf9-f77b7e298cf2
* For some reason the arts sdl audio subdriver is called artsc.diego2004-08-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13196 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.63paszczi2004-08-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13195 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.688 + some fixespaszczi2004-08-291-252/+782
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13194 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cumulative patch for all Diego's patches before Aug 29 18:38:15 CEST 2004. ↵gpoirier2004-08-291-146/+670
| | | | | | Some minor fixes too. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13193 b3059339-0415-0410-9bf9-f77b7e298cf2
* Addition of x264 encoding options plus minor spelling and syncsgpoirier2004-08-291-2/+158
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13192 b3059339-0415-0410-9bf9-f77b7e298cf2
* AVC (fourcc avc1) in mp4 supportrtognimp2004-08-293-0/+134
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13191 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-08-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13190 b3059339-0415-0410-9bf9-f77b7e298cf2
* small gcc warning fixesrathann2004-08-286-8/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13189 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixesrathann2004-08-283-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13188 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix overcomplicated macros and a few warningsrathann2004-08-281-8/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13187 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix missing includesrathann2004-08-282-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13186 b3059339-0415-0410-9bf9-f77b7e298cf2
* fall back to --> fall back on, some consistencydiego2004-08-281-24/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13185 b3059339-0415-0410-9bf9-f77b7e298cf2
* use correct headersrathann2004-08-281-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13184 b3059339-0415-0410-9bf9-f77b7e298cf2
* loader gcc warning fixes and avifile syncrathann2004-08-284-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13183 b3059339-0415-0410-9bf9-f77b7e298cf2
* small gcc warning fixrathann2004-08-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13182 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264 section reviewed.diego2004-08-281-41/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13181 b3059339-0415-0410-9bf9-f77b7e298cf2
* more consistency, small changesdiego2004-08-281-77/+45
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13180 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Reynaldo Verdejo Pinochetdiego2004-08-281-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13179 b3059339-0415-0410-9bf9-f77b7e298cf2
* trailing whitespacediego2004-08-281-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13178 b3059339-0415-0410-9bf9-f77b7e298cf2
* Small changes for added consistency.diego2004-08-281-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13177 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistently insert lines with only "." between options.diego2004-08-281-19/+585
| | | | | | | Greatly improves readability. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13176 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync against english manpage. All done until "video filters"gpoirier2004-08-281-46/+137
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13175 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Sebastian Krämer <mail@skraemer.de>diego2004-08-281-3/+147
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13174 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.682 + random fixespaszczi2004-08-281-4/+140
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13173 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some more dependency trackingwight2004-08-281-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13172 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Sebastian Krämer <mail@skraemer.de>diego2004-08-281-310/+152
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13171 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added Reynaldo as maintainter for MPlayer's EDL code.al2004-08-281-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13170 b3059339-0415-0410-9bf9-f77b7e298cf2
* EDL enhancement/fixes:rtognimp2004-08-284-122/+278
| | | | | | | | | | | | | | | | | *Some edl's code moved from mplayer.c to edl.c (mencoder will use the same functions) * slighty faster * removed MAX_EDL_ENTRIES limit (just reserve the memory we really need) * really treat edl_records as a linked list (coz it is) * edl now 'remembers' pending operations after a manual _seek_ * better way of handling Mute/Umute eliminates some nasty bugs when manual seeking (scrwed up mute/unmute order, no audio after seek, etc) * seeking while on -edl mode now _WORKS_ Patch by Reynaldo H. Verdejo Pinochet (reynaldo at opendot dot cl) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13169 b3059339-0415-0410-9bf9-f77b7e298cf2
* Rough but working bigendian support for radeon cards, patch by Luca Barbato ↵faust32004-08-271-3/+30
| | | | | | <lu_zero at gentoo.org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13168 b3059339-0415-0410-9bf9-f77b7e298cf2
* x264 encoder support. Original patch send by Bernhard Rosenkraenzer <bero at ↵iive2004-08-278-4/+515
| | | | | | arklinux dot org>, modifications by Loren Merritt <lorenm at u.washington dot edu>, Jeff Clagg <snacky at ikaruga.co dot uk> and me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13167 b3059339-0415-0410-9bf9-f77b7e298cf2
* Includes latest english patches translated in French, new sync against thegpoirier2004-08-271-502/+509
| | | | | | | | whole manpage (moving sections over, work nearly done at 50%!) and some spelling corrections. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13166 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updated the AUTHORS file.ivo2004-08-271-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13165 b3059339-0415-0410-9bf9-f77b7e298cf2
* wordingpaszczi2004-08-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13164 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.681paszczi2004-08-271-23/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13163 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync to 1.125henry2004-08-271-8/+153
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13162 b3059339-0415-0410-9bf9-f77b7e298cf2
* better -slang description inspired by a patch from Guillaume Poirierdiego2004-08-271-5/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13161 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplificationdiego2004-08-271-9/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13160 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added output to multiple directories for vo_jpeg.ivo2004-08-264-12/+140
| | | | | | | Updated the manual page to describe the new options. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13159 b3059339-0415-0410-9bf9-f77b7e298cf2
* added "xbutton" support for 4-5 button micejoey2004-08-261-0/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13158 b3059339-0415-0410-9bf9-f77b7e298cf2
* Patches should be gzip or bzip2 compressed if necessary.diego2004-08-261-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13157 b3059339-0415-0410-9bf9-f77b7e298cf2
* added forgotten dvb-t params lp_coderate and hierarchynicodvb2004-08-263-11/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13156 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added myself as maintainer of vo_jpeg.ivo2004-08-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13155 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed the removal of French maintainer of the Doc Nicolas Le Gaillartgpoirier2004-08-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13154 b3059339-0415-0410-9bf9-f77b7e298cf2
* clenupshenry2004-08-261-7/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13153 b3059339-0415-0410-9bf9-f77b7e298cf2
* Changed the name of the French documentation maintainergpoirier2004-08-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13152 b3059339-0415-0410-9bf9-f77b7e298cf2
* some more segfault fixesfaust32004-08-261-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13151 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lmichael2004-08-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13150 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove unnecessary mips check (it's obsolete anyway)rathann2004-08-261-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13149 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatehenry2004-08-261-23/+55
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13148 b3059339-0415-0410-9bf9-f77b7e298cf2
* More sync against latest english manpage patches and french grammar correctionsgpoirier2004-08-261-146/+196
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13147 b3059339-0415-0410-9bf9-f77b7e298cf2
* change to match current bgr/rgb definitionmichael2004-08-261-15/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13146 b3059339-0415-0410-9bf9-f77b7e298cf2
* properly set linking flags for NetBSD, patch by jb13@gomerbud.comdiego2004-08-261-2/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13145 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync + some small fixeswight2004-08-251-121/+123
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13144 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add \: after /wight2004-08-251-105/+105
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13143 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.677paszczi2004-08-251-39/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13142 b3059339-0415-0410-9bf9-f77b7e298cf2
* Apparently the latin1 groff device gives better results than ascii.diego2004-08-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13141 b3059339-0415-0410-9bf9-f77b7e298cf2
* prevent libmpeg2 from freeing shfaust32004-08-251-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13140 b3059339-0415-0410-9bf9-f77b7e298cf2
* warning fixes and a 10l (.IPS vs .IPs)diego2004-08-251-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13139 b3059339-0415-0410-9bf9-f77b7e298cf2
* Detect if the assembler supports receiving data through -pipe,diego2004-08-251-3/+8
| | | | | | | patch by Gabucino. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13138 b3059339-0415-0410-9bf9-f77b7e298cf2
* Search for X11 libs in /usr/lib as well (Digital Unix), patch by Gabucino.diego2004-08-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13137 b3059339-0415-0410-9bf9-f77b7e298cf2
* keyboard control: some fixes and extensions, punctuationdiego2004-08-251-41/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13136 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cycle through the available subtitles with 'b'.diego2004-08-251-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13135 b3059339-0415-0410-9bf9-f77b7e298cf2
* allow alignment without ATTRIBUTE_ALIGNED_MAX been defined, it fixes sparc ↵iive2004-08-251-1/+1
| | | | | | unaligned memory access git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13134 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32004-08-251-4/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13133 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics: fix some compiler warnings.mosu2004-08-252-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13132 b3059339-0415-0410-9bf9-f77b7e298cf2
* Document how to specify multiple paths with the --with-* options,diego2004-08-251-18/+19
| | | | | | | 90% based on a patch by Torinthiel <torinthiel@megapolis.pl>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13131 b3059339-0415-0410-9bf9-f77b7e298cf2
* Display the language code for subtitles from Matroska files.mosu2004-08-243-3/+50
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13130 b3059339-0415-0410-9bf9-f77b7e298cf2
* compile fix (missing string)henry2004-08-241-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13129 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not use globals. Put the variables into the appropriate demuxer struct ↵mosu2004-08-243-12/+42
| | | | | | instead. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13128 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for subtitle switching in Matroska.mosu2004-08-243-10/+139
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13127 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.642, minor changes, space at end of linedanny2004-08-241-243/+331
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13126 b3059339-0415-0410-9bf9-f77b7e298cf2
* add rgb32 csp supportnplourde2004-08-241-19/+95
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13125 b3059339-0415-0410-9bf9-f77b7e298cf2
* postproc fixhenry2004-08-243-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13124 b3059339-0415-0410-9bf9-f77b7e298cf2
* printf -> mp_msg conversion, first stepsdiego2004-08-2427-185/+239
| | | | | | | patch by The Wanderer <inverseparadox@comcast.net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13123 b3059339-0415-0410-9bf9-f77b7e298cf2
* id3edit updateddiego2004-08-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13122 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Guillaume POIRIER <gpoirier@irisa.fr>diego2004-08-241-132/+174
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13121 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix crash when using close buttonnplourde2004-08-241-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13120 b3059339-0415-0410-9bf9-f77b7e298cf2
* more TARGET_* conditionalshenry2004-08-241-1/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13119 b3059339-0415-0410-9bf9-f77b7e298cf2
* actually use the acceleration on SPARChenry2004-08-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13118 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compilation withoud libdvdreadhenry2004-08-241-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13117 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.46paszczi2004-08-241-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13116 b3059339-0415-0410-9bf9-f77b7e298cf2
* spellingpaszczi2004-08-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13115 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.675paszczi2004-08-241-6/+33
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13114 b3059339-0415-0410-9bf9-f77b7e298cf2
* libmpeg2 B-frame fixhenry2004-08-242-28/+54
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13113 b3059339-0415-0410-9bf9-f77b7e298cf2
* H.263 spellingdiego2004-08-243-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13112 b3059339-0415-0410-9bf9-f77b7e298cf2
* vm window handling fixesfaust32004-08-241-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13111 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmeticsdiego2004-08-241-17/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13110 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling, rewording, some additionsdiego2004-08-241-24/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13109 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_svga suboptions, yuv4mpeg notediego2004-08-231-3/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13108 b3059339-0415-0410-9bf9-f77b7e298cf2
* wrong formatsdiego2004-08-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13107 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l Pepsidiego2004-08-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13106 b3059339-0415-0410-9bf9-f77b7e298cf2
* default stylewight2004-08-231-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13105 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Guillaume POIRIER <gpoirier@irisa.fr>diego2004-08-231-202/+228
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13104 b3059339-0415-0410-9bf9-f77b7e298cf2
* large updates by Sebastian Krämer <mail@skraemer.de>diego2004-08-231-27/+413
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13103 b3059339-0415-0410-9bf9-f77b7e298cf2
* prevent XFree execution on wrong conditioniive2004-08-231-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13102 b3059339-0415-0410-9bf9-f77b7e298cf2
* mime handling support, patch by Konstantin G. Khlebnikov <c00nst@ezmail.ru>diego2004-08-232-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13101 b3059339-0415-0410-9bf9-f77b7e298cf2
* Check if -liconv is needed for iconv.wight2004-08-231-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13100 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make the stepsize of volume changes, changeable by a commandline paarameterattila2004-08-233-1/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13099 b3059339-0415-0410-9bf9-f77b7e298cf2
* Adding doxygen stuff.attila2004-08-234-2/+1151
| | | | | | | From now on every function has to be documented. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13098 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixesdiego2004-08-221-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13097 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-08-221-29/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13096 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix for audio position inaccuracyjoey2004-08-221-1/+1
| | | | | | | | also accounts for -speed option patch by Mikulas Patocka git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13095 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync tag bumpwight2004-08-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13094 b3059339-0415-0410-9bf9-f77b7e298cf2
* forgot some ifdef's and broke mplayer.c without ogg & dvdreadjoey2004-08-221-0/+4
| | | | | | | 1L to me! git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13093 b3059339-0415-0410-9bf9-f77b7e298cf2
* added runtime toggle of root window playbackjoey2004-08-226-0/+34
| | | | | | | only directx supports this at the moment git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13092 b3059339-0415-0410-9bf9-f77b7e298cf2
* added -rootwin support to vo_directxjoey2004-08-228-14/+27
| | | | | | | | updated all man pages except chinese also added mention of vo_quartz's rootwin to man pages where it was missing git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13091 b3059339-0415-0410-9bf9-f77b7e298cf2
* moved combined vobsub_lang into sub_selectjoey2004-08-227-19/+93
| | | | | | | | | add support for dvd subs and ogg subs into sub_select document sub_select vobsub_lang left as a link to sub_select for backwards compatibility git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13090 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/wording as suggested by Sebastian Krämer <mail@skraemer.de>diego2004-08-221-26/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13089 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording fix suggested by the Wandererdiego2004-08-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13088 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.669wight2004-08-221-18/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13087 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor fixeswight2004-08-221-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13086 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-08-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13085 b3059339-0415-0410-9bf9-f77b7e298cf2
* H.261 support via lavc codec and lavf demuxerrtognimp2004-08-221-0/+8
| | | | | | | Note: works only on raw h261 files git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13084 b3059339-0415-0410-9bf9-f77b7e298cf2
* spellingdiego2004-08-221-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13083 b3059339-0415-0410-9bf9-f77b7e298cf2
* more genre IDs by Bernd Ernesti <mplayer@lists.veego.de>diego2004-08-221-6/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13082 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Sebastian Krämer <mail@skraemer.de>diego2004-08-221-388/+564
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13081 b3059339-0415-0410-9bf9-f77b7e298cf2
* small fixes by Sebastian Krämer <mail@skraemer.de>diego2004-08-221-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13080 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync + random fixeswight2004-08-211-132/+135
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13079 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor fixeswight2004-08-211-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13078 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing \wight2004-08-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13077 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for snowalex2004-08-211-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13076 b3059339-0415-0410-9bf9-f77b7e298cf2
* support snowalex2004-08-211-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13075 b3059339-0415-0410-9bf9-f77b7e298cf2
* ffsonicalex2004-08-211-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13074 b3059339-0415-0410-9bf9-f77b7e298cf2
* nut is only handled by lavf, speed up detectionalex2004-08-211-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13073 b3059339-0415-0410-9bf9-f77b7e298cf2
* synclumag2004-08-211-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13072 b3059339-0415-0410-9bf9-f77b7e298cf2
* Include origin text for quote.lumag2004-08-211-2/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13071 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Sebastian Krämer <mail@skraemer.de>diego2004-08-211-115/+121
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13070 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part Vdiego2004-08-211-157/+154
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13069 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Guillaume POIRIER <gpoirier@irisa.fr>diego2004-08-211-155/+285
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13068 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-08-211-17/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13067 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix English before the translations.diego2004-08-201-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13066 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part IVdiego2004-08-201-16/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13065 b3059339-0415-0410-9bf9-f77b7e298cf2
* typortognimp2004-08-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13064 b3059339-0415-0410-9bf9-f77b7e298cf2
* Credits for Guillaume Poirier, maintainers are listed elsewhere.diego2004-08-201-15/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13063 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/wording fixesdiego2004-08-201-42/+42
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13062 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed fb_dev_name handling.syrjala2004-08-201-13/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13061 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.663wight2004-08-201-7/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13060 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistency fix, same sentence should be changed to samewight2004-08-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13059 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.17wight2004-08-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13058 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed superfluous XFlush calls before XSync.al2004-08-208-10/+0
| | | | | | | | | Original patch by Piotr Neuman <sikkh@wp.pl> extended by Joey to cover all X11 code modified by me to only do the above stated change. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13057 b3059339-0415-0410-9bf9-f77b7e298cf2
* portability fix taken from the NetBSD patch setdiego2004-08-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13056 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Guillaume POIRIER <gpoirier@irisa.fr>diego2004-08-191-102/+109
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13055 b3059339-0415-0410-9bf9-f77b7e298cf2
* better description of the chroma_opt XviD optiondiego2004-08-191-0/+7
| | | | | | | patch by Guillaume POIRIER <gpoirier@irisa.fr> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13054 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling/wording consistency as suggested by the Wandererdiego2004-08-191-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13053 b3059339-0415-0410-9bf9-f77b7e298cf2
* readability whitespace fixdiego2004-08-191-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13052 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Guillaume POIRIER <gpoirier@irisa.fr>diego2004-08-191-46/+53
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13051 b3059339-0415-0410-9bf9-f77b7e298cf2
* user can select which dvb card to use as vonicodvb2004-08-191-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13050 b3059339-0415-0410-9bf9-f77b7e298cf2
* user can select dvb card number to use (V3 api only)nicodvb2004-08-191-14/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13049 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling: big-endian and little-endiandiego2004-08-185-12/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13048 b3059339-0415-0410-9bf9-f77b7e298cf2
* minor fixesdiego2004-08-181-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13047 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Guillaume POIRIER <gpoirier@irisa.fr>diego2004-08-181-188/+229
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13046 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with 1.123rtognimp2004-08-181-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13045 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-08-181-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13044 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing .br's addedwight2004-08-181-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13043 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.657wight2004-08-181-60/+67
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13042 b3059339-0415-0410-9bf9-f77b7e298cf2
* another wrong style Warningwight2004-08-181-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13041 b3059339-0415-0410-9bf9-f77b7e298cf2
* Consistency, punctuation, some minor fixes/clarifications.wight2004-08-181-48/+57
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13040 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Sebastian Krämer <mail@skraemer.de>diego2004-08-181-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13039 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing quotes added.diego2004-08-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13038 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, sb, st and vstats are lavc _de_coding, not _en_coding options.diego2004-08-181-9/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13037 b3059339-0415-0410-9bf9-f77b7e298cf2
* massive sync, rewording, consistency, fixes etc.wight2004-08-171-855/+933
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13036 b3059339-0415-0410-9bf9-f77b7e298cf2
* xvid options sync, patch by Guillaume POIRIER <gpoirier@irisa.fr>diego2004-08-171-102/+181
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13035 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplify roundingwight2004-08-171-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13034 b3059339-0415-0410-9bf9-f77b7e298cf2
* maybe more understandable?michael2004-08-171-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13033 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clarify a few things, spelling and wording fixes, some of this belongs todiego2004-08-161-40/+38
| | | | | | | the Wanderer. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13032 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Robert Kestersondiego2004-08-161-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13031 b3059339-0415-0410-9bf9-f77b7e298cf2
* dfbmga now fixed-vo compliant, lavc exports field flags.diego2004-08-151-3/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13030 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed useless SetOpacity() calls.syrjala2004-08-151-11/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13029 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed BES aspect ratio.syrjala2004-08-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13028 b3059339-0415-0410-9bf9-f77b7e298cf2
* Reorganized init/unint so that fixed-vo works.syrjala2004-08-151-78/+80
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13027 b3059339-0415-0410-9bf9-f77b7e298cf2
* Revised description of --with-xvmclib configure option, inspired by The ↵iive2004-08-141-1/+1
| | | | | | Wanderer's patch git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13026 b3059339-0415-0410-9bf9-f77b7e298cf2
* print matroska check resultiive2004-08-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13025 b3059339-0415-0410-9bf9-f77b7e298cf2
* TSCC (TechSmith Camtasia Screen Codec) native support via lavc codecrtognimp2004-08-141-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13024 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-08-142-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13023 b3059339-0415-0410-9bf9-f77b7e298cf2
* Wording and spelling improvements, mostly suggested by the Wanderer.diego2004-08-141-16/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13022 b3059339-0415-0410-9bf9-f77b7e298cf2
* Patch updated for latest changes to libmpeg2.diego2004-08-141-1/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13021 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change patch structure so it applies cleanly to libmpeg2 sources.diego2004-08-141-38/+38
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13020 b3059339-0415-0410-9bf9-f77b7e298cf2
* Improved SPARC CPU detection and SPARC compilation fixes.diego2004-08-144-3/+38
| | | | | | | patch by jb13@gomerbud.com git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13019 b3059339-0415-0410-9bf9-f77b7e298cf2
* untested multichannel supportfaust32004-08-141-24/+74
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13018 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing quotes addedwight2004-08-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13017 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix slave mode for mingw, patch by Anton Ragnarsson <anton.ragnarsson.1093 ↵faust32004-08-131-12/+6
| | | | | | at student.uu.se> some cleanup by be git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13016 b3059339-0415-0410-9bf9-f77b7e298cf2
* better XviD option descriptions by Guillaume POIRIER <gpoirier@irisa.fr>diego2004-08-131-28/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13015 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync 1.45wight2004-08-131-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13014 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update ao_jack for new bio2jack API, improve check in configure.diego2004-08-132-9/+18
| | | | | | | Patches by Andre Kuehne and Ismail Dönmez. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13013 b3059339-0415-0410-9bf9-f77b7e298cf2
* mpdvdkit now accepts X:\ as a device name, as well as X:joey2004-08-121-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13012 b3059339-0415-0410-9bf9-f77b7e298cf2
* windows path seperator fixesjoey2004-08-122-9/+13
| | | | | | | | | | | | mp_basename now looks for \ and / both new playlist parsing: /path/to/thing is treated as a full path c:\windows is treated as a full path \windows is "near-full" and we prepend drive letter file.avi is relative and we prepend path to playlist git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13011 b3059339-0415-0410-9bf9-f77b7e298cf2
* As discussed with Attila, I am now the new maintainer ofal2004-08-121-2/+4
| | | | | | | vo xv, vo x11 and x11_common. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13010 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not exit without an error messagefaust32004-08-121-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13009 b3059339-0415-0410-9bf9-f77b7e298cf2
* Credit for DTSrtognimp2004-08-121-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13008 b3059339-0415-0410-9bf9-f77b7e298cf2
* DTS support via lavc and libdtsrtognimp2004-08-125-3/+94
| | | | | | | | Patch by Aurelien Jacobs ( aurel at gnuage dot org ) dts in wav by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13007 b3059339-0415-0410-9bf9-f77b7e298cf2
* -rootwin is no longer X11 only.diego2004-08-121-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13006 b3059339-0415-0410-9bf9-f77b7e298cf2
* nick, typodiego2004-08-111-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13005 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-08-112-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13004 b3059339-0415-0410-9bf9-f77b7e298cf2
* Documented sb, st and vstats lavc options.diego2004-08-111-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13003 b3059339-0415-0410-9bf9-f77b7e298cf2
* Break some lines, stray .RE removed.diego2004-08-111-8/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13002 b3059339-0415-0410-9bf9-f77b7e298cf2
* --Patch by Stefan '1stein' Schuermans <1stein@schuermans.info>:rik2004-08-111-32/+74
| | | | | | | | | | | | | | | | | | | | on the CCC-Camp ICMP2 (www.icmp2.de) this weekend, some friends and I played around with our Blinkenlights replicas and found a little bug in your MPlayer Blinkenlights outpur driver "vo_bl". The Blinkenlights UDP-Protocol contains the maximum grayscale value "maxval" (e.g. 255 for 8 bit) instead of the number of grayscales (e.g. 256 for 8 bit). Because some programs are very strict concerning this value, we had to patch mpalyer to get it to work. Today, I've added an output scheme "hdl" for the Haus des Lehrers in Berlin, on which an installation with grayscales was done last winter. Additionally, I've also added an output scheme named "grayscale" that adapts the size of the UDP packets to the size used with "-vf scale -zoom" that we will need for a project (a room with over 15000 pixels at the walls and floor) next year. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13001 b3059339-0415-0410-9bf9-f77b7e298cf2
* RGBA variantsmichael2004-08-113-0/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@13000 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Andoni Zubimendi <andoni at lpsat.net>nauj272004-08-111-7/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12999 b3059339-0415-0410-9bf9-f77b7e298cf2
* better? RGB/BGR specmichael2004-08-111-3/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12998 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing 32bit RGBA variants and some cleanupmichael2004-08-112-4/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12997 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part IIIdiego2004-08-101-45/+58
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12996 b3059339-0415-0410-9bf9-f77b7e298cf2
* alphabetical orderdiego2004-08-101-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12995 b3059339-0415-0410-9bf9-f77b7e298cf2
* width instead of chromWidth causing segfault in some casesreimar2004-08-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12994 b3059339-0415-0410-9bf9-f77b7e298cf2
* do not attempt to seek backward in stream on MDPR chunk with no codec datareimar2004-08-101-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12993 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo and consistency fixesdiego2004-08-101-38/+42
| | | | | | | New sentences must start on a new line. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12992 b3059339-0415-0410-9bf9-f77b7e298cf2
* man page review part IIdiego2004-08-101-121/+116
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12991 b3059339-0415-0410-9bf9-f77b7e298cf2
* Lots of Pepsi, this was a leftover from the stone age.diego2004-08-101-9/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12990 b3059339-0415-0410-9bf9-f77b7e298cf2
* Empty lines are not good troff markup, use .sp 1 instead.diego2004-08-101-65/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12989 b3059339-0415-0410-9bf9-f77b7e298cf2
* trailing whitespace cosmeticsdiego2004-08-101-37/+37
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12988 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_tdfxfbdiego2004-08-101-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12987 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.637paszczi2004-08-101-40/+115
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12986 b3059339-0415-0410-9bf9-f77b7e298cf2
* embarassing typodiego2004-08-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12985 b3059339-0415-0410-9bf9-f77b7e298cf2
* more precise wordingdiego2004-08-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12984 b3059339-0415-0410-9bf9-f77b7e298cf2
* some new maintainers, some cleanupdiego2004-08-091-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12983 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't drop frames when paused, fixes not displaying the pause OSD icondiego2004-08-091-1/+1
| | | | | | | | when paused, patch by Mikulas Patocka <mikulas@artax.karlin.mff.cuni.cz>, approved by Attila. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12982 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't use flicker filtering.syrjala2004-08-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12981 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better protection against double definition of MPEGLAYER3WAVEFORMATwight2004-08-092-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12980 b3059339-0415-0410-9bf9-f77b7e298cf2
* XviD option descriptions, patch by Guillaume POIRIER <gpoirier@irisa.fr>diego2004-08-091-37/+112
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12979 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fixeswight2004-08-091-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12978 b3059339-0415-0410-9bf9-f77b7e298cf2
* We shouldn't translate filter nameswight2004-08-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12977 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.123wight2004-08-091-7/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12976 b3059339-0415-0410-9bf9-f77b7e298cf2
* LIVE.COM tests moved to ./configurewight2004-08-091-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12975 b3059339-0415-0410-9bf9-f77b7e298cf2
* LIVE.COM autodetectionwight2004-08-091-8/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12974 b3059339-0415-0410-9bf9-f77b7e298cf2
* now use vo_rootwin var to check for -rootwin switchnplourde2004-08-082-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12973 b3059339-0415-0410-9bf9-f77b7e298cf2
* -rootwin switch use vo_rootwin var for all vonplourde2004-08-081-9/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12972 b3059339-0415-0410-9bf9-f77b7e298cf2
* qpel and ilme lavc options are mutually exclusive.diego2004-08-081-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12971 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make symlinks behavior more sensible - regenerate symlinks (and documentation)wight2004-08-081-4/+6
| | | | | | | only when it is needed. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12970 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use port number embedded in url for mms streamsrtognimp2004-08-071-1/+3
| | | | | | | Patch by Bertrand Baudet git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12969 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix for crash when seeking with -novideo optionreimar2004-08-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12968 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fix for test programreimar2004-08-072-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12967 b3059339-0415-0410-9bf9-f77b7e298cf2
* Leftover from the old Matroska demuxer detection removed.mosu2004-08-051-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12966 b3059339-0415-0410-9bf9-f77b7e298cf2
* language handling simplificationdiego2004-08-052-19/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12965 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ignore some more generated files.diego2004-08-051-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12964 b3059339-0415-0410-9bf9-f77b7e298cf2
* Makefile replacement for compile scriptdiego2004-08-052-15/+26
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12963 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with recent changesdiego2004-08-051-8/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12962 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some explanation what the tool is good for added.diego2004-08-051-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12961 b3059339-0415-0410-9bf9-f77b7e298cf2
* ADTS AAC supportdiego2004-08-051-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12960 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed the old Matroska demuxer.mosu2004-08-044-3238/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12959 b3059339-0415-0410-9bf9-f77b7e298cf2
* fibmap_mplayer is long obsolete, noticed by Torinthiel.diego2004-08-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12958 b3059339-0415-0410-9bf9-f77b7e298cf2
* libosdep directory does not exist. osdep does.wight2004-08-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12957 b3059339-0415-0410-9bf9-f77b7e298cf2
* And a tiny compile fix.wight2004-08-041-1/+1
| | | | | | | I should learn to test before apply. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12956 b3059339-0415-0410-9bf9-f77b7e298cf2
* Native darwin timer update.wight2004-08-045-110/+67
| | | | | | | Patch by Dan Christiansen <danchr@daimi.au.dk> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12955 b3059339-0415-0410-9bf9-f77b7e298cf2
* missed wordwight2004-08-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12954 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.12wight2004-08-041-3/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12953 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.10wight2004-08-041-3/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12952 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-08-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12951 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync missing \wight2004-08-041-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12950 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing \ before -rawaudioreimar2004-08-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12949 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync, some spelling and copy/paste issues.wight2004-08-031-15/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12948 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Ismail Dönmezdiego2004-08-031-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12947 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid outoptimization of static variables patch by ismail dönmez ↵faust32004-08-031-2/+2
| | | | | | <ismail.donmez at gmail.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12946 b3059339-0415-0410-9bf9-f77b7e298cf2
* even better -vo md5 descriptiondiego2004-08-031-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12945 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Philippe De Swert <philippedeswert@pi.be>diego2004-08-031-2/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12944 b3059339-0415-0410-9bf9-f77b7e298cf2
* Corrected my mistake in the last memfix patch.al2004-08-031-4/+13
| | | | | | | | Bug was discovered by Shachar Raindel <shacharr@gmail.com>. The basic patch idea is also from him. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12943 b3059339-0415-0410-9bf9-f77b7e298cf2
* This fbset version is outdated and it is generally available in distros.diego2004-08-0310-2625/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12942 b3059339-0415-0410-9bf9-f77b7e298cf2
* Moved to the TOOLS directory.diego2004-08-0335-0/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12941 b3059339-0415-0410-9bf9-f77b7e298cf2
* This alternative Debian directory was never used, so I'm removing it withdiego2004-08-0320-739/+0
| | | | | | | the consent of Attila, who originally added it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12940 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hint how to decode raw AC3reimar2004-08-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12939 b3059339-0415-0410-9bf9-f77b7e298cf2
* summary of the MPlayer specific libmpeg2 changeshenry2004-08-021-0/+210
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12938 b3059339-0415-0410-9bf9-f77b7e298cf2
* applied old patch that was missing an include...reimar2004-08-021-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12937 b3059339-0415-0410-9bf9-f77b7e298cf2
* forgotten libmpeg2 postprocessinghenry2004-08-024-0/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12936 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better documentation for -vo md5.diego2004-08-021-3/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12935 b3059339-0415-0410-9bf9-f77b7e298cf2
* -cache-min, -cache-prefill documented.diego2004-08-021-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12934 b3059339-0415-0410-9bf9-f77b7e298cf2
* Importing libmpeg2 from mpeg2dec-0.4.0bhenry2004-08-0227-1685/+4304
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12933 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.630, some typo from 1.624danny2004-08-021-18/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12932 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing guess_cp declaration (patch by Ismail Dönmez)henry2004-08-021-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12931 b3059339-0415-0410-9bf9-f77b7e298cf2
* Preliminary Support for building MPlayer with Intel C++ compiler.atmos42004-08-021-2/+29
| | | | | | | | | | Still needs some work to use the proper optimization parameters. I haven't yet fixed the loader/dmo/dshow code so compile those dirs using make -C loader CC=gcc [...] for the meantime. To try use CC=icc ./configure with ICC 8.0 or later. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12930 b3059339-0415-0410-9bf9-f77b7e298cf2
* ICC 8.0 compilation fixesatmos42004-08-022-15/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12929 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for passing mouse events on to MPlayerreimar2004-08-011-0/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12928 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l query format at least when used with vidix, disable colorkeying with ↵faust32004-08-011-0/+5
| | | | | | vidix, should fix #38 and #33 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12927 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l to the author of this longstanding and obscure bug. Each languagediego2004-07-311-2/+2
| | | | | | | | should be removed only once from the list. Thanks to Chris White for pointing out that there was a problem. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12926 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, fixes DXR3 compile problems caused by my last patch.reimar2004-07-311-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12925 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic warning fix (missing newline at end of file)diego2004-07-312-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12924 b3059339-0415-0410-9bf9-f77b7e298cf2
* synclumag2004-07-311-7/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12923 b3059339-0415-0410-9bf9-f77b7e298cf2
* mingw stdin fixesfaust32004-07-311-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12922 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed long obsolete files.diego2004-07-308-513/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12921 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use = instead if # in ALSA device name, as # irritates our config-parser.reimar2004-07-302-5/+5
| | | | | | | Original patch by stan (at) saticed (dot) me (dot) uk git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12920 b3059339-0415-0410-9bf9-f77b7e298cf2
* unified audio options dialog, fixes also bug #40reimar2004-07-306-294/+338
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12919 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove obsolete entries, patch by VMiklos <mamajom@axelero.hu>.diego2004-07-301-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12918 b3059339-0415-0410-9bf9-f77b7e298cf2
* These files are long obsolete.diego2004-07-302-161/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12917 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove leftover references to libmpflac/ad_flaclumag2004-07-302-11/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12916 b3059339-0415-0410-9bf9-f77b7e298cf2
* Obsolete now that the docs are XML.diego2004-07-291-20/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12915 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for 24 bit audioreimar2004-07-291-0/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12914 b3059339-0415-0410-9bf9-f77b7e298cf2
* add var vo_rootwin and -rootwin switch for mac osxnplourde2004-07-294-7/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12913 b3059339-0415-0410-9bf9-f77b7e298cf2
* compilation fixes from Gentoo by Chris White <webmaster@securesystem.info>diego2004-07-291-8/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12912 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, FILE is defined in stdio.hreimar2004-07-281-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12911 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes a crash and unchecked string-handling in ENCA code.reimar2004-07-285-43/+27
| | | | | | | Also does a bit of cleanup. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12910 b3059339-0415-0410-9bf9-f77b7e298cf2
* automatic loading of af_volume, original patch by Dan Christiansen (danchr ↵reimar2004-07-283-5/+13
| | | | | | (at) daimi (dot) au (dot) dk) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12909 b3059339-0415-0410-9bf9-f77b7e298cf2
* added missing 'synced with'paszczi2004-07-281-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12908 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synclumag2004-07-282-5/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12907 b3059339-0415-0410-9bf9-f77b7e298cf2
* We're long past 0.90.diego2004-07-282-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12906 b3059339-0415-0410-9bf9-f77b7e298cf2
* typosdiego2004-07-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12905 b3059339-0415-0410-9bf9-f77b7e298cf2
* We support more than just DivX 5.01.diego2004-07-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12904 b3059339-0415-0410-9bf9-f77b7e298cf2
* ff-snow addedarpi2004-07-271-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12903 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fabian's nickdiego2004-07-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12902 b3059339-0415-0410-9bf9-f77b7e298cf2
* Wording/spelling suggestions by the Wanderer, merged sections about when todiego2004-07-261-9/+8
| | | | | | | send separate patches. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12901 b3059339-0415-0410-9bf9-f77b7e298cf2
* prevent segfault on shmem faileriive2004-07-261-0/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12900 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain how to handle big patches and why uploading patches is bad.diego2004-07-261-9/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12899 b3059339-0415-0410-9bf9-f77b7e298cf2
* More syncnauj272004-07-251-71/+78
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12898 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix -nosound and -novideo (bug #28)rtognimp2004-07-251-10/+3
| | | | | | | | Move audio fourcc assignement inside audio if() Remove bogus VLB warning (codec missing, no demuxer problem) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12897 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed saver_on, saver_off calls, they are already in x11_common.creimar2004-07-258-21/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12896 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix segfault caused by changing a pointer that will be freed laterrtognimp2004-07-251-5/+7
| | | | | | | Patch by Martin Simmons ( vyslnqaaxytp at spammotel dot com ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12895 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix segfault when loading subtitles (idea by pl)rathann2004-07-251-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12894 b3059339-0415-0410-9bf9-f77b7e298cf2
* almost syncnauj272004-07-241-146/+454
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12893 b3059339-0415-0410-9bf9-f77b7e298cf2
* added src level documentation for the get_path() functional2004-07-231-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12892 b3059339-0415-0410-9bf9-f77b7e298cf2
* false-use-of-get_path() memleak fixes.al2004-07-232-4/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12891 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed ref to extern WinIDnplourde2004-07-231-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12890 b3059339-0415-0410-9bf9-f77b7e298cf2
* add support for -rootwin commandnplourde2004-07-231-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12889 b3059339-0415-0410-9bf9-f77b7e298cf2
* add rootwin cmd to mac osxnplourde2004-07-231-2/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12888 b3059339-0415-0410-9bf9-f77b7e298cf2
* listen for key repeats, patch by Dan Christiansennplourde2004-07-221-59/+66
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12887 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix for people experimenting with GUI under windowsreimar2004-07-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12886 b3059339-0415-0410-9bf9-f77b7e298cf2
* typopaszczi2004-07-221-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12885 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-07-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12884 b3059339-0415-0410-9bf9-f77b7e298cf2
* update RedHat RPM sites in doc translationsrathann2004-07-218-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12883 b3059339-0415-0410-9bf9-f77b7e298cf2
* update RPM site location in docsrathann2004-07-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12882 b3059339-0415-0410-9bf9-f77b7e298cf2
* nroff bugs fixed.diego2004-07-213-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12881 b3059339-0415-0410-9bf9-f77b7e298cf2
* reduced code complexity, and also made consistent with other partsalex2004-07-211-12/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12880 b3059339-0415-0410-9bf9-f77b7e298cf2
* removing broken and unneeded copyalex2004-07-211-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12879 b3059339-0415-0410-9bf9-f77b7e298cf2
* skip ecc only if present, patch by Alexis Durelle ↵alex2004-07-211-2/+12
| | | | | | <alexis.durelle@cen.cnamts.fr> (needed for the Aiptek DV3500 camera) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12878 b3059339-0415-0410-9bf9-f77b7e298cf2
* unmaintained, outdated, unnecessary, removeddiego2004-07-201-129/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12877 b3059339-0415-0410-9bf9-f77b7e298cf2
* reorganized, reformatted, explanation improved, typos, wordingdiego2004-07-201-70/+96
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12876 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix typos and better explanatory text.diego2004-07-201-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12875 b3059339-0415-0410-9bf9-f77b7e298cf2
* Patches should get an answer.diego2004-07-201-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12874 b3059339-0415-0410-9bf9-f77b7e298cf2
* 0.18 was never released and a few dates added.diego2004-07-201-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12873 b3059339-0415-0410-9bf9-f77b7e298cf2
* mencoder psnr segfaults on readonly fs patch by (Fabio Russo <f.russo at ↵michael2004-07-201-0/+2
| | | | | | sosinformatica dot com>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12872 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.121paszczi2004-07-201-6/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12871 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.629paszczi2004-07-201-14/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12870 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-07-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12869 b3059339-0415-0410-9bf9-f77b7e298cf2
* -adapters only works with directxattila2004-07-201-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12868 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updated to conform to a small change in the LIVE.COM API.rsf2004-07-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12867 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updated to cnform to a small change in the LIVE.COM API.rsf2004-07-201-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12866 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hint about . and ' in nroff.diego2004-07-201-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12865 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates and fixes by Sebastian Krämer <mail@skraemer.de>diego2004-07-191-162/+214
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12864 b3059339-0415-0410-9bf9-f77b7e298cf2
* embarassing typodiego2004-07-196-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12863 b3059339-0415-0410-9bf9-f77b7e298cf2
* name changediego2004-07-192-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12862 b3059339-0415-0410-9bf9-f77b7e298cf2
* embarassing typodiego2004-07-1911-16/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12861 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-07-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12860 b3059339-0415-0410-9bf9-f77b7e298cf2
* embarassing typo and new namediego2004-07-192-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12859 b3059339-0415-0410-9bf9-f77b7e298cf2
* embarassing typodiego2004-07-193-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12858 b3059339-0415-0410-9bf9-f77b7e298cf2
* embarassing typosdiego2004-07-194-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12857 b3059339-0415-0410-9bf9-f77b7e298cf2
* -monitor-* options corrected.diego2004-07-191-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12856 b3059339-0415-0410-9bf9-f77b7e298cf2
* cat disclaimer > /dev/nulldiego2004-07-191-8/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12855 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove stray \.diego2004-07-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12854 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-07-193-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12853 b3059339-0415-0410-9bf9-f77b7e298cf2
* name change, codec download locationdiego2004-07-191-7/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12852 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos pointed out by The Wanderer.diego2004-07-191-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12851 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed unnecessary commentspaszczi2004-07-181-54/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12850 b3059339-0415-0410-9bf9-f77b7e298cf2
* manpage translated (finally) by Torinthiel and mepaszczi2004-07-181-2601/+4619
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12849 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-07-181-16/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12848 b3059339-0415-0410-9bf9-f77b7e298cf2
* stylepaszczi2004-07-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12847 b3059339-0415-0410-9bf9-f77b7e298cf2
* no redefinition, clashes with OpenBSDalex2004-07-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12846 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.624danny2004-07-171-511/+563
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12845 b3059339-0415-0410-9bf9-f77b7e298cf2
* changed misleading TEXTUREFORMAT_32BPP (was 24bpp!) to vo_gl2 style ↵reimar2004-07-171-3/+3
| | | | | | TEXTUREFORMAT_ALWAYS git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12844 b3059339-0415-0410-9bf9-f77b7e298cf2
* use RGB32 textures on OS Xreimar2004-07-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12843 b3059339-0415-0410-9bf9-f77b7e298cf2
* individual sub_select option not interferring with vobsub_langalex2004-07-173-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12842 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1, killed some 100l's (no error checking). 2, added subotion for output ↵alex2004-07-171-9/+23
| | | | | | filename. 3, fallback to 'md5' in case 'md5sum' is not available - this is the case on Darwin git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12841 b3059339-0415-0410-9bf9-f77b7e298cf2
* let DirectFB find it's headers in --with-extraincdir=DIRiive2004-07-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12840 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix altivec.h inclusion (vector keyword in structure)alex2004-07-172-3/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12839 b3059339-0415-0410-9bf9-f77b7e298cf2
* simplify the initalex2004-07-171-45/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12838 b3059339-0415-0410-9bf9-f77b7e298cf2
* some fixesalex2004-07-171-14/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12837 b3059339-0415-0410-9bf9-f77b7e298cf2
* cache min fill adjustment, based on patch by Jeremy Huddlestoniive2004-07-166-8/+32
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12836 b3059339-0415-0410-9bf9-f77b7e298cf2
* Major translation update. Sync, some rewording, etc.lumag2004-07-1615-362/+452
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12835 b3059339-0415-0410-9bf9-f77b7e298cf2
* typolumag2004-07-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12834 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add <application> tags around MPlayer.lumag2004-07-161-2/+3
| | | | | | | remove wrong dot. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12833 b3059339-0415-0410-9bf9-f77b7e298cf2
* two small typoslumag2004-07-161-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12832 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed typonplourde2004-07-161-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12831 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cinepak, CVID and RoqA/V are now in ffmpegrtognimp2004-07-154-318/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12830 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cinepak and RoqA/V are now in ffmpegrtognimp2004-07-152-1563/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12829 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cinepak, CYUV and RoqA/V are now in ffmpegrtognimp2004-07-154-45/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12828 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add Window Level Key, Can switch mode with T keynplourde2004-07-151-10/+39
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12827 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync, reword, fix 80 column barrier :)lumag2004-07-151-37/+47
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12826 b3059339-0415-0410-9bf9-f77b7e298cf2
* It's past midnight ;-Pdiego2004-07-151-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12825 b3059339-0415-0410-9bf9-f77b7e298cf2
* Number of subtitles corrected.diego2004-07-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12824 b3059339-0415-0410-9bf9-f77b7e298cf2
* last changes for pre5 (really)diego2004-07-141-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12823 b3059339-0415-0410-9bf9-f77b7e298cf2
* VCD support does not yet work on OpenBSD.diego2004-07-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12822 b3059339-0415-0410-9bf9-f77b7e298cf2
* synchronizoationpaszczi2004-07-146-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12821 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed status in debug_msg as it is nonsens anyway.joyping2004-07-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12820 b3059339-0415-0410-9bf9-f77b7e298cf2
* missed function name change after ENCA support commitiive2004-07-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12819 b3059339-0415-0410-9bf9-f77b7e298cf2
* last minute changes/typosdiego2004-07-141-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12818 b3059339-0415-0410-9bf9-f77b7e298cf2
* -use-stdin renamed to -noconsolecontrols.diego2004-07-144-15/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12817 b3059339-0415-0410-9bf9-f77b7e298cf2
* trailing whitespace removed (cosmetics)diego2004-07-149-29/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12816 b3059339-0415-0410-9bf9-f77b7e298cf2
* pid syntax documented by Nico Sabbidiego2004-07-141-0/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12815 b3059339-0415-0410-9bf9-f77b7e298cf2
* cd and cgop lavc options documented, based on a patch by Nico Sabbi.diego2004-07-141-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12814 b3059339-0415-0410-9bf9-f77b7e298cf2
* Patches should be created from the root of the source directory, explanationdiego2004-07-141-7/+10
| | | | | | | improved. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12813 b3059339-0415-0410-9bf9-f77b7e298cf2
* volume calc fixes for mixer, by reimar döffinger, 10l reverse by mejoyping2004-07-141-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12812 b3059339-0415-0410-9bf9-f77b7e298cf2
* saner order, additions, deletions for pre5diego2004-07-131-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12811 b3059339-0415-0410-9bf9-f77b7e298cf2
* final (?) pre5 changesdiego2004-07-131-9/+36
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12810 b3059339-0415-0410-9bf9-f77b7e298cf2
* clarificationdiego2004-07-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12809 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_alsa now uses the device= suboption syntax instead of hw= or hw:reimar2004-07-131-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12808 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix 10l fixed_quant bug reported by Michaeliive2004-07-131-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12807 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixes provided by reimar dörfinger. mixer, subdevice parsing, alsa#help,joyping2004-07-131-78/+74
| | | | | | | set chunksize, others. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12806 b3059339-0415-0410-9bf9-f77b7e298cf2
* Status updates and comments about other dll required by some codecsrtognimp2004-07-121-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12805 b3059339-0415-0410-9bf9-f77b7e298cf2
* added multi-pid parsing code (up to 15), pid 0 is always added (for the PAT)nicodvb2004-07-123-76/+156
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12804 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix build on Turkish locales when LC_ALL is already set.diego2004-07-121-1/+1
| | | | | | | patch by ismail donmez <kde@myrealbox.com> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12803 b3059339-0415-0410-9bf9-f77b7e298cf2
* OpenBSD portability fixes from the OpenBSD ports treediego2004-07-121-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12802 b3059339-0415-0410-9bf9-f77b7e298cf2
* x86_64 fix by John Stebbins <john@stebbins.name>faust32004-07-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12801 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make rtp:// cohexist with LIVE.COMrtognimp2004-07-114-159/+5
| | | | | | | Patch by Nico Sabbi git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12800 b3059339-0415-0410-9bf9-f77b7e298cf2
* Indentation fix from previous patch, as discussed on IRC.rtognimp2004-07-112-47/+47
| | | | | | | Patch by Alexander Strasser git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12799 b3059339-0415-0410-9bf9-f77b7e298cf2
* OpenBSD portability patches from the OpenBSD ports treediego2004-07-112-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12798 b3059339-0415-0410-9bf9-f77b7e298cf2
* This fixes the problems that originated from my ewmhrtognimp2004-07-112-9/+34
| | | | | | | | | fs patch, caused by a different handling of the wm's ewmh fs implementations. Patch by Alexander Strasser git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12797 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32004-07-111-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12796 b3059339-0415-0410-9bf9-f77b7e298cf2
* don't use uninitialized font descriptionsfaust32004-07-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12795 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid using corrupted font descriptions patch by Daniel von Dincklage ↵faust32004-07-111-0/+9
| | | | | | <danielvd+mpl@cs.colorado.edu> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12794 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_macosx is fixed, moving it back to topnplourde2004-07-101-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12793 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, patch by Piero di Vitafaust32004-07-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12792 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesrtognimp2004-07-101-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12791 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_macosx by Dan Christiansennplourde2004-07-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12790 b3059339-0415-0410-9bf9-f77b7e298cf2
* enables resampling of audio in ao_macosx by Dan Christiansennplourde2004-07-101-14/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12789 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix for xscreensaver disablingreimar2004-07-091-17/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12788 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove duplicated make distclean for libavformat and libavcodecrtognimp2004-07-091-2/+0
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12787 b3059339-0415-0410-9bf9-f77b7e298cf2
* make mplayer capable of being in the foreground by Dan Christiansennplourde2004-07-091-3/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12786 b3059339-0415-0410-9bf9-f77b7e298cf2
* better menu icons by Piero di Vita <scognito@libero.it>diego2004-07-095-142/+787
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12785 b3059339-0415-0410-9bf9-f77b7e298cf2
* output wordingdiego2004-07-092-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12784 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2004-07-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12783 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates, corrections, wording, spellingdiego2004-07-091-18/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12782 b3059339-0415-0410-9bf9-f77b7e298cf2
* homepage design, codec packages maintainersdiego2004-07-091-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12781 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-07-092-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12780 b3059339-0415-0410-9bf9-f77b7e298cf2
* threads lavc option by Loren Merritt <lorenm@u.washington.edu>, typodiego2004-07-091-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12779 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync and changed character encoding from euckr to utf8 bydiego2004-07-081-500/+511
| | | | | | | DongCheon Park (David) <dcpark@kaist.ac.kr>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12778 b3059339-0415-0410-9bf9-f77b7e298cf2
* 3-pass encoding is evil.diego2004-07-081-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12777 b3059339-0415-0410-9bf9-f77b7e298cf2
* make config accept true/false as parametersiive2004-07-081-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12776 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Sebastian Krämer <mail@skraemer.de>diego2004-07-071-3/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12775 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with mp_help-en.h v1.121rtognimp2004-07-071-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12774 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Sebastian Krämer <mail@skraemer.de>diego2004-07-071-60/+125
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12773 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Ioannis Panteleakis <pioann@csd.auth.gr>diego2004-07-071-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12772 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with help_mp-en.hluran2004-07-072-6/+30
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12771 b3059339-0415-0410-9bf9-f77b7e298cf2
* default is now to center the imagefaust32004-07-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12770 b3059339-0415-0410-9bf9-f77b7e298cf2
* Altivec unscaled YV12 -> packed YUV patch by (Romain Dolbeau <dolbeau at ↵michael2004-07-062-0/+159
| | | | | | irisa dot fr>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12769 b3059339-0415-0410-9bf9-f77b7e298cf2
* better wording/spelling as suggested by the wandererdiego2004-07-062-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12768 b3059339-0415-0410-9bf9-f77b7e298cf2
* more credits, spellingdiego2004-07-061-2/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12767 b3059339-0415-0410-9bf9-f77b7e298cf2
* dc=11 fixedmichael2004-07-061-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12766 b3059339-0415-0410-9bf9-f77b7e298cf2
* dc precision and closed gop patch by (Nico Sabbi <nsabbi at tiscali dot it>)michael2004-07-061-0/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12765 b3059339-0415-0410-9bf9-f77b7e298cf2
* Console message corrected and moved to help_mp-en.h.diego2004-07-063-6/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12764 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, OSX compile fix, patch by Steven Schulz (sms (at) 2BSD (dot) com)reimar2004-07-061-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12763 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use aspect ratio from Theora context. Patch by j at v2v dot ccmosu2004-07-061-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12762 b3059339-0415-0410-9bf9-f77b7e298cf2
* multi-threaded lavc patch by (Loren Merritt <lorenm at u dot washington dot ↵michael2004-07-062-0/+15
| | | | | | edu>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12761 b3059339-0415-0410-9bf9-f77b7e298cf2
* NSV added to formats, cinepak etc codec updates by Roberto Togni.diego2004-07-052-17/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12760 b3059339-0415-0410-9bf9-f77b7e298cf2
* improved DVD ripping guide by Jason Tackaberry <tack@sault.org>diego2004-07-051-151/+385
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12759 b3059339-0415-0410-9bf9-f77b7e298cf2
* Neomagic TV out support docs by Rudolf Marek <MAREKR2@cs.felk.cvut.cz>diego2004-07-051-13/+43
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12758 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not add libmad to the X libraries. Patch by Evgueni V. Gavrilov ↵mosu2004-07-051-1/+1
| | | | | | <aquatique at rusunix dot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12757 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove useless "size restrictions" messageranma2004-07-031-5/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12756 b3059339-0415-0410-9bf9-f77b7e298cf2
* Point at new XML documentation translation.diego2004-07-031-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12755 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix crash when no audio-out is available (e.g. mplayer -ao bad test.avi).reimar2004-07-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12754 b3059339-0415-0410-9bf9-f77b7e298cf2
* We now have JACK audio outputrtognimp2004-07-021-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12753 b3059339-0415-0410-9bf9-f77b7e298cf2
* WMP doesn't encode urls with mmst protocolrtognimp2004-07-021-1/+15
| | | | | | | Patch by Ilia ( chest4l at mail dot ru ) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12752 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed XFlush() before XSync(), made config_glx return-type signed, force ↵reimar2004-07-021-8/+15
| | | | | | 32bit on Darwin, idea from a patch by Marc Hoffman (mmh <at> pleasantst.com). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12751 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed XFlush() before XSync()reimar2004-07-021-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12750 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_alsa now uses -mixer-channel instead of its special -mixer syntaxreimar2004-07-021-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12749 b3059339-0415-0410-9bf9-f77b7e298cf2
* string, alloca etc. fixesjoyping2004-07-021-66/+34
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12748 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Sebastian Krämer <mail@skraemer.de>diego2004-07-021-66/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12747 b3059339-0415-0410-9bf9-f77b7e298cf2
* better wording by Sebastian Krämerdiego2004-07-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12746 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with mplayer.1, noticed by Sebastian Krämerdiego2004-07-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12745 b3059339-0415-0410-9bf9-f77b7e298cf2
* (hopefully) better -use-stdin descriptiondiego2004-07-011-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12744 b3059339-0415-0410-9bf9-f77b7e298cf2
* final pre5 changes, release namediego2004-07-011-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12743 b3059339-0415-0410-9bf9-f77b7e298cf2
* code cleanupdiego2004-07-011-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12742 b3059339-0415-0410-9bf9-f77b7e298cf2
* ao_alsa and ao_oss documented.diego2004-07-011-7/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12741 b3059339-0415-0410-9bf9-f77b7e298cf2
* Bandaid linking fix, somebody should do this properly some day.diego2004-07-011-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12740 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10ldiego2004-07-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12739 b3059339-0415-0410-9bf9-f77b7e298cf2
* We still need to make sure the upper 16 bits of dwFlags are clearedranma2004-06-301-2/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12738 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove borken index fixup (breaks more than it fixes)ranma2004-06-301-13/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12737 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for Winnov Videum WINX and WNV1 codecs with binary dllrtognimp2004-06-302-0/+24
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12736 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Sebastian Krämer <mail@skraemer.de>diego2004-06-301-32/+29
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12735 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Sebastian Krämer <mail@skraemer.de>diego2004-06-301-44/+72
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12734 b3059339-0415-0410-9bf9-f77b7e298cf2
* incomplete skin directories, noticed by Sebastian Krämer <mail@skraemer.de>diego2004-06-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12733 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos pointed out by Sebastian Krämer <mail@skraemer.de>diego2004-06-301-18/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12732 b3059339-0415-0410-9bf9-f77b7e298cf2
* small updates by Sebastian Krämer <mail@skraemer.de>diego2004-06-291-9/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12731 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync and change widget -> control by Andoni Zubimendi <andoni@lpsat.net>nauj272004-06-291-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12730 b3059339-0415-0410-9bf9-f77b7e298cf2
* If we don't have a NEWAVIINDEX chunk, but have an OpenDML index,ranma2004-06-291-0/+7
| | | | | | | | use it even if there is no AVIX RIFF-Chunk. (See also <40D2E910.2000708@comcast.net> "Non-seeking OpenDML AVI") git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12729 b3059339-0415-0410-9bf9-f77b7e298cf2
* freedesktop.org compliant menu supportdiego2004-06-294-1/+22
| | | | | | | patch by Piero Di Vita <scognito@libero.it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12728 b3059339-0415-0410-9bf9-f77b7e298cf2
* updates by Sebastian Krmer <mail@skraemer.de>diego2004-06-291-118/+357
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12727 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncdiego2004-06-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12726 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Sebastian Krämer <mail@skraemer.de>diego2004-06-291-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12725 b3059339-0415-0410-9bf9-f77b7e298cf2
* new error icon by piero <scognito@libero.it>diego2004-06-281-121/+542
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12724 b3059339-0415-0410-9bf9-f77b7e298cf2
* better wordingdiego2004-06-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12723 b3059339-0415-0410-9bf9-f77b7e298cf2
* Do not dereference NULL if no track could be found for a block.mosu2004-06-281-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12722 b3059339-0415-0410-9bf9-f77b7e298cf2
* Zsolt Barat maintains all the new ALSA drivers.diego2004-06-281-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12721 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-06-281-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12720 b3059339-0415-0410-9bf9-f77b7e298cf2
* This should be the final changelog for pre5 up to now.diego2004-06-281-21/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12719 b3059339-0415-0410-9bf9-f77b7e298cf2
* more credits for Rezadiego2004-06-281-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12718 b3059339-0415-0410-9bf9-f77b7e298cf2
* VIDEO OUTPUT DRIVERS moved right after VIDEO OUTPUT OPTIONS.diego2004-06-282-380/+380
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12717 b3059339-0415-0410-9bf9-f77b7e298cf2
* better -really-quiet descriptiondiego2004-06-281-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12716 b3059339-0415-0410-9bf9-f77b7e298cf2
* Let's keep the full functionality for the release, we can switch this offdiego2004-06-281-1/+1
| | | | | | | when we have found a nicer automatic solution for -af volume. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12715 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l, stripping credits when applying patches is NOT a good way to get ↵rfelker2004-06-281-0/+4
| | | | | | developers!! git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12714 b3059339-0415-0410-9bf9-f77b7e298cf2
* -rtc-devicediego2004-06-281-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12713 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l of a sweet liquid to Alex:diego2004-06-281-1/+2
| | | | | | | | -rtc should be the inverse of -nortc, added this missing option and renamed -rtc to -rtc-device, which is more descriptive anyway. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12712 b3059339-0415-0410-9bf9-f77b7e298cf2
* pre5 changes by Reimar and myselfdiego2004-06-281-2/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12711 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid visuals with low color-depth.reimar2004-06-271-0/+12
| | | | | | | Based on idea from Timo Kanera (timo (at) kanera (dot) de). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12710 b3059339-0415-0410-9bf9-f77b7e298cf2
* Negate default palette for grayscale cvidrtognimp2004-06-271-1/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12709 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32004-06-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12708 b3059339-0415-0410-9bf9-f77b7e298cf2
* mingw crosscompiling step 1faust32004-06-274-16/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12707 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync by Andoni Zubimendi <andoni@lpsat.net>nauj272004-06-271-5/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12706 b3059339-0415-0410-9bf9-f77b7e298cf2
* Paletted cvid supportrtognimp2004-06-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12705 b3059339-0415-0410-9bf9-f77b7e298cf2
* The granulepos does not depend on the number of channels, only on the sample ↵mosu2004-06-271-8/+15
| | | | | | size. Patch by Wolfram Gloger (wmglo at dent dot med dot uni-muenchen dot de). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12704 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l in GET_VOLUME. Fix by Lu Ran, hephooey (at) fastmail (dot) fm.reimar2004-06-271-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12703 b3059339-0415-0410-9bf9-f77b7e298cf2
* Explain that commenting string operations is important.diego2004-06-271-1/+4
| | | | | | | patch by Alexander Strasser <eclipse7@gmx.net> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12702 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatefaust32004-06-271-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12701 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l WAVE_FORMAT_DOLBY_AC3_SPDIF needs to be defined first, patch by ↵faust32004-06-271-0/+2
| | | | | | Gianluigi Tiesi <sherpya at netfarm.it> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12700 b3059339-0415-0410-9bf9-f77b7e298cf2
* altivec yuv->rgb convertermichael2004-06-277-2/+878
| | | | | | | | | | | | | orginal patch by (Marc Hoffman <mmh at pleasantst dot com>) critical fixes by (Reza Jelveh <reza.jelveh at tu-harburg dot de>) known bugs/issues, which should be fixed ASAP by someone who has a ppc: 0..255 vs. 16..235 unneeded recalculation of tables general cleaup, like removing double initalizing of variables git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12699 b3059339-0415-0410-9bf9-f77b7e298cf2
* Real now supports index building as well.diego2004-06-261-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12698 b3059339-0415-0410-9bf9-f77b7e298cf2
* this is broken and causes relink during 'make install'. fix it or leave it ↵rfelker2004-06-261-2/+2
| | | | | | disabled git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12697 b3059339-0415-0410-9bf9-f77b7e298cf2
* grammar/typos pointed out by the Wandererdiego2004-06-262-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12696 b3059339-0415-0410-9bf9-f77b7e298cf2
* mga_vid under linux 2.6.x support written by F. O. Tempel, Ed Sweetman, ↵alex2004-06-261-5/+27
| | | | | | Gergely Nagy among others git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12695 b3059339-0415-0410-9bf9-f77b7e298cf2
* simple, smooth, ram-saving dynamic potmeter, which feature is required by ↵alex2004-06-262-2/+29
| | | | | | the tvisor skin, patch by Andre Kuhne git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12694 b3059339-0415-0410-9bf9-f77b7e298cf2
* make the awk script working for localized machines too, patch by Onur Kucukalex2004-06-261-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12693 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix GUI compilation, patch by Reimar Döffinger and Alexander Strasser.diego2004-06-266-8/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12692 b3059339-0415-0410-9bf9-f77b7e298cf2
* Seeking in RM works now.diego2004-06-261-3/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12691 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for comments in plaintext playlist by adlandalex2004-06-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12690 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000lalex2004-06-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12689 b3059339-0415-0410-9bf9-f77b7e298cf2
* x86-64 (amd64) support by Kenny Rootalex2004-06-263-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12688 b3059339-0415-0410-9bf9-f77b7e298cf2
* simple subtitle editor by Michael Klepikovalex2004-06-261-0/+445
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12687 b3059339-0415-0410-9bf9-f77b7e298cf2
* scroll strings from the left to right, patch by Andre Kuhnealex2004-06-261-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12686 b3059339-0415-0410-9bf9-f77b7e298cf2
* ac3 passthrough, initial patch by Gianluigi Tiesi <sherpya at netfarm.it>faust32004-06-261-3/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12685 b3059339-0415-0410-9bf9-f77b7e298cf2
* asyncblit slows down on UP systems, regarding to the SDL docs, noticed by ↵alex2004-06-261-4/+6
| | | | | | John Phillip git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12684 b3059339-0415-0410-9bf9-f77b7e298cf2
* SDL_HWACCEL is a readonly flag according to DOCS, noticed by John Philipalex2004-06-261-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12683 b3059339-0415-0410-9bf9-f77b7e298cf2
* rtc-device cmd option by James Noblealex2004-06-262-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12682 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix loader build on windowsfaust32004-06-262-9/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12681 b3059339-0415-0410-9bf9-f77b7e298cf2
* avoid double slashes, patch by Yoshinori Satoalex2004-06-261-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12680 b3059339-0415-0410-9bf9-f77b7e298cf2
* cseq starts from 1 according to the standard, patch by Yoshinori Satoalex2004-06-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12679 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32004-06-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12678 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10alex2004-06-261-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12677 b3059339-0415-0410-9bf9-f77b7e298cf2
* disable iconv in case setlocale is disabled - compile fixalex2004-06-261-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12676 b3059339-0415-0410-9bf9-f77b7e298cf2
* user nl_langinfo if langinfo support present for proper chinese support, ↵alex2004-06-262-1/+32
| | | | | | feature requested by Shixin Zheng <shixinzheng@sjtu.edu.cn> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12675 b3059339-0415-0410-9bf9-f77b7e298cf2
* make the internal sdl mixer optional, idea by Reimar Doffingeralex2004-06-261-1/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12674 b3059339-0415-0410-9bf9-f77b7e298cf2
* New 'Mixer API' with ability to change volume through libaf (this part was ↵alex2004-06-264-54/+94
| | | | | | written by Reimar Doffinger) and lesser global variables git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12673 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync tag bumpwight2004-06-262-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12672 b3059339-0415-0410-9bf9-f77b7e298cf2
* top/bottom mb row skippingmichael2004-06-261-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12671 b3059339-0415-0410-9bf9-f77b7e298cf2
* mplayer.rc moved to osdep where it belongs, approved by Sascha.diego2004-06-252-41/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12670 b3059339-0415-0410-9bf9-f77b7e298cf2
* Send a command throught the filter chain until some item returns AF_OK. ↵alex2004-06-252-2/+19
| | | | | | Patch by Reimar Doeffinger git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12669 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lalex2004-06-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12668 b3059339-0415-0410-9bf9-f77b7e298cf2
* silence gcc 3.4 warnings, patch by VMiklos <mamajom@axelero.hu>diego2004-06-251-15/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12667 b3059339-0415-0410-9bf9-f77b7e298cf2
* index creation/reading behaviour just like the avi demuxer, patch based on ↵alex2004-06-251-14/+26
| | | | | | work by Reza Jelveh, Moritz Bunkus und myself git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12666 b3059339-0415-0410-9bf9-f77b7e298cf2
* shorten description, typodiego2004-06-251-5/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12665 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10ldiego2004-06-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12664 b3059339-0415-0410-9bf9-f77b7e298cf2
* JACK audio support through bio2jack by Kamil Strzelecki <esack@o2.pl>alex2004-06-2510-2/+275
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12663 b3059339-0415-0410-9bf9-f77b7e298cf2
* email changebackalex2004-06-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12662 b3059339-0415-0410-9bf9-f77b7e298cf2
* neomagic tv out support throught vesa vbe, patch by Rudolf Marekalex2004-06-254-0/+62
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12661 b3059339-0415-0410-9bf9-f77b7e298cf2
* line breaks, clarificationdiego2004-06-251-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12660 b3059339-0415-0410-9bf9-f77b7e298cf2
* enable .PHONY for correct dependancy handlingalex2004-06-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12659 b3059339-0415-0410-9bf9-f77b7e298cf2
* bigendian fixalex2004-06-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12658 b3059339-0415-0410-9bf9-f77b7e298cf2
* static tablesalex2004-06-251-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12657 b3059339-0415-0410-9bf9-f77b7e298cf2
* more verbosityalex2004-06-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12656 b3059339-0415-0410-9bf9-f77b7e298cf2
* correct spellingalex2004-06-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12655 b3059339-0415-0410-9bf9-f77b7e298cf2
* degccifyalex2004-06-251-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12654 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l cosmeticsalex2004-06-251-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12653 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-06-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12652 b3059339-0415-0410-9bf9-f77b7e298cf2
* Unify the config.h #include, use "config.h" instead of "../config.h"diego2004-06-254-4/+4
| | | | | | | everywhere, will make extracting libvo/ easier. Approved by Alex. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12651 b3059339-0415-0410-9bf9-f77b7e298cf2
* more wishesdiego2004-06-251-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12650 b3059339-0415-0410-9bf9-f77b7e298cf2
* Real codecs and Mac OS X, don't recommend installing Real player.diego2004-06-251-15/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12649 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Alexander Strasserdiego2004-06-251-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12648 b3059339-0415-0410-9bf9-f77b7e298cf2
* string handling security fixesdiego2004-06-2513-84/+214
| | | | | | | | patch by Nicholas Kain, Alexander Strasser <eclipse7@gmx.net> reviewed by Pontscho, Alex, Rich git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12647 b3059339-0415-0410-9bf9-f77b7e298cf2
* name changediego2004-06-2510-18/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12646 b3059339-0415-0410-9bf9-f77b7e298cf2
* darwin flags cleanup by Dan Christiansenalex2004-06-251-2/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12645 b3059339-0415-0410-9bf9-f77b7e298cf2
* dvd-device option by Anton Tropashko <atropashko@yahoo.com>alex2004-06-251-4/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12644 b3059339-0415-0410-9bf9-f77b7e298cf2
* green stripe fix by Jan Kanty Palus <atler@o2.pl>alex2004-06-251-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12643 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove the latest use of log10 in favor of the better af_to_dB helper ↵alex2004-06-251-2/+2
| | | | | | function, patch by Reimar Doffinger git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12642 b3059339-0415-0410-9bf9-f77b7e298cf2
* tcp fragging bugfix by Song Du <freewizard at gmail.com>alex2004-06-251-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12641 b3059339-0415-0410-9bf9-f77b7e298cf2
* mpst fixalex2004-06-251-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12640 b3059339-0415-0410-9bf9-f77b7e298cf2
* RFC compliance patch by Eric Lammerts <eric@lammerts.org>alex2004-06-251-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12639 b3059339-0415-0410-9bf9-f77b7e298cf2
* uber 10l found by Ilia <chest4l at mail.ru>alex2004-06-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12638 b3059339-0415-0410-9bf9-f77b7e298cf2
* move macosx in the priority list after sdl, patch by Dan Christiansenalex2004-06-251-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12637 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Alexander Neundorf, straight from Linuxtagdiego2004-06-251-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12636 b3059339-0415-0410-9bf9-f77b7e298cf2
* ranlib cleanupalex2004-06-242-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12635 b3059339-0415-0410-9bf9-f77b7e298cf2
* another 10lalex2004-06-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12634 b3059339-0415-0410-9bf9-f77b7e298cf2
* ranlib cleanup by Dan Christiansenalex2004-06-2418-15/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12633 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix memory corruption, noticable at reallocate imageiive2004-06-241-8/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12632 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for realvideo codecs under macosx, original patch by Donnie Smith ↵alex2004-06-241-6/+26
| | | | | | (together with an altivec patch by Dan Christiansen) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12631 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lalex2004-06-241-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12630 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for realvideo codecs under macosx, original patch by Donnie Smithalex2004-06-243-7/+278
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12629 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Fabian Franzdiego2004-06-241-3/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12628 b3059339-0415-0410-9bf9-f77b7e298cf2
* build fixwight2004-06-241-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12627 b3059339-0415-0410-9bf9-f77b7e298cf2
* More information about modifications to comply more closely with GPL 2a.diego2004-06-2393-89/+276
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12626 b3059339-0415-0410-9bf9-f77b7e298cf2
* added more key to keyboard eventnplourde2004-06-231-24/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12625 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed buggy rgb32 supportnplourde2004-06-231-103/+31
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12624 b3059339-0415-0410-9bf9-f77b7e298cf2
* bugzillaalex2004-06-231-2/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12623 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording/spelling improvements as suggested by the Wandererdiego2004-06-221-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12622 b3059339-0415-0410-9bf9-f77b7e298cf2
* wording, spelling, bug fixesdiego2004-06-221-49/+45
| | | | | | | MAN PAGE REVIEW PART I git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12621 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-06-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12620 b3059339-0415-0410-9bf9-f77b7e298cf2
* better wording, patch by Sebastian Krämer <mail@skraemer.de>diego2004-06-211-134/+136
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12619 b3059339-0415-0410-9bf9-f77b7e298cf2
* width and height in seq_header could never be 0iive2004-06-211-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12618 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync VOBsubwight2004-06-213-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12617 b3059339-0415-0410-9bf9-f77b7e298cf2
* uniform VOBsub spellingdiego2004-06-216-27/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12616 b3059339-0415-0410-9bf9-f77b7e298cf2
* Prefer libavcodec for cvid filesrtognimp2004-06-201-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12615 b3059339-0415-0410-9bf9-f77b7e298cf2
* disable buggy sse on mingwfaust32004-06-181-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12614 b3059339-0415-0410-9bf9-f77b7e298cf2
* added support for ac3 in non-pes aligned private1 streams; removed useless ↵nicodvb2004-06-181-71/+131
| | | | | | and commented code git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12613 b3059339-0415-0410-9bf9-f77b7e298cf2
* Just a tiny fix with configure/Makefile for not usingdiego2004-06-182-1/+3
| | | | | | | "caca-config --cflags", patch by Pigeon <pigeon@pigeond.net>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12612 b3059339-0415-0410-9bf9-f77b7e298cf2
* calling bind with multicast addresses doesn't work on windows, patch by ↵faust32004-06-181-3/+21
| | | | | | Martin Decky <deckm1am at ss1000.ms.mff.cuni.cz> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12611 b3059339-0415-0410-9bf9-f77b7e298cf2
* array initialization fix by SungKwanKang <ksquarekr at yahoo.com>faust32004-06-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12610 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l, patch by Michael Nottebrock <michaelnottebrock@gmx.net>faust32004-06-181-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12609 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l for Michael, nsse_weight should be nssew, spelling.diego2004-06-171-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12608 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Dan Christiansen, by himselfdiego2004-06-171-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12607 b3059339-0415-0410-9bf9-f77b7e298cf2
* libfame has been removed from MPlayer long ago. Compilation fix pointeddiego2004-06-171-1/+1
| | | | | | | out by Hetfield <hetfield@email.it>. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12606 b3059339-0415-0410-9bf9-f77b7e298cf2
* Debian Sarge build instructionswight2004-06-171-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12605 b3059339-0415-0410-9bf9-f77b7e298cf2
* another DTD locationwight2004-06-171-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12604 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetic reformatting (preparation for upcoming changes)diego2004-06-171-58/+59
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12603 b3059339-0415-0410-9bf9-f77b7e298cf2
* moved vo_quartz higher in the listnplourde2004-06-171-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12602 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistent suboption description for vo_quartznplourde2004-06-171-9/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12601 b3059339-0415-0410-9bf9-f77b7e298cf2
* MEncoder has problems reading from stdin, files need to be concatenateddiego2004-06-171-1/+2
| | | | | | | first. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12600 b3059339-0415-0410-9bf9-f77b7e298cf2
* consistent suboption description for vo_quartzdiego2004-06-171-7/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12599 b3059339-0415-0410-9bf9-f77b7e298cf2
* Better audio filter description, use same values as in the XML docs,diego2004-06-171-3/+3
| | | | | | | noticed by Alexander Strasser. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12598 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-06-161-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12597 b3059339-0415-0410-9bf9-f77b7e298cf2
* add more info about vo_quartznplourde2004-06-162-0/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12596 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.44paszczi2004-06-151-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12595 b3059339-0415-0410-9bf9-f77b7e298cf2
* nssemichael2004-06-151-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12594 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-06-151-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12593 b3059339-0415-0410-9bf9-f77b7e298cf2
* Address removed upon request.diego2004-06-151-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12592 b3059339-0415-0410-9bf9-f77b7e298cf2
* some missing librarieswight2004-06-151-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12591 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make configure point to translated docswight2004-06-151-6/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12590 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-06-141-76/+72
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12589 b3059339-0415-0410-9bf9-f77b7e298cf2
* and one more consistency changewight2004-06-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12588 b3059339-0415-0410-9bf9-f77b7e298cf2
* More consistent naming pointed out by Torinthiel.diego2004-06-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12587 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync tag bumpwight2004-06-145-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12586 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l for a copy and paste error noticed by Alex.diego2004-06-141-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12585 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos pointed out by the wandererdiego2004-06-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12584 b3059339-0415-0410-9bf9-f77b7e298cf2
* major reindentation of x11 code try #2attila2004-06-146-3335/+4262
| | | | | | | | | | | | | | note that this is plain ident output, i didnt tweak it by hand like the last attempt. if anyone is interested in the indent profile i used, just drop me a mail. please contact me on irc on how to send me my share of cola, but be aware that i will only accept swiss or german cola, as the japanese is way to sweet :) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12583 b3059339-0415-0410-9bf9-f77b7e298cf2
* qprd needs mbd=2michael2004-06-131-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12582 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.38paszczi2004-06-131-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12581 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync with website, more uniformity, better descriptions.diego2004-06-131-71/+67
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12580 b3059339-0415-0410-9bf9-f77b7e298cf2
* 's should be outside of <application> tags.diego2004-06-136-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12579 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync tag bump - was OK.wight2004-06-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12578 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l to Alexdiego2004-06-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12577 b3059339-0415-0410-9bf9-f77b7e298cf2
* change linking order for static build with live.com on mingwjoey2004-06-131-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12576 b3059339-0415-0410-9bf9-f77b7e298cf2
* detect screen resolution as in x11_common.creimar2004-06-131-0/+16
| | | | | | | Patch by Philippe Dumont (dumont (at) lifl (dot) fr) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12575 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for big endian systemsrtognimp2004-06-121-4/+9
| | | | | | | Patch by Jean-Francois Panisset < panisset (at) comcast (dot) net > git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12574 b3059339-0415-0410-9bf9-f77b7e298cf2
* display height may be a lot smaller or larger than picture height, sample ↵iive2004-06-121-3/+3
| | | | | | provided by winnicki git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12573 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix playback of file after playing an urlrtognimp2004-06-111-0/+3
| | | | | | | Patch by Aurelien Jacobs <aurel (at) gnuage (dot) org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12572 b3059339-0415-0410-9bf9-f77b7e298cf2
* additional formats - 8bit & floathenry2004-06-111-2/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12571 b3059339-0415-0410-9bf9-f77b7e298cf2
* debug printf junkhenry2004-06-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12570 b3059339-0415-0410-9bf9-f77b7e298cf2
* freetype depends on iconvdiego2004-06-111-51/+58
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12569 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-06-111-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12568 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1lalex2004-06-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12567 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1lalex2004-06-111-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12566 b3059339-0415-0410-9bf9-f77b7e298cf2
* translatedalex2004-06-111-0/+114
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12565 b3059339-0415-0410-9bf9-f77b7e298cf2
* OpenBSD/VAX support, patch by Gabucinofaust32004-06-111-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12564 b3059339-0415-0410-9bf9-f77b7e298cf2
* mpeg2 chroma422/444 supportiive2004-06-112-2/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12563 b3059339-0415-0410-9bf9-f77b7e298cf2
* We play RV20 natively, some rewording.diego2004-06-101-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12562 b3059339-0415-0410-9bf9-f77b7e298cf2
* wishes--;diego2004-06-101-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12561 b3059339-0415-0410-9bf9-f77b7e298cf2
* typosdiego2004-06-101-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12560 b3059339-0415-0410-9bf9-f77b7e298cf2
* SYNOPSIS reordered.diego2004-06-101-14/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12559 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.55paszczi2004-06-101-7/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12558 b3059339-0415-0410-9bf9-f77b7e298cf2
* forgot to add changes:)paszczi2004-06-101-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12557 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.9paszczi2004-06-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12556 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.43paszczi2004-06-101-15/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12555 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1lalex2004-06-101-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12554 b3059339-0415-0410-9bf9-f77b7e298cf2
* removing unused partsalex2004-06-101-16/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12553 b3059339-0415-0410-9bf9-f77b7e298cf2
* ports translatedalex2004-06-102-1/+469
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12552 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for the "custom colors" and "forced subtitles" entries in the VobSub ↵mosu2004-06-103-41/+141
| | | | | | idx. Made the parser handle whitespaces better. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12551 b3059339-0415-0410-9bf9-f77b7e298cf2
* configurable 'junk' borders for pulluprfelker2004-06-102-8/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12550 b3059339-0415-0410-9bf9-f77b7e298cf2
* old changes in my local tree i forgot to commit - minor fixesrfelker2004-06-102-2/+56
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12549 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try to get the "size:" and "palette:" entries for VobSub tracks from the ↵mosu2004-06-081-0/+92
| | | | | | private data. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12548 b3059339-0415-0410-9bf9-f77b7e298cf2
* We don't want junk in unused parts of the BITMAPINFOHEADERranma2004-06-081-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12547 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix hang on broken mmst streamsrtognimp2004-06-071-1/+2
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12546 b3059339-0415-0410-9bf9-f77b7e298cf2
* dvd:// now supports title ranges, patch by Roberto Togni.diego2004-06-071-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12545 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support dvd://start_title-end_title as requested on wishlistrtognimp2004-06-071-2/+39
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12544 b3059339-0415-0410-9bf9-f77b7e298cf2
* nsse weightmichael2004-06-071-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12543 b3059339-0415-0410-9bf9-f77b7e298cf2
* small updatesdiego2004-06-071-1/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12542 b3059339-0415-0410-9bf9-f77b7e298cf2
* libfaad2 updated to version 2.0.diego2004-06-071-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12541 b3059339-0415-0410-9bf9-f77b7e298cf2
* More support for audio format 0x0rtognimp2004-06-061-0/+1
| | | | | | | Patch by Reimar Doeffinger git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12540 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enhance detection of embedded smil playlist, add embedded ram playlistrtognimp2004-06-061-3/+8
| | | | | | | | support Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12539 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support for audio format 0x0rtognimp2004-06-061-0/+1
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12538 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.593danny2004-06-061-48/+203
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12537 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use same order as WMP for mms protocols (MMSU, MMST, HTTP)rtognimp2004-06-061-28/+31
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12536 b3059339-0415-0410-9bf9-f77b7e298cf2
* Segfault fix for some h264 in avi filesrtognimp2004-06-061-1/+1
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12535 b3059339-0415-0410-9bf9-f77b7e298cf2
* Compilation fix with --disable-liba52rtognimp2004-06-061-0/+2
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12534 b3059339-0415-0410-9bf9-f77b7e298cf2
* small linux/altivec compile fix in postproc/ by (Romain Dolbeau <dolbeau at ↵michael2004-06-041-8/+6
| | | | | | irisa dot fr>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12533 b3059339-0415-0410-9bf9-f77b7e298cf2
* MinGW compilation fix from a patch by Joey Parrish, approved by Saschadiego2004-06-031-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12532 b3059339-0415-0410-9bf9-f77b7e298cf2
* MinGW compilation fix, idea and approval by Sascha Sommerdiego2004-06-031-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12531 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix bug reported by Leonardo Giordani: sh->aspect is not pixel aspect but ↵rik2004-06-031-2/+4
| | | | | | movie aspect git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12530 b3059339-0415-0410-9bf9-f77b7e298cf2
* history translatedalex2004-06-021-0/+112
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12529 b3059339-0415-0410-9bf9-f77b7e298cf2
* update to the 2.0 release of faad, patch by adlanddiego2004-06-0285-22637/+26146
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12528 b3059339-0415-0410-9bf9-f77b7e298cf2
* progressalex2004-06-022-0/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12527 b3059339-0415-0410-9bf9-f77b7e298cf2
* hungarian xml docsalex2004-06-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12526 b3059339-0415-0410-9bf9-f77b7e298cf2
* hungarian xml docs, first tryalex2004-06-023-0/+200
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12525 b3059339-0415-0410-9bf9-f77b7e298cf2
* Indeo audio support via acm binary codecrtognimp2004-06-021-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12524 b3059339-0415-0410-9bf9-f77b7e298cf2
* Buffer overflow fix in string handling, patch by c0ntex, approved by .so.diego2004-06-021-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12523 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added "audio_id", "video_id", "dvdsub_id" to the call to "demux_open()".rsf2004-06-021-1/+3
| | | | | | | (Thanks to Nico Sabbi for suggesting this.) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12522 b3059339-0415-0410-9bf9-f77b7e298cf2
* Metacity fullscreen issues, patch by Alexander Strasser <eclipse7@gmx.net>,diego2004-06-025-1/+65
| | | | | | | approved by Attila. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12521 b3059339-0415-0410-9bf9-f77b7e298cf2
* choose fullscreen device with suboption device_id=#nplourde2004-06-021-22/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12520 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed unused and commented code; audio is pushed synchronously (reported ↵nicodvb2004-05-311-26/+18
| | | | | | to work better); pid 16 is not default PMT (100l); trails of data are add_packet()ed git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12519 b3059339-0415-0410-9bf9-f77b7e298cf2
* uyvy osd supportnplourde2004-05-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12518 b3059339-0415-0410-9bf9-f77b7e298cf2
* draw alpha for uyvynplourde2004-05-313-4/+59
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12517 b3059339-0415-0410-9bf9-f77b7e298cf2
* Big Endian fix. Patch by Romain Dolbeaunplourde2004-05-311-4/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12516 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix X11 libs detection on Cygwin.diego2004-05-311-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12515 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix Cygwin compilation, patch by Sascha Sommer.diego2004-05-311-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12514 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_quartz now default vo on OSXnplourde2004-05-301-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12513 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l to me, leftover line from a correction not deleted.diego2004-05-301-2/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12512 b3059339-0415-0410-9bf9-f77b7e298cf2
* Update by Alexander Strasser <eclipse7@gmx.net>, some corrections mine.diego2004-05-301-116/+131
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12511 b3059339-0415-0410-9bf9-f77b7e298cf2
* CVS snapshots come with libavcodec.diego2004-05-261-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12510 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync with 1.42paszczi2004-05-261-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12509 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Scognitodiego2004-05-261-4/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12508 b3059339-0415-0410-9bf9-f77b7e298cf2
* MPlayer logo as taskbar icon by Scognitodiego2004-05-261-28/+140
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12507 b3059339-0415-0410-9bf9-f77b7e298cf2
* xvmc and *vidix suboptions documented, better ao/vo suboption syntaxdiego2004-05-251-19/+51
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12506 b3059339-0415-0410-9bf9-f77b7e298cf2
* new and improved icons by Scognitodiego2004-05-257-2303/+1177
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12505 b3059339-0415-0410-9bf9-f77b7e298cf2
* dispositionmichael2004-05-251-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12504 b3059339-0415-0410-9bf9-f77b7e298cf2
* index fixesmichael2004-05-251-12/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12503 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove index flagmichael2004-05-251-8/+33
| | | | | | | | | | | max_short_distance reserved_v -> reserved_count header repeation rules some of this is from rich git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12502 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix compile with network disabledrfelker2004-05-251-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12501 b3059339-0415-0410-9bf9-f77b7e298cf2
* nicer icons by Scognitodiego2004-05-243-109/+277
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12500 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix "raw " audio in mov files.rtognimp2004-05-231-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12499 b3059339-0415-0410-9bf9-f77b7e298cf2
* no kabbe-bytes or men in black or any of that nonsense here...rfelker2004-05-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12498 b3059339-0415-0410-9bf9-f77b7e298cf2
* MinGW comes without zlib (necessary for compressed MOV headers).diego2004-05-221-0/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12497 b3059339-0415-0410-9bf9-f77b7e298cf2
* first cut at pre5 changesdiego2004-05-211-3/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12496 b3059339-0415-0410-9bf9-f77b7e298cf2
* credit for Ross Finlaysondiego2004-05-211-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12495 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1e6lhenry2004-05-211-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12494 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix crash due to fast_memcpy calling itself instead of libc memcpyreimar2004-05-201-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12493 b3059339-0415-0410-9bf9-f77b7e298cf2
* MinGW doesn't accept trailing /reimar2004-05-201-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12492 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000l....of pepsi :(broke -ovc copy!)rfelker2004-05-191-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12491 b3059339-0415-0410-9bf9-f77b7e298cf2
* more lame optionsrfelker2004-05-192-0/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12490 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add quartz to Romain contribnplourde2004-05-181-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12489 b3059339-0415-0410-9bf9-f77b7e298cf2
* re-use same window when playing multiple filesnplourde2004-05-181-102/+146
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12488 b3059339-0415-0410-9bf9-f77b7e298cf2
* using bswap.h for endianness conversionreimar2004-05-181-9/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12487 b3059339-0415-0410-9bf9-f77b7e298cf2
* more sane order for overlay workarounds, fixed a bug where the mouse would ↵faust32004-05-181-18/+19
| | | | | | stay hidden on win98 git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12486 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove 3-pass encoding guide (can break A/V sync), rescaling is notdiego2004-05-171-68/+15
| | | | | | | necessarily bad, typo. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12485 b3059339-0415-0410-9bf9-f77b7e298cf2
* Peter Simon (wma2ogg.pl)diego2004-05-171-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12484 b3059339-0415-0410-9bf9-f77b7e298cf2
* WMA to Ogg conversion script by Peter Simon <simon.peter@linuxuser.hu>,diego2004-05-171-0/+341
| | | | | | | sent in by VMiklos. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12483 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix endian conversion for (curently unused) case where in buffer != out bufferreimar2004-05-161-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12482 b3059339-0415-0410-9bf9-f77b7e298cf2
* some corrections by Haris Kouzinopoulosdiego2004-05-161-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12481 b3059339-0415-0410-9bf9-f77b7e298cf2
* Change divx4 examples to lavc, based on a patch by Compn.diego2004-05-161-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12480 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for 24 bit pcm/wav filesreimar2004-05-164-3/+93
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12479 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add detection of nsa streamed by aol ultravox serverrtognimp2004-05-142-3/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12478 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed #ifdefs that are already handled by libao2/afmt.hreimar2004-05-142-23/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12477 b3059339-0415-0410-9bf9-f77b7e298cf2
* give Y8 and Y800 lower conversion priority to avoid grayscaled videoreimar2004-05-141-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12476 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support audio format 0xff (it's aac)rtognimp2004-05-141-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12475 b3059339-0415-0410-9bf9-f77b7e298cf2
* If demuxer does not fill codecdata try to get if from waveformatexrtognimp2004-05-141-0/+5
| | | | | | | (fixes audio format 0xff) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12474 b3059339-0415-0410-9bf9-f77b7e298cf2
* -ao option removed, there is a AUDIO OUTPUT DRIVERS section for that now,diego2004-05-141-29/+16
| | | | | | | said section extended, "," should be ":" as pointed out by joyping. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12473 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-05-141-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12472 b3059339-0415-0410-9bf9-f77b7e298cf2
* ENCA supporthenry2004-05-131-0/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12471 b3059339-0415-0410-9bf9-f77b7e298cf2
* skin authors, alphabetical orderdiego2004-05-131-3/+125
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12470 b3059339-0415-0410-9bf9-f77b7e298cf2
* AUDIO OUTPUT DRIVERS section added.diego2004-05-131-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12469 b3059339-0415-0410-9bf9-f77b7e298cf2
* AUDIO OUTPUT DRIVER section added, VO section extended, small fixes.diego2004-05-131-12/+119
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12468 b3059339-0415-0410-9bf9-f77b7e298cf2
* segfault fix by Jarrod Johnson <jbj-zl@ura.dnsalias.org>diego2004-05-131-1/+5
| | | | | | | approved by Vladimir Mosgalin, the original author of that code snippet git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12467 b3059339-0415-0410-9bf9-f77b7e298cf2
* alsa9/1.x merge, now with api_compat-definitionjoyping2004-05-121-0/+1177
| | | | | | | | | | printfs converted to mp_msg, thanks to adland <adland123@yahoo.com> gcc 3.4 fix, undefined label at end of case statement default device is now 'default' instead of hw:0,0. so users are able to set their own defaultdevice (dmix) in asoundrc. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12466 b3059339-0415-0410-9bf9-f77b7e298cf2
* changes for alsa9/alsa1.x merge, only alsa.joyping2004-05-121-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12465 b3059339-0415-0410-9bf9-f77b7e298cf2
* segfault fixmichael2004-05-121-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12464 b3059339-0415-0410-9bf9-f77b7e298cf2
* changes for alsa9/1.x-merge only alsajoyping2004-05-121-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12463 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark EDL only options as such, typo.diego2004-05-121-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12462 b3059339-0415-0410-9bf9-f77b7e298cf2
* Event Handling Makeovernplourde2004-05-121-167/+158
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12461 b3059339-0415-0410-9bf9-f77b7e298cf2
* correct model numberdiego2004-05-122-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12460 b3059339-0415-0410-9bf9-f77b7e298cf2
* FFSVQ1 in avimichael2004-05-121-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12459 b3059339-0415-0410-9bf9-f77b7e298cf2
* better CVS checkout parametersdiego2004-05-111-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12458 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync (pre)nauj272004-05-103-9/+135
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12457 b3059339-0415-0410-9bf9-f77b7e298cf2
* more cola for jindrichrfelker2004-05-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12456 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add support for a few more Radeons, patch by Nyk Tarr.diego2004-05-092-0/+13
| | | | | | | Extended, corrected and tested by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12455 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lfaust32004-05-091-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12454 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-05-091-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12453 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.587, some typo and some word untranslateddanny2004-05-091-82/+131
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12452 b3059339-0415-0410-9bf9-f77b7e298cf2
* report if the service creation failedfaust32004-05-091-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12451 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000000l for sig11 without -subcp!!! (and 1l for my first commit :)rfelker2004-05-091-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12450 b3059339-0415-0410-9bf9-f77b7e298cf2
* removing useless code, improving readabilityreimar2004-05-081-39/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12449 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix bigendian problems (left-right swapped 8bit pcms), add 32bit supportreimar2004-05-081-12/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12448 b3059339-0415-0410-9bf9-f77b7e298cf2
* fixed memory leak and removed unnecessary static variablereimar2004-05-081-9/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12447 b3059339-0415-0410-9bf9-f77b7e298cf2
* changes to get manyfmts nearer to working and fixed memory leakreimar2004-05-081-20/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12446 b3059339-0415-0410-9bf9-f77b7e298cf2
* Use roqvideo and roqaudio decoders from libavcodecrtognimp2004-05-081-0/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12445 b3059339-0415-0410-9bf9-f77b7e298cf2
* ENCA support (http://trific.ath.cx/software/enca/)henry2004-05-086-8/+123
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12444 b3059339-0415-0410-9bf9-f77b7e298cf2
* synced with 1.41paszczi2004-05-081-30/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12443 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support ffmpeg cinepak decoderrtognimp2004-05-071-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12442 b3059339-0415-0410-9bf9-f77b7e298cf2
* use fallback for unsupported formats instead of quittingreimar2004-05-071-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12441 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cygwin and MinGW now behave similarly with regard to VCD/DVD playback.diego2004-05-071-26/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12440 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing spacesdiego2004-05-071-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12439 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hint at -playlist option for playing streams.diego2004-05-071-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12438 b3059339-0415-0410-9bf9-f77b7e298cf2
* clarificationdiego2004-05-071-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12437 b3059339-0415-0410-9bf9-f77b7e298cf2
* List Attila as maintainer of a few video out drivers.diego2004-05-071-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12436 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetics. Shortened the "displaying subtitle..." message. Replaced "OGG" ↵mosu2004-05-072-29/+29
| | | | | | with "Ogg" as it is a name, not an abbreviation/acronym. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12435 b3059339-0415-0410-9bf9-f77b7e298cf2
* More code cleanupnplourde2004-05-071-59/+55
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12434 b3059339-0415-0410-9bf9-f77b7e298cf2
* Switch rgb32 from QD to QTnplourde2004-05-071-289/+206
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12433 b3059339-0415-0410-9bf9-f77b7e298cf2
* Encrypted dvd playback now accepts -dvd-drive e: on mingw. fix from ↵faust32004-05-061-0/+11
| | | | | | libdvdread, left out the various cosmetics changes for now git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12432 b3059339-0415-0410-9bf9-f77b7e298cf2
* Be more verbose and tell the user which subtitle stream has been selected ↵mosu2004-05-051-2/+4
| | | | | | (if any). git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12431 b3059339-0415-0410-9bf9-f77b7e298cf2
* Qt RLE is now in ffmpegrtognimp2004-05-052-401/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12430 b3059339-0415-0410-9bf9-f77b7e298cf2
* extendible frame_code tablemichael2004-05-051-12/+15
| | | | | | | maybe more compact too git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12429 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_quartz, yuv related usagenplourde2004-05-051-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12428 b3059339-0415-0410-9bf9-f77b7e298cf2
* more credits, names, nicksdiego2004-05-051-12/+20
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12427 b3059339-0415-0410-9bf9-f77b7e298cf2
* Disable live resize for yuv - HW accel bugnplourde2004-05-051-6/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12426 b3059339-0415-0410-9bf9-f77b7e298cf2
* Cosmetic change std ident stylenplourde2004-05-051-304/+339
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12425 b3059339-0415-0410-9bf9-f77b7e298cf2
* Removed unused debug code.nplourde2004-05-051-62/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12424 b3059339-0415-0410-9bf9-f77b7e298cf2
* Support vp6vfw.dll version 6.0.7.3rtognimp2004-05-041-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12423 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-05-041-3/+27
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12422 b3059339-0415-0410-9bf9-f77b7e298cf2
* VIDIX now works on Win32, approved by Sascha.diego2004-05-041-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12421 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hint at diff options useful for avoiding cosmetic changes, patch by Reimar.diego2004-05-041-0/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12420 b3059339-0415-0410-9bf9-f77b7e298cf2
* winvidix documented, alternative ways of specifying -dvd-device.diego2004-05-041-0/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12419 b3059339-0415-0410-9bf9-f77b7e298cf2
* subtitles in black bandsdiego2004-05-041-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12418 b3059339-0415-0410-9bf9-f77b7e298cf2
* unnecessary escapediego2004-05-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12417 b3059339-0415-0410-9bf9-f77b7e298cf2
* typodiego2004-05-041-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12416 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add yuv csp supportnplourde2004-05-041-19/+513
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12415 b3059339-0415-0410-9bf9-f77b7e298cf2
* proposals by rich:michael2004-05-041-28/+50
| | | | | | | | | | remove predicted delta timestamps delta timestamp in the frame_code table reserved vlc count in the frame_code table global timestamp after frame_startcode git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12414 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l for mertognimp2004-05-031-2/+2
| | | | | | | Ftp fix patch was committed commented out. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12413 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavformat, realrtspdiego2004-05-031-1/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12412 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-05-031-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12411 b3059339-0415-0410-9bf9-f77b7e298cf2
* Spelling and wording fixes pointed out by the wanderer.diego2004-05-031-29/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12410 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos, wording and mistakes pointed out by the wandererdiego2004-05-032-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12409 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling, wording, consistency in comments and printed messagesdiego2004-05-033-76/+77
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12408 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling, wording sync with cfg-mencoder.hdiego2004-05-031-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12407 b3059339-0415-0410-9bf9-f77b7e298cf2
* wrong number, pointed out by Scognitodiego2004-05-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12406 b3059339-0415-0410-9bf9-f77b7e298cf2
* more wishesdiego2004-05-031-3/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12405 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing namediego2004-05-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12404 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hint at -mf in mf:// syntax description.diego2004-05-031-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12403 b3059339-0415-0410-9bf9-f77b7e298cf2
* Blinkenlights section expanded.diego2004-05-031-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12402 b3059339-0415-0410-9bf9-f77b7e298cf2
* divx --> lavc, spelling, more sensible section namediego2004-05-031-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12401 b3059339-0415-0410-9bf9-f77b7e298cf2
* Obsolet -mf syntax replaced by mf://, based on a patch sent by Compn, bugdiego2004-05-031-20/+19
| | | | | | | fixes and further wording improvements by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12400 b3059339-0415-0410-9bf9-f77b7e298cf2
* Restore ftp support (was erroneusly disabled while fixing bogus errorsrtognimp2004-05-021-0/+2
| | | | | | | on conection failure) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12399 b3059339-0415-0410-9bf9-f77b7e298cf2
* Enable cyuv decoder from libavcodec, use it as preferred codec for cyuvrtognimp2004-05-021-0/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12398 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix hang for some asf video stream like ↵rtognimp2004-05-021-1/+1
| | | | | | | | | http://193.219.139.115/ltv/zinios/news1830_20040501.wmv Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12397 b3059339-0415-0410-9bf9-f77b7e298cf2
* bigendian fix by (Romain Dolbeau <dolbeau at irisa dot fr>)michael2004-05-021-0/+10
| | | | | | | with #if defined(WORDS_BIGENDIAN) && (WORDS_BIGENDIAN == 1) -> #ifdef WORDS_BIGENDIAN by me git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12396 b3059339-0415-0410-9bf9-f77b7e298cf2
* clear buffer after (glX)SwapBuffers in fullscreen to avoid flickering bordersreimar2004-05-021-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12395 b3059339-0415-0410-9bf9-f77b7e298cf2
* As pointed by Diego, I forgot this.lumag2004-05-021-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12394 b3059339-0415-0410-9bf9-f77b7e298cf2
* nicer startcode before keyframe rulemichael2004-05-021-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12393 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix url escaping and avoid double escapertognimp2004-05-013-33/+74
| | | | | | | Patch by adland, approved by Bertrand Baudet git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12392 b3059339-0415-0410-9bf9-f77b7e298cf2
* Try to get an asf file with normal http protocol if http streamingrtognimp2004-05-011-0/+12
| | | | | | | fail. Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12391 b3059339-0415-0410-9bf9-f77b7e298cf2
* -adapter is not directx specific anymore.diego2004-05-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12390 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_directx now supports keepaspect.diego2004-05-011-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12389 b3059339-0415-0410-9bf9-f77b7e298cf2
* keepaspect support, tryed to clean up DirectxManageDisplay a bit, enabled ↵faust32004-05-011-105/+69
| | | | | | UYVY support and fixed bugs where switching to fullscreen would keep the console window on top and where the initial window position is wrongly calculated git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12388 b3059339-0415-0410-9bf9-f77b7e298cf2
* more stupid craprfelker2004-05-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12387 b3059339-0415-0410-9bf9-f77b7e298cf2
* this isn't actually stupid, but it's not valid C and gcc 3.5 rejects it as suchrfelker2004-05-012-10/+10
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12386 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10lrfelker2004-05-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12385 b3059339-0415-0410-9bf9-f77b7e298cf2
* ok this one is beyond stupid. the code didn't even do what was intendedrfelker2004-05-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12384 b3059339-0415-0410-9bf9-f77b7e298cf2
* GUI supportreimar2004-05-011-0/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12383 b3059339-0415-0410-9bf9-f77b7e298cf2
* Sync, update my email.lumag2004-05-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12382 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10000000000l twisted typecastinghenry2004-05-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12381 b3059339-0415-0410-9bf9-f77b7e298cf2
* limits too small, my CBR mp3 samples have 2x overhead after removial of size ↵michael2004-05-011-2/+2
| | | | | | prediction git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12380 b3059339-0415-0410-9bf9-f77b7e298cf2
* more lvalue casts, ugly this timerfelker2004-05-011-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12379 b3059339-0415-0410-9bf9-f77b7e298cf2
* more lvalue castsrfelker2004-05-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12378 b3059339-0415-0410-9bf9-f77b7e298cf2
* more nonsense lvalue casts, at least these aren't quite as stupidrfelker2004-05-011-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12377 b3059339-0415-0410-9bf9-f77b7e298cf2
* and more and more stupidityrfelker2004-05-011-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12376 b3059339-0415-0410-9bf9-f77b7e298cf2
* more stupidityrfelker2004-05-011-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12375 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000000000000lrfelker2004-05-011-26/+26
| | | | | | | whoever wrote this crap has no understanding of c whatsoever... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12374 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync + wordingwight2004-05-011-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12373 b3059339-0415-0410-9bf9-f77b7e298cf2
* keepaspect and nokeepaspect are now useable by all vosfaust32004-05-014-11/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12372 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-05-013-9/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12371 b3059339-0415-0410-9bf9-f77b7e298cf2
* S/PDIF spelling correctedwight2004-05-013-6/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12370 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmeticmichael2004-05-011-5/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12369 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l for me. Header seek is not needed to fix 28_8 and can cause sig11rtognimp2004-05-011-4/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12368 b3059339-0415-0410-9bf9-f77b7e298cf2
* standard notationdiego2004-04-301-2/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12367 b3059339-0415-0410-9bf9-f77b7e298cf2
* additional start_code rule (implemenattion does this since a long time already)michael2004-04-301-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12366 b3059339-0415-0410-9bf9-f77b7e298cf2
* wordingdiego2004-04-301-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12365 b3059339-0415-0410-9bf9-f77b7e298cf2
* Allow user to disable writing of ODML indexranma2004-04-303-10/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12364 b3059339-0415-0410-9bf9-f77b7e298cf2
* Only use odml index for files that need itranma2004-04-301-4/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12363 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for a few more radeons patch by Reza Jelveh <reza.jelveh at ↵faust32004-04-302-0/+9
| | | | | | tu-harburg.de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12362 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l on cygwin WIN32 gets defined in config.hfaust32004-04-302-2/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12361 b3059339-0415-0410-9bf9-f77b7e298cf2
* add X11 headers to OPTFLAGS patch by Steven M. Schultz <sms at 2BSD.COM>faust32004-04-301-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12360 b3059339-0415-0410-9bf9-f77b7e298cf2
* Make it compile on mingw again. Now it is finally possible to include ↵faust32004-04-304-4/+9
| | | | | | windows.h in mplayer.c git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12359 b3059339-0415-0410-9bf9-f77b7e298cf2
* more cola, not mine thorfelker2004-04-301-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12358 b3059339-0415-0410-9bf9-f77b7e298cf2
* minimal fix for alex's 1000000000000l compile errors. imo the fix inrfelker2004-04-306-4/+10
| | | | | | | | | | aviheader.h is totally correct. defining useless typedefs that can conflict with other headers is bad practice. i don't like editing mmreg.h but oh well... if you have a better fix, commit it! finally, the fix in the ad_ and vd_ files seems totally correct. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12357 b3059339-0415-0410-9bf9-f77b7e298cf2
* oops, forgot this with the softskip patchrfelker2004-04-301-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12356 b3059339-0415-0410-9bf9-f77b7e298cf2
* 100l to me!rfelker2004-04-301-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12355 b3059339-0415-0410-9bf9-f77b7e298cf2
* Remove MSZH/ZLIB, FLI and QTRLE, they are now in ffmpegrtognimp2004-04-297-1326/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12354 b3059339-0415-0410-9bf9-f77b7e298cf2
* Should be Connection: close, and not closed.bertrand2004-04-291-1/+1
| | | | | | | | It has been there since v1.3... Thanks to Jonas Jensen <jbj@knef.dk> to noticed it. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12353 b3059339-0415-0410-9bf9-f77b7e298cf2
* Leave the subs uninitialized and not "forcefully off" if the user hasn't ↵mosu2004-04-291-2/+5
| | | | | | chosen a stream with -sid. If he used -slang then we need the comment packet which might be found after demux_ogg_open has finished. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12352 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncwight2004-04-291-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12351 b3059339-0415-0410-9bf9-f77b7e298cf2
* spellingdiego2004-04-292-19/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12350 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos, wordingdiego2004-04-291-12/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12349 b3059339-0415-0410-9bf9-f77b7e298cf2
* XML translation completewight2004-04-291-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12348 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Andoni Zubimendi <andoni at lpsat.net>nauj272004-04-291-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12347 b3059339-0415-0410-9bf9-f77b7e298cf2
* dewinifyalex2004-04-291-6/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12346 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by paszczialex2004-04-292-3/+167
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12345 b3059339-0415-0410-9bf9-f77b7e298cf2
* don't even mention avifile, 14 subtitlesalex2004-04-291-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12344 b3059339-0415-0410-9bf9-f77b7e298cf2
* forgot to commitalex2004-04-291-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12343 b3059339-0415-0410-9bf9-f77b7e298cf2
* removed loader/ dependancy, imported some files from g2, also used patches ↵alex2004-04-289-53/+220
| | | | | | from Dominik Mierzejewski git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12342 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-04-281-1/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12341 b3059339-0415-0410-9bf9-f77b7e298cf2
* updated documentation for detc,ivtc,pulluprfelker2004-04-281-13/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12340 b3059339-0415-0410-9bf9-f77b7e298cf2
* document harddup and softskiprfelker2004-04-281-0/+19
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12339 b3059339-0415-0410-9bf9-f77b7e298cf2
* soft skipping for mencoder. rather than skipping decoding/filteringrfelker2004-04-285-3/+93
| | | | | | | | | | | | | | frames that will be skipped, mencoded tells vf_softskip (if present) that it should drop the next frame. this allows filters that need to see every input frame (inverse telecine, denoise3d, ...) to see skipped frames before they get dropped. in principle, a smarter softskip filter could be written that would buffer frames and choose to drop the one with least change, rather than strictly dropping the next one. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12338 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1l debug junkrfelker2004-04-281-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12337 b3059339-0415-0410-9bf9-f77b7e298cf2
* forgot this, needed for vf_hardduprfelker2004-04-281-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12336 b3059339-0415-0410-9bf9-f77b7e298cf2
* "hard" frame duplication for mencoder. this finally makes it possiblerfelker2004-04-284-2/+98
| | | | | | | | | to generate valid mpeg output from avi's that have duplicate frames in them, or when using inverse telecine filters. to use it, put the "harddup" filter at the end of your filter chain. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12335 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove frame typesmichael2004-04-281-29/+53
| | | | | | | | | add decode_delay and dts calculation/description monotonicity requirement samplerate_nom/denom git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12334 b3059339-0415-0410-9bf9-f77b7e298cf2
* play the audio buffer in case of normal eof (i know the change is rude, but ↵alex2004-04-271-2/+2
| | | | | | mplayer.c is hopelessly obfuscated) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12333 b3059339-0415-0410-9bf9-f77b7e298cf2
* Spelling, mention that one vulnerability was fixed in 1.0pre3try2.diego2004-04-271-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12332 b3059339-0415-0410-9bf9-f77b7e298cf2
* Mark all options that work only in combination with XXX as (XXX only).diego2004-04-271-45/+48
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12331 b3059339-0415-0410-9bf9-f77b7e298cf2
* don't use odml when we don't have to -- the code is buggy!rfelker2004-04-271-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12330 b3059339-0415-0410-9bf9-f77b7e298cf2
* wma9 speech codec dmo and dshow entriesalex2004-04-271-0/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12329 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for 28_8 in rm files and header length != 0x4ertognimp2004-04-271-1/+17
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12328 b3059339-0415-0410-9bf9-f77b7e298cf2
* More about myself + typortognimp2004-04-271-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12327 b3059339-0415-0410-9bf9-f77b7e298cf2
* Hint about testing different colorspaces and putting codes in ./, based ondiego2004-04-271-1/+16
| | | | | | | a patch by Compn. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12326 b3059339-0415-0410-9bf9-f77b7e298cf2
* vocabularyrathann2004-04-273-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12325 b3059339-0415-0410-9bf9-f77b7e298cf2
* 2 more FAQs based on a patch made by Compn.diego2004-04-271-0/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12324 b3059339-0415-0410-9bf9-f77b7e298cf2
* Send updates to mplayer-docs instead of dev-eng, wording, spelling.diego2004-04-271-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12323 b3059339-0415-0410-9bf9-f77b7e298cf2
* English messages removed, comments summarized.diego2004-04-271-144/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12322 b3059339-0415-0410-9bf9-f77b7e298cf2
* more demuxer maintainersdiego2004-04-271-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12321 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatesdiego2004-04-271-2/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12320 b3059339-0415-0410-9bf9-f77b7e298cf2
* typos pointed out by the wandererdiego2004-04-271-5/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12319 b3059339-0415-0410-9bf9-f77b7e298cf2
* More credit for adland, added a missing name.diego2004-04-271-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12318 b3059339-0415-0410-9bf9-f77b7e298cf2
* finalalex2004-04-271-22/+22
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12317 b3059339-0415-0410-9bf9-f77b7e298cf2
* Copyright notice added back.diego2004-04-271-0/+23
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12316 b3059339-0415-0410-9bf9-f77b7e298cf2
* dvb_set_channel now has two parameters, patch by Nico Sabbi.diego2004-04-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12315 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling, additions, slight reorderingdiego2004-04-271-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12314 b3059339-0415-0410-9bf9-f77b7e298cf2
* New and old maintainers added.diego2004-04-271-0/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12313 b3059339-0415-0410-9bf9-f77b7e298cf2
* multiple DVB card syntax, based on a patch by Nico Sabbidiego2004-04-271-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12312 b3059339-0415-0410-9bf9-f77b7e298cf2
* DVB now supports multiple cards, patch by Nico Sabbi.diego2004-04-271-1/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12311 b3059339-0415-0410-9bf9-f77b7e298cf2
* new configuration structure, gcc warn silencingnicodvb2004-04-263-28/+49
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12310 b3059339-0415-0410-9bf9-f77b7e298cf2
* new configuration structure, multi-card supportnicodvb2004-04-261-35/+117
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12309 b3059339-0415-0410-9bf9-f77b7e298cf2
* new configuration structure, dvb_set_channel takes 2 parameters, 1000l ↵nicodvb2004-04-261-192/+175
| | | | | | memleak fix git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12308 b3059339-0415-0410-9bf9-f77b7e298cf2
* slave command dvb_set_channel now takes 2 arguments: channel cardnicodvb2004-04-262-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12307 b3059339-0415-0410-9bf9-f77b7e298cf2
* Updatertognimp2004-04-261-1/+6
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12306 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix possible segfault on lavf demuxer patch by (adland <adland123 at yahoo ↵michael2004-04-261-2/+4
| | | | | | dot com>) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12305 b3059339-0415-0410-9bf9-f77b7e298cf2
* attribute_used patch by (VMiklos <mamajom at axelero dot hu>)michael2004-04-263-8/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12304 b3059339-0415-0410-9bf9-f77b7e298cf2
* The eve of a new release is always a good time to take history lessons, sodiego2004-04-261-302/+423
| | | | | | | I read the changelog in an editor... git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12303 b3059339-0415-0410-9bf9-f77b7e298cf2
* attribute_used patch by (matthieu castet <castet.matthieu at free dot fr>)michael2004-04-263-52/+52
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12302 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix embedded smil playlist detection if there are parameters on the urlrtognimp2004-04-261-6/+16
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12301 b3059339-0415-0410-9bf9-f77b7e298cf2
* additions, wordingdiego2004-04-261-9/+15
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12300 b3059339-0415-0410-9bf9-f77b7e298cf2
* spelling, some additionsdiego2004-04-261-17/+18
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12299 b3059339-0415-0410-9bf9-f77b7e298cf2
* imo i'm one of the nut spec authors :)rfelker2004-04-261-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12298 b3059339-0415-0410-9bf9-f77b7e298cf2
* Add Fullscreen, Ontop and OSD supportnplourde2004-04-261-447/+461
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12297 b3059339-0415-0410-9bf9-f77b7e298cf2
* Added Nicolas Plourdenplourde2004-04-262-0/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12296 b3059339-0415-0410-9bf9-f77b7e298cf2
* typosdiego2004-04-261-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12295 b3059339-0415-0410-9bf9-f77b7e298cf2
* release name, changesalex2004-04-261-1/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12294 b3059339-0415-0410-9bf9-f77b7e298cf2
* attribute_used for gcc3.4alex2004-04-266-7/+12
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12293 b3059339-0415-0410-9bf9-f77b7e298cf2
* reorder funcs to avoid warnings/errors (gccs are nowadays are more pickier ↵alex2004-04-261-34/+31
| | | | | | about code than gcc2.95 with -ansi) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12292 b3059339-0415-0410-9bf9-f77b7e298cf2
* attribute_used macroalex2004-04-261-0/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12291 b3059339-0415-0410-9bf9-f77b7e298cf2
* potentially exploitable buffer overflow with maliciously crafted cd tocrfelker2004-04-261-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12290 b3059339-0415-0410-9bf9-f77b7e298cf2
* fix exploitable buffer overflowrfelker2004-04-261-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12289 b3059339-0415-0410-9bf9-f77b7e298cf2
* missingalex2004-04-261-0/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12288 b3059339-0415-0410-9bf9-f77b7e298cf2
* support for ATI fireglxalex2004-04-261-0/+44
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12287 b3059339-0415-0410-9bf9-f77b7e298cf2
* a52 dynamic range compression support by Peter Ganstereralex2004-04-264-0/+57
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12286 b3059339-0415-0410-9bf9-f77b7e298cf2
* updatedalex2004-04-261-3/+49
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12285 b3059339-0415-0410-9bf9-f77b7e298cf2
* Ogg spelling fixed as pointed out by the wanderer.diego2004-04-261-7/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12284 b3059339-0415-0410-9bf9-f77b7e298cf2
* rawaudio bitrate optiondiego2004-04-261-0/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12283 b3059339-0415-0410-9bf9-f77b7e298cf2
* needed for a/v sync with compressed audio (e.g. raw .mp2 or .ac3 file)rfelker2004-04-261-1/+8
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12282 b3059339-0415-0410-9bf9-f77b7e298cf2
* Name corrected.diego2004-04-251-4/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12281 b3059339-0415-0410-9bf9-f77b7e298cf2
* spellingdiego2004-04-251-132/+134
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12280 b3059339-0415-0410-9bf9-f77b7e298cf2
* Synced with 1.573, remove unwanted space at end of linedanny2004-04-251-16/+86
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12279 b3059339-0415-0410-9bf9-f77b7e298cf2
* More keyframe search fix for VP6xrtognimp2004-04-251-3/+3
| | | | | | | Fix by Reza Jelveh git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12278 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fixed CRTC2 surface size message.syrjala2004-04-251-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12277 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix VP62 keyframe searchrtognimp2004-04-251-3/+4
| | | | | | | Fixed by Reza Jelveh git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12276 b3059339-0415-0410-9bf9-f77b7e298cf2
* Suggest -playlist if asf_stream_start failsrtognimp2004-04-251-0/+1
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12275 b3059339-0415-0410-9bf9-f77b7e298cf2
* Don't say that a protocol is unsupported if that's not truertognimp2004-04-251-0/+3
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12274 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix support for audio only streamsrtognimp2004-04-251-25/+24
| | | | | | | | Add keyframe search for VP62 and VP31 Based on a patch by Reza Jelveh git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12273 b3059339-0415-0410-9bf9-f77b7e298cf2
* More bounds checking fixes (thnaks to Miguel Freitas)rtognimp2004-04-252-26/+49
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12272 b3059339-0415-0410-9bf9-f77b7e298cf2
* Escape urls (needed for urls in playlists)rtognimp2004-04-241-2/+8
| | | | | | | Based on an idea by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12271 b3059339-0415-0410-9bf9-f77b7e298cf2
* Stop parsing an url after connection failurertognimp2004-04-241-2/+2
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12270 b3059339-0415-0410-9bf9-f77b7e298cf2
* Handle url redirectionrtognimp2004-04-241-2/+30
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12269 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fail if empty or nonexitant playlistrtognimp2004-04-241-6/+6
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12268 b3059339-0415-0410-9bf9-f77b7e298cf2
* Some sanity and bound checkingrtognimp2004-04-246-25/+71
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12267 b3059339-0415-0410-9bf9-f77b7e298cf2
* 1000000000000l to bunkusrfelker2004-04-231-4/+5
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12266 b3059339-0415-0410-9bf9-f77b7e298cf2
* Clear subs in broken OGM files (those without empty subtitle packets) a bit ↵mosu2004-04-231-1/+1
| | | | | | later in order to avoid flickering if there are more subs following immediately. Patch by Michael Reinsch <mr at uue adot org> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12265 b3059339-0415-0410-9bf9-f77b7e298cf2
* Much improved seeking. Patch by Michael Behrich <behrisch at informatik adot ↵mosu2004-04-231-45/+98
| | | | | | hu-berlin anotherdot de> git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12264 b3059339-0415-0410-9bf9-f77b7e298cf2
* update to version 0.5.1 by the author VMiklos <mamajom@axelero.hu>diego2004-04-231-13/+25
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12263 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove data_size predictionmichael2004-04-231-36/+35
| | | | | | | | merge lsb and full timestamp maybe clarify flags git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12262 b3059339-0415-0410-9bf9-f77b7e298cf2
* prefer yuv formats over rgb in case both are supported by hwfaust32004-04-231-13/+13
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12261 b3059339-0415-0410-9bf9-f77b7e298cf2
* update, spellingdiego2004-04-231-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12260 b3059339-0415-0410-9bf9-f77b7e298cf2
* Less verbosity by moving some debug messages from printf --> dbgprintf.diego2004-04-231-3/+3
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12259 b3059339-0415-0410-9bf9-f77b7e298cf2
* I consider myself ao_nas maintainerranma2004-04-231-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12258 b3059339-0415-0410-9bf9-f77b7e298cf2
* revised listalex2004-04-231-71/+65
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12257 b3059339-0415-0410-9bf9-f77b7e298cf2
* dr bugfix by zoli (author of the filter)rfelker2004-04-231-5/+21
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12256 b3059339-0415-0410-9bf9-f77b7e298cf2
* new time_base_nom limitmichael2004-04-221-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12255 b3059339-0415-0410-9bf9-f77b7e298cf2
* and sync counter goes up :)paszczi2004-04-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12254 b3059339-0415-0410-9bf9-f77b7e298cf2
* wordingdiego2004-04-221-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12253 b3059339-0415-0410-9bf9-f77b7e298cf2
* cosmetics, wording updatediego2004-04-222-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12252 b3059339-0415-0410-9bf9-f77b7e298cf2
* missing namesdiego2004-04-221-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12251 b3059339-0415-0410-9bf9-f77b7e298cf2
* Missing options added, one put into default order.diego2004-04-221-3/+9
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12250 b3059339-0415-0410-9bf9-f77b7e298cf2
* forgot to translate :)paszczi2004-04-211-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12249 b3059339-0415-0410-9bf9-f77b7e298cf2
* remove bad requirementrfelker2004-04-211-1/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12248 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-04-211-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12247 b3059339-0415-0410-9bf9-f77b7e298cf2
* more nicksdiego2004-04-211-11/+11
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12246 b3059339-0415-0410-9bf9-f77b7e298cf2
* more nicksdiego2004-04-211-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12245 b3059339-0415-0410-9bf9-f77b7e298cf2
* copyright --> MPlayer teamdiego2004-04-211-1/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12244 b3059339-0415-0410-9bf9-f77b7e298cf2
* file_id_string (idea by ivan)michael2004-04-201-1/+21
| | | | | | | | remove 0byte skiped frames (idea by rich) file structure git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12243 b3059339-0415-0410-9bf9-f77b7e298cf2
* Common -vo driver problem solution explained by Lukasz Proszek.diego2004-04-201-0/+28
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12242 b3059339-0415-0410-9bf9-f77b7e298cf2
* dhahelper.sys is put here for installation.diego2004-04-201-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12241 b3059339-0415-0410-9bf9-f77b7e298cf2
* libavformat may be found in the main tree now.diego2004-04-201-0/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12240 b3059339-0415-0410-9bf9-f77b7e298cf2
* removing backward pointersmichael2004-04-201-47/+24
| | | | | | | | | | | removing frames with type 1 forward pointers point to the next packet (=size of the packet) instead of pointing over several type 0 frames removing forward pointers from type 2 frames (they are after the above changes equal to the data_size and would thus be redundant) simplify frame_code flags 7->5 bit remove zero_bit definition (was unused) git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12239 b3059339-0415-0410-9bf9-f77b7e298cf2
* QNX does not support -rdynamic.diego2004-04-191-1/+1
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12238 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l: don't run strcmp if arg is NULLrtognimp2004-04-191-1/+1
| | | | | | | Pathc by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12237 b3059339-0415-0410-9bf9-f77b7e298cf2
* Get rid of the 'RIFF chunks have to be aligned on ODML_CHUNKLEN'ranma2004-04-191-42/+56
| | | | | | | limitation and the JUNK chunks needed to do that. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12236 b3059339-0415-0410-9bf9-f77b7e298cf2
* credits for Ville Saari, one more nickdiego2004-04-191-1/+4
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12235 b3059339-0415-0410-9bf9-f77b7e298cf2
* translation prepared by Boski Cinek <boski_cinek(at)o2.pl>paszczi2004-04-181-0/+930
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12234 b3059339-0415-0410-9bf9-f77b7e298cf2
* translation prepared by frogu <frogu(at)frogu.emdej.pl>paszczi2004-04-181-0/+1372
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12233 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-04-181-105/+106
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12232 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-04-181-6/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12231 b3059339-0415-0410-9bf9-f77b7e298cf2
* Joe Barr calls us Mplayer.diego2004-04-171-5/+7
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12230 b3059339-0415-0410-9bf9-f77b7e298cf2
* typo fix: Mplayer --> MPlayerdiego2004-04-1711-63/+63
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12229 b3059339-0415-0410-9bf9-f77b7e298cf2
* /usr/lib/win32 --> /usr/lib/codecsdiego2004-04-1713-14/+14
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12228 b3059339-0415-0410-9bf9-f77b7e298cf2
* syncpaszczi2004-04-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12227 b3059339-0415-0410-9bf9-f77b7e298cf2
* New filter by Ville Saari (114263 at foo dot bar dot org)rfelker2004-04-174-1/+761
| | | | | | | | for removing duplicate frames from telecined video that was incorrectly deinterlaced. Minor bugfixes added by me. git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12226 b3059339-0415-0410-9bf9-f77b7e298cf2
* Fix for some audio asf streams like ↵rtognimp2004-04-171-1/+1
| | | | | | | | | http://ms.bandeapart.fm/bap/albums/973/6573_h_07-Patience.asf Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12225 b3059339-0415-0410-9bf9-f77b7e298cf2
* Respect -playlist for asx streamsrtognimp2004-04-177-7/+21
| | | | | | | Patch by adland git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12224 b3059339-0415-0410-9bf9-f77b7e298cf2
* sync by Daniele Forghieridiego2004-04-171-18/+92
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12223 b3059339-0415-0410-9bf9-f77b7e298cf2
* 10l for me - stray option draft left behind.diego2004-04-171-15/+0
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12222 b3059339-0415-0410-9bf9-f77b7e298cf2
* vo_gl suboption doc improvedreimar2004-04-171-2/+2
| | | | git-svn-id: svn://svn.mplayerhq.hu/mplayer/trunk@12221 b3059339-0415-0410-9bf9-f77b7e298cf2
generated by cgit v1.2.3 (git 2.25.1) at 2024-07-07 01:49:22 +0000